%PDF-1.4 PI4 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 45 /G2D 46 /G2E 47 /G2F 48 /G30 49 /G31 50 /G32 51 /G33 52 /G34 53 /G35 54 /G36 55 /G37 56 /G38 57 /G39 58 /G3A 59 /G3B 60 /G3C 61 /G3D 62 /G3E 63 /G3F 64 /G40 65 /G41 66 /G42 67 /G43 68 /G44 69 /G45 70 /G46 71 /G47 72 /G48 73 /G49 74 /G4A 75 /G4B 76 /G4C 77 /G4D 78 /G4E 79 /G4F 80 /G50 81 /G51 82 /G52 83 /G53 84 /G54 85 /G55 86 /G56 87 /G57 88 /G58 89 /G59 90 /G5A 91 /G5B 92 /G5C 93 /G5D 94 /G5E 95 /G5F 96 /G60 97 /G61 98 /G62 99 /G63 100 /G64 101 /G65 102 /G66 103 /G67 104 /G68 105 /G69 106 /G6A 107 /G6B 108 /G6C 109 /G6D 110 /G6E 111 /G6F 112 /G70 113 /G71 114 /G72 115 /G73 116 /G74 117 /G75 118 /G76 119 /G77 120 /G78 121 /G79 122 /G7A ] >> endobj 7 0 obj 9898 endobj 6 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 9898 >> stream xz |['{Pfi(-P񒄭"g{Ȳ,ɲ,-w$k]lˊ8/([YZN{*:3])ڙ{3ĉso;;|.D !-k?S~wJX_hܵUG]l(~^"Rnq%kR +Bz~K~]?ky_Fj~unF݆#B+DhB t?B"!9B!'ڌVډP B5!Ԃu!G!BV D#!FhBaJ!E(BfGh?B:qE4B/ B":Bo!6B!!B?Ec~oBП7$!EHF!%Hv]dW"UHv-]d_C1W+++*+*++VWX-_|+W<,_Ny]ryyR^^%/_)/_%/_-/P^F^|ay#;w+V+JyEbbbAyyC+W%\!,WV++UʕUk++W>"S^uj\^U!WUɫVʫVɫV˫WW=$Z+zX^|wW,\)_Jr|%ƛn-֭;U+W{{<桵?"tcܸiS[n{zohlڦhWv:m[cE2F8/eW6,,( ²lDb,!KR,#d㲜lB6)eӲllF6+deCò#cgedN˞ {QKe^&u7eo~$m;weޗ} PG~&cc١.LQv)]dC肵Etyt]t_@ă!r"5! QGP]|- ]rd ] /K7K2.@0t ]~]@Ww"+Е嵨 $*gt ] tjtееW6nD_m@_ͣ6/DoCק 7kC_g?A7^n@73ot[niEߴomFވn]nmE FۖסۿnoC}ztt9A;OXjcbsŜvIv:!rw&`-J)Z~(袺;`wY3 iF9'Q^Icc7a%ぎ1SG>xi~}؈+H#a9m:fk:j1I -D ,]v5(:L ,S]0B7R5FqJ(=;pG%J|*¯ M}q*2Q{09 <RWXKd2ab!zx$Чz[> YND!f;ПPޕxJ+^[[Ǟ6@'f Cm!B c{-KS{ oT NҐbHn^1W'9fXrBTeHl^zCbL}϶ujWjcx*=cT4@ܚk;ElKr?ޒD.O y?Y=œ/21FuY[wɥ:&b!n+5i-Bc!=C1C^1e$: a3C[ZzD4MĽR6i<[6= v} <{+iCi*$[ZIx:S}2C!E E0+uVYjx)J ;oK ? 1!_΀ƣ堉Qk̠6&=MM\^UBdׄX9ۄu#2}YcBOޖ655,lgm65g:==*BOHjdZ$3T;$z#-R[  NAdj2zU!FK-N/G.GEKjq R5Rz{ROv?{kY٪$]ajO ;}5JQnPm嶾'uޚ]uty )D^%M hokA|uNwt'mgiে =-'c1HGs<yD;H%KV b}1+3| 3Ž/ EoN<;$UOK"n_gS0ˍH? dF@Zw{s u̲ħ@ͿxϧYq TCZ{liE En )963@:;aךzZXhe pM009.瞄?3H"(pzW6L4g`f.~{6g[J,CH{?yv%`Hr2"6( x\ 3l 9`ǚVXN3lAeAb`+4!p(65l$>b`7`W> ̆Zjw#k`"Qp: &%mLaIiuD(>dӭqp} h= [zhx2z =l xɥJ溪x;nGI3k' ^O[BUa`BѰB>gѼ k}\l`(BĜk,~e1^owMw [&L#nF6sF G9xB|NDF!^B m0dl)ٮ3:࠯B[ijHK?{EYZI*"MFNƓ1'ZQOdPx$m7Ԫ[6cXO.-k0Tp[qM(ʄzQ9RL%f…/IRhňc]vB)JI :?AH4pŶ$+| 57 *퉁fæ]AcV`RaixV x޺)i݉Zx#Z^hվ,Yw Bd4aM:c&khͤNtTV%\h_ 1n&"um>]-5\c؊9+)k()L% C+ŜҞM8]ӫm8hYð)H;L%F 1{`ܝJ]JN/n&m !ѳP6(] K|I%bNu7) geBD)] ^Έ)?隴{j*`zz ]=FQi]k#vL0 (<ظvh󽶒n T*gzm>߫Z aB'$9w S"8aM aN1p;^(`T.r:-wכg,J3L$ҐH <2G h$:Y5*F5ҡ U_֪` K1ᘒY6M7ɥh`.7tp; [ *Ыj غ*ci^p‚mښB6rxn}ZXokI,ֆx "S3D^1g<<[0LsNgq0:M>x0+,Ȁ#<獄y3֘F !CJ]/J*F-+KWRxqX«J27 Eq/vݸ,Xd}vCnϐ!=u>deŷxK&҂rẇ Xu76ḯe5&P: kͣ;`q)f!;觤 yc)ܕ.BNx3|v;)^'n!r3~qDD683 DR\EH[ /c՜jاj! *1d-mntivE!h,NnG +_1\,&㐋'R1yRl /~n0Od!¡got8(k"8֛Р76I5$S -Ph[J՗%!0GnI#jmzuݽz t4qece/{iQJ%-%ÇC0 Y3ItwXt`X0@ },% ūt/&CsawFcHQ& 2Ͱh啐oۀ~U S+ۂu@9z:ಁFsNz>}ԑpx1 FS; l}"uz/,¯gI=LTЭiCJxw#KR ]$vɠCWu;R9) x=K\qO TRg0[` 7 ,AC zs'sش{302/𰟞2 jv7S:h,ۤ$uMSf2Xг}^k!gȑ067lj<@dMb8 5(Za7-lQê†Kс`ҝ &F^l$ *ԓh a)fS#Ͱ3@\ƆSijŃ]o|J ۟kO>ήfgxx5o[=4|L^n3=B8sPV58Ln; [S¾ pQϾ'p'~pl:>`vXmMfx_Fِ V_pbCG<觝 qdN؜vsK(pď])֕,z9v/Rq˖HXC~u#c#h< /xYJzv':=v7Zw'̻to'8'빼wh?w'~%nV4A}I3%RHdR&R\UsJ`mj}75V%yHd|"~}z:Z# 3&:;ML=puq5uLX κ^UZӮmڤb`'ە;CtobOv2c1F)WndMmکj7@wm9ؑC;g1~_l\xy" ɮ(ha K kBR- ;m̘1ؓz[ЪQQZoI]$$'# ¤pdY U4jhs(maQney۝m&In)ԑꆔ.g>nfdRbD0ƒa:bDKJq,^wl^QE~waw݅x`߻qǘv--j,zK&ѡشma31;C+KۦF|) Yݐ34Lr@"hb$ ͋\ͳO!k? "?g@'AAn6eP!JL-G"boP..fn/}@I⍂e9$q뤰I׊kbzRj tΩ"qЎLf4ӟg' 2qH%GAO~Ǿ]& X2 dk clmׁBglcjքԄ߶EFS LȮ|-kO9Jb̒|0fu8X41+d_CVU*aEBj/}ppLRhu.潆4,r{BcȦ)G;3]NX04-34#W=bZP̀j1VC btZ٧q+ڴ2C-bT)o;?J56Z.*%ZV2ḌGiH!3YTKX:OHFa2Ό ֘ {EalVMaz`98HR_TCxxT; p"^&Ml YMKz2)q'1_GO ;/!..ePCJ_g21L̴bL/D}I~E |a0PjuԿ/KA-XàFӫR5Wq#IҾTTcFjl?ۧ@WGx<~7x'߰'Ł N?8|6V-Y"1 cB>*,*$m/~A IO\!2iN5Dma*JctitA,boQ6DX9XWE'?4jʈՆ>L[h9nGժT밴1CU?Ò ^=")0P:Wc]_>Ƀ'?aG08a=i6s&LxWc0A߿d83|Ti bwp)[Nh$ 8@l/E'0tY% endstream endobj 5 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXT#2BFzBookMaker1DlFont1 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 6 0 R >> endobj 3 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXT#2BFzBookMaker1DlFont1 /FirstChar 33 /LastChar 122 /Widths [ 500 500 1000 500 500 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 500 1000 1000 1000 1000 1000 1000 1000 1000 500 1000 500 1000 1000 1000 1000 500 500 1000 500 500 1000 1000 1000 1000 1000 1000 500 1000 1000 1000 500 1000 1000 500 500 1000 500 1000 1000 500 1000 1000 1000 999 999 499 1000 1000 500 999 999 999 999 1000 1000 1000 1000 1000 1000 1000 999 999 1000 999 500 999 499 999 1000 1000 999 999 ] /Encoding 4 0 R /FontDescriptor 5 0 R >> endobj 9 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 45 /G2D 46 /G2E 47 /G2F 48 /G30 49 /G31 50 /G32 51 /G33 52 /G34 53 /G35 54 /G36 55 /G37 56 /G38 57 /G39 58 /G3A 59 /G3B 60 /G3C 61 /G3D 62 /G3E 63 /G3F 64 /G40 65 /G41 66 /G42 67 /G43 68 /G44 69 /G45 70 /G46 71 /G47 72 /G48 73 /G49 74 /G4A 75 /G4B 76 /G4C 77 /G4D 78 /G4E 79 /G4F 80 /G50 81 /G51 82 /G52 83 /G53 84 /G54 85 /G55 86 /G56 87 /G57 88 /G58 89 /G59 90 /G5A 91 /G5B 92 /G5C 93 /G5D 94 /G5E 95 /G5F 96 /G60 ] >> endobj 12 0 obj 8693 endobj 11 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 8693 >> stream xyyf ə-Ѳ Dۢ] 85MdRiHf2ICG;!hWO1"w1wNԅR7!i# O}W}fxK)|n(A1bO:vhJ!myRW{GF2eL=n2Qo4m`.kEa%ݐtJ޹* F RKl)ÁP@˂ LA~ g6Z'Eʹ@Yޠ5f1)pJ/ޠ;`B"SJ ?D P‹OQqQW7@M{|UfZ(^jNhIh&N$LҴ0`R F,@|\JV!ڬЉׂy'Ht3ЏQ㻔\\<ב0;l5N&aOY{ޜ>b; Ow3>: +#0tMT)kd t9YK^g!;ٿL+ K8ޘ'mN~u4$ӀsL. bB ZT?AI3$h-A2挒O1? o\ 4KriN,sthɓbe! ;B]Ww+e>Ql,B}tU?:4db2DDV&Mv*y5yI< z")M_nwl8l)FyK>ϛ`|[|vu=hf1C=Ym͜7C˃'u͊,SZ 4Ы@8OApǭJ/?#>Yx%ۭRe0Jx{_11u-#mm=Ѡ?->3 $"yJ"![(UT-V kv#''3>lo ,yG__9"r c(eioROQ,{+A(sz2?c'a #,Mh'6/F2!(0넍8q/MM{֘mM}AC;) \Ϩd&S ԛ7z B_ ޗy\om%^fäomB4)~$*8 ^(x*4 \  x)8+A{=Nlm|ֈdOLk`X>ՓmH^͵yp6B6 p si{)fD5t/Y]tq Sx2-"Fj~\SiuP]fZ|`I4Æ=c )co!<ǭ@o5rbyNk68 hO݄]>tHs Ua)E7d`W"d "..DK +Vq)@p 6#"}tl0tڃp3I{@Ͷ/]0 EPBڹz3D7Hؐt k zYf2O9 gGN=8fFb= 4*Ogag*DŽ}ȇW4/tM>ߤ¿=+*8j2Y[m(<(,Iނy$R JZ1 ۠BkX׀l?ꇈ)pdo[)* x01 V$tmY4f&]P2g'M:p&1p׸ '(9C+%riRb15P0ef8D٭`<MB_owgZ4sWlgGadhHx["b8ϝ&L6 p,51_XZL+v-EQȶYD"㣇GtcNu8p2Ӓi]d4D\y/]쾑-O'*QM ( F}G&a0anS|/iůlR~[^-kY(_"BY5LcE4 IHےfcY#<3-+גޖ^[ xuf DZ^W^U:еhH;9N-TYQ!RMCnH?׸Y/Y`i3y%akH*#̘s*l;p@Nl8ɔqy>)e$ bi0 ͂19Έ퀿z= .3ÃwfCV%KT1<GIweé'J|imzahXt{퓗7kz~,L}I W3@kƝ!κWΟ_>+nkRfW )W|W4E!!B>gjyj/_z5 @ -΂[+xTgN-%dB: /13ʙMO1 +*9&l4?>d$ЋtbdXtIb D,Q(5I!XE_U?&OW:`)%d $^K]fviOoMMuJ>6-j.4i!!r>錿B/Cuʥ**Kb \LWa$:遤^B񺈙(ws~Da7N$o1kS^;dKjP?$1)^ Y1U"̊񸇘1ߌ f[E1byMm1ג%VSyٹP%$0eKxp ¾]گ1 79/+jFV)Tj OT;XqBٞ5`uNu}6=tlM#4w'v؝;ȺK.:8JFA"#^NW,za޻BsK7V].4GKАja: 5Frty| Ʀ SIQ-lM}Qs}||u9M|FFO{cyD~˜LVlԫjl- ѕ2 r-P7 <ψOom ;8q6^{FVf𷲞HA_ԋ/tDS7`L /H_W^<)ARM-?!NP[)^$$OXk͵R- Ӻ#L&׃ju% (} u GgbL0a,Q9}k@ UsvF듡 N$K!`UjW*-(5"wh#T`#)kMƣ$)pق` 026֋!}{™ve)l pϦHeY2C{"駷5Z1z bXk/OQ"Xm-K?mE5 C_/׬jmv)ʊ){-zMy1ٜ?GGI{R JLHk sRW6>&q[Sff}JUnZErlr =$o#T?B▲g+BgM uԱCImrκ9or)gm}Œ4+7$:KoXGwbb- L[Л]K _cw&nHa%4e2q'IbI%3b<_Cy+i! zs;Y1G܈kK*̜uL-yc0j%Ks%B#d=qba?>_ɂ;Ke^oɧˌJ&˶U)nT9XUVq1jr/t=#]_,m)4'!5f endstream endobj 10 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXX#2BFzBookMaker5DlFont5 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 11 0 R >> endobj 8 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXX#2BFzBookMaker5DlFont5 /FirstChar 33 /LastChar 96 /Widths [ 1000 1000 1000 1000 1000 1000 1000 500 500 1000 1000 1000 1000 1000 1000 1000 1000 500 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 499 999 499 499 499 499 1000 1000 500 1000 1000 1000 1000 500 999 1000 1000 1000 1000 1000 1000 500 500 1000 500 500 1000 500 500 500 1000 1000 1000 1000 1000 ] /Encoding 9 0 R /FontDescriptor 10 0 R >> endobj 14 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 45 /G2D 46 /G2E ] >> endobj 17 0 obj 1445 endobj 16 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 1445 >> stream xmSYpEI=VrJ܃( Re8AbDHD*\&dw&P>TH œ>!j%X$,yfgF@HGH@hZņ뷗.d*mh-[ uWK)צ!HЊwgv>L0(5њD $jza:JmĊ"-&DŠtPā`jHr!dp\4GFLw\ʌ8wL J83`#T\řJ<ˎ2eGkuThP6r .n(@GR]v{q| ۂGװrػk6\'%NۆYӨAm4qǖ?r|]i3iJ_&ڱ6E/NFj ,87}^=lhp,ܤ_#?spϟV@Shg# ӡtBh66ļYZ O =O,K0M3fH5c5&nB>{Ym'hF]muf(#t'|H2D?*tjB7=#޸h #C=`^+YwX4TM/y:6IZv*ky">#9}Q:,VV#"=F]F]YrMdYh/H]6VƯ:Ȯ^cpLdshBN&"V/:qa 4.қtf72' = endstream endobj 15 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXB#2BFzBookMaker9DlFont9 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 16 0 R >> endobj 13 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXB#2BFzBookMaker9DlFont9 /FirstChar 33 /LastChar 46 /Widths [ 999 999 1000 1000 999 999 999 999 1000 1000 999 1000 1000 1000 ] /Encoding 14 0 R /FontDescriptor 15 0 R >> endobj 19 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 66 /G42 67 /G43 68 /G44 95 /G5F 113 /G71 131 /G83 132 /G84 137 /G89 138 /G8A 139 /G8B 140 /G8C 144 /G90 145 /G91 146 /G92 149 /G95 184 /GB8 209 /GD1 222 /GDE 224 /GE0 226 /GE2 ] >> endobj 22 0 obj 8064 endobj 21 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 8064 >> stream xmz |Tr}XKˠ*5,["I ` $d.w;$' C "n.MJv}=}3A>wsudYQQA΂(|h R=”E|x}GR7(nlҍIId-iɴ7_'?܉o~OF|o$*I?$<9CfG$i$'IJR$HR$=*IKғB̒F%i$=-I!IY-I9$햤=T I$XќМlN^dN^lNN1'?dN~؜jN^bN~Ҝ̜ܼ8ټxybsSSSSS4.3.7/Y`^м$ټ$ż,ռbyJ數hiY3yeW[klǕN[y׿tRllIMF7Y ʡ8NȖ>5g,[ <ݞf%z®Po7sMV+9ߵ= ec.uo{+Pڒݱ4\=?*JZ=Ҙo@V鬳_%Xa j2"WfOGź}͖UZGb66)w9)`",wCl>-|bdL+D=g@4ʺkjN'6-<Z*K>m>bdf4>[fD4wIn&?|sdr18_^i#7-|1l!,B[A2GaOiw&ޙb?xt|-fibq:L(Dn_^6FbPɵ]"],:.6/~) *W)ϔ21gp!QT5- uLƏ(P;C&D)%;LU 7skN p\NƧаDkjAJL|wUOm)}tho=묖 D̦MQZ*9:? t+ɂ9+S@qj.h/&A1pkgMىcQEC<>JzsB[t[܊kgi[ZS[VݗmGa?]>8b3Ek> T}P<àJ3My/"{ <2kdgDR 7R.d)?qe޶yӳ=ڌ s TKeApߥpܪӎO8 JPr ȼCVM18,8] 5ـh5DJĴD9tHnzXhQ9Od eZ*> SKũ_S>~){U%;ȓW _Mi hm`Ѝo7ٲ :] i>8>{KtCKv/n/c5+BԄW$xy$y+\6 ӯoǖBFFdFrW'M_ ?H.§a㍜[qlTl‡lŨ9 'xn: >?.3 'H* |'="eO9w*=>3oVBmf]kjvuOg;`\%b0O[iK."Ud̃>%S#vE5߯\A|f˘+aw:4OXV_C=mgz{4o4Tpd?,XZO;*Pwi 4uBWLVǦ5(qW#'z;we?k]%꽣5jD=dΩYom:>f-D-W {G#qOn)ۂL yJ\ԦCpE_+ovOtcJ6"?TsXƘLI$ʋҌC[ʠ FI4!.Eچ:Z_ˆ`EW'l |:kb D&[([,JehߖsZ+i2D=hiЎһ |3J!;{ XY\~B ']խ]!̩v;hbE0Jpj47[JBToSR<`^vȞ']wUb3:Ou[?RA.e,yv~r `@B0ҪO~e,e 8iؾ>#o|R^?ʆx7bPپ2l U&j:[4w1\JiKonmc~o*OJ/PQGH3u`VTHv;Qk߉E?Aww3ۤ?B8y[()62ςtqIG%DPC+4 %bu YЗѶѓjҠ3FTG/]06} CƵM5z rEO^ۨ$%[٫С+:em6>'gJܾ߿zv. FBPcw!b6b'bؚ5L>V2![ڇdޔdpFt~P3|#3wz/'z Mۃ~$ܯPq,CL}YG0e\ͤVا&֕P#)L% bX2?89YFCLH &vmgCV;uu68wEk1"e1=>o[E/d ?&3y'+ @|Ao=lnuւf鯽{mW>X [mBm3uR5ACWr|[tjIփ> 쫐Ӯ78?,Vsa 6S/=A4<*~4$uFfwJ״2P6*rCCU"--6=Xu#1\zˣaWi#DQ-x4 뤼%?(9ׄ>&7DuO)a MjOR|7oo%^IoFњ^J!$FtͥlԎ"}Y2א3'wv3q`;b酲3UD&Ёn)D=Jg?55:5b@{}Hup ^iBE)o)hϊaYj^RTVEaWl[&-^jy;mO.YB{a,Mt7 WWhqZቻԻ@;563v2r_!l.jjrd28lۣf^y¢9tz3ΒΝCSWc"Ͻ%6u0]_{7dsi7 «C1zCNj]Q@}#Mů^腾3"Q QuMGQ#2& 1g³a,6!o`S|FǖYN7[s8P}E"?UxTzd#[> i1YL>]t~ cU'Sm4@rУGut¨[*+{nSk4 elt9do#AOuM!yrV NJE1~wʼn8L)o*z+ҁ0(ǰpbmy IFJbh'GєywB~Aׯ{zM/_wv3-+. -Rz u~(TJC}e|9>h@Q]jGp9f%Br&䢌XLl3S<\|B[jPg ^3A%;3:龦`fp Tg!;-{y@-9I3d r!a )`ԓ@Ч)ͳR932Eл#ykQIӑviUͦGv>!si˅`u4uuS"oI!aEm|EJ3xH)f#RK^aoN1%x+=͊ Aomdx{ec;[?^#^De!D|<C!S"6Dl 9ոN>aO)łWi.!-OEUZmЋ{!/!ۋWx6 k P%TzRQ3*+k-QtZ;Nf VW_}^EMU+vw@עS:K:5e5)%si8juЧ6h΢+||ΓZWSӅ5>M{P=bFU`^a=O(84<Wk;~_-`obزס앁AuN4T\0ٳT"S^d yv%R3zċz>م?R>e3}Jbo5|F}\aOWF]RAGB Ƀ}B0'M1g2j ;ؐA]w'Hw ~\ʗ禺TK,πzt^ b63PbJXf_O!\F-+}ˆ| i+O)xz96/=!Ӟ+ iPZPU!vZtГ ›zF vJcB="tO Eo Vy$P'S]AϖɈ2)Ȗ%gWP\ 31}/՗w A;8d^hŴa{{߱ -^RX$Z܅k9m]&`[~ ~mo!IG7ft1r/h팃]3.0lZO*{l[٠֍K u †OGPRh$>YF;ihFL>>|޷ 'Od;$Nm]]|RTlto17|Ʀd`Kt\/O/FWLgDYy2/U=IX[t\}ENf ěo:95LyJr/LQM Gl9FY8.e'x7(:9Wt'pnݘ)[[dBh5cn:Jw2:WnwFR{8{Aa(^-E! ,GˋG陟:LP^C#>oWd]#b؆W&s]{ "4z=^cOS{ȩi1'o}ggt?iq٠iD{i ﰭY~siՃQW ۵nPQJ;p#rSs /2^aK.v' <*v?]3~!5W-L3arBKf |v@Fµt "2 sů{F|qk^p;>OTE<ɢBA}7~ _C^Mk|`jq.~> endobj 18 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXQ#2BFzBookMaker0DlFont00536871532 /FirstChar 33 /LastChar 226 /Widths [ 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 0 0 0 0 1000 1000 1000 1000 0 0 0 1000 1000 1000 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 1000 0 1000 ] /Encoding 19 0 R /FontDescriptor 20 0 R >> endobj 24 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 45 /G2D 46 /G2E 47 /G2F 48 /G30 49 /G31 50 /G32 51 /G33 52 /G34 53 /G35 54 /G36 55 /G37 56 /G38 57 /G39 58 /G3A 59 /G3B 60 /G3C 61 /G3D 62 /G3E 63 /G3F 64 /G40 65 /G41 66 /G42 67 /G43 68 /G44 69 /G45 122 /G7A 156 /G9C 157 /G9D 158 /G9E ] >> endobj 27 0 obj 11951 endobj 26 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 11951 >> stream xu{ XWnU+<$IΙHb&ƘQD0>(FyvSŦ)[%0ɘp&&L̍w&3/gNlrY|GWZWGq(tkz}5Y{^_='6/͍ssr?}.r]ww}})⿩SM}٫m?ƟwM|-8c'{~qqxq=qpL{~qq9-渥q+9n ǭ %s\ ǥqvqgB+w*8q8GύƟ1c_~)>z~|K_^,>91sccbcǼR|1cǼ4>fY|ϛ?/:~^Lyb_ZK,pӟ|ٙz~ ?37:f^/_+bK^[l"Q5QrR\QQZ(wT]T}'!1jjGFEDFGuD EuF G:=7aO.߸/r:8F=՚]>Sɠi$HRHD"S> 婢9K93 (;\6h,v绲AwƞH| D%5AOwV\ld)^)=G~vȵIokjmbg]WDRОؑґ +7N(hjulUDTE) &"&&%s=BO*Jb'SFx{t\ykJ]秀*jbKtI5u0J0.]uUH)+P6[B`ET\XdR );I<# d\B[.)DʭY\߮[0@Leb&#n&a>a!G$\2,T:rM=RwZ92b%sU.F?kqDEɦԍ`i};}-<֍WK54q%k6+y3q' }}:'g;ɟ/gx7"qC^e:s6d[:wu Mrd#D`W]J`6Ni.L+ 9ߑ/᫋iL7k=G=yKJ8 6Ť7 2ׇW*q ./Uw^ ͠r,% |ËYCЗ zOYBoVKK`]yWӫ84/ZDRxQ/ce-c2# qߎh>?}V_xK'Ul6#OGɿw l.xY gFOǞbV/`YsrmڂM:7҃V|0AsY3Ka8k;SU4h?g-5n֥`sg7 cU$`I(L. ࢥ|OSMg"}\yBʄ[%F4LWOs3Z,bB,bMRk`:vytA6ǓłF5zn9a6n̵3e z-h~~,ID^}RÂ/CžU;H!VYVw;+P&q;pH̭Iir'tL'_\O KalO̾DFZFf-̘K`&[TzZWe?N^pqG\~HS|&L/t02OFg1 s%SIr f >uHa9j} 9JmVI-#I\yJa)X$3T4&}qJrv|5C=+B7aa܊:436·!}}B!)ٸJqM|2Ie0mCB1rV|}tB7[݆ tW+ND"uPD=A]#9i Ci=SD:N F4?~'gت2@&c8b-9`I\`cqN$Ю+_BW I8^p}d$$_1\l_ar,|/;*n ie}܈t"ȃr7 U1_ 6-۹ ۋL@+'Z#!籱;DƮ"EF݋_ @W fWT,ӫJ`}躠+ :-AuWUj=f>џrGA$2AoG=B3,y+zS0$ީbZg1e6ץHz"pTٖb(me w\mjP L% o_̙"sÌKVE@ʭSA)DNBH1v@YnfL&A4:ӰHȔU*&PtՏQ&0Q[_q6bC[Ǭ]@we2Rcx`BTO`|M>%_$Of)ߓUlT~THoȂ=sg °&נ 73ϾMJBolZmq72C]ݷȸ@PVMQ5 VAB)Rfugx 2>t/``f3qs_nx5UHM0Ѹل_Qpߐx+T AdWIpLoPP\<Y1z]bxh#yW`_'A+'@9lK1]}b3|>`~g<ئb> c|[5ub&y/9vXB* )to#GԣJA {;:U/ y\M8#O<^#ɇLeV4zJ+ C{3e'%|m .f_]uBy2c0^.`e*]"p{.ZB~90B29*nzL9TeJ`企nDdC{+C> GwؾvSr\bwWhFbKxm yekUr"KNT"#;.hlpbC bN5j7Gb .O6L`bcvv)tJ:iFh+jڃ쑰bdt_:CzAy"$ۺzdj0ƾIkOUّ^>(NA4Gb.}_MV)+5D!r ?B~%%$7ex{w3bd'ϴv}RkF~/57::Yr0h͈5ށ;Pp:dg`C.2|-Uq$@x 8z睻\/'hZOI3FeRW |IOI4YTD"=,R61ׯW\3k_#@]&ߋ,ɜ½0>P!(5exwiH= ]u4X+O3MֽZ9.mA\HfU-nb3Q8 0"%+|# 40`Hۍ?BN+, OqToL(}^vJz0AʇN)dGXD|B =q5f{C`&_*?Q>3ZĖH5>.EU;R;3\G oϣAL( [{G冁a0wCT0߃]+m2+KaFZծKi6<33h;@"q?%7qF!׍i~Z}1]s x?:v=Ŵ:.kBq_C2l2zutb#Bmň-5Di"2(B1_D5y TC,bEU"5a[xAH096vAw/>LAH -ōZ:{>čO/Ǜ,Ѽ]ւ2Tm%$.Tj>M q_CH#/2^M ݄|fLfJ\Q r|,IdX?ExL~+QcV@# H%Η 1V)^Ki)nsF)Qc6ɷ0f>F#L.K̴?0E'WO Dj~gzx;mSi3>A*}GvEtG///tN"Vr=<ɎUqy=A ˫Qx#$#u>FE+};| 'ٌuǷ4gP R_^>q@HܛxR 'z ZR5 cH +' 1JQYR]p nU/,gBN tL<FM%.-Edه9 }r5>Sޭ(4;As;U|dt㺐%(vv*.MXUq9y64hf_c26RJ,~_B!Z#'I\b읕e1XZ*ȝl#L؇)WqrqlZV\#Iy/g+@hMh)%U𵮯{tT)+I|P=Tq%Po_耶5ZSdUqUͰu݆* X¥Sgz:r}N^go߈,n x4RUDf^f"e?? -nF _zZ,uv2%D{BhAډ-MVEj~\$4J9h{ k|XCZ$3baN43շo3daPԽ?WWX)Ϗo^J7w{4jNF }] +"bV=:GOʳof7V,w: >$? oU_/mxAw3l=%0pWgav`e%췖c~=&r&GF Btr,1!HD$km%[ "d"YTJ%R1ۅBWR7QՈ4>cg|s8 :+@_R mS+!1aa,+v2ૡ>??IPg-80[%rE`)Β^ N) [AG] sO`!q*q#]ď O6V4=dRQLB\eIjmG:Nl%^5ZF!M?AHd+Ď6(cK tY|$[o+lBE/#t{Qs2˗Ul_$_2Eu{8]>t!545 ~p`zyӋ1۴˓}} 4(bZ_/9j^7 vE9W (]2&{bۅA&\&!86Uʹ*l4":!@P>!3_"'ٖ!խ(_CZ2*Zʒ,[R唊P2l`,#/tHTS݊@D*]Z 9$Qše ݆vSvo*}{BĪE#(6FaAiH}SFuGT"V̆a"kXu>ő2t@.'\npl0|4yC wn_؞!=|!Kt ƏdQ6ZTw/x,x;uRx |MqF6 ^w7au:w3"DʷU>:)`{vCB2EГjJ s’CBaEIaH j΂M۩&`) jm#nJN%cHERm3UEo64iwbT]F'AO}gv@xV,X <;lԲڹN9#5y:G, ˍ/ lv0:Rbw*ȇGc얹얛>.2ܑ{ԙ{ ; P1m|WfBoq] {kTj'DTߐTDHe*UI4fݠ? _%֥짓^5)Hg JVq#~I)Ps]G=e 47$C>t).\46 4kZ=ۂ)<`U˜6++,/\ss{lEN];2fF Bn+|p|ox7֧5𨇝*2_ZC S;LW_x%vf󃵧tq/E[Ul9@VjeJ6EvU6л/gⷒ%+_SwaVp*%m4T立NR1$3Q!!Oe{t$O4;X. @kepbC/µK+$;3z{Va{ɪj]=HA(]jW4SJz2  zGߛ>}%,% w]89x#.7AN-?籍fziz,jPP|Hcb{7-<(Zycl[2vF8(oL-X!y0RKz HQo-׵9߱b|d˃0?|6(ygo}ũE9HAJ =o]-zoD0;"f[76e{T̒/iq6at@ۡݰs9QV;i]m6s6jpj әBv{XR t),pggM =jsnLi&6٧zԍeV$[R|.9TzqM髑v/*b iVn}8;'Lr4^uhHPnvNB?/O#Iޢx Vnwvocl`?<:}zsG+K­ $VJJ0gK{ |!JhkYlUjB[-pA8x%Z`bCO%e=j@٩"N SA3Zh[HxSԸ0ʵ.ʅ:lCނd\F!dƣO$I[x룆k+yaMFfm8[0ғ۷}fqpZ|I俏TSzEL \-~_ާARuk[W!gzD*zx4f#oF_F: s+L5^}2Oiӥm*3SοOYGǧ{2(w܋->$3 u|;4F1qñ!d;Z(oU?dHaƙ8''YWU(1/|Ķ !ٞiޜX ~Ґ"#vnrW[Sj]n 4ݝW*["]>9eR{oC)|3?ȆZ#hٴ[}x`TAoO`cAs)\*_`fdŚ;bQDcG-@+&~B~?"Wnݴ3.VD%iw-,YtVi 7Ϟ?֌kRdbEѻ1JD#Ib2?u9,N=mo8mV=ީ(D{ۃ4Dawxcَtk| lJl;@mDO_1~E'Oc^N6c?My<˥jT̓s8ILO3'yMOe"igs#/ChNge'Fd .ܤևl$5l*.>#dΎПZl4Zzo܎5gP2٫]}t#Erԅ8x@GnZޚ Il3姛(XfMc%lXX`d>#;HEvqMUw"!¤D 2Y^4e5Γث@o$}3iET"#? }_ĮN&#1n}ƥ)`\`~+~X-0)=WL2݌.ܤ}VVn̓Y5%m#(OMR:h,z b+țŭ,:AȗНtmd_vo+~6NσSZ؉ڳ<UIٺ SXgw0C:n_H'R|@2m%V| 2 JCHFdc 1[%.%8A'H)+!~*եf"WxzQg %lbmo=ΓJ8K/l^^o!w]<˅hy{0fƵXkP=qڹk:5p&<ݲ'aylxzk+ؙ$H7¾¾v_+=]NhWqX$U.gB=VЈ]>"'/IJr֣r5q)eY& O o*TmkZpϚTX[})NNg0"lud2]vpa)$!z3/T ӾNnO~?'(7T:d p}-'p.o?lKƻw3 ?7$[ā-5Ar[q!0۠?=SB?9.5Kp ;.3ȆJLRV ܞccf̬{{U}+:t0]g_~?0_^tqy+xk{wCD|CaU"TPIuZ4UU*߈ (I:Par $پP N N$?W^ žyǁ7> endobj 23 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXR#2BFzBookMaker2DlFont20536871533 /FirstChar 33 /LastChar 158 /Widths [ 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 1000 ] /Encoding 24 0 R /FontDescriptor 25 0 R >> endobj 29 0 obj << /Type /Encoding /Differences [ 33 /G21 36 /G24 ] >> endobj 32 0 obj 246 endobj 31 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 246 >> stream xcd`af`df``d`P urvrMN-2vq+1605607456)!C,S7ӏK& R*þ3*?Ï퇧~{ njn6]N endstream endobj 30 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXS#2BFzBookMaker3DlFont30536871534 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 31 0 R >> endobj 28 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXS#2BFzBookMaker3DlFont30536871534 /FirstChar 33 /LastChar 36 /Widths [ 500 0 0 500 ] /Encoding 29 0 R /FontDescriptor 30 0 R >> endobj 34 0 obj << /Type /Encoding /Differences [ 70 /G46 125 /G7D 148 /G94 171 /GAB 179 /GB3 191 /GBF 195 /GC3 249 /GF9 255 /GFF ] >> endobj 37 0 obj 2651 endobj 36 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 2651 >> stream xmV{p?ALyQK06o1lp'ElI$%dRlGƘ7!!P0 LB LJIK+giLۿ::aDA3Q40(w۪佷j}gdVUX%YY IΜ@NH~>ug$2OYPa?ϩ"LA>]gx>"L}+M0K\AX BA$7?{q+3WgMΫؿ! Ѵi$k]dNCka|aR G)”dڏucNiPH]/ `D銘F%P[uؾl͈ݕ脂(:x={|&420~HMuqt<@'t2 ngUr: xvVlXWSL^+Jh1s %?t. vTÊlZ ξuF:?ZytJݎ2nTskYLd1mvoHD&'XXZLM`mnj%'~y\J;͊-#:s:ҀOWJP:c>OρtQ y<IXu266[k1+[SBޡObD0$Lb7{BlFOUX˒Hb;&] Cqrײ"m0WXYšZ6C~\"CrP xaGہ&:$ωDrrGNs׿. b׷+9` GŁ3 0^qAb7(zP ,XU90 ^)r.O`#jen-Japњ4uv)n.?EjTV y Y>-eҲD_N Չ'Džc2^+kgd$d،@L;L/H1oJAHV%@3Eڮ@ -wl 8.ZP1)$@D-@q6tzvGt`G0R ӭKqJ{<ʵ; Qj-&dݚrtK3a˯ќs7B.,{ӮQ8=g5؍f\zoL"`|opz(H#x 8 2H+e7ٝJu_I]}X9Wj9+9ڈ~=NU`CK2@X!Ij%<)5\ę~%pMsWUevٜY mgDFJSGZw"C_y^K?Q_ RDqNA'} cgva_Ŏ~,=u~ r{f<6-f[/A6#5MO"2t6&KuE;?AY%p8Ô2ODzW?(Ob-b߃OL-Pza!b%ԥĩ8<^/,ies A=_^'һۨpf+⚫(>QC=^]7:p_{k<~즖-'ƹ dIA!D[P/nwb\(*aOo;ilW Xq&P TҢ&+~b(Y"]Q㔯8R+%j3u&[X +}~H]QTtts {.FL>%Ehtj!QGq+;MS^eb<]eA|]VPrfs"+K AxS?Sʠ*_Q@sEZBca@8%Wwܱ v `퉮O%c7t eU[vk9uM]P*?JMw_`RAnYFamZ^c +`e6W9qo9bo{):d=v`.55ՁbR] Ba}sI<5% WwA7ă;ձ#aH>Z> endobj 33 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXT#2BFzBookMaker11DlFont110536871535 /FirstChar 70 /LastChar 255 /Widths [ 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 1000 ] /Encoding 34 0 R /FontDescriptor 35 0 R >> endobj 39 0 obj << /Type /Encoding /Differences [ 116 /G74 ] >> endobj 42 0 obj 604 endobj 41 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 604 >> stream xmP]HSqC `ASDD.3t*8V Kny6ͩqϱE3\YPB}RSo=v=tߏwksESѪryUdW:EŖJ 5W~A9> endobj 38 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXU#2BFzBookMaker23DlFont230536871536 /FirstChar 116 /LastChar 116 /Widths [ 1000 ] /Encoding 39 0 R /FontDescriptor 40 0 R >> endobj 44 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 45 /G2D ] >> endobj 47 0 obj 802 endobj 46 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 802 >> stream xmRYLQCm{FhLT5j"1(ĸZIiP V#S5K!jbB܂[b8Cc{-{yy̒%8h]}g K[+U[l^V\ZR| ˨t~Q?d,[aA`NmgR_KcSyAq%ll_` .XP`JӨ5jF]QRzF]QWqU"R>Tfgx 0 1ɅN2/}=u0shQvsa&Fc-oo{o# lNakĊa:"_t6YHhFr)~QB(~+SQLL*S5 ,?'3(i4=w,r[l:Ԟ?[*vtEaoZL>{jF0ds{oOpmbD=~tݘ//S+jBtdG<{0#OoHZ_oR7FO.'>XJw7c:41^cn#e'j$pX@F֘%bbks0dhBh ֻ,,?$0o%ECKTJ&y~ISRȵqNΉ\{raB!uzorn> endobj 43 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXV#2BFzBookMaker4DlFont40536871537 /FirstChar 33 /LastChar 45 /Widths [ 500 500 500 500 500 500 500 0 0 0 0 0 500 ] /Encoding 44 0 R /FontDescriptor 45 0 R >> endobj 49 0 obj << /Type /Encoding /Differences [ 40 /G28 71 /G47 210 /GD2 ] >> endobj 52 0 obj 1562 endobj 51 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 1562 >> stream xmT}l_&((.D@#[08Cbs5vC9'؜}>.[ޭ>`sqj1 EA@!*R+*I&mfwFo7o~^ {~W[~g~-ul\[jzjnqMJ\]x*YW떳Q_wWsSZ-rwn3/WLr{[qws4ȼNוM9&Hd4u|SPdԓnaq:‚h @mI0 е”D a<HR 9ƌ4PAd;ƾ"{t$y+[' HuPDCV24 ;k4~aRR a} n'"hi5n%vnK7A2BY y#OjZܞ#uD:V}HXax,Q0b~Ǻ)ӗ_oBƥǮΠy!1t?lukz1pHe*v%H(F!8XI44/=#u\~.6/Ř?-U?)] @7]^dһ_9.1s ]~Krq6" NbB)Z!CԀ=" 7qccb4AOr,BIΤ6sg,BųQv-zGrS΁^N/~ORWU^"냯 v8_7~,+_dDB14̍1 g3_$iq#S%G'Z, B`d,2q++9$L<ُo褔tR`yD;(E8}dA}/]ŵ7KZ9p+kPN*x^bh_h|mMci̊SEش躷i ]!EH)~o#O7 |d'&s{OdGe}l;9W. Y^jZq07F0% ąhqNY|s >d@V݂ t4!R>Z) "WUvp7yD VwЦ6+Kv 4o|sFZT@@)Qx'Ly;@C,U/9)OXɌy 3BuT=bʬb gDkB%DIf[lBF}Γe#)B˨L5``oq endstream endobj 50 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXW#2BFzBookMaker18DlFont180536871538 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 51 0 R >> endobj 48 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXW#2BFzBookMaker18DlFont180536871538 /FirstChar 40 /LastChar 210 /Widths [ 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 ] /Encoding 49 0 R /FontDescriptor 50 0 R >> endobj 54 0 obj << /Type /Encoding /Differences [ 33 /G21 47 /G2F 60 /G3C 81 /G51 90 /G5A 121 /G79 128 /G80 147 /G93 160 /GA0 199 /GC7 200 /GC8 217 /GD9 240 /GF0 252 /GFC ] >> endobj 57 0 obj 4923 endobj 56 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 4923 >> stream xmX TT׹>D>hl(FMb*1D@^CD%"8(yx8:sf0LFtp "ћ`SMs[VӤYs%mەn]?{׺.} \ZcC~TEŁ^8xMٺŋYAD$HLU'@"[dbӍgtaq XJ6$|^DHHojRtX@p^[ B& ^^=A*;I J>IZq)(alZ O崱 ]5gN (ykhEon@Jn ]^76~=]̯- W AEAV ?,r912×W `5š_; ])P?~ϹţCiHQSPh#jU-sC4G-WV[Ewfz1ؖ/C΅r^#n#VY˱T肠T=zT ./Jh(rs77>{W"OsVHFHin5BYX4G=l[?dDՉ嗟ˇnvPπiԏRs Ei.X遴9~Tsϙ ScK+@pc*F/EkY^vwUE("\$C_fb +np9b0d~X؊XNx| :=0NTuvXW'JÈY_W%1rH0Ͼl6v.;ulCl"h+ ɽj1Z%U6PAq$2A$YR:bMK#?W$HbwUMZC_2B5(4jb= l6#v9J2DH4zj0T+ >,U&>й/V J҄PV'k6Z}:G _΋m,Ҁݩ+n8ҽ~`[kMf>Н9hսB4{_ވSD5n+/]5֟kAJY&kϑ=Efk#ϴ@#fO^%+P>Sp#2mGȢKʾg5ŌyË%ρ̿yo5{> } @¾.Y@<>kg&.$5C4)0F%)#[7Nq{LJxܝ-#tГqx:{T0577 ^Oq1S<$gS[O/I-U[m, {:T ТN% !*` <,.k 8rI\V QPlPaq.m:78ua֫C^`*Ed=׸W#5( >LEz$f.ad1>8N"l`Oecы7{AE`sZ˗ڇN9z@ "4QcG2 aY qEB͞7'kuGy׹c6Xrx_T;iVH$1PBSk0 :PB(//M;(Lq UfGZ4GĥAYdDv>=f尽 *DhmZ_xk.u*vox{?C]xN}n2ޢmKzOޗ\=DH-qtM fхD'BwrE(NmK M'vߞ 2  -2)QŸGMwfج1˜Gfdl]`#-Zi!&CN ?} ~Efہ4 *J/ovၥ<:2p-~I4I$gv+f)$w-O]tJ/}޶u ,hfOl}{ u}@t:N~t$+x[c]545 !MCT(juOۖVhr>)wu F혴HcfV[e"E{?ۇL'9pOs_֮K~k=!Q~#hU8Ћs;TF,2>5zcqmۣL bmcZppQXG-XqB_chO,Ol]1B/ܿǛ IxH1.2 7,E:JzajtlX+cHs!C &hW!!' ;BZ'KeׅoxjB$A7TT64>i76ֿݎq}s mot%toy=ndw%4tYah_JwwE%pb ;_酾kBPHE^fE2"i_L5p 1,H3${ |߉@=лxDjǢ%`! |kOŸ@'CHV ycZR[YsbgmAWxhCnjQ%Ylb[-pV N vN\w~0sH~J4v`O&zP@i"^bmf,eĹo࿸>w`|-!?Tۻ9dCO^\,Ҝ!vAuڷٔ ",QcSrX Zx;O]ޮt2 ^**gvKz^BَY( nWY$RVR5_LL*ȁvƧR>#E%`ج.8+UI7y!YCT3͛:{l0TТ:Ǹ32~)~KRM];Г>u"ս*= ^zz~?Y3?.'Ǽh\mF6TK(Ym~^|6X;L. &!L !3.!ȝ]"65YjO(w3@v?'v^Ey\A"ծ71^`!H>D42{"زW endstream endobj 55 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXX#2BFzBookMaker10DlFont100536871539 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 56 0 R >> endobj 53 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXX#2BFzBookMaker10DlFont100536871539 /FirstChar 33 /LastChar 252 /Widths [ 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 1000 ] /Encoding 54 0 R /FontDescriptor 55 0 R >> endobj 59 0 obj << /Type /Encoding /Differences [ 119 /G77 249 /GF9 ] >> endobj 62 0 obj 878 endobj 61 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 878 >> stream xmRoL[Uh3IDcfi 7dLfZGG^+׾>Z^{P Bl.NM/&Ə=_|L`wrߵvd#dC虎wvk=w#w]uUw}t2m 08csJGPxz!E妽k~شwGxݍPBKɪ8l6ۥ$ Uv=jtnsrFeNx?m37 I@S x*UC{5~(0 Ԣ/YI,Ua05HQ2r& 3ӥ50%8_~ugYD ,:06~il ΍b?HJa,O=yDԫw'߃IH!s'weL%$`N9 K`¯9}W[h\"#"xy7ow-w2*R C:=Ξ#Dr}|[|@g|h!F$NQd'D8r.Q\\|g`р%>TlT^O͔HΏ8M>lRB,5nh7}^l-hVZ?Ezj$I"+MjBl69 RtsxYpGP|hRF-\\QY~ep0h,Iw7]ܠ+7&Aq*Hi`ųqbdz>xR'\9WmFmaVW`QiSD%&%]wvrɐa[|A endstream endobj 60 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXY#2BFzBookMaker14DlFont140536871540 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 61 0 R >> endobj 58 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXY#2BFzBookMaker14DlFont140536871540 /FirstChar 119 /LastChar 249 /Widths [ 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 ] /Encoding 59 0 R /FontDescriptor 60 0 R >> endobj 64 0 obj << /Type /Encoding /Differences [ 37 /G25 105 /G69 230 /GE6 231 /GE7 ] >> endobj 67 0 obj 1657 endobj 66 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 1657 >> stream xmT}PT޷'1Sh$Ʀ+2DBƖ1R"U> O]/ۯ lVugi)4FBFL3͌cDZig3}K.y;ι11V2 cb)M/)lh+z3oly[X~mYm v/}ƒNNEE*_F3z?~tw!D0'jӰ5֊f+Nt[C Ń~$/Zb6j.Wv3kn-V GQx(ܩ:}1eD Bv Se[Y^9TJ'_NƓJE!RSE1_vbR;3P:Øo`c'όǡQ*rȧFBF }[/Ã>MȁQYlY@Mc*M4ޕKvV{')}UX'Co`[iSe m8%UU y J)(#Ot-!ToV\!53Y2EjŁ˃aU/UTa!&|#aX1@׻t'cD=<7̳c8Fx~F8coS>ugS.;v4YՖc* ȡ+AF;ⷂbS kp~> #3TTMTI RFZCA}A;wi,[h7,~_1] o?/VmJddXy^)8Xya9оnzm7Ko@LESH Xs_imf.7wK} ؝WCŽܛSO=)Pׁk<ՉG/\O`ռv4)RTJ89~,-|yD'J7yY@5DY|s5$E52 {wc{ȃ]g9'pH {4f'?5s ҇ڿˍ2b@\ŋj+7`25rKDcEV?h$_2t@'X@vN֖TBu9Ha٤L٭J.(^iKz{)WJv{Ũ sw' Aփ# endstream endobj 65 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXZ#2BFzBookMaker12DlFont120536871541 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 66 0 R >> endobj 63 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXZ#2BFzBookMaker12DlFont120536871541 /FirstChar 37 /LastChar 231 /Widths [ 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 ] /Encoding 64 0 R /FontDescriptor 65 0 R >> endobj 69 0 obj << /Type /Encoding /Differences [ 46 /G2E 47 /G2F 48 /G30 128 /G80 135 /G87 136 /G88 179 /GB3 180 /GB4 181 /GB5 182 /GB6 183 /GB7 184 /GB8 185 /GB9 186 /GBA 187 /GBB 188 /GBC 189 /GBD ] >> endobj 72 0 obj 6462 endobj 71 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 6462 >> stream x}y xSyXii:8 Kb'KȒ%K&jFHBccl,tuս,KȒm0<HҔ,t%3k#kl<{d;I?6H{{Vyzf[-6?7t8ZշZhkKK/{d;l;+Jw]G]Wzg}*<{񷦺^9[My0:Op޻Mߋ/wlL;6m6vvemͶf{fVV]GYtq +jW.]vڕ_]ڕΣ+]vڕ8mVN/|W*""ZU ¬WXdE_E"mif^lvpnm{6vcJl.ݮmwm#7W7]LTѧVS-4Yɇ%"ɪ*6XX 39!Uk6m7 ozIKf.ገ 1NSdA -YG&2ojB")' ]AӬX/ $h Wuؚkk֡dg"j\&vV jUzK`챵O'R¦ ?jeՃSw W!u|t,0EӢ1bBЎ pa"HR0( '^? 0*-N \V 6L/0԰T3s:ꇺLX3J^uY`Iq@U -j5eA10b2t\nB@i^{Nkykd =į-#Bf`L?"q|~M Ls ( d| KAYd> F΍SΈY&$ SYnXP*v@#0^?LzVaU[<xԙx\GS.(ϙsj7ߙAaaOB0}c" iAaWO hASZwnz Mf'F>g6$&֧QRZÐaX0 b%7X "nMm҉]1{a?5NOa+6` Q@6 P$^?N] #v|tyl09 *F^_ бq"H {4-2N\h6%!PP/KC~Aq[{ZnФb0yo?)$H;cS ,Yn'L?A e&úSZ:/8RuPvRgo?x=hք^O@k#0TuM>5čw\b-%@˾wTCYZ# Ă# yY+EWaĕjQ끸^]lۈ4̈\gGy&\뛈ސoL('X a/ Vy4xPCL8h@NyΓ}dӢż|ZCf8BQJ5|I<LѽpQ-lY|< \ jx2rA KK- M;1qc1DRK3uA8!&V2U`av7zxba"^>H g@БMh 2y*~&RDd8u~*C$Cj)67e@FTe=]J8~zQOyRPL[h6A~DE\ʇbk=FKl~ w.fgAg Z%"s!Ra9ev㣋X7@ a!e ?X>vX@2:o5LhBj2Scg1#1Cv5:}S" 8S`Z )%0W1ZRq&l.A u 5j(3n! (ma$ID? G[ ^Qa D3ő K<No"Uq2rK_sGsv*e?&5VL‡vK%4skx{FqM_ I ' l~# 2|/p1]<2S4[T6S,'mUy)%|xWyx(uVyw=ӾIh0/z٪%#)능~{~"NI/>ipS@"C3M@X9\Xkɡ~6?|OLԄΩk|ZL%^昅Ns(bH0\>vBĽDŽGzt J>M2xd8H1ap\;0T82^`0cF*8ͺ~xQެcA~] ZO6\4qP!tQ}}TL{f25`rYFCS 4꟏DA"TAxP{!Ӏ]r Y <ʖǜ@/ IMy /֠p2旾pq**@K8iU6P (H-\6hz|3c~.<,Cno) #TI^7ʵqCDm)u9r1d6B>s Ao+k]{iy=7f0԰1)+9?s!_^|DH[|XoyuWRvȚsRl߾=NLWA-0^d ۓDUGgy EDc,N!P$D"}L7ni3 <Ŗ~} Wd Y9şއpWdgh\׼B,D<~-3,*X *GOCs;ƑA0&xعq<zwa]<.*`9T42B,?:vj̖e=-v2镙XQPːI'7%L 3?̽^Yw]O:u2.X-=Y> X<;`õeQ.)MܴB-Lr08 #0}ǷsG( wW 5\E Bn`3]oGP26w:ҒlEC"!~;u?p~ɥhQ_i#;3vk=2Cqp>@gJ L"Тrho=gzwwzvAfIh7fi5Z55xve |йǻ0,3V°tX@/ilYJ\ZXeâMO0n'^Y!9%Dw7r$Q&}z' :6v,@zzFű.ێ w6eq ׈ãmYq|'ג#9rɚDQv7t(D"~_PKo{!sxk7 :1X]qŅse$_Gu(ho**Y6m+[[U,)J.C{yhuu"]Osw0tΡC[nrt><{N>z-y)[D5}W֚m<+Oլ={C'*pg=BqJ9{&,}GIu0rG7l@1X,nپ# Ez7h;MCH/*&9zwt=֏+wQ.#zQc+5d?}F.MClӌ>86İAXjJzM ev~ 3Q]S;0M"KɓtAAk6HX1#T1XҤtf.~7}J<$nv@Db,\V"fb sjfH엟S3;WED" UIKY_THڤ-c95gw>& gx9#Smm"56}ۼ4ry4%I82R>>lR # . ~5*k!H;i+*dQ/3_`-[F_DĂ?Can1nI;٪_ lZC$!L[,RwRBv-nB[Raѩ`8.;?i,:óg9.0536$i!e=G0a<Т3VOC)tJ ;1C0zمgﺕo˿-Y YA'Iahx#~Sǿ|w3yDUSQstZfMCdj(%•>?bq+D =4N47\tC#!5lK Zp'O%!-)語f Uҵ2iE,~Es>.9oVQ"3 O5eFR͗F9TRDOM endstream endobj 70 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXA#2BFzBookMaker6DlFont60536871542 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 71 0 R >> endobj 68 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXA#2BFzBookMaker6DlFont60536871542 /FirstChar 46 /LastChar 189 /Widths [ 1000 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 ] /Encoding 69 0 R /FontDescriptor 70 0 R >> endobj 74 0 obj << /Type /Encoding /Differences [ 36 /G24 43 /G2B 45 /G2D 46 /G2E 51 /G33 53 /G35 54 /G36 61 /G3D 62 /G3E 63 /G3F 66 /G42 67 /G43 68 /G44 70 /G46 71 /G47 76 /G4C 82 /G52 90 /G5A 94 /G5E 96 /G60 97 /G61 98 /G62 102 /G66 103 /G67 104 /G68 106 /G6A 107 /G6B 116 /G74 118 /G76 122 /G7A 123 /G7B 125 /G7D 130 /G82 137 /G89 141 /G8D 154 /G9A 155 /G9B 156 /G9C 165 /GA5 171 /GAB 180 /GB4 182 /GB6 188 /GBC 198 /GC6 200 /GC8 202 /GCA 203 /GCB 204 /GCC 207 /GCF 211 /GD3 219 /GDB 222 /GDE 224 /GE0 226 /GE2 227 /GE3 230 /GE6 236 /GEC 237 /GED 239 /GEF 250 /GFA 255 /GFF ] >> endobj 77 0 obj 23689 endobj 76 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 23689 >> stream xl{|?<v)[zn(e  l W$\qQQdVd]FF4x,YcG8qbLd!4 (.MemR(]V7|{ &my^9j˿|aj 6ъ[ػ}ms=wx ,Z| Zp}5e>{/\U;]W;oUu\w kc7,{۹0dd|; s0g0̿0̝ a3a3*q0Y02c 42fib av0L;t2aa2aB 10 2La 30& 3cQg2d ,e saN1K ygwsU;W;,p,XXȱ`c]w:Z.]wkcᝎ W;w,ñNǢEEw;-v,ZXq]9^c8rܳq =+:p˱bcJE+;VpĿ>Xjcjw:V/p^Xұzc;xa|m/Xh}X#7>Tֶ;ۻ={}$g͡đg'/r??!55rRQk5&Yפj5FM&[c X55|HMXTthX񚉚5gj&k9\sfٚj9^sjN<_BͩkN׼Tc澹XR50e.gH10U̗\2_)1_a702xv3=;9Ov17|en3`n3ZYf?1w0=Y}_3ҟ1ddVbV?830k;G2ۘǂcLCi|ټijdf3/cv0;Nk1!Wp R"{uc5PDc!+JP`!% .O1B#dJ j6 k%,,)9313ʠ Jbf@!p@N*Ztgp%_6Ac2>&l|ٞd~r=7 [(DY:2~MV'L6bJl.~o#~' 6= 7(vP-Z+mVN1C=**PQ_4++ ~6Ewf7k{ZX@gɫ@UzɁt<J~SiPԔҜ^g7]L5{PTbAL/{YhC ޽^}2d0YwOf*5M/TW5?Lt$dٛhI}k%FPK]2Kdf(JGdc[Y'iA~̂n⨞9:S]k.û!n-7C$h_MvK2bqάIO{u&]Ad{gNF3p0н}΍nx1׬' =EϰP"L}8M^=dH3.#6΀3=8Q(N6Jay]6-𥰅;R8j1[߁7TC3y o/9y r\6 f רݍ "EC3荀(FOH,%i6DpY,^TgculeR1(VEA\zhn9(|wDPiD7F$xG ft_yf ,S18ؠg \oo?* D눓ko+{3^Cz,eAO'$gj\M^'\R8t r2h=в_|K.aL%o=+%?z} YK@gKSdw,,ܷwY\*$]=߾& $IJ~jq]30IjC^>\uǞ$ Yș\IGB '0OEM@m޴Lٖg!("tѕ<dKEPeQ\1U"(O& tΰ@7c)IIDaA ~ I:m$AadA(qg2`fVݻm >:*,& Ӈyiĥ{h-i)A+R%' #BDs"FFg.'9 x- J3A_??'BBU"Sdi_ +հ/{\D2yG/Գ*}H tZ}|֢ϙPvYW**82OQeh)N 鋮/vt{m&tp/X+18M=;KЏ0byl˛bDPq %HX P^/ $,}UՕ8.Kh#ߐ^;G"B?f_,aҫ4(J1 LFY|",I,!k*L/?*npyB,^&<[??)pZQP-e@NKPN!k-j}~|RZwAk38f6 #[^}Ί>dhO@At@+]J 'p,.gռrs`3ݎ98 Zk-*:4|ڣKQ >&Q0q0>s otl_' Ȼʽ`~N*JU4X/ x<9bB}aKi^-/era#>;KW=?F-k~OuI XIL"Fi, T}#Њ1<#NM+.plD!^{db'gNl/ Q@1w ڌhyZvHCbȳw ,d uqt(rmnAŨFu<9b@ZiW=/iY99ٖiTfşVf\n ;}Tw%bȡ4pط`d/FC` Oqxck߾$2@摦OS`;80"ttS6j (!-$:zѾb(C@ H +x`CTJP*ex\{v;ZJ7^ dla/܀@PfűF.52e㻳1/J8QEzyDOU[)Tcx%z{ps t<Ҷ9( "UH|Pl}_} 4Ιܜ^~6 &e]I(<{č0s)߿b z"!Dƽc" VF S'ބ09wkd#ueC]=Ag_B@& m_[_ =a Kap򧧟Jn"kG4H Կ6(ec<06jq#(x2pPi\.RH"9$*\qN BEW4xddTQTZ:hDGqhʈe zP9U%*j$VvI9ƫzhQ{FzgQȓaf'g`9W询F_1@W _(Ibb*Uph^ 6oھ |N90T FGGc|*IQjwn.-?x C4/TtiZ^t2 㥟55tmz'Byѩ7g?5 ÔCO+&xK^ȓO44?tȀ'Y}{*ꕌmuRXW1ջ% aͯdd?WI}P\jL^_%|)$ ^LiJ \Dr K{kշ'2O yž+ &qzu{ڃ].Yؐ@J 3?Cjx~zف܍z&JIP͝cyH[fqx xir3ҔʡXtI%@K_{]Y2Ԥ.Dm#k!)m5ݷkxeYQJq<״|a]܀A=rHt ]5dIeOOK TU B=~|A88P;5FQMWqO>T! s۞=,FTѢjvkms.ZJ}vź. `/Q[,(Nտ~D-"< Jyǽ1' rƾ^j_!6* bjЌ[/'X V-ltCNP"߆΃C7ۏhȏSkQ\*,NKzt-L/k4\!Oơcr.CkBn֜_+PI .#'7KPM,>i`OǑRN@v-r%;l#anC hQBX9~ُTjjǶ/P"2HSnS֦C0I؄FIUjM/+hak4v+&^{ 0N<'4d`cd pk{#N^e,KYu, o~2\=`p&:CC("IT;k註",6_볯V@;;FNGG>x錳/^cC?ڷ p{D8SCF,O y!JF!%$TnY}C]BQ7i𱨊ˮ?zbP0K;3 t?srBs= A;,?ʝ'l5>;Ƕ.ҭk675€&"La4j;%QE Tn}mMd o$"& a'$|*0:4=dg5ISAMTA/k} 8-6W Fo'@k)[Bt㄀okYChC]'Kun;ڜr«ucY+]'O7UD⺰jȠD4]mާ64F1W %Ry /". Z7a9` 4XQY{ ,H PѰ{E7Et<'GixC=LFe(}G2pl\3 5W7l]>#nqqX,Ph-n/m"A KX>Ga L_Oc=)='c&s UCOǦ'QbeY4x0FBX{cPu9֓^c#c),lCs{c^LUwhk^Œ*>h_x J;`YEiePL)\֑]nZf &ݕ}{)~KHEP)IIA4{ۆ5p}}|{jpò4;Cu?W3ez桳уԻ6sNy@Q 3_]~≪Z7Ui{UG-) (y@;Iew{#ACU3ա8 n'o) dڽw)FGQfCHCZMKHlXnZuDsrLEqC%<-o=f&v{!|G\;Y9 B,(prڃЖt$pvuz#@tam#w%o2s1iԒ s=?TN #o~gf ^+;V)B췵U+:750.dPd Fi圂&8$szҠGl$7ad8`7Ep\$ @-2N0OjqKKA\#l9j; il ?8}ҋH'c31ԍ( mF1gϪ'I Tn4̴d]>Ex2e5 3[PBZݻoBeC%mzSnS\Hzgq#7+dbK!ɇ2N#zLZE~h=^ٓ_1Ē1*l"$;z!ۄ6oI)y<4zk&D6Z7(27z")87MU U) 7Z|bT"hjl<{U :]O2:-?QP  >kdQxd=dL ^KO`6gYj_^gc2X쐊=21=ʤ DoYhj@}bOFV{'Gj,>?fG (?kuIem{o+T\g/B@ J8Z WdCk:PJ?I"1DC2 d])mb=."jRդC^~:^)Vⴅ}.!jJ$]+oiȁYe *ta<-ӀOJƤ/fFRQ܇zʢ &Px Miܖ`2"j_szk19y 5Eʎ&TCO#jj`|d׏e1؏;[{^}!9ƣTeqЌ(gk+WO PIt=)a zcv}"cd"r/ Un{KI"x c_Y{_H`ޅEz+*1) ,.P=1? !&\H.mЃ{v}T|=n -.D"Z`.\i_ VW YVG8Ӄ(,UTJiPqxPSVlRPU2+ 4)X"bw5p6vE|a gc)xn^ za?MfJy8k^SYȾz |@ 3&uk!12CN3t&.Q P` ⨣܈ֽ.\zC ՝ .ն*{t/;A ֞&|HTX(Jwn|Lw(2jTDA( 욥KVF '/'2dZ~=1bA) ZJ>KݕnrJG9!$):D!r>\]7u^}׋0%qгskUxu^ PI$áa~1΃ʥX8O >ո݁;dK+OtpMAQ-].W`/K|&Hwv0MK„Ii;rCݴcȻɨENGԏϦ_J|WDQdaxc^/qFSNi2FO,hnbPm|IT5`gQ$3YO !$}8;3A֑ y}OK$_D.r|R9DO*ρ|-w#-JӐ̎%Jskw2ts!>6 |sb#߈^{;VttIM}Ov4I!?Br83P-S(2dFBVG|im9 f'r eR*Nѥh1n=5sK'{[ b{ `iNobH"`K, HL[;;[fyZTh5q+7%eT6E`IWgg7Zt01 u*8gPn9}8%Ml9ezhwwu>vH tr]{x0Փ sRFx1 SdM"8|9gi P@^ d K0/MR4U$cD+ɮGBZM讼#Ote qqE6Tg b 4ܻGM81AYr܁\"W( 9D/>ve}qt?bwC={yo!lfO+pS&k6Lg}NB7 wJ7<,DVih^dƦ кPs`p$ʿkoo%z]L D-XCR^=G:(?qew=$?\$g|=0x|%*# _tt ;% w{&2fӮ^USscmTnj}%T.~'H׃MQH\#ŞU_ 3jP\s{,A#iT/FTQ ~; \ChK`;8ށj-ioC c=KD+kx8'ڔ6~RkWGLr`!u>_( yX!g֏n߆9*+t^OkI[ۋЧäZ/FOq!b Ut;PyžW};UE@1RO^׏<Ϥ'h]n}iy*6Gt3獷Rk0*TnQm_<ٽsE`?dw*H݃=`S89i# >>DBzmtYCZ `4ae}R[-B ӳ`#&:u 6\k@j<Dњ^KSKd{rR\0k)OT7Xf:2qtA\oCDx {O&%{W}닄 )-V,wyKBbtUS%P{6XPJol\ "90tv #Uh#/nBO»`h:J{}:u\ ˠCkUR]\ԸՅI2@Qvhs2ʵaj!eݟʿyO`ytY"z q #Vp䍉,kqJ[}kliW mRG>] I47nk[f} l$U}Heh Po?쵺a=ǦRWp+k!md6-M\ Z5R?\5V;3hkJy'.DЂxC|P7vFm֒ Xԫ-)/d9ʯ)ZRYo+_"SzaM/)<"GD”m= YtzHT)!'8'P'zp1.h_XmJaĮTQZ{WyxZj#~+xڗE֣h X4(WgaF;K{5ZrR#CI[3\C~T/1V[ڭkǡ2 lN@d @\YDMNuB3Vא4QQ4!d#X<hCgLkQz9zD γm- 9yH8\ Уv\8^ pmey^}AIli{oWg`M+(='Owz|YVGR2hB=TIP0=ti.똛S~:qeǶ/54@g{_ͷYW^9lj Hw"|OXnm,R=R\PYyϓ(IHhR%:oo Z OS'-r=/,uPh3jrgq( zgtk08Igwm ' T.aSSEZJabi`pӝ)*#%X/+֯v8zW9Zױ^~FG1h|_ /:* "'"B(^9&@7;7n m[aGBp7޷`T-(/m|+t!:Mʵ>7'15BvcHz3& ʾH |X^CtEh4@],Ea6Uk<0)luϖ?髶 zuJ<0K{`qCv2?DV∠ܸ4Gk'nZ_KVf RXh6+:e -RqXl@t !$$ACdܸN_yWY,?~ +NAշơe)UG{8R'vm 77 =Ed %zB= nz7GϮ'XIi}\ì"7nn0eknq6|3Rn@]dvi0_CCtO+05?ԯkൺ~u/'ĬO뢚,@N]jwҪH8 35GK hjDD-tُR !zhALn!0z. UE.@S1(SCDŽW @=_H0}W~ZiUٵm`x}]+qQDg Y"8;޾,INCk>pf /…Z~ϓAZRF".zZ5M0ŸNEVcvX؝0=z y8W4+^!VNjEJΡ͘*4z7*AqJ_kzV'U:{}ŽyV"'e3-gCJƞ#~s|n[|Gk{.8UnzX_AQjyxx!< ?mIUII LJtVqizdV7:JOO'[uwm~EDd[kO@bz^HKfE^R[[#Qܝ?|O$0+WI/ Ww;#0KXFևMșB{3q7ؖ]+MyсD? -c 0kS0-6.Ҧ{gjp]J' !ߋ3AM5>):Ph9guqnsuybza''zؗyuhhj(*rxrgY-+~1n`8W;s6 #Vv/HIYnpKp1K0]';o:sbҶ{5>ArrwOl,,%0xWEE@V%@ؾb'tteTz xIzuxAlߤ @jyl1.۷#?}>(8f55ƝqE6mFڌe}(Etj3 TR[ڕiVr NGA ".ښt2N?)/Wj7]j5/m [_=^@dgX̾roh}kA:A^ς|Z)+)t|jC%<Y PB^{߲oG"r?>{@mdwG  B_+7-stqyr3Z[Devi0ud+qA!x ~HKG*5A'ZGJ"۳{FB4MdjF@htA;ȎǂʼG};Xȡx/*\vCA'cD+s'$j 7#U)q&Ct~_Erܩp<Gt͡ d4lkI]pȸ m b5.~kl4 I2n/>6qtqt?,|־̷]+K Ӯ+}1z~|vHRѡv47ckӲä>TU btšԾ3&L0XMϲD:Hm :ۇ[DABkz P.{:!`[L)~}'F̀D0ٴ0~|.I:|8G)nۼ>Yfru%Ndze|&qgvU;v;JdڲdJ2%)H Ia$KfdɱTv57qvI:Iwگi|mG ;?$y첉5Trnz>R)zǙxgA|‚vrW[ :+}0s\qTE76Ԥyu[2rXRz\!ɒrA!a#;DeRct,V͞3e/Ds4<="O- nMU>OsXv,Et ;]4>bkh'NP eK~iSUkÚotBwxĀVYg󠼜Xb xhVckfa=^4ڤ6Z# <0TN=M=XAԁoC0D,;"{SIFaī#$0AlU/])~x0iiB- 6%FQHrDXr&V1k/V,Ma|wcVNe6c^Z*f^]WhݲuCu}KGN#v Y^a|J&,9rt&|5I~"pb&ߴIH∰ 9;+a6ȌbKpY:XUS4i0\^< n"#H|@0`A%$sV T&UU=ٴkgI Kt,SEX.Td]C2dFiOf-Z{;(d~{fZ5 Wdg+x-?~[ t[f-ض67[Ӡ)JUprn?p8>(y5g+Csq;63?Q=U_7Z˙+πgv'o*YyŞsKA﯇#cm ,JE6zlq\՜jO N&'h|\s m ]b|ozO 7:3%/?)x%`0V)94 e rZ,6T'8$bؙo C hG2KyAkϒ'I˺ڭÍG|=XnnG /hݰUY-lo3 J]FOZX*O*: ͒|kX>I`z$h>;(SO$=,/?GC?k~]\Qfr{%GNZVϧXi~ ZSqה `1 pWTk_:FZ_:Iu@q|BI}bkכAjY1kXFF 黴9CLRnG?Re5R/__C&n.j9:ZVp=KmݾArVpYYk&ք>^2GyJ~;CaCn$Zs ŦDRw,7GWjSM_lĿUVu7W':p8 `O mCtZIjNHW{1bT `{4oG:<$?C ɪZtW.j`D^C}Y|UKYTi-Bڙ:-OWaU@M4Dg7sVkDu`ZeOKnW&5r]Ons+v8m4l)^|o}B̛"Hcr[hgY?(o!v=m7[BOߖ*L`t9q!}u XH[סuk}mb[;4 ! Ŀq2ڋ|A5 U {e+C} (5Ou/?Vl={)Motp܍^vgw'L=fZZ>okp[tXU-e34)‡7 d=dFˣ0_Zxsp㮄v2)6ӉB-s:X6E~T6(ŭ4as|F$֜{{HQ=ψut΂Yܪv=>27.zW
bj>y@É XU^b) K3!HK$' NJQ%!;E9I{50M6憞r#%?IC? bwn_[yC#mZ̧HЪlkhAtjsOa{#x@[;Z@k†RN)w( vd34px#,sc.܅şhV'@>e]}␛_IBsz+ sUKL.)s+^{C#_n"dM95:aËCA/ǎW`hƒ&L8'} )L,%VU0Һa"BP{cƕ7ȼiP:RnY;;>LZ7?9>$Vbk֡qR(\w}:Ao}ʆ5|`g+[_ܐG Y(p& WH܊j#A*dHֳxBcjό90(\9 g{jl1 igB&mF۪.YƯ8lt&H!{'IOz՝A'GW$T+&>[|@JVSh hi&G'3F~9jW.}ȧg"+iX=eFrLw&? x- d~+liQ|? |<tUy] .|~v6w/bАĥ^D-(= ߹(W$ ? Ԧ^VRYDwi݌{QlEPl_h ?'^M2U[2Z #Q@V/vwz,6 Ew T`hGH`qf6k u|2q6&eDⴾojy%)~Av2L4Ldgf%lw&?FxhvpGOdu-jP|q;)>!s_X=Fv}yҋ\0݆k~]y`er~R@^24MJߦU˂ OJ@ea\ Fn,0ٓF).GQ~ i('ِ OX`Hȉk/`[wG K֮Zw}quY-ʔB"ti_SSݕCƖ[ʮ!%^aV*hIV0NC4{'^ݰ1*xSܣhz<;AJ#;/CCUArNnhiFKJv,z o@!"&ٌ[q$e_:\]1ds>.D[X lUj(kH+v2q- U#솈snNq8qԬi@#,)'Z:@awn^?)njoX%!c#dvr0XGˤ2VťPP\þ\6_⮾y̮"} 9eں+EU{X5Er{WEk 4sUEsk2<ه^Mfvun< MMQ:g^i}v}(,L=LbGnENqC!! endstream endobj 75 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXB#2BFzBookMaker7DlFont70536871543 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 76 0 R >> endobj 73 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXB#2BFzBookMaker7DlFont70536871543 /FirstChar 36 /LastChar 255 /Widths [ 1000 0 0 0 0 0 0 1000 0 1000 1000 0 0 0 0 1000 0 1000 1000 0 0 0 0 0 0 1000 1000 1000 0 0 1000 1000 1000 0 1000 1000 0 0 0 0 1000 0 0 0 0 0 1000 0 0 0 0 0 0 0 1000 0 0 0 1000 0 1000 1000 1000 0 0 0 1000 1000 1000 0 1000 1000 0 0 0 0 0 0 0 0 1000 0 1000 0 0 0 1000 1000 0 1000 0 0 0 0 1000 0 0 0 0 0 0 1000 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 1000 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 1000 0 1000 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 1000 0 1000 0 1000 1000 1000 0 0 1000 0 0 0 1000 0 0 0 0 0 0 0 1000 0 0 1000 0 1000 0 1000 1000 0 0 1000 0 0 0 0 0 1000 1000 0 1000 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 1000 ] /Encoding 74 0 R /FontDescriptor 75 0 R >> endobj 79 0 obj << /Type /Encoding /Differences [ 40 /G28 63 /G3F 69 /G45 75 /G4B 82 /G52 106 /G6A 126 /G7E 127 /G7F 130 /G82 144 /G90 146 /G92 150 /G96 151 /G97 172 /GAC 175 /GAF 176 /GB0 177 /GB1 178 /GB2 179 /GB3 180 /GB4 181 /GB5 182 /GB6 183 /GB7 184 /GB8 185 /GB9 186 /GBA 187 /GBB 188 /GBC 189 /GBD 190 /GBE 191 /GBF 192 /GC0 193 /GC1 194 /GC2 195 /GC3 196 /GC4 197 /GC5 198 /GC6 199 /GC7 200 /GC8 201 /GC9 202 /GCA 203 /GCB 204 /GCC 205 /GCD 206 /GCE 207 /GCF 208 /GD0 209 /GD1 210 /GD2 211 /GD3 212 /GD4 ] >> endobj 82 0 obj 22494 endobj 81 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 22494 >> stream xl}|6,wQshiJYX( PHSBܐ`8vr>G֌f4i$y$Y"ǎp8 i 464ЖnEs+dCBqusO풿uasM+XqӃGFnu+qz;nn/^/>r_cr.\fꫮ_ ?|eK?g'>߆ 6ە6ۗmmll7l7lߴnnپm-Vllllu6[kl6mfim6ق6[fl&lfm6fl9`6[fl{l6>mf][}yv@]:z[;Yyzg=wu>;/\~K[;ֹwt.s]\~O:/\s:?عbi[:Wڹwsŝ+\qw{:W<йby+VvXչΕK;WҹΕu~}Y#)ln-yP|VS '^/ MH@^㕽Y ̂nZZ'pU]Ar@x`dXV _.yK:@ 2 PcBD.>.ÛKޔraeD(C  1db[;:Y(H1-ܐ4F6%CY(_r#N&pO&' H5UҊ $'fpX GX˵*~}#JV÷.uR&b祚 s58iqߞ8[uG.O= 'X85WH:0e@h h!y HPbqR55LщJdt&7!՚M0: ԣ8A$hR~iDjtNS CNЦ,$g39)¤$W]",׵Ԋ xF('' ΋*h 2GGDԮkQDI >;[?5sʬE%1!Px-5A+NKqhצc{o'VyHqFzʄg| ;PUzp AgtgB/fq ?׫Au)M~D% p#ٙxar,Ѳ<6SqxZwoBEykAF6Jf~z(#@=J΁t&sZ4C%dIZH$'t'(7svkH58jy ҹb? !)E))#9",B)TY[ 8O'AV%I\a-.ĊTDŭKxudh!3[ChH8&sDtXn]?,$\&EĵC >0E 7"8}3=AԊ݁&|ͺ " lAh|Y!$ okc:Fm 7 OcZ#xfĺ;zz[ (z G~w_rAy\=% wb<~㑫;a2kfٷ"/Cx4gw{v$F%SDP#9QviAXHT#QT9'vşb20F"CBdk{ {輻 XF@վ N'(oAU.7Td ["#*$Y뙺Vjh?9+zFO ?0Xҡ򼉛.{*N(rQfm9l _)Z I"Ψ:3(͵`3)r nJ ⥞.u"ҍGw08#sx9ӝQ@ O@ 4"DQi*e`Y`O11Pݛց攗't:~Ky৷PjFvApG},RW ;_#G2/PV]>|~q}ro}޻WAn4V|s/2uZb ɨҗ5Y0uy] sqr Zgd J`j𮇸MwCA;ɑ O2C- 0LjI-q?sIsMI5'H!)FeYA $qi1K Gr, dnaHݭk,[WZ-?0҇`2sbbLRw&^bqك{k`&pe\>ԑc\U뵇^4#PWAf4XܙADZo}psK ШMҔ!wCnD~~UY;dxI)qF`5<~/o*|4gӇU~+O|urpy#a 8uի?o]diiV.-Y]@֦ gR?Q<4_"LSS ZfH[\#}oEFURyk֥ jfŠ_%#H]B*D 2ך] z,S{1\,K YҎooO<;Z!U6Ƀ[k}ʢ65W Heӥm QV@dL@aPy_ aݺϺZvB6iкOl=oYzgǐgD1E$Yo]v]kHEM(*w u`\ޙQ8eNZ_:nH S!k8>hV(&t7S,r`>'Ww^Sk73j}iԺ*QBEؓl%y`24aPؕ@ڏ@u|}x?=@xѺt,՚JEFI6 G@!߫P9yt}&㎥Ok4{ET(d\EC=U (>Ω`!=Jkk|(~pqYQ Pq;b!6jAfhgUyqو]&UD!WmX_\3 sHF0Ƨ6ǙWY Js(ɷ kQա?..ho'ZCYQIN2C>Ӿ+5G*$5Ҷ]Y7fz9vjd%"wdQj;6p<{ (FW=~Z^{|&UEWD UjPAZfԗW\rJV!%Mh.CYNASR)DhcACSw3OG0 9ڧS_:\zF1dvGg}mm NtuZ6_hZdUbFހǦ=1k3QC:$!0Gtnk@1j{ έfε#8ƮAz  #ypu!Wiխh.nOѨLe3@*')? 3 JHWFqtF5Z/Z\ ݡU5vkBMFR)|ZDq\l̶}Bu"O`}|ǹ"Z#t8}VGHHɬXM`d"a"pPsEllmA{7Smaa3/Yv4>yY^bMwzP`ĠHԼaKCNa)|]%Mp'<Ar QC14N#"Ue$C>ϖ+3^āUPJgU-keI$>}c|g=q\˙JDW%fز22+΁\N0b_7Q4eg,l3n}r$S==r2ŒRI!QC Un` w8?R:*B?Ju-zdN۳pUŅI4ıV<]l$\A~C[gZa dCuo ZfFa0,C`y8y@ƂW` ?H`t PBH@sk໑GXy6*FJY 75ZK%O])PB][_XsqUq_iHO,Baoet]M#7UjbPdPa {27X'y,i;!%6lJ)&"L-!\G%Vehff̴hH⢢^r`#X104#hBWcS(.0i` E_./"?#9 Nhu[7P SB DC|ZO] eujMM)0v*3CoulztI8e #e. kqhn@7j6@0z+wڅ&gIY i8Y?+PpAκTȵ 'OɯGQ-4֏QM cS[\M28Ex_$!˭gCAg1_ϼn޺r:"T[W€fR[0L%o=6Z LAʡ廤mFqsPkxt{&uAj1l~rju} DМrukA{%VVqЅG (˔d/j՜ĩD-HXoY<tyu :N> ??qaUY5gd:%m>H/$׸oZ_""FtJx%bN x!wf]'[pe_3# Уʁ&ÝQf'!՘x7޺igR^m/wCFsN{ z+XK]JP*!=i5_Rh9GOl'EGB+-[ٝJAֈEԂe{Wlۺ{z;k8m /И>cAcwֺ_H$GP.Cc]/qm^Db[h}吋wa>Ϛ{S,/_г#Si؃sƐUHTK׵3W;f9n! s(9h4V$"7c^ҮYo3ԧ':ӅQ|*5_Cqz7%: Nu- BT  Gch_3jkZ_bߋFg߾u*릫l>:M?ܖ MGE*بpHMh WkJAa{RנhoaG*Tgt-:Rh~TrjNacIc>s͜'"(hT @3Dp;%MqyLXe v-f Z}&\1o$!X"z~q 3Ŧ1q<31$y?q\àԯ*ţW^D |L2Ypwe1|c?1ϖ O0LV5?>[%HG- bH:<8?!%LM|LkY i]BM+8m*8W '\S &\mR}g;O/p2%Յqu k3[d/a4+V 0`),U횝Ho׀`=ɺꦛ I.M9xG'~So]J#BtR(SH`V_鶻p, bq~w ۷KKA9hX/DexY6 ~88ʰӝAT 좱?K吚ɤ )u. hG8{q l=7'@ٟetހTZn , ǝ3Ah~{kn`3돹i=Ra3ud|aoJ?9?.k}k{#wC!gi 'v,!̲ث)Χ)Οy&!-~ TNˢ 'dZyLIddzQVwi"LOkiɺh[9F&*x>G.; 1.4:Ax M"ѫ邪~p O^TN#5I2 3ks\ϻ $}CaDdN GFK!\~G#ܮFNҺ |:Sq9rknp%2?k |xxJ{|_NN&L\N%;RZ #6:Vu DҾ0aa!PԢ5RW3E3?+!;&SdGpom;)֦I [0E@1"/q LR9k/ .4#4?zG[l YӪI =|v#HǓ^e%6[0$^=50RP*jl5kr;8. h5H=MYE˵y%Bk}xPTTnřԃ[ kdֵp5#`PP-7JT'4/8\C~ۄK{*1fJ5ۢVfRr^kxxMApAESoLύqZhX%ļΩ"~^ `/ QRfJY6G<[1!SmE@Sމ=0h]%$:hz96"f 9zɛ8w}{w`͗!m@ {L1g[FDNs\"k,Cf!#;h}r$cCDS "uM~p+cM%h\>3.u:AOOpқ?>3tfllol.‡X}x1t:ghf(8g qWEc6ߺj4{}LjZo|@B2PSfO.a E[N|4PJ= i/v> w?MoSC]ϦiqUOv[7eae{ :hA .(hV*)*w?j0SھޏBHXa剭f.moKuĺm}{BTГ[v`qT 9oC4ij'#<̗mgdYag& -8UKC2Q }J]$k[@Ay"t#(=SNsb7Dq lf. =yK{U:Mɴ* x;=mAQBEb`s9z7'%.k# }ryNU:)!9b4>\cWb YӖd\ȨH$B[WL*/AN3HtvAPQYSBsܺsKX|/k 1pHIZ`RnΗ'Dz{syn:V~alQLuu7߸4?]C0ψ%g^pO?"n›KZV޸6IƔ Tn%;m26 \*p7-m9^QǕ \5CF  .7w4&[C0 R!yVss76%  =>Df^@W:w=mdZBX*aU#/}}oO;f(TEtB]@@"$1O,AS<\usjʌO-) OϨ JZC)5@@ބڃ!պ^ 9b7XB`}vY}5coݼnhӼ53{ vq rO}l4Y-1.T82 WxTpM!{#reIUk2@9,X%֥vc\ڽUc\ ͟~an8JTR\c:A+(k]b*dD#ɨݥ#`]鶷KZcgjl霞Dp˜8@Zeus;[G,589sG_3"Rj1R4BOߓ3iЏWH2E@}gq@C l<gd #SIgf)(_L\IXn+0ʆxElפ\$U(7n z2q_OÐ%?9n_GJ:e~Ӻ&D׏,.rȝW:HhSf7wj/?D 8qCo Wjy8j,)kݎ$Ni8CBBD 늏L"ei~h76`m~'x)h*2ei <YC kvg )fG̣yw3\jXe%9~-ӣDGfv "HeS.nW룦WGhnKrC}vQ{64niZ)ΰ0#X/rv>i,jnC41sb[K&ܼZ_^mٗ2_/oO?iɱ5Ua96QTPr׻\"exԝ>6#RA=pKOHÛ s 61V8\%)_6`171(ʱY,~i?m/-L*R]Do3Jg>*o컻zj:MS١6Ileoc=LlVg@zw }U&lO 7 1>Ij7ITgpCڋ+4<Io d!DXZ8C:6kTg/3 ka\QO@CeX6TGA m55sAѨ$@ɔЃ殩-Y(lOL>SCD OYXx0m\Ƹh|Oڍ"EIY[vuu|M{e}&^a'i̮r =2"p_>vkInݧ~EW*')1:A'(1qQxAsDZjol[J(it ns.}\AgXcͶ5s64FT4DP#[M*%f<3IYyBN25>b}qJ{E{* Uϧag2kЖΉ-.%Smx8xNrG!j,GEmrkɍ7B4zyNZ:ڽYg +hzC=Bk#3{{NE$vpn+#>J3=A.p""&+^3$Q5c?k]8޹ pKO;~w5N.h}zfk-, ɀZ`A`wkdS`*ΣܻEn_2hBz t!Z޺)m5<8%2'٧m"n_Դ nSR4QJvG/ISMhWarLƯT }2,~TҡygGZ]/dv)/`᳄Q`BPejGx8₨Cمv{< J ^1h A-|II% bq4aJֽ+`]L]Q ֥,Mh$-JCyگxdk಻a+4fln}k({^ - 7C'h臵SpHY!L} @@_p0pm0(k8WyCD{%)m]sݵ<"m0Pz5DdR2&=Ӗw0pPeh%k8 kXߠN (`oB&{&=AFNj}mȪ?v!B2"nU 3L$S"vAMP<.-OŌ0x6+Oϓy^uNO#PP{Ǡ~]yXz&qoEz=؛i&À$JF ΋TƓOVҫ~[*}$riLQwSl@2J ^.h.P}r}0r4}_}zB)^=p=_= gCCS& ʾ JdCi%g7`}pl]ILN'%N-G3Fr{+h?ꎎuV 5D9BBfH%:I'Nql ЕҮ$H}6z^ 6APH鶵 m@vROd j%+f}mrl"ǘ3⢙6fi!Vp~ HBPKU&m衾v"VU x /b*!Yq375VVzv]*i-K)N{څZK1y52N4!S%fB\4F;ۿӍbs$N'U H ͉"[h{ O<dԏ?e; U7q @aE 1g ۫{3 }Ci UyYۤDHq;$a2/ByqpZ,=u?*"3crsPsQ"[BgDx̴M}P4F.ocrGX"(I0'մÌ?= ]Csv67?pfR[.*Ѷqwex/=#O0{w>=M5 !UߐFuiyAx]9g 5&&\LJک$e(Hay\FRjCr-{H8#vo߹yݪpfiwrM/i݈dbX{^jR,¶R0t9[+<.n񍺀e9Tm/{fj}i6ܑC2b>`|쮍HFҁ+8;zG" ӔMW@n?X^>V1B$B@=y[6R4- f,~`j6Ҿ8%wBL>EkLL Ͷ7c4#Œ ~UedE.Uܩ/ZHZ-Zp80`D4G;nUaXx*PI ;^w\XCSN 3Sͱ5 ~pp.SSٕ /r97gyo|$# pQ p qv}i5ӟF@KZ1_[!^+O1>ˑWڕBe"s%֒X?"ц7§c04SrCS_/fQYdeXXf Q##Z}8:;.r7ߺ dфjUɡ*fDOp-,sG  .$ lJxr֓a4VVsJiΜhJ f&n[DVKg\JaMXv Q.O›H6^cӴ3\V~mYUw+aӂ."+>s̨:m|QsiOǸUyhVg fϮ;+UhB6eLIk(LO7S%8g|-HtYG4ϖ&f"(#4=d6344g58OU+U - cК9z,mueot$Q2ca #Hf6f`0wdv~|2hhVc]W56*wp.-Hϐi853:,WGtSڑlbRM=\Am\%n=Bg4ڧ(Ey਺HVBt E ks/IN{닋kݯx%'yÝo'1~]dbP*Y}Q T6\EMv/_GBp2^Gl3Anxu3d}aT@pnv3.p'r&ŗ@oKIy)!18R Ha`.G\1o)"$'&كg_UX8p0yLT{hPOeBa 7dn+ѶhǾZ-sʟq'W ?K ;yqcWE`tʃ) RXnb:aMAɺ]. Q+/IX'ХH}gAhQ]7 ZʺsOF~?;\\aHED 2g4W>w֗{\krsjZ05 dH4sNx;cp=H Φu8i@9o kT ߨ\A!J4Pte^6CҺWA?B8//w)Op1`.P(`+ks}x7S Fj=< R^HdvкӏzdZ<l狛C=588{O >aHWO2*2PLnē4fXʹF6*'~+&̀棹FubpqԀH,2$_փ-d`E aӒC,DiPΡEl5@ ܆}߀(>!ڹڱ).Tz4 ej\[)  zr:Dx1ZuǻO^ %i2'ex%${%puoz/yO^C|P{^:eamx;,SkVRKXR"5׭?O7߇Y-;gܕeFʻT-vށ= |e"7O;fX8R+uSp$aEA=R!y)Šs.ŹZ$ZdZo*HeCyNzZiߢeĺӹDL6o Ѽ[1 ́mPC --2ĀFs9gGK3j-d.-@]LU#+,*E,oQl*Xu})bfk)y/+\c>|1i!rvK *00?_Qߤ"q!^8).R7zla˦NBDzy^ kEP:)Lu l!jS3f=.ۗۙ[Aj: fz;ݲ0cΧ8m, [0(\Y2s*!iF7Ɇ cχe $T'3^؏era[5 =k >GGϖ^,HQ;#]"s"[ {9`=w B!Õ{1Uvzkf]|Ukti37_`kFyXm-o#=>m.7KHq1'/>dR2I}ro6;uG3vFaemnZŌ'x>K :2H.z:x+㇌"1mMq$[^LF%]n6o~{C N̏y(9:02KژSqd'22m6W Jep|̩rD{Ĩ&TzӰh%v4cTByz1JU xDknm*s?.c J1|`4FY# ځ*%G<*"bNv;1n =: ym :9gsʃ0lΥKT9ͤzJ!iRmN>L-AO"ٻe݅k3t@Y9p۵]-sQme{#[ Sn|p A9cs+a1w AB=`o\+/iq!$о~Т%NAj?L+*2\zj)6n _WPӵUh0ZP\Bz|jm0&!Im'~AA.<EW~ H*aB]͝'AmvF#|ɻk5 .XE(o]{5'tCp\)$,( EtaL0Qfm*gj4V kpZ0 u|p[ږH.u ʡ\R+̄[?({QAq!+K  vx-Izq1k<΂t'JGԎd|P>/K゘Nt1JRg"ta{˵w`&m='%)T&I,gtI&flk< }pBm]nL2[R-Ȇů@V`lޯBM-:'WqTyzt[`F Jvvo!d~NK2{z!@aX endstream endobj 80 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXC#2BFzBookMaker22DlFont220536871544 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 81 0 R >> endobj 78 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXC#2BFzBookMaker22DlFont220536871544 /FirstChar 40 /LastChar 212 /Widths [ 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 1000 0 0 0 0 0 1000 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 1000 0 0 0 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 ] /Encoding 79 0 R /FontDescriptor 80 0 R >> endobj 84 0 obj << /Type /Encoding /Differences [ 33 /G21 36 /G24 38 /G26 39 /G27 ] >> endobj 87 0 obj 502 endobj 86 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 502 >> stream xcd`af`df``d`P urpvrMN-pq+005607451)!C,S7ӏK> endobj 83 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXD#2BFzBookMaker8DlFont80536871545 /FirstChar 33 /LastChar 39 /Widths [ 500 0 0 500 0 500 500 ] /Encoding 84 0 R /FontDescriptor 85 0 R >> endobj 89 0 obj << /Type /Encoding /Differences [ 43 /G2B 45 /G2D 46 /G2E 47 /G2F 49 /G31 52 /G34 57 /G39 66 /G42 87 /G57 89 /G59 93 /G5D 96 /G60 97 /G61 107 /G6B 117 /G75 120 /G78 126 /G7E 128 /G80 152 /G98 155 /G9B 157 /G9D 159 /G9F 162 /GA2 175 /GAF 176 /GB0 184 /GB8 189 /GBD 203 /GCB 222 /GDE 244 /GF4 ] >> endobj 92 0 obj 11390 endobj 91 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 11390 >> stream xm{{|噮LI¦-gY )K\4Ę8q8v(%˒FьfiF34x,Y"ǎpqH@ʭ)fI,a{iv~sQqq,i>hp\GW-o|UZ޳}K]cK^vK˗7~k>^Kɂy -\4oEou| {c߰+n׷]؋^p\p\p,r8XpUqvޕ6oišnJS|?:HCAh RܐjP jC!۠5 zH0Ph(65 {* E 4_qك;}o;9q8z5+ƱߛuG78nGǭ6p, pŅ=!iqh{0+Ӑ8 RK>4ǖE`)X'GkCl-5\x! "R" Tidmr3H.M=s@$!CYeb 4aiXE@a#8wdE}.ϲw9'焌R8'g-{*<4x#Kq*p4G>w]b%V|Tz n.=̈́@ ;B01}r}׷NKA!(q)p񰂺@'c]{ 1\+I 8@x">&j Uj慵>}~P~3ZgZ}5(uIƽ>;78oJQ1D\D@F7[Ӻ[/C) (d$S)yه4o"7ʂeeOBJ/p~Bae˙ȪXکI B6D) gSQ&'cT#22+>: b9|5KsGcwқntIpcF݆y6;N`4<= kmJo7ٜHB/֥kuZ|dt$m >z|"˭Kqօ80E#r0B@ JkMJKNsg{=3#oN2R0Fžc-/Z?164WZq'($M&v=OF@G{N@#&] tޞsM0D7EY=Uy'uXc-n.y \0%!p";?0 L<$2z7߄kk"bF5t=F hk@אǥcH" %(`` 'X[gZ DTP7;M<|D] 4kpc.Rb1% ۚ/O*etEslN‹S$ Q@#7pl4WCq BsYlS|?p7Ȼ|>5^\Cݜ&HX\\JmsE,H%=B_yǎ|,9;1z6iޖxI ~s+SEKX' OhuD6'BVx+3OUXDW of3eP+V -8Ƞ%q[WbM+a[cwoΈ|r/$] QA3ޝ2Cꩌ3C!WD ኳn]􎷀Ĉݢ9/qCokT:< s9tulyM}<˃ӿ=bUwg4%B (T_Y̦ȶ@7 o҄-ݏ]!^$q ^$ `6t(OG9| Q)l䠄[J ,~Gb>޲G1.Q@XlOЯ`ymC<9 %c<7J?yq|WczT,ۯ!4ON 1>g6KbnQ0Z;&IV8`'%c}yڑQW8 kF<~[C;!p\C+әhb !JTAK2|\"p0PRTm$׽{Nޓ R "'m3PW %YUYmTLBM|#ʵV ~;Y14* 5 Ov+t6 NbPnL[_:JN/?\9c7ʗ]F=Wn=c(FOgAEIEimkebɕ]Ilpj#>(ML>`evj}+ Yᝉ#H3fp],6'MyKDsP=R;iߺ$͝*EIR>_;GrӒj^QE 3P'8҈_A ]:pj w[.ƀ. ۻ^NNm͉xp?q"Ćщ[h e `_ ʣ.ħRyEeO~**M_'!bWXu$3A Mrq޿ؔNf ̼(ӄ0OM-t,C +#M(B w&h/R eH n_]!XW`8ty0"QE1Gnб#III!i1f^;d?:? e_@MŔ# \ Nm^M7] ASRh6S ku ւHiA$ .*{A .Ͻ1m zN#Q-PRSWߨ#pLyq3QFB6_ ͺ+{pB7`=@[WO Gqf}!瀘y^޼lD*+PUKO}@{!B')z4`#t;vM/"4#Rǒ-*]VT&IΨM= B8uA|9 JT"f+ O˘EonWw#b mrZ;uu9]-;``N) @S@t6jM7vQO ;o_ї%pUBtɎAGGY[WEe'[kh>j4gfDdƺׇKB#fnҗ^(Pn4Iq`pXy-o^ G/ȱc" CHft.~UZ(X-qsfjW ^؋T+pSZMl[í,m@BY(e*A# %N;-~ɘ-?kz Hm,ϒŸah2|m'ÂߊLņQ5ϧfT!ɟ/^NR<?QYnNUvv1<3 [!>zGպcr":d)0pvf|W,w6d50NFjN/k0K"iv^PDW0s!W.($e@XR Z+R^/n3:Q FO6Z þ`(>@Vf 1S_ɼDD 'QC˴K4 NF4GU(c5q:(bLNG|,(3"ZxS};^y^2p\lǻbLC2/:|TkcAvT*^ 9LIRgoY}rX 3s3O'aRs<#'nX:F J:gyF8]ޭ<@0@G"7<$2P<: 4x4Qpf,a^iE6=4˽CC1$i./!h\{|K:˷g`/+YΒh +gᗟ([kt#e^CG>)_ذfJoX-B{O`p4{6P(g~[%| a3H0΍,zI$db KBq/ :Bz3i :BOW S~=^GT'Uĕ.=ֳt*USr \GtjכlE, _|(Xc=\45Sk s#Y"T^9 ֦QMy{QH̖dãnl O}>FZBbn*n؞Y`tQ}Dp+Zm s5>4B]7kAu;" #D/Tb;䓨'94Jֲ&k7.tL ̿ʜ:y/'K hrr>_44Ը1QE rOAcwˮY?f8Y}s&1%O .;Q3ɟO䠪ԀӅ +K?h}opH In$I4_&NII̱65|9 %.*Xhk@Clmn 8OPVF푟1~[25z dH̅(O{N句kh۹`oo37]u%G}xb=mb_䣓!(*.0|eZ)"/૛&O}p1xJ8֫H;z*w@K | cr{Ag8g`賋#ЌX׸KKAWHG̫'Ǡ&(@<8mA jN4!=M*N4641|ymֳ yhOwDц5md +M}aRG)W889F%Q+cZzvPNwcgڐ6Dc,Jsic\h]kI*Hɀ&N^q, mcvE!"`<0ȃn?s/YJ}x4Qn0j1~;H`3vK.Ue @@M0ju mw4'o[= Ͱ`^0:FYa % XZ[΅VYy^O|D)jcQ+|M¿ i /WUΒ+@>*^ͦ0 |*v7O"!1fvz7 WAۗ8,qi\FnKuD"OIgv=ٛ1"\'vA5Q!sz}A;G;ϵj4Eu BI/NHnK3њʼna4ƄV:xbޭ|_JFh"$3J(c~S9 T*Ȫ<ՙ;>ߏ4a21(xy5a>*k'kȹ^K%&"vJٜq rO;pdK}yEY@yJDI`9*Wn}O0=_I8Dj` ܅]. nH'݇$TQT5\3r49meJF>! DTc-9?땥-}Ze^y<*gӈ?ۋ]8mYgͷߓ5,pSP~8? dN3i!+ Rq_ ;hZAVRl.9~{p8ξ(<*!8Us0U:xk0|V@]HiC/b([T$Y)S=v4'yv=t?Z*5ۊ=+V+bTnou_"2(z?װ4uYOwZmg͛G:"-͵Xgz쇪4v\ W mSfCVrD^ A>&ۇ PdpnRiqJՎgM}wz)ɯBDB٭8bFl,vQmI^.I/Q R"GZQ7JBj VG1XN\oM`y>o~W}7'2BeZ%WuIlJ. nn \wYnxBAV , ].:'#i|8NE=^05`LCFxA_gts\21!FEn=/OoDZ?hro,bJр#ϟ<0B *C H!eQɩ\?'9 I,>4I)2i#Qb6D8q4sdeO9 4A!8gvkiKi}\@E3\ +ǒ!PM)YĿ_u ]Op µrh ,=4F%Jr6Vzc}zE3Z]B9KDΈ#a|̆ tudU>(3Mj``(ћmŜyAhկRFdJ$X ̆g*ƺ ᆫ>uHnwљP*du,^ ;+&dޱ[952S!Bzc?ފ\WS/se(t$gE>TSg (}֡`Th R fπ{f% XXk.+`}QL1Ҹ5X9-˽`n^gWڿ=F>|})vӅ1Quƾ3*ksY4B~>GTOvW27 Ym=H! jNܺNrבGo-d2m]R0сlbcpqR;m^i1}"]R2.G:(h6MŢ9PH z#.|xs=/SՖmp<{6~} 2I;1\@B/C?Xfn(t?rY_+ZC:|OͿ+A 0ฺWFOa>jmhYHFI f֍|JD)D^?E&LsEVB FBh76SD%|)5A݆F#c+υVwGI8 ,HVi{h0AM}ƿ#/;3ԻX7;UߨRc}:Vwx^%`xbDң^eƷQy?N)}08!{g`Lcd)o7ǍF3ڬ6TyW8})z.a쳠a'P;RddpCRZ*.Jeޔ}Ma)|"W+vS!nw{TxDi>xd"uȷjAxơu kBìMk_:-px ~{+oߚ1%zHȠ[]5-f]Ry<ݣ݀;*"ӓ/CViJb$ѾmԿI?tl_;wY/xCY".i~  \ƕ٧*7 u[mh3"ҩTNc@h/Cdۇ~%paxx3ۃ,,z&<WJ)1Du!7Zg{iEC'Ew-e-kڋCЫy~10V@r[A%bnO~gZ3$$𔫴UQ {B{vl܊=o4}`fjㅢ:4Qz{G=y̡_YR Om>\+>MS@'_PVߦ_`TB}ا_7l}=!d0"hzZd0¥x,IҩY &F!K\Y}K N O)>a쳝P+4 ]LS:ޘ rJšAw>1=V[G46?l:W bKXd7:_\$+t[W]^1βO`z֯v^;4CU?R g2?޵/iߩE2 T^9w LY+~whfJ-@p5BX1ıvkY kɵ$لr_cQ"b"Ą8R/v1hk)t$4(k}XMNo9F> ~k/_ 7ĂX=5nM}o4<IqOqw]26`IZm"}X>5_ G|.Zal8~DpwEh5.vI^p|:ZÄka2Ln7JS`^?Sv rV\F _DS4 0 endstream endobj 90 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXE#2BFzBookMaker13DlFont130536871546 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 91 0 R >> endobj 88 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXE#2BFzBookMaker13DlFont130536871546 /FirstChar 43 /LastChar 244 /Widths [ 1000 0 1000 1000 1000 0 1000 0 0 1000 0 0 0 0 1000 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 1000 0 0 0 1000 0 0 1000 1000 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 1000 0 0 1000 0 0 0 0 0 1000 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 1000 0 1000 0 1000 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 0 0 0 0 0 0 0 1000 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 ] /Encoding 89 0 R /FontDescriptor 90 0 R >> endobj 93 0 obj << /Type /ExtGState /SM 0.015625 /OP false /op false /OPM 1 >> endobj 95 0 obj 1693 endobj 94 0 obj << /Type /XObject /Subtype /Image /Name /Im1 /Width 236 /Height 236 /BitsPerComponent 8 /ColorSpace /DeviceGray /Decode [ 0 1 ] /Filter /DCTDecode /Length 1693 >> stream JFIFC     "#()%$%%!'+,,-/4443.4444444444   [!1AQa"q2B#R3br$4CS%DT5cs& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjz ?I$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֥_E/)ăEK$._ w5R"H?]MAkH_E/)ăEK$._ w5R"H?]MAkH_E/)ăEK$._ w5R"H?]MAkH_E/)ăEK$._ w5Vowoz<3C endstream endobj 2 0 obj << /ProcSet [ /PDF /Text /ImageB ] /Font << /F5 3 0 R /F9 8 0 R /F13 13 0 R /F582 18 0 R /F583 23 0 R /F584 28 0 R /F585 33 0 R /F586 38 0 R /F587 43 0 R /F588 48 0 R /F589 53 0 R /F590 58 0 R /F591 63 0 R /F592 68 0 R /F593 73 0 R /F594 78 0 R /F595 83 0 R /F596 88 0 R >> /ExtGState << /GS1 93 0 R >> /XObject << /Im1 94 0 R >> >> endobj 97 0 obj 9826 endobj 96 0 obj << /Length 9826 /Filter [ /FlateDecode ] >> stream x]nGU 7Ϟ)ﶇJT`+DD@ŏD3Ԙx ( E@AQQzcHh g?3y^̻5k֬Y֬yYwgbgbwӻ>rͧm{w3.P[ovV] tN;XDŽ܈kg/y n#zu;4ZI'UOB۝Sdz,:";ei#c]N;m$;Ǵ֔Vm{${-SY#,s{ȄT g1S:4vȲӦ*تگi+! 2`ob "\3[NwJӅx_%61(;˭QP|eΪވSIyJMgԎNIv0@tT:'tFa)BurݟnTZes}T]/tJ{/|>}7ۓZ.N8;lsPeSC)?ѽ4D@69Cm$RHJ6=oCl<3m&HFIC$儜hI)E6>`;߇ߥp٤qt(iyF&hd%y9. q0tK1BOsN|n6|wٻΔ;-<;=Pnc42~z8)ƦsGڒ3&\`FEDžbqYa7$,[kG>{GFH/ͱ4t0`{(ڣ)ZKxz.Y;El43?'?Fڇ3]tM8#c^s:B03(f1R&5z}!ayVV 8tR"،WRv}|лuƻ&Ƥ'!3C!GEVtӜ<<)<[J*Qcl!MgaSDc9 sel=Z ?2&'T겏X/79949eCm5^} cwHDPr*RNFHy cF,$dN2^p&B4'w3I%Esyog3U\){(_ny0dx⏓R}b!+}|>〗]J1c㢟=v|VJI% K6b2܃Ֆ{E9 ]NTa\@J.QYd &ž_&QC0a.) \Aqvɋxt t ꤜBٹ>CR :`}t'@] PD4.teֲ:P(@Sk+J:RaBjhFL]}@f2~Դ0B mdgQi.]+]j+d>/KQ;y͂3ˠ44(F!"dfr}n\ _Ԙ˦m"ؘ1O46;PqHؘ1ӮJt[ w4/ qXNisCiLMP):VjKOzLسQ Fx!z%!{A[M3g\tA 2kcO9V B.`K'/5,XwT#n\/0#<W@H~;5wMmUEg2=zz~|wj'3ԍ'QĖf;23;d ~`ѩ#볏ҹ>d2rRPiL%Q Ε6:%P0 0 `N@vЂ¤z[a*` ;6iiA-ʅ6|4CUK'pE[xm{H)>r=%J=@Z@L jIC3kM+Lɞ^bbڸ!TX.rO8 )ePZV XS؆]B[&toEa=w}|]X؁O$:A?'5a(ygM}i6BiOzd?g'#y]T&UmSQcwL}lm&MD3煁\mY]ߋpc|TǩE% GnNSsNqNio֩1HSO3XkAmդj ~='=ϊ&<탪! ھ)tz/;G#Wj7 . l|)TPSɼjr) Dh _jaɖL 'sN %EE| wh IQHkҽ:+-(&J6D\H$Apeh@6-q#$ VT5Ly.L)4xqGt/|w@Wo;&ZT؛N}:U$en8VN-K-i;W;OH6 PyJ:Y7x]F/>q6VmJh-] JoS3LkﮯУ|UGJz{cF`Y;\Z0hb6SRȏFeIXCdm r‰&٪]WGu%!2:tˠZzzcFt*A:J>oD*|}cs^RNdIuKIoPY PLmurP̜ 9[Ece׌'6F)1w'Tj{yC(oşxq1&<߀o\(S $K 5s/ d`F~T/.;м"b5gyD""_}߽*,lKIX?,LM :<$arDol ;u(?y 2 8&5pS[6GWg؁9oN&ϧ[xCϴ. H3.&xTأton:׻J\clFЏn0Y3CiIbxP hS_NdR=Be!͗Uw!٤f$? I@ghY(vahԤ75h{+-PG'<03|c8B3>IR96y%ۧ[cSt[bp[b l:Q ^ X' }FE `vV`E'mтe:y|_˸=  Ih>R>CVRhktU@[I7< 5tU4 N,B2JHƩ_lSqRF-Ӷ@W[J}񟶀L6`e4xر dz8?Y?M s3xt"7¦tu @|7_k?gLsk.1NPNx2ߍ)m▔gƽOy4/(`Ly$ LR*UІ6 ?m2ŕ$( )C–B$+=ϻi͇MaU E5_hax1lC ftz_w ch5Vx0]ͯlc) i063!df§G!< ze˼)˼l}F97ha-<>XnAdaERK9>05KN>g\8gAs-ÙjjF/>iB%EN|3dlp[_ R~{JA!l͸iϩxn6h̻igjgY/-X pvݔ~6^Z*"6 ̩޴7 ߾85뺩fM=\$™IÎ%dƀ&Sے Qd$[|:SMS>' >ƪJїZd!gv9uχv]-g>!HK7n!K}@@Ms±N֕Z`-64hk)mwboVز7RppO :[Fo[)9tWZd!"%CT} in\nd<"sDpŏ6Ԙѵe)_Sǯ t! iU29.p|3cI^~6m4LUp^.7wpӒF`}FXGJf4?R?> 6e̡3sQ Q⹬R41ߵOvϜEg0<-g0b7Tm\h~ @?;VKJ%խ&g-'y[g{EDzˆomq-Ix28*$E2ђ" W!ТF Ag4- ]y =j 6 T~O4d6SgyȬxODf$%f4Rhs&3#)u褽LwdLn{񺻜o|7T%5rON[ɏ4L۾Z]ƐZ&\ 9uBS|X0j cz7:3/ӌ+ jK7n"7o4lD=A@[Kr×2 0&Lڢ[n׏%W)={l`Ug !(/JӋg?ӻM½(9WiA>4m[,p]j;t6QRO7EjO$' 0wc|'A$M4'6ի+/H- +Py4;t7 JLBҊX-5Hp?Z*(V.3F~f½`v?η\SWDB || 1ۃ֓Рϥtn>r>۠OgےMhӚvLŸ /RN]vgiSWJ \ rYũfgMJUзǠ_Ѱ6Fn= y$ݜt(+HS չ$%ϐAbd<Vy͊erøT)ܽ.ZXtr33ym#GN쵀}g#w3ƺlkq@E?~b  g.1tP XCn P3zȟ-t !JSǑS*_#%)_pkfX;252΅> Q(HWJv]< <tɱ`r(}3piӇ>x]euhX+dot$,Z/^z$&Edb~>io%Z5 deK ӁoG 3Ȭu,枈3.%bZ!,= u=:̔C$ ن5[U][b!RsqHP1u4h4]Ug˟es!FtUR-A[=Q{\wfKfxvR,2ߘNʄXIbH5HFB& ?Bںz$դ8afJ)ae@1$RH|* y컸 ofhK P5 sGh7Ϧ`oіdrȭ6M)yHjw}pcj `)XKk Rn(]ʌ_W2nvPjaݎKTYEq|;1'x^BRLz'vgmHClp6(EGM[ך(6+"L/R8q GVG|3nhhH|軔<iBmu ) TäIM 3vq">q<6X{2=rvX5C8UPix_nNCby|}& 9D.Ґ ͥofow.Kj,%VA%MwH!Px.-fg&O wKByJ+SP,-( ddU^KL >J\rLŴ4 {rh2@:"Q0-k$ĕG 8IoiCuZțmP`tņX\>9@Zΰ֖X0^~Cr pmN z ڶ^ Ih%N]JJf_aݾ>+a4ti}N^)& Ybs!XR hͬ%$Ўw&} D۽^n@{gKpcTQb<h C a=WH l(XU̸݀k @,ps!=wܪ!:lo8~ ._$)k% L+}ΌV ptŀYrrSJpT< /![( %:^}Lq0hf}%Q245l9Bt5;{)IJ;Mn /B_"͟5Y.@4ՅRRU0ÈtG%3hlvXE%ߏ⑭so65po|}kWOtqPa*LVPIZ)xa0Ӣ/қ.`f,36y-vNŌnr)[C[3Y)lEؐEAyA ]<>R8?(QPQZahȧ#,.z.lmKAj{n^J@e'qnqkB-0R_/h0[zCZ0Z ް1]@Lt 5pz6a9'F.pK|\O޺ P8T>ϋn!יH?ၹ#NK˺@zmV:B'yaVǃ;6Z;Qę69vlEF,Ydg-;LlG<:v6RB\ER1.Y1 mٍUJb z#~r+@%ۇA+k5;o\̧PuOzۧUU7@ա:M.D")N((S Sɶu&`?~ey 歜斋ޏu`uB5Ydz ,և"/bNұڰ0SVK"6Qp[LV%4XoY- N;jCzY^21BP1. d4~z >P6$_@4+?S=89'Bx n~xUMVjie9ޯO ~H맫SZTRS:6FChǹt_)-=9\8~iVxǸ MSؤUri iz49Gzx36_FfDea" 4?_oNxKG,Ǟkd~.QTCZ㗬mj7hU3Z'5ۜu\(AʲI:A3ٛfI"!+GgE.ㅨGC @Xm0턱wL/Dc8gҿ0ok >p0uGV8Q$!xZH-_P׳X2($1#XjRv *9WTX/$Udԕ!pz#y+ c /N1{76=769myt-{rOn~w>[wq;O H{layQmY endstream endobj 1 0 obj << /Type /Page /MediaBox [ 0 0 501.333 763.151 ] /Parent 98 0 R /Resources 2 0 R /Contents [ 96 0 R ] /Rotate 360 >> endobj 102 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 45 /G2D 46 /G2E 47 /G2F 48 /G30 49 /G31 50 /G32 51 /G33 52 /G34 53 /G35 54 /G36 55 /G37 56 /G38 57 /G39 58 /G3A 59 /G3B 60 /G3C 61 /G3D 62 /G3E 63 /G3F 64 /G40 65 /G41 66 /G42 67 /G43 68 /G44 69 /G45 70 /G46 71 /G47 72 /G48 73 /G49 74 /G4A 75 /G4B 76 /G4C 77 /G4D 78 /G4E 79 /G4F 80 /G50 81 /G51 82 /G52 83 /G53 84 /G54 85 /G55 86 /G56 87 /G57 88 /G58 89 /G59 90 /G5A 91 /G5B 92 /G5C 93 /G5D ] >> endobj 105 0 obj 7576 endobj 104 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 7576 >> stream xz t#'$ IBZΦ n[eI֭-U}U}Xmq_40LIv20ogfgd#Jnrmzoɖ\ t٥Hq)B >gw>M#uOl]1?8鉍?G*6>s ⒍_qiu%믻C+_ Bɏx||O{ns5B t-B#9r [ڎP'B#t'B_C^v" z ڇ3=ACh#GH$B&1"@#D(PB"4PyZAh B B Bo BoɈ)۷+ەNe{6e;ٹC~>e*w);nUvlWv+;:ʎ.emʎە;w(;Svܯةx@cVevegC٩Rvަ]ٹCy>eΝ*;w)nUvmWv+:]ʮ.emʮە];]w(Svݯکz~syW7}[rήnqǝ_kws}|]ʇ#>O~j}x>X+EPRETS ERR"*r(*J*5ŴQ49żbAXRU,+Vc5 uq I)iŋ3/+^QUxMqN:{ VKG%!t1tu貿EMZ@hh>{ϡ CE.+Е+7G*Scc+>EpnFWU>y d=Ρ]}چ>FZBӿ@fC>C1t]kt,  N%[G*=$ oKDT0s ֈ{͌8t0[.5;g`Ky<_L)‹| ›g=JꡣEj-o m}biۚx~v:8C!]躙^prf޾ -R41Evnf{F<|6g_AfdRhɽݰA% >h{ځY8_Ν\B_1J{P38O0OMy0eEo<@gO^PzeQ[:ZX`o0 jRJ(7vqG`FX%UDM,狐+UR\sCr aظCn 7 wԤ5aҤvc`Cq Fx&^o58ZpU]ESL.6Cg€F5m/ӃI"ā GYXs"T"S,~vcneoVhjH{t{tsy3Dr=گS={ m\N7Noڸ˩gnJ<;Zb K#X Zgo[uM'q?Ľa'o0}s:zpzƨ-冔[1r3c[Z`3Zt,x+#8|8RIAXr-H]H7*[R`IM'08[o`0~9S`J# ܸ[ZU95`'XаΆP,n}RzJίAlNDK(8#Aj4-<5$ hXg'9ŧK@NE),,ugEsrl |F|fÄn*M+:mtxAW G@atj~5mYuJtNk'ei#S(^ ʭ7`^Y3;M4#nv\AXJ5便3:-W9.I4 frt?{q&L^ahGcq=4:'Isk"xF,B΋YHgA.EQ %> V PfRzi2h] OU`Ɣ59-lr0N%7GxbD>D6O Qo![d":bUI7+vVFdj|6&Sb"x ڄ\//Aq1$mn Nzw臚9qvMQFtC# 9+`RLuԨfҦ=Q {$$F+,A)K`j9YJ_WeyfCj½!}73ݸPKjz޺!PPL246GlI$7ϑ8sP/a2&cF򑑆LF!Aa}ٻCg f& Fpo |֔sœc[`JKCIL9@ʛoO'ksn٘O b^ a\q `{DAoHL@9^ 9E E1wwtDk?]$jni=6.@5o%1i%V:=3 eJ?U Rܲ0o) NR[@mM2q5<-kRUx[dhk :ɥFlrCegWJڅKncjmx )-?槨ԑyfB:y5czE_Plǵ5Ԇ ҄ʜ!<&ˆ Tz04kA_BS"1r\N &) #u8HI6#>`>Ȉg_j3Ɉ/! gRdf>e hUQK{IJR_/m~b]'<ld?aPez[T& 4-T8 Ҏ &?uF nAQ_߶qmڼG=b2TRB9QZNq sȥr?yDt%#24KUH:H ѶeM7}mpԪa]z>RqBsUE)RJd%DyCԒvBڑ1Tp5Q@R^)510N2:I1_?Q"~ qI :SXbh0, `M BQ@OѰrݢVgͥNeav؀8.` rBTpjrpLL&I؂ ?ny7&\<(&c؂Wd`9B&&bdR> >_ a`q D@1! =Mĵ  Q脌+GփKikSS)1ZOO&KxSAŚvYM7hiƚ9X]b:=kKoo֫VgAԹ*pg+7WI''[~b$Y'j\-5uqPBy*9λSVyɀ' qT'L`O0#$jepUnBd SHUyRRUḘێj0gذt=a|`zj b k*V+j+pBmdiiUKD J$yէԦ~(5OOWWf`~=ι|^fZDdLs[m}IP~ -"$X9^9LwHεBݜ 8r%{Z8qD c`6,IJ-i b`bC a4dta+$rĹ|237 s ~*QC>+f0{i~ԥjI=߳e1ζn;Gftzwzݭf2-m^+QJԷh'm5[e$[soyjJϓ7ycAzy{ _9# )vΖ@v<6Z/{m)<֘`ܤrЍGӆ)0Tsx ]/!^]hԠ15^ H`` 1~dp>OHi> ?ȟ;z&L?v*>W=Ú}OՃև#d׻~hU~ k&!}|bڼniU\A(ʜ iYh'$χ#I88fl:`pHKʶ4}R}xdFCw6ʶ. 1stkc^ϭSAoIbu6Ulͭ[hiBjP?j6HoE oS)Oު~E7w7#7E@h~jr7 @Kio{5c{Xg^&܀rHRylN `0`ŵE F&_UO[p\< B0q #B.܀Lb&[L BX 7jmZjDŽm,z#%_z SǪ@Ωf0gYp/퀗 XNkUҋ:a̔6Z?t C05h4)& OS-5O^JKP/N' b0pĄ Fbb8NДDϳf3G;֢!Lkl*Rg mQ&1b2"x kX w@&2U;ZQy@HĒKI4D6·dȔPOYcl5Bŭ/ߗ8 ӕ*!"٠>~/niJN(X0inv4rF A-Wo[TIL#G"A,`B!EOtVOy~OCFbsd8b3+7F?JUEѢT a| rS91 ^vp}s {TV-$p4[OիPΝ^z"Z`HYN֧&!/;Iׄ5hUO^)~ p&CA,WsCXCA(3j;ò,1MS񗲯A̙ E[~fꐼ:mel`6 viP66z|!blnnɔ#>Ī,1PG]#Pn)v+DI~ߩ[q04ߥwzߢy2jW3JBEdJh>]7 eI.l;Iy&2C`8xmܜwBY0 //ztȾA6`֊ZI` reس~}qF0w Z堮G=#AŻCc@x''[Ѻ,b! I?##0ZFd(E~!&n:!,+fz|: \DtBڠ!a%s,f+ (7 %0E(1!'Zb2N#e"WK,KwQũ s 8CP h2_Knh1 wiZ d+7gC7,]fi>, Pg䃛Z=y(k7 F>CKO^vPnю8IbNO$Ck7jW Kܔ=@Z,1x- dF}n^+Ձn >}xp4x<Ig QGȉ 8 ᘰ^.L3 ħ#58w(4RZHcG endstream endobj 103 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXL#2BFzBookMaker17DlFont17 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 104 0 R >> endobj 101 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXL#2BFzBookMaker17DlFont17 /FirstChar 33 /LastChar 93 /Widths [ 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 499 999 999 999 499 499 999 499 999 999 499 999 499 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 499 999 999 999 999 499 999 999 999 1000 999 999 999 ] /Encoding 102 0 R /FontDescriptor 103 0 R >> endobj 107 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 45 /G2D 46 /G2E 47 /G2F 48 /G30 49 /G31 ] >> endobj 110 0 obj 3082 endobj 109 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 3082 >> stream xmVkpu^X9Q& ;Ԗn:M%*8XEeɒ%YIJCHX. `ě%>Dɔhe[~%u:i;N6 NtwϞ{(P-GƋ'?V>ԯfvؽ=jƣmlbqۃdr7c_vlNwܶUQ\f7~Wf:~E=NQOPS}EQ?=#KQ?)jEӽ=Ot?ӽ=|O =/trO;{vo~xޟ|OwaQD")⊄W"H+DEF!)&o} VJ34z@)(ֿoE}}v1LѣG2,ZL>}&|HE)n\-:%n(5 |91bv1ңhahgG9?[@y`z:[6g\]H c p؄qYJ߄L+(V*S)H)AxB\`;C1zm^ȥ4q8>UuX3{˸xKd 00p( v忴K||Y4ɴhD<8y9W/ ; nSvRƟwRR^[a#\ӞtxpzD37K``9VЉ5CrwuU{ϗߑudWO#j?#yFEkd#Lu6|v".i uUv8=C9[ep?Wz6u6ˠ[gƒWd a/J%~2E+Fˈ3+H\Nߜ*QiN9h=[ustE)B.u r3x 'U ۴L0CΗˎ0Vgg,a9#N%fW^ryo1F+SR\n"y%4,$!+WOK (,P^(4H3,_x[hT:b%Z.KkmNX6!lh.3YΠL Q\" p+mtp:1{ѝg"IX>˳r%#$;)lHVpYĪk҄yV0x  'HOHL$ID&]L"EdG\t8b_٪3]aĩt=1d K'("If5ChU9uB-4Ϭo`zgY:[M0nse {-&o󩱆3k>>neXUYp9:&n dAo }-ĴXɖ-N + A-M>ޔXG9o^+*N(QlYӾ|HqR.xmhU2 hNZ0h1jebQKUU`ʱ'g ez%7_\KsuR'amKJX$()LBHxxB)}\1P̜$x>HALÓ$G# &3LfVcbL 6g(&su+D3-{dlr%#9 L:0:{>kմR0#)S/zu?y6V?ܝYq],: :L5n/K(Kȥ@$"! eR0T!7'.+J/ = ؁ vDwjWQ]T^6emmPs 0߼tmf ҭ IfZ,`ɝ?|>0~ 0ss;WR82kFkߺֽWtg=3j c$bo "--&?P?]2spF29`C?xuc7BOZʩ5gۓo7:;w3 em څiN$eJ]LQcC83>؏_V~j=wo09:Cp!8K3* Չuu澣 wYTrP{ʗOtoVRM1 Y$<~~f! D]̥lzp; <}iW)!Zs[f?CiW6?i<֮\~7Hԣ5v l9PbJrx0f*\V+=6l8L\c!&ȒG#pV# w)$pe_C|NML04듹xB= )Q8_$= Dr`+Hgn%Df2CFcm.C%HҜCU:Nѧ¹/zsU!SΩ6Sͷ3JN/E͔| X^FAL|4'` ` 6o3:u:]=o,W>?O K# $h/x1t_<'Rw*j-|.^_ĵř2*tKoD*9Wod > endobj 106 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXO#2BFzBookMaker20DlFont20 /FirstChar 33 /LastChar 49 /Widths [ 999 999 999 999 999 999 999 999 999 999 999 499 999 999 999 999 999 ] /Encoding 107 0 R /FontDescriptor 108 0 R >> endobj 112 0 obj << /Type /Encoding /Differences [ 91 /bracketleft 93 /bracketright 123 /braceleft 125 /braceright 233 /bracketlefttp 234 /bracketleftex 235 /bracketleftbt 236 /bracelefttp 237 /braceleftmid 238 /braceleftbt 239 /braceex 249 /bracketrighttp 250 /bracketrightex 251 /bracketrightbt ] >> endobj 115 0 obj 927 endobj 114 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 927 >> stream x]QQlSUO79165lHP,8FfشFJv]FF iʐn*Y4[HŵnE|P͘19|*+U =mqCpaPCz56+Jj ="6"դY =6AOzP?6R>UY`N |0-, p۶;[cS=mZ;աW]n򅽊GcJ(*#ȁ*M\V%D]ȁ^%TeMe(k> endobj 111 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXP#2BSymbol /FirstChar 91 /LastChar 251 /Widths [ 333 250 333 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 480 250 480 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 250 384 384 384 494 494 494 494 250 250 250 250 250 250 250 250 250 384 384 384 ] /Encoding 112 0 R /FontDescriptor 113 0 R >> endobj 117 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 52 /G34 56 /G38 58 /G3A 59 /G3B 60 /G3C 63 /G3F 65 /G41 66 /G42 70 /G46 74 /G4A 75 /G4B 76 /G4C 83 /G53 96 /G60 97 /G61 101 /G65 102 /G66 106 /G6A 109 /G6D 111 /G6F 116 /G74 127 /G7F 128 /G80 131 /G83 133 /G85 138 /G8A 139 /G8B 140 /G8C 149 /G95 150 /G96 152 /G98 153 /G99 154 /G9A 157 /G9D 159 /G9F 160 /GA0 161 /GA1 162 /GA2 163 /GA3 165 /GA5 166 /GA6 169 /GA9 172 /GAC 173 /GAD 174 /GAE 177 /GB1 179 /GB3 184 /GB8 186 /GBA 188 /GBC 193 /GC1 195 /GC3 196 /GC4 197 /GC5 199 /GC7 201 /GC9 202 /GCA 203 /GCB 205 /GCD 206 /GCE 207 /GCF 209 /GD1 210 /GD2 211 /GD3 212 /GD4 213 /GD5 215 /GD7 216 /GD8 217 /GD9 218 /GDA 222 /GDE 225 /GE1 226 /GE2 227 /GE3 228 /GE4 229 /GE5 232 /GE8 233 /GE9 234 /GEA 237 /GED 249 /GF9 ] >> endobj 120 0 obj 22968 endobj 119 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 22968 >> stream xl |U6^Tu\Ì""([ ([l kL`[ ! YMQ]Nwi@ D"!A ȸ3s;mέ$.PU=9sι8=:ͼWy孹)YOJALK>)q//==vtOu~#G= ycww\? G817sܳi>i>)Q4G4W4O?#Q?c~F~ 93^ϙ3I?g~Di93sIϝ;E?7I?w~y>y>y.cԸO?Ԥ/򜹯,Zd[^`GEft{@!rO>v/n~7~I}:YgYuΦT]Ρs\:Σ|:^u .;uMCf].;kӵNu'uutwtu]3nݻY{sut..>]]]}X׫D3/t7tFwS^ݷܺ~Cwg=ǧpPNLA774KsNz{&p6{o?4cܣGF{|7r-7j-747ܓMX3T17 nWg&s"D7sS"v.%.67܌gOs3?^0prڹe7Onznr.UnaYn[B_%qK7b8r'GG2.&F2npe~ƭ܆M\m]sC,IߵI:SY_|D? WPgXK͊o5(`<-~~Tv"[dII.F ~-^?޷1pV^ Bw %ۈVi~sjY XU~v/~O Rx}E@QTũ]Z% &߻"ϩ#IPYZc0KCJ'+С".,hMM%`̩-2W!xgԘjvwIeCş.G&Ѥ`ɢorMV}.%<@(; 95k)no!jknm5EF<3Z*|"Tc{j%=* ѯaEI*vn{A(X} -d(ϖ{Q_NJ6 M "e]x(%Wc;PhwZLZ~.jb] ҩ¿(hb7iaEzƻdv{E$\kkh1_ɸ1O'R[#T}.: Rk cy i84rc5`c߸=Ӊ\[cbC[B}gSА(aV/|zK }~S:_!\${R/L|_WA{dwLT@s(;KK R"d%O#cڧiOp^s^N:e|g}986/u*4E[0H~f:p:qn]u(6n8-]fЩ3TUw?\H@ELӨHӄP/ɒm_Zur41>_jhFDEr $]$csE;U6MShrn A4QٯeOmfj/]N0T)O1d 0Q81 +`j:b ]"c+Ʉ33ׂ'5}nhݲQBT7P-,U Px g]/D_i d|NNwm/$DN} 6%I7x%4F\ac[7 t%FU+6ܞUg/ |(m*Dl ߁3|_Qzmll&u_JBFcg] ۧ&(Z97x⧱q۰χ| ]VK2M=%,gsNѺoߗ@#Lњ栻 NY{H8eIH=\|W˖5.d'`F~;pH›4Eґ5} 2:Kƣ1V.Fit䆖Fa-}Wt$q6C#~i+?&vfxM_ U:*JBM-\Fu ZICYF:M|'_ &: A8m=?v:7Ks¯/]ā[>ॣZ(tM7qZբX帧H9x+ܳ<?*# v^)oqy_䭓2'B| k= ]k7lݥ5R5s[YBOO+ ,n 84Z`CYU7<o2C͝)-(J4V7_"{%X{Z3ړ;! ,ȤvWkּBmS/Nݕ{ F#,r#A%Ƿ|L"JR1hY nli5xt@{~ͯzthHo+I`Z<0?:R6@ i;SK؈T B_QX# gvjILT-i{ݘf ɸoy#8&,H |@2ӵԟLWyݷo 4WGYi*f˵΂F$.Ns˸B#w E֙2BWǿl5v*œl[( ̈&dOrJ)c9rYITU`?-9V`Ɇ!} Z]8oy #qMt&B撴5K _{1JĒ32_޼/wdVß$T:H`5DI$c$I! $i` 5K`vߨLESܖA6')0s PEBc s _'^زtżYIPR*πls@#7d^Z^ԝJd"ꑼX=w+cwu75`5퓘?Y\C, 74?ÚA9|u!Nukb)dw.[ʪRlBCywVq c(JD$]siJWi~ ɯz q}t!]E23Hz<X rWF]I.z.N}[ә#ՈMh\G< 8! Vq >B\p_G6;G:4ѧ'TWrNlW 5d|D0 e\,k?5é u W3vg||8|VOƨXк`j=MzB-q4+yj`@ 5;sLx6U'"J9f\N,mpK/Z6&-qׇsv_p~ˠt჉W#!ϩ\Ab aC*`[,@-e4.@o^rCSdL/:.4/?LDVŮ"G}ahҜܜjv h : =6Rv22|&(/< ,0z> bW }:,}Foj|ͷ]=8Q2Ce# @[GY/|c o!5sm ǁĹV-ƧhSr‚1;6G ѯ+pճ7#}H7R4 u>,S7!C3~hYN?x]T .c#LJ>byɯzeyl-n#nHf+`CfRH>~kW?ʒ-E{[ڀEӺHUt)x6o]R=P&ƕ/- 2+%x6"[ɳ>>&U8(M+aSM@^*U;Ӵ&9۟rQF!+R୰DhtExCi>b "9&dȓۑ';>,G CyA1 K ,eEa[3#uQ|P“|i<[v-ܴt /J2c#ň%ߋ)Ph-YawBU ZD0=sz85 d@׈#qk3C0v)5 &;"\ڡ!-j7Ǽ5" xi@iVf:)x#F. RV6j3(G%0*ʋQ%Fo#l$.֟0)S v'ɍ4W$tWww|~@U/@yF0wI2LV7["uK"4s4zB" .Q*/+.&~w8z̓CqzAlJo96QVـ:Q3P|DSb2x&;.w\jكUW-Hvd]G'QUY}h3Lh,OӇD't` Q/` ߏ5,as XX2I-?NfN&j*h4}hK70#{)[tͦ6>0Y%W<jݙ1ȅz&A.IE$fe'9 ɫ.&Tq[-Wa{vTx\$'T40Ƌ1O c`~kX b̓^H{^d!~6 K%Ux ׿پD_gieU䏂qEJJfF ڂ<{X3͆ %3$5mv?iDsY 9 2D3&o^!# 0fd`Ղ~˚Y[d<ձBU~}:O |O^c0?閖njyiTLo?ïaw{jW@QUd d4PZS\Hnk4ŌebYC3}c>ˡX*\* 9q$fKt(Ї;@pLNC^ӻFڣ],R/-dHR)`bI,#~*hP#QD$0骄M||-. 8d}>ZQD1f|VbeOsHsX/Ԟ@WSuEMj*(2F\v04f2}'+^C<*v\򹴅R4˨~GƓgv8վ* ʱӼ2:Ԩ伕ϧu;S2:2eJ:s,J#.;:[C9 2z%9֑Z^ZlX~v< #G {XރQFhtaipX\~[_h׀wuLǘ@#]naQNȝBoeƠ mTW./zM&'[L4ENإɫ(nb9+ <,(&+jCgݲIݸKc.էκn)szߚ(-`Et1`"2Y׵b`1 9Vfhd!L~ wXXZV$$jrtt@6+x5zͮV!eNKAP#UbY@MfhyxV]7q=rMAPMk-;."Lk BFmaGbV$$\-DB0p=v (@r\:ڃTcGU@rZe#БC]]!4A;L`lr%qZF:u޺.ҕ"bXLq t~>ao Nb6GSQjgUS>ˑPؿ ?d@cBiG2[1Tؤ]w 6bTsJ GxHHMRZu"+bĐԠ1>|n&+VW8<լb[-Yh@-3S[6w]^>cV!* dկhLM2! la7JX/25=R{O?|>'&%UyaNCJ[A_ _ÁAK {a^C$:CdN_H|Ʈ KP]x,|#\tmrB;PPK|TpϊG@-Poi|'=|ZKf#`h-`"\OJfEI͢ѸB6i vIC[͙;l/؛" *?z .eZ{۲?8J8_q{1ߨ`0KlTM R@eQjgnmpmoj zV>#TZ2VGR oZ:( Y:!wO$߾% b9\w zxeJ8Yl( B,k/N7f'*CWHIj~ y@F ݼb blYEfFƁɧPc$dAj0\H;ˎ[>(^ ΦnIE ffT0ҦLDOz]|QRH#,xnCP[x;j+C "^󖳲@FɐȐ mx#P}rDXۥ8 gcޛz4^ΠwLIx S@-b4:!?H_._D=c{ú(cK-s!Vq?`Bɇzjr *}=Q BLp~ dz}{Ā@Yٿ";*Y',L(.xT{V˓DŽUt :#0{7d4&/bǖYuU٪nwcG;jsm-JapOM'0eY|@Q-ݒGC}fRt ˔O_eFU1\T7yZi5X?O1>r`7A{@PUU(J.AVvtwW{>,O:ǒiy{| xHziv4:AZc5ZǛh+u\#r0g@N_Tc"3GJ'}ᑥA)Gv{Ł@s940(ݩa~Yl &xD--UTDi(] 3ۼ"=Hؔ'e"m@'tpdN/ lD_gc29<I$VrmfZjFpU;Ђ0XͽtQ zIHm GeGjjV*q1?cnU0N4m:. .:8l6-)I{IGYM/2 ~Bh[2.գU(1E/N 1FHNL@:N]C(p;d!/@T@EAv [p{'%9oJ3l鿢I!uW{b(K񶳜bXhђVÿևgen~vө' U H3(3C6Kn2 !'Y f$e{dM'Ufz|;A0Vlq|fѐkA'yW%ͳ]罶ՔŇs2Κ֢>ЎEAdćB)kvg~V|^KI`\\EORXԟ;킏>k!f HQ$kV|5`/?n.Cd$dQxYF`LAfUIP= دyDWχ"]Qps+drCpjh4R뇐Jm,il ʋ4$H=EII)t]+a M X6i}JŹk12{kI63dZz po$PKO%ſ 95BX/Vi4tL}ƈdF W? q䋦eU`cdsw F! 2_GkdeMP3u*go,~g 6:)I;pP.)ox!VKT#(eȞ->N,W͟}m?b\gkhhtc$PDV3DpY9 Ώbf6 8+ڹN`ɤUB*Vm,jR16pq \y.G*ɒY/ FЛAR(A'E&ab|`c!:;Malir;72D0{!ln#ΔPBE:ȳk@'#|;N9E#Ff{P/LQa"VQ%P.n$#չmP֐ڞ@d݄~#$4ȃ4D'`o⳰χkgd?4}]MF/%[DDO|z#:pEf9Uz˄{NP ty!鿽 d^k?@=VZU9_OeɆY z*W\l)uY{Z -~dB:3co6f@)UѷJp_N9Pt@E@y-p2 }#u\YZ/*2d36A[w:! <a=uІG4T`e*7J@6IW` b< %TUAM"I\h}CHR+K xvv/Xhl z0 4D^;U-q ǟt^$R?xz)I_&`(]E*0 ?i>gMH>-AbCi r>%'_wdy|AqLXCPke]' 8fٺ"U8d~տ> w-LRR|WO_)u Ā.R] %7c VmftJځ P 4:,jɋ0zsX< {U Y~˖LajJ B/s)$#P")z=׮#%Fi `1-2 ;| mT_cHVjLVsday_S,~:૶ {0!㬫O&"ghIRy,A/,AW@ԏ\Z 3 omRCu-Ψ t1lD!U@[ѝJQ\h.>C%J՟o U3B=Gѯϓ;~^W.S,\u KxlE%6z }|,Ps\jZdFkYö5K.:8,cj1/ukJ{WZ^Av05z{g!tfA[ }iZK>e˘o3S_ ~ AmvG A(lԔt(XOv0ý"YOwq$ F]Git$Tn7sp?-l_+*iSO02fUme%Cs`N-c4CXQAY ?I.6)˸0 jj7wi&^rvחHQu;*j<և쳪ۜRcjbyOM%H}$9 CB?Rok0s2yf/ |̉Z8lxigRј>zS0qXF*ߴ6GDa(%*WD2. hHNJT3`<@0H"(|e!S,~Gtꋰ6PP}i7}y,ܫ9]tzECz'f6>B6THƁkR>o\?4%,ES #ky\y-<vz]-E]ߚѲ8?P-%*+vb3H43=J7pw9Q̤M=4;9$Wro@OQCK8~86¯G #]%A`s֒{xG4Ca"Aͦ$Ý\ `Ќ,[z=u +2YKы'$Tn󥂽$uXr WTk4@Qayy-nO+kB%oHv2₻}x ihM;`8WNhym<A)Rae~ئn%R2pf>&)g2e1D% "Q56ԁ=JQ1 _$޿n6oriTZxҗ>KBj`a'޸bzIM9,産6X1@/oV^DA 璾%#0ry YǟL4ټ* !pQ5Oς݋){Pkh=6 B'=Dci0Oq\O%BKsrߠC~Mgf_oBBTz +gS^ViG >w`(v aX_ybP\N!'!C.^ 4#wKd6q1_3dAa >=$}(a`r5R?F| \_FWDxg-T92rdfѵI\2 Y˗Rrg%:"rOo9>o:  D>%dlCVdZpߚdɈ`ׇLw-)\RjT,nw( ɏTHc$g"ujcY*o4Zк_`툖,yTN/8x6KŗɝY#bYbl{31*θI1N+QP!pG b_wdMݼXKtq1,rE(1@%=ۺG6D> pө`Z]f?-OfW-7-'+`'";-gx_`A\Zrvvv<ӥm{^Vr ZSaep}gl?w2el?x;߇ZJ} 1bl2M->u>Ojocf\ʹ)ҵ6UֳY<DV#".%^eum{սŸŃN>>A0m%TD fAV٪-(C7_' 5 Uˇމ\ 4[ wh1l1gSj>3Dċ} .p洶*OzVn>Ohc%Xg7L ^wV!CT-WɰіBm-ϐ|уjvH'_3VJtIBm)ߚڠnPpX $RWF@rzig,% ?Ε7rI:R/LHȪC6)V\IAvP),Nms**ϺeHN`m7CHp[W'M8YñcW (J U teMm9#.40%bq8͂zơX,Qvpd;58"6aQ@Bº۴f]4i+;F?!y2TRj:mAFk^7$OZop)e=BvqK-Eu hfPG=RLAVEsZmb]j‡=אLty, ; +hBᆪ~f;T緹AVjۗ0*ueWvI\֒*w}d퀚SVMzBhb<8kHs{dfwFnu}LUZuu|D#~C ϗ_W gyPS`wu(K-`CQ!'v/)Bnuy kBkLH}aA+9]/cmDƒOd-|:1Xc#ZPYj&g5Fϒ,Xk=eэmtSٳ:hYaZaQ!](!V6u=']GK*l:.aI<͡ i"ƀG_KJ2ˡ89M?:h_U2=?9B-!'@#^X}@w3|+G @i l^k_//?Q͋q 4,_!Tڞy ,I)fAg8&dCz>}*M+:`1oa4*yC5{^a'~[h_Bgy^N#"˲׋r/jB`>Kl wp< 'W]ypv8kXvbAkn vkA1re)%K^f }/`Eǐo}ե|(0p^tMix>Eg5GYvd:yL%S:M&I/ n'Z<]6VK=M"Lv 2fń d.c9b5˫t@ *KNkIm+@$5B-!KC].1IZa% o {A?r9"Z@_1z!+S<cД PZZUi6ȵ 2Z!^ $'ׄ✒7J v=MoT`zM7B+Z4W>>wRKN+)vf])d%?3>'쳵Ba;Y+=j Rx⊜ OFQ AdB,·\G?$-J*$ԀS{K~swqlg܅u Y唧zH`ϡ:iwya!0x tbY)4Uĸ!asDƤT8!VNZLty6[b$ˍjJbs  l#`|~bc_XGzn5H`oB@Z&]b˰e3D >k=ثYƭQħDžYr%C`'uXRUj,2_͠k{d8yM^YZ95s͞@Pmdmrs3*>XR"o^#F-kpLrKAQK8HVgȯHHՓ`g&XZsv~%l|C+hΰStyF&dˤܩuȐu@JrD*gH`3MlA1ATE;D{g"Zՙziՠ&ǵ!}ʛ•@ _3Rض9 Կ(,+H͹ZVOȽ3K͙~ƪbǼ.i86nN(+[W 竻74"-ÆcW/)c\W]v~qMtC-M7ҥbCuQQqp0X-+PVZ6.ENQŒx/> 2\ :iJ76eB\"Sً.&;~VUZQ6z;z`d, lP۫T?--m%d!9"2ߡ>MfP!p(x8]J{@F@G5Ӿ'H\eK0R߬e- %'57A gu`CfiAѬm@Gp$C)SCǾII 2{_di^4O[$UOR 絮B:frfMXuUZ}Lx 7MZv)[?xb[D"G/ɲfa4ۤ0 Ԍ1~Y8eM6".{ ]#}d':S2L2{W]+mc {Cnp":\ܬ0 dgG;u6gT+!^EE2y= q7IiPC).FLCV%'Rk$fs^.oƚn줝u_>]NH;fP&[I M]mXSW9g9ӏi8s[[jZVZju"EK(A!4<9  R_V:Zkicg{ "޵3H#s& %Z[? B#A!ȪȨݱ(sEn6"ʽi{7FmCskkT"Ey2י-OHYa[/ >/wrBD{|'ЛNE\ 'V!=YJ[D >z.M'v _;Ҡꪁ߶v4'~U]M=& άew;0^+BUk7f IBmlA ҚxFVvm2CoX'xk_ZBge>-kJf [ѿp}MVt^yzLxdQ3KQ3cQ7>򷟳?OQC$w4[Ѭ^_Q6[^=~8c3B6"3X:2))_w(Ͼ*X=1c},.pm۔$z^2v-E'{ٹoAeni@?\Zdb1Xt QׇC̻O:[Ԫp~?Κr-OgAbAۓW25qE$.ةBhD!Y^>qUdˑٮLdz$ڞrw dae8> R#ۿu` iobb=nm<_{Lt 74 =.Bguި(j:r+;9ZK( -B%} ^ oa3m(8g\ Q(][)JQJ5l9!@Ԑ84{7Gz%nYbd .$ 04kQ0xl@H~^%DUťyE!6ъ%eʋ`MU6L>3n9GB! )<њF<݆F3tBb/͎.C9 GY*mq]ٺ5R@*!?=, 3ʏDv:j%/;- !bqۄb:*ˠؚy1XbZQPea[3PGQBs?SF&5ȵTpZ"Y9#J~gE [Ѽ6tꏱk6PMIJcK@/N7m`6d̠?_Dgd{ރd[N>syFM>ʊarG<[g([G(xjnNn8%!d= (Yp6 hcpK N+*&~=#Y͛c7ޜ^:vY8HHML6< S8~>Y0ld#8.#{I/p^$3מA{ZFō \z:Yovd@+_;]y)~FBTwȝ[@poFӺS{b'e ?hoF7ВYi;v6\Ey0݂{'UY345uM`jfW,tjLުւƦGv=HugAAXg|L8ʉw_j,dK,gy_ Zȝrq`Ƈ[{q0p} do.r@CS~0{4|)NEdw.{{K0p0i,dP0)q ٔH*,z~z)Z|y@^/ Amɜ!xA]*h)_z{ 57t{!D Hc/4 '9 9'RԌrXMѠh|!3Lta3CAqdouR\RV) o @PB|̳#\D7Itd\'E,}4ginLflRY'%%BRh@)v-psϑҗ E+cW_ul,On w~,Љ||1N'KwlL1kW!cPinU*@j&^ de=NgkYR >J9(5͛`(3_^ian>3jxG@vڥ;P/ГV|򮭑ܹҹ'mє.yɶJ0zvLvz+7g] i ~C[]Zh-@XaP`ϧˊ\ƤɲßP57+ؕs=@3|"S , 1[ĮaD?~C Oɰv[pG_d XW-^ O|wg-Z djVV+;$T20ћM ˂; ʻr9ȹ ,[2mPcӀ6 };)Ө?ޡ0+4A_@%lN5;|Xp?Foġg)U;rwLE+>R9GnҕtY ,,"++2+r#}4sO!% DobF&I$ߥ`H_gvTeO)`&Z>"q TB@1W]`鏢BnC3.x"*/ ©Qh]ۮ+*-!s1y&-]mL /T޷~lX=}2mg.]rO9Sl)M`J]377wLKnd%u;A%H8$/;nϾAv\ ҟ7%s=O`hu=jwn(0 -s'b8 E*>{u.m!h씾ݲ&ZbW7 i WMmvAxKV a\d:)$UH?Z]ҽUɩ.XYHj)#pҊpݎ3Eu Elݾ3Lz'xe#N= endstream endobj 118 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXF#2BFzBookMaker0DlFont00536871547 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 119 0 R >> endobj 116 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXF#2BFzBookMaker0DlFont00536871547 /FirstChar 33 /LastChar 249 /Widths [ 1000 1000 999 999 0 1000 1000 1000 1000 1000 1000 1000 0 0 0 0 0 0 0 999 0 0 0 999 0 999 999 999 0 0 999 0 999 999 0 0 0 999 0 0 0 999 999 999 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 999 999 0 0 0 999 999 0 0 0 999 0 0 999 0 999 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 999 999 0 0 999 0 999 0 0 0 0 999 999 999 0 0 0 0 0 0 0 0 999 999 0 999 999 999 0 0 999 0 999 999 999 999 999 0 999 999 0 0 999 0 0 999 999 999 0 0 999 0 999 0 0 0 0 999 0 999 0 999 0 0 0 0 999 0 999 999 999 0 999 0 999 999 999 0 999 999 999 0 999 1000 999 999 999 0 999 999 999 999 0 0 0 999 0 0 999 999 999 999 999 0 0 999 999 999 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 ] /Encoding 117 0 R /FontDescriptor 118 0 R >> endobj 122 0 obj << /Type /Encoding /Differences [ 33 /G21 36 /G24 47 /G2F 48 /G30 49 /G31 57 /G39 58 /G3A 59 /G3B 60 /G3C 70 /G46 78 /G4E 81 /G51 89 /G59 90 /G5A 91 /G5B 93 /G5D 97 /G61 98 /G62 101 /G65 106 /G6A 107 /G6B 111 /G6F 119 /G77 120 /G78 121 /G79 125 /G7D 134 /G86 138 /G8A 141 /G8D 142 /G8E 145 /G91 150 /G96 151 /G97 154 /G9A 155 /G9B 156 /G9C 160 /GA0 161 /GA1 165 /GA5 166 /GA6 168 /GA8 174 /GAE 177 /GB1 178 /GB2 179 /GB3 181 /GB5 182 /GB6 188 /GBC 190 /GBE 191 /GBF 192 /GC0 193 /GC1 197 /GC5 200 /GC8 203 /GCB 208 /GD0 209 /GD1 215 /GD7 217 /GD9 222 /GDE 228 /GE4 239 /GEF 252 /GFC 254 /GFE 255 /GFF ] >> endobj 125 0 obj 18962 endobj 124 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 18962 >> stream xl \W>\d͙,Lf$$&@AE6BkQM7E7ݶ`DQDQC0cb:dw2K %?}o[9J&|KǥpcYK7,Ybٞee[_5siɲҊY3gΞܬgnz')#"qȇw|/p~N~|;D?w7 )]{{ӹ{tr?>Ƿq?=npqS㦶s?=r?X 7}*b:Trn#3gU.r=Q4nA B=p"h[Cnr.8-m܊(n0,pksqOs^1If$gN+WVfV'Dg<9(~b'.me|R;G\\PNXi#XJw pD "wvBPWƽ8z'< Τ+ C__t/XK;7Iz^gƃ3r#_4$l X{q,!?b,hclD\QCE-P^L* #_>O/t$,5:Pki0S: ƶVK/w9/f9/hRLe)IN q@rn }Rm1R⳹\X(#6Ґtq+ޛ'Hr5<ޤL^_Ns|=%t)]Cd[dP"ta^bg>> Ԉd޽v by'@t9!@@'W0$q,/zߴsr8~En:-Pv<8UY,=qvPEv჻jJru[ai6[zk*g=p$F_l QeEwiʭ2.vO]܎. ~ Ҋz %`,tV%Fm=TW.'.! ˨N36fj^tjBN'e8pv. l$K#'͸BNIn !d%~z 9w 0w?8VЙ:?]pdS"dߣ9 $$4o==EVf,\&,ϠOJs_ZS^o@`kv<q%s!ro+ـ1{j@5XzUAS?'DZm]E@j{pipcV(n {7|Nmkeւ~| O jam{d%]0vOb 6uӈjy C1|x*}@st *wX2`-]&W+[Y`)1ě$AX?s<5z7O.b,?)rnjw hKⵃz`.Yr7#s CaϮ(g-:qq?=pz,> E~Fh߯.Ta9)J‚gg` fO5LGJgzKr5LxN+Y5qk_+ SGcէ_`K9o* " Bd*__%2VÇ]-]!yE-\tw4A_ I +)U2=Q_҅f"Qcc}=4-V T'°+PcGtGedo$$ ëB*yIr;e/هOY)Eb*Ґ@L #,  71g=ar4 v ^BR耢]dm4׃ơ!MqlwkhYZ_qrsɁ4īo!y:7C tv0jK* f3X,Ŷ, œM]5~(&Thq&V$j!ayp4}$= Msr 0ӻt k8sQH )ځ%NGQ 6z5 0te"2"#Gx y]Pmhcc~'OO%;.GrD$S?adhqd5#NN[7~YHlgÈ޷)Qܽ?$# l_Q._ n+?,G<1@E*ڠE,5yݪNCΒv4Inlr1 8< T ǣ eH9R!$Q_0Āv*#,'HЛ-i^W=ֶVvHwoo9^::_{FeU WmtLWeg0]-Kp z ~[ѩ hmr D^Fy#8k]fW#6O )V$1c'{G[q3Vb 5VT8`R%A'&w+ kS_}ik>Ԛkk(Bnc2}_& /~G"SH8t3$idջ^1}ogDY r2fܥCXoLykr 'lgtcz/]>d~)ye8.;Is6tTx5BrJ7$}AQ8!dxC*^} ""FtnCȇ,6>uS"J\ cm8ZpAB3J6Q`M: C` 3`4溺:UBf̏,W eT*H@" Q4qM<==.\.Q1d*ϗRo8$47J}-DͤLBYA^X-SalFM< w+L߷F:1 `HC\X &}A*kz]N}N@=v'!-rVʖ 'K(i v!qCt\Ĩ} 1 "bEYQ$br8Y!VE4NdԶkcyJOKBG Qc+4!\@9k$mH|r Ӏ nc*z/H"a0JtOeİɋ,nαh46Pf4P= NU4uO ]cY䖶\W8 ~3r27%J]: _j@N6Ҍ40n3/MK=ZL3{A NH=`ODh)NTlH@ғV g|)@A?4m`+15VnCFpX"G#a{z]9 "T(풪!hi CǤn-T&M;@2tUEJREVj`( nnwe\:TX⢕s2?tIrH-y6`H'Pf*r?v#B-ŔOƉ\:KP\f6Ѱhu (`$,k.̃@u SBŗ 9'I'"0o5y_>zg}!NZ8dgp Щ.zgP;__drY/`}b.Un k~# t5"#FV' QQH$/~u sjk5I81ZsJu Fҩ P=8߸(OT0i⭭kE|u#\'^txGt:}LܐjUя*woNܧgNYΉ*. l)D(#`(f|2w Ti:`,.Tvt.|"ZmVxS &ᡩ,@nz:lme,vag\@Cjż% x'vt~"K~< ?X oܮI6[3>1PDlM|𡨢ɣaEʂU^[0UG'H$I߰\TY]-C`QGZ;A~yLә <)vx#j<DzR/AY?مqy[X)DUx_>s`_ۼ׾TcFy_gW/?ܘxm2zS!.V"%8T_P|("/GvM"ɝr$ @啼_|:[+UP I52ܚXBk*IFD JWmEEBlmFx &#h7"IY}ċu=7` onzLcٿV$L9{ N]3txd]G6a ЏChBmKVcc2w+}lG+Ӧ:N@h,&3e\+3FFI/\D&O₁=gd76 x = X8>F:%qS> K|.~>Aژ> ۽R*R073t4ZrO:PQ-݃&eXͰJ}5X$NG[-XWU8K"ġ6yzPttf dJ[Â9`U l^TTS^SU2_ zn\z< _i V:#S-4yr!.ih?G*bң>' `0OET/>q _ #?j_A:enU i3kcq]H*#C--QWd fOFy^`1I[z\}Ն]~yO!Bv+$lpdׄDҗBmds4= Zʘm[=X4K|RdZ^6'8y|S a DFJd"YR ŗk>V Ki W\FsDBuEQ~NnvJt$5EraSait:Π%c;Y`q"*ΨOB}yTG5ZU\NB<ȟ!ͧ y-(Ϣ 'Da~0DՖGF+zz")lP<8z9%biw" u_1Xk M)_Z czfF0CK:`xZYRhp" ,XȮ;#ɚ/ЯDHh]"]C _k+ 錏aş ,zzǞO~[jcwvm j6Fu?{rFedWH90I:J׹?ȗ3HXsQ.xd~.}y~4zd @4S.JUB\zM MCũ"W޸H<-|A@#}+$fzh(s^Sod ]> "_e"^t 3OԘѰbGVkpah`< |AH!H @ z0 whH86X9̏Ay~ U]$ \4M kľ$ךr˘k>G!5KcM@0!uԩP\`k{RM v+K=,'yO8## Ogdhڞ˲Ʋ5Fm*C7W{^8/e9>t Nyp Gɽd#NDTZ! ҂~?4hJ% so¥2ו[jN&gj_EZb+OatYr;zGcrPuuA3o1[ؙǶueۄ.kzڗ;0zJˑ~Q #i4I {_Z&;\HWW\cH]+{W]w.-.J%ԌAsﻒYOFͨCĕt+g@nn75$[CK]Twՙj'&>@nlž kl%8mdAڐ!TAsy24p5* kR dE poVAQu/a;<)ۤGhg6WF_r_U_beaYh-,ZCIOΧkf$:9*)h3ݣ#ݥ &.K|dH[7 /)j,¡|L9^OvbE::SM7,лEz2)-f4/S+K~!}4%\ <>)^0@*Ȭ8w;#QHEz0x|n `@ kefuȖ:{MfdZMV NѺsdz݆`v0\Pj: MíeG95 UF@^ѹ?yG+c4/?], 汊zo{w<.HX+ƳKDQ)ˎ*ʆ4Eʃo o:\IJ aԐ uZ VE%d8vNF7,hQ'|eڣX,Xbj-"mmH>uF*::eKE#yO8;DqlQ uF`pmPib~ʂ*0ZPk(6$ shO|R[}7YzFfŊ+z:cgTVZi3l H.B `W/rumyVƟ,?Ƈg2]5zDGű{n˜ƞ#[tRkR)9\?r\e"D7*ɯⶰ\ȍޖ cz ߗ˖W(cÿƣPݛw$dlpZY긼#ng ͫ`i[g*g*:[.jo).uH| )R]EG*p@6s|R=3FiY }LЕuH;>V 𢆘!bH:!!=ꑯ'uioL C։AeLι1D;i1??v:P FY Nב%=EAh t,!Bx;?jC9}$.Tߓ V%*&%10_<^3H}6>SO? 0y>LEgh2;jiqos {λ. <`a'WR(!cy ſۆ^zc ;3nRMv2u,e ,hb,;.nPM2%P%|.wdW$ }ē^ze^e-/]# Dž? OhOk/+Zct*-›kO]il/K9mWԴJp$H)YЕ[prx$\} A6y,s_O)0t>BXX|Y; i]7CrEz6|oS Ju?dz[״ybetb6kx .\ >NsԮ!'_ݗW@ FU8Օ=;#z- 6ީ0 ޏ1 3z9}Ne_(}Q@gKĮȎ0ɂT|o VKs$=EQbAQT7ha] /g35Ceq^ ɝB N߯ռ/Ԟm$w+Ӻ @G  #ې1>h.Y n ޻c0"GƳgIh s}5m+XJ,zxj4c{4>]T9Vy[n4w֔Xg2Aj{6S^ҁBWV܌lb-L&Oem&STF\2SP3݇BA䖴r֌J|̣+E|z̯jlOzcJ8NrI^a{Gmxn` NB(~vBm]0rܠ.,HH{M`tXan C]5Vr5 {.DZ9n\ &XMNڳ3>]C , 뙦gp^HUN~ ,N>xdALoe9NjFIW \<"_P>ouc fJjQf@3.ZL'Ağओ3xOӻ-?L{ux՗F% ">2jSÅGCa L~YHr XA.꿙4vhin&A&Z@KD:KJ^c+cs*-8;w B}O̶Ys=d-\1"uqv/$ jB֨0_yTȹ\2O^~J?:U2w_fcob/ćVD̹_E'O ۇ_.#fK/z@o3feX;9 $aPC " Hu:+y}P17L.9g{Rg{& r~ ݀9wV[楐tQ"cqwYעnqa#R7P]otI 'C ~Ȝgh@;;^q3K'a7H ]WDh+?2hA$7 q='.bG:Q-@#UyⱺHtP[9؝|50 y[z:iӋFPF˨q o'?fnx9m#n,:Ց ҌE,0?م X\'o_C-y?}vȑl &0_ԅZky9CAbj/e9y@{CNd;yAڴ(…oW"::EKYo42}c10P((F^<,F ՋT:"Rv!z'wq|#U<CVdx⭐/ =bo!tGNg|y9_Hzak1T`}>dhPy[ *d>OBۧ׮PXf}; ף[znk:ۂ}8\2~a{b/Rq#{Y_ VY]3g;^ԍjNo穋eI5/!fWnPTF%{rB*sjWaqT0(g{w.Z>1UakXXL_l}"ޞWeu Ϡ3TPSaTۅ=u/ѢK@ j:,sXC|PL Fl_mRoT?$YgU:X!X*:MrE%f N-0\kFϵz ?`ɺfzo'Uoo\@' b@iW[oA[HPc,zP$GOǧ@r y4Lgʶ9LrAW栯8|f""ۀךOZ/ KKgxZE +. #nݮKJvYU(TYF'"NP_:̧f>hrgEKO{+F+6oEiひjL\aP, !=$j:Ӱl FJ JA j w_%A(&q:gªG?< %EQ[Npz zۗD{h@`:j5a:X|b0#wM$k$Y_t_runX?gƇg|hFt"!<y+A8}BylyfQoDaI!󠻝XSĹCgq?oi(vNt/kڮEԃ>Б$,}r2${Y+) 3Y{W?yhԬ/4y'~/!Rھ rC%nN@Sh)`(W5,V'۲R!Od SΞ .[Lp'ܭ,&yh²@y4 UR_Mk NB9vnq'0JkE]z+'zúgkw dx?"Xs rg2V$@dmt'.J5KhOv0 Q r,$mO՚//?lbAKu$GQCx|./`ˬ:$O%Brߍo"Iw܌+c]Fb9 +`U'As(ѻMO?[5k֘)B{w5BxbXFY}}.ڬ5{=0 Ob(W+=:TgpnXoЎ.Ǧ2M_TթϾ{s%BHcg'jbrgE 1 MӻoD),7CosviY n~ZK'z_#őߴ{=[ Dۙv0l /&Q{Kot. Md);qU㗲ZUg4ώn[+YJ؁!\#QX>?Y$gyXaW w8zƋ@<c$kd@5Գ+ :tվpLh^Gѣф.w ?5M˔c e4KN NDh^ M,Set24c+?OE.1Wx~{eMi˭I^:54]|t2 Da.yRcɏzh%<m.\]=ϐȻ@]nm? blB_gvV.d--xf 4qsŅ?BAe=#)sQ:xH(.Tܑ#g0(~#/ސ@Q(yq[;[1xF_{jm*xr&[ (/o/I ,H tVFYȊlbi爳bUZY4Աw4a)}d|rcT @oeVکzهaWUC@f+5=Ysc' D ʛg9q') $O{1܏Jz' YOs0`=QuEX hSzD p$J.(t'$ OimeA:cЗ.t="'XMG|8(Tg(/3b5ɀ=II9OA7t WsEz'+Ae[oF) .ZX\ES.3NC'`^sk&P݁=zH JdC鶝 E +ZDq"NN$X{< {r q@!Byƶ _ c54d[/H?*㻾/^1E[Bq<W2 mP; SdLAFi_HnZLG6uQI)W"@*+{QEf"~^Ѽҏx|Q =xk8G[dmDmE*sQֆ[Y2_,|&} /(+GT.s'kgI;%z9+N:!šk_V+ t0њhA2PԖwItЕ DIM?a3J4=uW_OJ&N{P%/asM`l ۵c^{A( 1pw{!zѳ{ J=tnj+HYUn6cܴFmHDfA󻲷 SGRPsg%/!̚e*H]-D[+z1A긱'qJ3O~Cw̦4ghLz9O\b@ ^?Iޘ&08ݲ mƩO!q:F0 TWo=^Ar;eE-dl1FOKL4˾4?>^a[i/{<π_VR@>k+;Y2` W,Y]e5zꯟ-/Fh$X)>0!&&v!-H8 rYs_%VIBt fjmSaIs>%g!pzh7&gH*xw;r:P'<' '[x,br!]*"t3na//FYHt8dúʢjT@!nJVem dAb,t6.UZR~Ϳ~1ة:!S\@yT !qjߗBԅLm5t`z'[)a)xDR|C5-= BP'Pj렬rAtYv4Ϙm3SW#AqqV7x}[H!9GԚ3wca ͈V@]G07olI4Yt]vu 1I 8xƹ kR- hK$S'4C}/Ťx(6$՜I> W'H0Yjo%uc>-[ZsŁ57ƿJymYY\rAuc%[(V4~Z*]^$[5?9,}|[ck]s]Np8,q"όu0vUG>i(:2L5}tM \kD:i]pQ/7gx'4iw釄d$IAI_ :^xHjSbz.v*ȓy7b\r[%2ri ]>1NEO.GV U0093>ut5Tmް#sG37Ɇ9QxLKZ9Z|` H Hm/Y GGPe`5t,Y/n' 6ڡm5xd-La5Jwfn$׳ Y}~ߚs? 7VBIeʋuN%< #ł^-jdt% ~^ZЉXFD֛JVpb+66ہ|(>09>xjaUG^2iv܃yp;ғXxqƜ_&a3ǝ@Xp K )g\QteCz@h2gI,[nэ)cMU+!تp1nzLB.4u;Q'Hb\/*Be-dF endstream endobj 123 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXG#2BFzBookMaker10DlFont100536871548 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 124 0 R >> endobj 121 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXG#2BFzBookMaker10DlFont100536871548 /FirstChar 33 /LastChar 255 /Widths [ 999 0 0 999 0 0 0 0 0 0 0 0 0 0 999 999 999 0 0 0 0 0 0 0 999 999 999 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 999 0 0 999 0 0 0 0 0 0 0 999 999 999 0 999 0 0 0 999 999 0 0 999 0 0 0 0 999 999 0 0 0 999 0 0 0 0 0 0 0 999 999 999 0 0 0 999 0 0 0 0 0 0 0 0 999 0 0 0 999 0 0 999 999 0 0 999 0 0 0 0 999 999 0 0 999 999 999 0 0 0 999 999 0 0 0 999 999 0 999 0 0 0 0 0 999 0 0 999 999 999 0 999 999 0 0 0 0 0 999 0 999 999 999 999 0 0 0 999 0 0 999 0 0 999 0 0 0 0 999 999 0 0 0 0 0 999 0 999 0 0 0 0 999 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 999 0 999 999 ] /Encoding 122 0 R /FontDescriptor 123 0 R >> endobj 127 0 obj << /Type /Encoding /Differences [ 51 /G33 57 /G39 58 /G3A 62 /G3E 71 /G47 91 /G5B 102 /G66 104 /G68 111 /G6F 115 /G73 117 /G75 119 /G77 121 /G79 133 /G85 143 /G8F 148 /G94 151 /G97 156 /G9C 179 /GB3 185 /GB9 188 /GBC 207 /GCF 218 /GDA 219 /GDB 220 /GDC 230 /GE6 233 /GE9 235 /GEB 254 /GFE ] >> endobj 130 0 obj 8632 endobj 129 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 8632 >> stream xmz{|Dyf~mQk* @Q@0p   !!aeLdo&eِ!&) "*j,pzikγ=}{y?`pf'3. aĭBƭ!^5}%%E6m=eʂgJvOfd͜2Y_33a辌oQF2[#G(#; (<>H wk?7|fg? v(AWAA£0Yc0S90Wga ,U JAX-k!O6 &A( }iӲʞ6/{ffO=cFdϜ=sz̙3gegMz&{cٳffz:{?3 e/3^8? ?mOfmQRj8w>䋯?Bƾ %cpe3< -9×d3B-zƁ #5#hˈf2f3 ɛ%-x_}L~pOy}m Mqy]Y]¨ׅ7\Vy0;˜~!+<0:_קCO8oe(xZ(F).bx!}}B$F4-CEMrYNXm '6'cU&Ecw,52p^-hTw CŻL6 yoU=ςQ[NwT@aׂ=F(Xwo]C2tidPN=\UΉЉzzG}MT1vx_B0p9^xY$k/}6{ ̿v{@-}qw}{MNi}P1yU#_Ɏ.j{6rn{OA5]Жvxgpǂ1]`WZ3ȲvH|N CO.>H֯:Kz3HSElv إ95%-.~2usd|lV<-L"3o^hOV6=.`_oRqO9%RCWvV bZ"!pNZޒwIFTUݯ( [#i|yeIe0EH1?Ѱɤw[|ZO#E^l/;e}ȱv;1yM XOM%|Q{FEٿ鄀 13\L_] X =-n A/HYj+ȵ;`"gTKA]6zGĈCO 4P. js "Wc)D/{M9q03n׻3ۨzk "Sxqijf#!ylJs]\Rx0^ ;O?$C^>lHL^1wĂq+|'$7dRu5gEt&`H 啕@D/3̸JqϺOT"[pޮY\N7%\ɞAX9g0ސ>_@cgLlĒb/2Qb&IB+4t=8єwDo1鱩㖁VMb6GK7~>Zje'_n;AIj?l?`?k}sW[!ЉVjn)3X\cM^=#dto?E/.IBj&v$Ӧņ#=P C;Kːf1}7P,﫝#FwrUdꛪ+aIia m5RGD9^69fs2}Zw8ڱ:mg`Y)ݗogl Eeǁ^T57'\ C\I/a^e9L"}ƥtYf`9%4VUn@e–xh7쒤Z6%-p!y;5 3-#tDs[|_O D:IR\ĺ*Kځ*G`glS롊2'?Lؿ]t3 9Ǥ9¾%q'_ %Q@J8z6(nO=i6om-PW(cMc5D4 Y`>0<0.^@Ax=!B?K,KȼҒUFG(V sv lJ W"9v0zCw&K\yǦcلj0,.혥 FFwo.d,b0_Es@}iӺPlYb~֧zhwAJ:#V NٳQ6ހ*Hs hC)0FqvIzsc0. 敞^"8fU1 IۣiVhqktx  &r&_&bc-$9yԭpc:\J[9}"i !Miufښ"izPhEM-`7d}9~hk$%K/MMTHl܌ZNcƄL)ut;#e/;Cw1M_t|_qeⶴFzM\v,-.v Z$EkcÅ'|)31ȍ>ѥIZ[H%L˧+d-._3Z4KSd;HQ'*\rn8&[2i )NWUt θqsm3uj#R ;-u[U(/Z {YA{#70hhsVG.; 9Yȏamm61DXK&a[ǖp|!kXf|׳ba|6~9+W5uo|1چϗB@[xWт$JǠbɿaxMFV/ D@@r+NE̋xJEVxe.,șD`BФ'ę)bxIN>G NC+EgLL["DKH[vǻA9UAV#0W_[vx?l2T4[1Şc']~U>Q{M/Ǘ-/۽=XZVS'H&c s^b[Ig8ɩG~Xg^DKf]FoaٻW/%@(&-QZq+*R_YoطeSFQiE ]'ÿe[9&{z.~sc}~Tw+} l4[ \~+P5'$-BoM×QjB{ڋU;<6|}\Ӆ/!0`LoYdCZU^h}!iG"_Qw+a`*@D19AlI 9˦Pk̥y2lid!5^[)ʷ 5GtH+e%Aػj9v<;UtocBy62@5* 4ǝJ[*ұ< s8헿׳;aLs|p[DC$dLp 誺 O "%|- Asl_CN) 5c6v׵Ack6mqm.1ՋڥBBBT2Ԉy64STm唳 -5`~ϗP'̬Y[mv&!ZҐrt(Fv h@'L(}J/\*=eMt`GwˋKr②K?W iՑǟK4{m|>(^Փ՛q܄xH\Uڊqs~+˯n0W&_|x?bfs'-;dp ԭL4ɬJă~BMb[ݶ| ]b7wރSـTϖ4J7UWTWy&#Y}/*[q9x" -q)+1y]X eXI (DoN=k{ܠ/߇qd;DTJI8?/W) qԣiNU!dSNڃ1DȊ Hr$fyirE< u/l.R?j%xhy eؓU(Fi1IZ\%kQ. c+φgb:t"kPڂ죠iz+[ gԫ4$ӥ3\CbW2ꝰwg]0Nsτ+HL9,ͬ5 wEI5gcˁvv4=լcJ?J G43hUy^OV[A *'me'rO,u 22X8s@K${!@e,.Q#^ƛtmk]i ǠXXkNT1 'x _@"߽|^N"̈[=[Zvl4B]{uKpOƋl"_}_DmZ[+GBs=J"=k_MƉc7/pHJ~>~O\v-!CBz®J֏81|Z:X(aYnHZ}!5n=酽yspf䃞CX"6V|U~ӯw$B*PC 6Nn-H=x!O5N2쇎isܐ^Y}\}}xRmӭ-K?]ƲOÊ2M2"Aad&B#L)\#\ݡC;<)iCc,Ʀe͇c~=&)HР$5yWM̼}R̵r@ ݗ]=*;gR 6"0~Eu`M˅U;k VIIŷb)?"wFh.mhlXkƑtzT'Z}_ W%G`m#q5-Ru6BHxueus 7cWv =lsO&pzwE@PmV񽎫G4UU_ S=5v9ЂqEBYv`+*_W8\\ɳ,_ɣB2.9;NkJ9Siij/ G]" 䳎ˎ/ -x KnP94KiqB@'~-uw~4tW K׻04ijɻOւwQXR,K@Asi36ҕpUp X!XfcI_As̱ɕxQVܖeMhG†vU]zr Jµ󡪺rݒTBz^2ȼ"{&D8b7T.qAefe%{$ȱݱ{'e MzV!1+D6$E59wK)(K]dYR\@% ԙd@2O2Ņ*u֎HJc3ܬ\pwH7}{6P'Y|T-3JlN}"Or?[X27Ab#ץ='?} tN@*؏I mGwhF}z~lJʚyޛzy*,X 䡶~h[#T|»$ȝt˲aZ.I]޷s5XsxCR=ձiIǵ֯!Hrup`,K%W9DyH:V4Q'rMTگްM5h-31CҷׁZs+ k{(ŷ΄] l3l"drG_F RXRjVL"DUNۑcP*tAoToFIvjMJZ9~崙 V>wW(,â-N'`9n\H{m0;=p.K6Ҫ*`\%TIh5n S5t<̕R[YlzxZK9~N# uD,3saW+>gۃ/%O^BSlrYR ^}? j`hU P7\r[/LKdR,ҥqFӭcރ/ucax޷{\x+PvcS;LF+խMV|I5JcΫP-6-R^Um ;@@$ =c#skWUQ|dЕD&W:wq˷bMvZm6dS"pLGo4lT~4 7rZ8ls{VUnNxs[KY]Q{k^b(Vb6)Vi,v@"},?(ԋ}z辢ƶp Gj_p^<3?ױPS!k]qJD[!XjkڈT5ڹ[{| XIӖW)(/PsU_c0єRzfoCG4rHkvr6y}geuckvw2N̾|y5P]Ao ˧e]PgȥS7=ix? ԛnx߄wv|Oa&3OzM5LLOl'EJY#36*,6ɤ/9':saHi/lIM|]%!fL%=~"ђJPce:=^o\}o]FrVl\X +\;-]kF@=m7TnH"H+wKvZM"mΜta> Ӧ4Vj>eZ?λ>o9e o 8Qk&{;QNQC;qa`*NӍ.91GB/CJ_]}r.ҢrMHDݭ>dj:VǓHT5|!{w Lɷs<;t 4߇}ttR^{Vղ@I+ԛ]?DREoV\J 7Yj9-95R?_aa`mbg0nWak@AwudOD%Pc577Ge^mҔ&s5~0=}? ͳ5=^K^IMsEZ$˕°]˥@[/޷TGd=]87扬@b Nt= 7 ^7þFQZuj[HJbq#"_%,vb__$iC+C:_l݄`l91>qN>y1Ud=>Y4䆝%?+Kz$*YjuV]<$ d͎Nm1̝ehSsW}j/c#D)}*&غo:{6D;;'#~z50Q[57Da6uXq6Z񫹹Ptv%.amEGݧyyʁv\xk$!brj7M0V[؆#OO9sy:QM^[\2t_גW:q0qMZ7r%m-~8bm u? ~ohwǽ9Qa,}Ċî ՚=BwW@n!,yT7I^!/'+ }3RwdIǶykd8trFY: v6nKgW^gG^6v 8'4>&Μy~ endstream endobj 128 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXH#2BFzBookMaker11DlFont110536871549 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 129 0 R >> endobj 126 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXH#2BFzBookMaker11DlFont110536871549 /FirstChar 51 /LastChar 254 /Widths [ 999 0 0 0 0 0 999 999 0 0 0 999 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 999 0 999 0 0 0 0 0 0 999 0 0 0 999 0 999 0 999 0 999 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 999 0 0 999 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 999 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 999 999 999 0 0 0 0 0 0 0 0 0 999 0 0 999 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 ] /Encoding 127 0 R /FontDescriptor 128 0 R >> endobj 132 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 47 /G2F 50 /G32 64 /G40 80 /G50 119 /G77 128 /G80 206 /GCE 220 /GDC 228 /GE4 ] >> endobj 135 0 obj 4241 endobj 134 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 4241 >> stream xmX}\_ggYi=]=fIJ+Q 1P$@ XYaf_]vV 汫ǺZ[nYClu`33<{~%IHI$W;IJjM),MnRn^[t7Mtz8NKiUD<؞]7n|m6S]M9й̆@g!\6e/2J'Ʋdvb`7& ުp9 ԤS*.M"VHlER2f8S)( -vU5,ۥHڳ_(Hphtv+GF骒⧠xx/CM ]1Vf6i$k {tnZhJJ+%>@Yy2bǔ`?MR 獆&N}dba˘'Ut)Ld%襏 Z[޽$Ґs[\ uHfQ&-n%pb VF*ùL\cm `ȁ5|bq87hAuZΈXUdX*Ѹk5\JSV-0f!^ɬJv :b$wvcB{w=l0䗻йc#x5E!=) %U[~6 8z&cBlɕ1h.5*'Ի`tI+,hwdҔ[q j: ϊa~w!=̎AZ(e$(?1z!K94+Rg28k]XeD%s_0lCiŒ'`d?o)юހhpԥ$.dUKBêdvޖoy^ {<FQ[x%&L]PcɿyGJ{\ssA1a,G@e_)2_V=оGQ/١_n!Vҋ*u ؽ]FtHFo~ s>O Xss7]pyL}f-R )%9p`6ۍdh4`57k`ۏ%w;eMlܸ!\E.rPckajO=.ʣuxP/C||aUo."bb$` tVppO]> eEM c8@kjazt~8xSvN5H) [J!GL #WxW b(D0\x d)b9KsXiKo;Ru*tTp$uDc7s%G+i J>6l Rty6ˍ* X`(G0X̌yvy\d6`N`d E4W Дd]> C]?W&z;' ,ԖChK HiaRhG?ůS$. cA_&9=^% z|HD9Z73e@RV9;CMat3I ]nU_OvO戌K$m2|LNwFϩ~f Py0k}H)3CC ˕ʼAf0~DCpFAYF㴵kJ28ea4~8*ʄSVi}? p joi"y*TZx3T-N^Lǭ$XSZUk7La8^o0izM&7 @{$mPcژv!Qm8Oh{/LE7N '[-BwWXC[}ydoA|2舉B| ;g2.#hwͿ˟dE2q…;_{}m.ԍ 8oeR mv_jrZ%x b=/tǐ BWlmp:V8V_JHmQ?1??lSg| }cL-S0UyP**zG3%*ڄpPK>]%HȪ}w"U)hcGe)t/Q3 6;iH;x? Wm_q8NwG{=I:yut*>IZA;\u\cnK.^4;$#%Mm[:^ ] 4 <.5>(D؄: *unxī3> endobj 131 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXI#2BFzBookMaker14DlFont140536871550 /FirstChar 33 /LastChar 228 /Widths [ 999 999 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 999 ] /Encoding 132 0 R /FontDescriptor 133 0 R >> endobj 137 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 39 /G27 40 /G28 48 /G30 ] >> endobj 140 0 obj 800 endobj 139 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 800 >> stream xmP]LW~?JGmt.'͟D(2Yo҄1չ9|H-tRڏNGAJ\iWƟF/LxWzcmQUry{\A#hM{icKC9/]#*l eLSVxQrQVWUer5U|PAD/֕%̯CZ"7m"L$m%A93N[juZVtڽ:mZV'nݶ9 q. 0U+v2"%3 *;GG72uDDOiT` ,IE#zx .%v!e|T6 t!z%E~cJ]TݧwI7Js}\YJҾR=[Xh; g :i{wmpRcNtARnɜ?zۼK^Ǟ> endobj 136 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXJ#2BFzBookMaker4DlFont40536871551 /FirstChar 33 /LastChar 48 /Widths [ 499 499 499 499 499 0 499 499 0 0 0 0 0 0 0 999 ] /Encoding 137 0 R /FontDescriptor 138 0 R >> endobj 142 0 obj << /Type /Encoding /Differences [ 36 /G24 40 /G28 76 /G4C 88 /G58 111 /G6F 139 /G8B 176 /GB0 227 /GE3 ] >> endobj 145 0 obj 2623 endobj 144 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 2623 >> stream xmVkpU@nf}J a!$("bH <'y_әW&Lfv2aB !(EU.eYZVY U{[]]sy|wN :Kq)p꭫/XrNEE,6޻bbcFcK/|q))ӧzSq:q;;fΘfͼ=]`?onׯC;;]ܭ?qtqrlq 8n .%y4-]g}W\J[ NiOS9EIQ?1Vpsy.m:woO=x@~s/Y:D|x7:Ed#HzN5!틟'sH,WQAiL!rׄ+ P%LQ  M4MK hTKsÍAZE8F7Xk5'_&ӆaE*Tp+^v+=tbWQ`-(urQGT1'(&FHY/v^_ XPWVZ^ v.[ }u0',U 1 4JrOF$vtG!5-{0hr4Sw0*J*@Q\zXJOc7΍QV BSywT *^<L 0XqKSS5EEKhۥyPDIb۞KWcG`?uU,$ =m*` BpX FaO%+3)ZO X՝%APܮ.-Ze_%S]IM[fDҮ_%0h:} \C#xy73B^3ԨF'^wMy,(F yJ:0cnފb{K[t0}yj#1a&V]/-au:\+7-tɁF+?B?ao7AS0JQe46㦓>d&_b$9 !uI`7T8tv{q'`;;+}h'DC^[pM:"Wo[[mN 6I~O#Y Yf.aē'N1F5v+A?\[x 2R:!>dZlaaygakc(Ӫ:#530>PIkiьM uv4tȘ@!ьMdċWAU[t[ "(N,2T-۷@冯$ȗ 2Y 0ZʊSg_^ FK@ktY5 WGtti µh *Ze %у-R-zlL'.r.sZ>yOj.֥"y3-RUցzU"5Y;FQR;+轄+$! ,ƬhO2W^ͥkS[8RlǥQ|>IeuɅG3:_(.%2?ՆPoY?JMW6 4W604Ѻ` (?dfNwEFErr n;!EA{,=1C T購p}y&M+sajcn9+*LXx g X7n7e@nF_yO!WET!,ݑ8sh8k}:bQh B_ƝIWqA;!̡W~ :>Ɯ7wT>KKюPY4CYQ6DNdN Sy_ݡ :G&Cf')|ntҋ[V=  ȩáӸv~ә\V4Fc9I{G"gx8eR)~9Fh.ڹ @vcOxBnK 䊶P> ڢptKCA%H5 ^bi[!ea0|:`#KRAXQ5dEG8 7䓛f22κ'J7-5m.]SZӓρnFQ%ð@_ҫ8(qse VuWX6k 'ݐ|Z_]At0 qOiark,m`+*1؅5`kw0Վτt-Id GO#е!vǻEx0+ԂJ Aö5[axͨyD9H%XgzwCbnd;lZNDMY @bR1BүAvV蒰Pin.b endstream endobj 143 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXK#2BFzBookMaker18DlFont180536871552 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 144 0 R >> endobj 141 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXK#2BFzBookMaker18DlFont180536871552 /FirstChar 36 /LastChar 227 /Widths [ 999 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 ] /Encoding 142 0 R /FontDescriptor 143 0 R >> endobj 147 0 obj << /Type /Encoding /Differences [ 50 /G32 69 /G45 71 /G47 141 /G8D 201 /GC9 204 /GCC 205 /GCD 206 /GCE 207 /GCF 208 /GD0 209 /GD1 210 /GD2 ] >> endobj 150 0 obj 4640 endobj 149 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 4640 >> stream xmX{|T噞ANu* EK4TI[0@ !!!N283g%LfLH !A.I **]PֵlmuW'/gP/9s{̦ɷ̷Lf{E6.]r_`k=,aUeO.xrS9 9}}cLbS&}4l v'L6L엯?No=6wyۛLSMM&C&Li4dg2L MLgn /_TeK_4)n,_eO/_6>e|\G&~330KfosЬ̪A!FI1MM4 M4eI;w*00~0m%]JHvI`^UA+D&)% 5liV"^%WXg"(HrHɠH~1$Qm:Dtdz_ɾNWɲdA | ukU)W=GAm#ILh>_'u`HTKE//(_/X_|*%@r sIPנ=?<{4LԩtDy6&Z"`T\ Vgwa m&_ h 6~K\@dկHC (ol( 6ZPymN !OA:zW F&1Gh|ND6WN~?> m-({5L>)R, ;ԯbLR>?l(c!d<f>x8ؾn&C;ׂWu( Tv* }?1OkM.'.ϥx "`03gH{AfKs{kwD}Kwy@<;eK|Wa /L "@%`ZyhO>MÓ[d]tO @~I3l.XXaNH#UGmb]"'hnrO9ZCҧf_I~P2ZgA mlDN _kQ u*^xqTUWkBH a/RG0°OAh<*Joҁ[/!D9+  ȴ5€P?ڔXdه5 DUu 6("~sFR9֑RV]o$r[D;9ZHVcPˇ 6{ nj,W #9ԨFObُ|5 H (듰l7J:V {/8qyٴ`:5K]D/ZPC࿹ܲCEQMr7)s*iWmťѶB<jCv{;w>VnTuz+-ST<}k잚=e` ~m4n'(VAc z=yWɖ5/x,b$ 7# &;8L\|}3?Dn˄Wb!`=ňB  !P<'+-`$$ar>-厶h zjMGIY!ɡ~+W-Wj~)AI0N *Z].J`x, R?|E:vE"4PQ o n> q3B/pߦ<*$$pwBXV`E xsK}m %^OlJQq~Pş] A/$ሄYBq&!jSx-7:ׁZ7aSG,y4;-[јnS猖r*g{|q*mQŰx>L.k48KZ@5o+#tFx\׽[ 9]J3gcaÿI@*gkeY=8z\<k+Af;vjQX651] l FnF!R[ 4 'Ѽti- " l-&B_I+Lt~s.0 Rgϡ_ѥ;A332.M5#`'+X^2 /? a OSX2U~p}>9mzpz^6RO _@D3Q'#i_ ۄJ;!S*RcJInY@sbk.)#?]Vj+aU"ōN=G!uP>T:mhກîM `,!xRa`ef2UBߣa 4L38}3 e^}2xU}W&;N jT \_ NgA.!jФ8 yDX~>;-Y$gx@%Ep`t*7ѢQɅk\Kl[X +il05^ ?dDɮl^GpWt3r|֭5z x'(#VOE~^F;z#y.]D%bSV8kq}6@mjkc%z==V}U3kQ|2=àn+Au{޿'.8 6CN|^ :6+hȃmJSQǘY%I)buE(% s0 NƺU%a;sN*gHՊUuÉX0g MvWUJb Iv$vi?Ʌ|Ôcw?6ŌA׼) NG0fre &yZ,+Nj0Mmi[e<5? =SWt{o[w }*F`J vIV@{FNPÑ0>$x'|ދΥO^ئ"6Ln)35ߟ,f }\ ڟ6i5kǚ/3Fk %p)P=z)5׶W"X{*}hGX()_{[m Tcb}z IGQiC倢fܨAYANBN-ʑ$Ek@xE+&Y0,E3 g!)3vd SA؎vHC$ZlBcKۍ9>˷ ދRԫOkL;Pd M43\QdVC:lKfY3YeS(M4C&Z8~ϣ4_~?8gMlN܍6R{;nl{ gό/Jv>݃73ˣ, 0p[I]eaJVvKC$; D^^7?u2lFu%+v􂓵͍LJ&@c_ Ijƻ)fh^M}G1/w]0̴eGxTcBWCȔ/\$`:#@*RY'B[uGZQmdO&O_6޷Ṃ:(tըߗ^n4FIC#ۛ.$cXdLF^i'/6vJR?V5X4BIF" 6=Np|{3}G!c endstream endobj 148 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXL#2BFzBookMaker23DlFont230536871553 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 149 0 R >> endobj 146 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXL#2BFzBookMaker23DlFont230536871553 /FirstChar 50 /LastChar 210 /Widths [ 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 999 999 999 999 999 999 999 ] /Encoding 147 0 R /FontDescriptor 148 0 R >> endobj 152 0 obj << /Type /Encoding /Differences [ 36 /G24 37 /G25 43 /G2B 66 /G42 67 /G43 70 /G46 93 /G5D 94 /G5E 102 /G66 105 /G69 111 /G6F 135 /G87 138 /G8A 139 /G8B 140 /G8C 141 /G8D 144 /G90 145 /G91 156 /G9C 192 /GC0 233 /GE9 ] >> endobj 155 0 obj 6439 endobj 154 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 6439 >> stream xmx xSUD GrDE ؑ{Tb)TKPJJ6mt$MH&X( V*Q=xtfq~/ϜsV{VV9uZzҤ1JiJR$=f%kW>|Ⲳś^=gisf?>/so^5|4<1m[;n[wQ ¯ɓ&Icɩ!܇.K~'g= co|#I$i$Mi4C$i$͕'$i$eJBIZ"I%iIzG%I%iw9sss1})ݱXgҸY]II?$ {NK?; :ib2jGFL\ʟY >=sA0{t:~|3[.]]si3I)Y9: %=GxVנ}nR\hYgn4mXKFҧ6֭3PU^][Cq8U*AQϤqw!4 Buv9eZx-^ i{أC"!2+NL Ô- ]Vg{j^s4H_~0q+9[$F򀮺] Tν/w렚F]&4wo/A?K#GkY/nCځ/d􃵆Y\~QFz>#V`-[ B5x(WHNH38wn?AO 9ϘH sq!2l‹)[!3(MeMFF;;mh~$92 G/ fͳADKfQKn E"4VBq-O!2/Ή+!hmx ݟAoѵ料luZր9z@wdy(N.?6u +ϥ!PtšS>A>ꉂغ.3{ :”>6[j*U6*,p1/}~QוSP?(sEaiϗ`YU-VًkxI)uhRZ:\x1er3֪GU!dDH(dwmZ Wu%6ν04oE*vZCAPm{Ͻfe3O9^pjohQ ayz=6?)eѣ9{ϔ.P쉹<8 ۇ4\ǵqrd탃?6!T$t.1}3dC$q '8'mis"S!Ea+#Ҝ7f 3T]`N{i z@ 6 9z{v -;jґܕd0Fv%n}0L+JE!B}AG!GJW5I!WLkA9~FCud#>/ϛq7?/wG]bbjů |Tg#lpIQx0tl<7s~?%5TGXyU!t_c:$dɉpЏ\Rܻ# 6]^-[feˎn1}qv<|;1ܒ:C|5"W*r6y_>?z3xu{bq?x?$ѐMܺH@?po8BD4e ~Q:.Y?K@[er8:: #s O$߈Sz+YlNX {|?!w5e6f1w5r  ^>iw#O4ϰpiS^#wGG?{K Tׄ+C[ہGZc Zw.cl>b} Ghk?6D" 41ս W]FOJx6&ׯ- 3dwpe6qy{:?,jÃ8.877x._n[Y @necIchh<7%+|_k%l56="8g1wAdGP' v,-RNV+{zL5Wr.JUySx*>5ljAҪ &@68pipŰ$[>r)~ʐQmbY0z`m*odbN |Rk,99 $\ ԩ6YIoͱ2O`Kuҥ@o$XGf l:\wT|jF%uTlm)ޣb=|Ej5e>cGzBJdVL -CO8G;6EqSA]w v>m-E#Aj\ +GNFݔ7A.4L+K98M [E&gЫ#Ot7.Gt{?' ]VlV4ٝ Qپ;$lGG xdLy+ {:N ʶ dS2O#J5M";ѷUBjWa({WPq#2;\`*FJ: -@Jo !R:9u;#z< A-n# [Cm7É_P_f;LV? u[`OE_6!y*eatLZg"+:!;0FG=j^DWËf4}aRܐ(oT+M‰SJm|cP'0#b&D^uSBllȥ8̫d--=Husi3BX/3+luRv^8hi!d@hPPs9;y[LI6ިéxPCdӦ2Nvf |J=i2;zGNDIS^$ZkS-n5qׇ^Kg>:{}KQcZ UR΄wccٔ (aϧFNBUoY~*L6+_+ .W=vO"oLyo¶z+9*~3ڢa?M=A Jj(ݕIڿ3oC1 s҅`T7!5<>Q,;+ԂNBvKF: sOl:Op LG-|ǐ~ۤV;ŽF[G=h'L\G-<5 F)ViGJGJBh{G7 h|;;]VWmapP=jծ +ey`‡.3ur%gQ <:HClM.ljWNP!\ 4{HfWŤPq[tѐTn,Z"O">llLcΒ0p MU)=d.=~M>& -^(NЈDkPY[횬e>1%ߛlҼ&1 0PhVėOBD' U(J<~ TjTi6Ď57 h}mN%vu!>}p7`gxG(ǑfX 18BA piӶ1SiZ鼾uPT!F%pu[;x Cn2MS:BFYq6UWcJcl a'c`0U"#hENVU¥r_Axer0DRWssMB/فf endstream endobj 153 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXM#2BFzBookMaker12DlFont120536871554 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 154 0 R >> endobj 151 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXM#2BFzBookMaker12DlFont120536871554 /FirstChar 36 /LastChar 233 /Widths [ 999 999 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 999 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 999 0 0 0 0 0 0 0 999 0 0 999 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 999 999 999 999 0 0 999 999 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 ] /Encoding 152 0 R /FontDescriptor 153 0 R >> endobj 157 0 obj << /Type /Encoding /Differences [ 36 /G24 68 /G44 73 /G49 78 /G4E 107 /G6B 210 /GD2 211 /GD3 212 /GD4 213 /GD5 214 /GD6 215 /GD7 ] >> endobj 160 0 obj 4108 endobj 159 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 4108 >> stream xmX}|U"s΋ʺ.?Y(+J񱅂, RZBJJH)-!LOda!mi,--P ࢋ{.eU^;{ G9}yަRAxlY/sr8 )XeRZFGQ'S2I?{PAl蠾: G߇cFG-ItJ~-g~|M1|^~_ޙA)a <,a <.I0Y|jrdI˜<;sʬ̌23̘1%3\͘>ORS`JIRCr0>ag]q w*°B~Rcn 6`>A!I ? A@µץ;]-曔 \7eM HUY ?цl&(. rL4ϿIv1F\ F5rVϠO Zzr)̥H.Qƹ@ժC8^V Ze»Y-d"-!k&azul c 嵲.nm9-`'l jqb`U4y|0RO֛p/+c1D>]fg:KǼ _Re`N&N٫lYN^ 4eMYpKUkݦ7ҩJNWe 6i\WX.d TCg&3 Dj!tlU2We|{0̶nPBSV]&fy V|c+AukQ8pXCI[uF!LIXJE܉""7|>UTʙBJ+1Rs2>qzF4PnF,ATBp!sAةxF |&)Ec";8&M_$;8NY$փT_P3_oaگ`n_f$8Y@+ α|y|6-73ktʝe./koBsxZ6v!1]4[:0- p y+C0?38LroaU/qٻrk%?OA$Ƈ&1RyI[T/pS r;6S6؅犽'psa ,~ܱDhrm'vqfFIp"M,;9Ly9KTAmv+aaę59je3a8C` O.9k-y{ <GU'w,oQy W[.Bț9$@L1tη, V(0pn\*3meKC4G5 Nؚ=yJ!Ubz_|Md3X2w2VTDF0]cXȢ}˂m*pc BY^tľH`xHUu1`ӴAY#U5eMJ#loWcߐ:^l}t: N͚8m*xܤFefM$!nRW@|XMS"BgӴ?,e-"EZq8L!ހRdS*jIyǮf_Rro'Tvy}ӓªbyk{ Jbx״# 'O)e¸Ԇ^% T&z= kP&G-  \}=>&X£F^F,#$-?9a` evy yvrKsU}^\i)h iuP3.,'{8a_S@Dxжxسwep3qVҮ5fL f5'#'ہmU~ uEK/ Mq ~ū4!hs$'yҜ9I7۪eb5.-J2aUG^3 FY)οx蓮l&#jx ^˫[j$}k q^g#=+| wԆ)љ8Nݱב򥞍 XZ6KzRvpoU%H`hmkugSv Nw,vg;VCߗ(XsP0qR[.Xݝ.kN801-=<= >tEG"G2.T(O (׃`1㗺ybى^k^d]X"Pg?,Ծ"βPhvjlrبԅ*\7^1ybc:Wx).MꙌKX'!Fgm$; g O @ .6&w?)y#ɽsXsaGֳ4J>w)'쀰;Llfy!H= 6Vpl)7`)e=p#yv\jwtW.e!Z|IѰS[C`?F\`h}}3=Z4=lIުVVp0v:Υ EcK[:=>+9RLqkuIRԒ{ڹ<uwQ;+.wYNUn -ko;Z GX:ރ:%GlbWȍ(cȴ0"}ReґgaEւt7n}ة"Bn"ͭ 0+kKzvpXWX$[|d/9sR u#ZH(ʩƭø ; vϤ*Y>(6)X{ۍnxSj U6T-doDw̷urݩ^w[deѠǯ$z,, ާoZ+6轭_ / zLm&5*5Ĵ6^Y\8r7_k^}{C#-!{TмE0Ǣ^&'^9nUUtB[DT endstream endobj 158 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXN#2BFzBookMaker19DlFont190536871555 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 159 0 R >> endobj 156 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXN#2BFzBookMaker19DlFont190536871555 /FirstChar 36 /LastChar 215 /Widths [ 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 1000 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 999 999 999 1000 1000 ] /Encoding 157 0 R /FontDescriptor 158 0 R >> endobj 162 0 obj << /Type /Encoding /Differences [ 38 /G26 51 /G33 92 /G5C 104 /G68 126 /G7E 134 /G86 136 /G88 142 /G8E 224 /GE0 249 /GF9 ] >> endobj 165 0 obj 3187 endobj 164 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 3187 >> stream xmWTT]4M'mMIT 9- CXAadB@D&q޼988@&2JV׵iڞxӓyC9gC?3{1qrg⸥6+ґ=j /9jWfZ*##qA;\껦9`N gQ"sCܢ 91_WOۣ׾=r{or?q-.%4-KM]:7̬59YYYY99+s_z{E. <͙|&4$lSfR9@h-nܼiH?-kQ|GY! aH}r0OXj߇_ [~7%[}' xmWQ/r#M>-Lȷ?~CgAxi ߈}yv%*Q$?!ޠ[<%LӖAےa7oNn_ϛmWJބ/ukoU=޷^< ?:wg= 5 ֽ}1snVy%dv6ܘtCTOvVj؈oҐtM $ǩ!O,u3Y6K(+g$:Rd;J/sI_Q@{%yNfh+#| 6OXL'+"(ntӬ%Ry JJvDC8%:(s׋C@d+ %0ScRLx@m^$m~YvJYB_ˬEr'Qs=6lJ  QO8 +6m7g'`gYpO FUE':@xpwtUT]Y@D<L[MIV'av_SwK7^Êv?/x YMK#釄yqAB b#eLgo;ˆڨFV>`ʴ<.{°T~gaix )(r,If.饄εpmb /ŀD<$`ҨTdJg-Ym>A@mɣGj 0('*L0* Љp@5 TI9L"F'kC1 C؉@P Vo!yR Y}+xÐ:T}QQ{uXFJ8A#iXbd$< |63Ȳ AQecAņ&XkhkR|\6;o &)v~h endstream endobj 163 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXO#2BFzBookMaker2DlFont20536871556 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 164 0 R >> endobj 161 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXO#2BFzBookMaker2DlFont20536871556 /FirstChar 38 /LastChar 249 /Widths [ 1000 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 1000 0 1000 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 ] /Encoding 162 0 R /FontDescriptor 163 0 R >> endobj 167 0 obj 194689 endobj 166 0 obj << /Type /XObject /Subtype /Image /Name /Im57 /Width 1881 /Height 1145 /BitsPerComponent 8 /ColorSpace /DeviceCMYK /Decode [ 0 1 0 1 0 1 0 1 ] /Filter /DCTDecode /Length 194689 >> stream JFIFAdobed     "#()%$%%!'+,,-/4443.4444444444 ####44,,444444444444444444444444444444444444444444444    [!1AQa"q2B#R3br$4CS%DT5cs& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjz  S!1AQaq"2BR#3br$CS4csDT%5& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjzyY?^I$I$I$I$I$I$I$I$I$I/Q3ؾؽ{NVNc}L.'9o_$'{0{7~; um`r $_\{{ 3#z2#I$$I$I$I$VWnW#!oI$dOIݰjclW>ogI%"I$m/#}h2I.8}2rX{ <㬤J؞?x|e41G?I//o_3 nAMkI%SG^=om׳)=)BI$]Vp2ezI%ƤI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$$I$I$I$I$I$I$I$I$HeYXX8x$JNwK>ѣ$K1$_LwNǿč?&2.meo]epyI|ΒI$I$I$I/SU[}h,ջ=GI$*ou8qOI$bI$ӿSؿY7>%YkɒI./'.=WI%9y7#/%wXltGdH $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$HYY8ؕz2Z$ v0g02} nV}U/a>&+Gw~=Og.Zߺgw<=m`SPxV}ok B 8,ӫ $I%&I/c_'oz$ĒI$I$I$I$I$I$I$I$I$I$I/+%>2`I}?(>[|]dw$_9}}u# $I$}x]ٕh9ܛI/h{^Glg~`\:e[I$o+I{s>I/>_fi886E;?I/gŐG΄I|I'c]cqI/e}-~I$쁓-+c[I%v79$URI%ki]="$I|$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ig{0:Q27&NJ{vz)/,=;7Bmr\͝PV]sN[`}ؤWiC~ iʯS(M>-veV&̼ռۙN]n%~Mk~ pkvk*T`p}iU5`kD5WW0K)'IoЛ)$U^ĒKI$I$I$I$I$I$I$I$I$I$I$I%mI$I]+Ln@l%$]Mn!$K&?q琒I/jd="o߿{~<>> I/iY epd$K?g|}ooݾh5mI$sݳ0.ƹ䔒Ik׳ 1~ I/`z+1&'dߦh𭜿 "I$ٝi)~RI%??Tŷ?*I$;fϸaP8ɱ0yI$ޏ]5t_4IxٿgXI-P$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ $콗Zf##yq8 ÐIpd;=ѵ5ؿ}J*1R*}U (qt_e;~fE}4'4Novvn%>sZy)#Lc-ATEVs]HI$w}I%}B$^8I$I$I$I$I$I$I$I$I#gd:si5I$wlwk&}_sg=I%8?%oxY~mUc5ԒI GۋjQڻ&?ы[uI$"I$I$I$I$I/k+E>~z~>I/I$/x`>4;鵾$]o@n/kj:w>pI+_e\Y_S?I/>}}\A$Q?:;MZI$WG`c}^(gU~67I `dskOSUQ>n>I$>k @᪦}57$KkI3N,I$mԒIyRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$}g}lgŗU-eݘwў C Yo񑇑 ʡ3u/p-@>׷Mltɮzg":{#WY)zk8geʽKLAa""]$DRI$I$I$I$^;;Bm>bv W{I/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$q$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IFǶ}-RD,\'rd3ʦRS tLŵvKluڽqb)dvdw6K_~3OsNWrx2-o[\=Rev}*tƿ%_gv~l_TXF+!a`McnvPc2KSI$I$I$I$oЛ)$U^ĒKI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?ݛʼn$z;>_ ڒI/*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\^1)w4eVB읽"%'F賹9U3SjkvַRV{o&_͜8\kS?ӯҡ7kF^ t8|^Ib2 @! F-.6I$I$I$I$K{?M^ؿNA/bI%$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?ğ|S?ĒIn|/OmI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*˝w)yYvwmHp$ieQ8N@i,} }xwEu~$Y^oYZ5az D?FԚpeP/t4Q$I$I$I$I$I$w}I%}B$^8I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.I3N,I$mԒIyRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$έ$h${/}_f{h,ylJJh⺍Ǝkb1?};ϋ.~Ojo1\+Z]ٶo5De>`%dmc/þV5=;mCG~DX4I$I$I$I$I$I$I$I$oЛ)$U^ĒKI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?ݛʼn$z;>_ ڒI/*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\گY4~xwz5ٿq^y's{{(c~7|D*7ȯd+/t[@↜8~jd`p۹%_Oiq/ڒJe]خjχHȨI$I$I$I$I$I$I$^;;Bm>bv W{I/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$q$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I3$K9_.w|3zIHG>U*,]+l~bz ,/ .%&Z͆9ڱd$ =6WR]G/}t蟦?d{V寥cyabI$I$I$I$I$I$I$I$w}I%}B$^8I$I$I$I$I$I$I$I$I$I/Q3ؾؽ{NVNc}L.'9o_$'{0{7~; um`r $_\{{ 3#z2#I$$I$I$^-~|j/&8ǭOX@I$+1q1:3Ii?evϼalX|⏨$K>僓30ߎWc|I$G-}v5amRI%_~O`NS{'uI[;v_}πf=~|I%m}Awm<`{mgI$Wߨ혚/YaS7$Kw>+Gg?ۨ;'×I$}k۾緰zc6ǵ=I$3+ nL\|I$$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IawO]w~ߗQjяwV߲}l[RYnp97# 5 Q, Y\m;6 K[7^se*g-Fvzk]K,<*22Ji&1mA/wJ d-ˤ$I$I$I$I$I$I$I$I$I%&I/c_'oz$ĒI$I$I$I$I$I$I$I$I"kKI_I>wIqG[z4yIf$K?Eݭˬ!I/I$I$I%_w0{glv+Dz<ק$RI%8w;Wtv;eAd#Kkiow&Kħiڳ,o yVo"~i$e۟o|\e$Zb;GњM|_&I$ۛVݚ$Us9&]+I$cww?]!Y[_~ I,\q2ȩ6I$sj~KSK3>%I$[I3N,I$:O/`}a2;խc8xIp??I%_MYMպkqks$J $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ICZI02Y=O~~&_q/:, J{Sgg]e%]ϼfT'W_k>`|4af˲됝&Iuf2&Orқ3 i< K+*WOU/H۶VYL Ӹ%y.Gqm!%u9WI$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$I$I$I$I$I$I$I$I$I$GÿfU@]'tI/l U|C3$VLJNnex%oг?_4IxI$I$I$I$I$Hc_7vIONAֺI/{eZ#g$_Uq~;<74$KTI;Ik!$_\j/{{+-_I*c֭RI%tyuƒI*$ucKƮuTg$_>?ݛʼn$3;ϴXf#/'!&K:<~I$~oo\I$ew ܌ߑcNqI $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I&{Zq5 I [v߱gpȳ*C/?t(d~1%%wxmwe{|*R~WOGio^s].{O< |pꦄ!\Z=7s6YXp /N=vv`ⶎ?9 uqui:KA=UI$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$I$I$I$I$I$I$I$I$I$I$FfF-Ϣ̵!$_OV;g 8Wy]I$_lpjk;B*.0x7I$I$I$I%'ھz?M5?InTwGd;6?RI%$}Y +|I$ȩ$v5=o7 $f^wߺ:g줒J?߲~=ձ$_-wj_]cI%U$_\vk/~ڪ*I$OwfqbI$ގCkKʒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Oϴ_hq6 g(YvRR*),/Sܮʫq&ZCq]RYle̾ekF%Vqxkwfbev{H\']wO2dxT3 U RWhzYUMୀ5x fr,SI5$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$ĒI$I$I$I$I$I$I$I$I$I$I$I{ھ8m_sIx'[txq:RI%A$I$[d~w=]Ly(I$A_oOg;$\I$-5U,v_p7w;K?g|}ooݾh5mI$sݳ0.ƹ䔒Ik׳ 1~ I/`z+1&'dߦh𭜿 "I$ٝi)~RI%??Tŷ?*I$;fϸaP8ɱ0yI$ޏ]5t_4IxٿgXI-P$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ ,úv;$))"%sB?ͳTUñt݅;~R\}3qɊkmV f{O>¸o3PE^C1(Q\jv]^D}-2I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$I$I$I$I$I$I$I$I$G uBkkw'I/to_(8c7M^z$KpŦ.Kܳڪk]w$ڏ^OeأvLII.E$I$N`$K>eSb;!Ý:I-`$_/ճI%{?CW\b%ی~I$=K7s)+ =moI$[q;74 ZϜ$Jb5vw{7WT$$Kϻzh;>W"<I${/v}ΎoA=I%?j>8_W_M;xyH?d;?}5UTOI$Ojs8jMM $7LӋI%w}_=$^TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_^wq{ox z|lKoa}:%iq>L~os'}:3 -vu-kתK ; .o8M/5} OU Z{U0Δv.#L$ֈw?V.us $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7LӋI%w}_=$^TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ve3ִ_cKAT?Rg\䮃m_q.Zw:DZD+S:1ʒ{o /01_7佲ٵy(?ݟ׼r).]\I$Iֳnt$IA$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IwOwfqbI$ގCkKʒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$N)ޕ>c{<~-7P8H骳0kԗX v9AZtWmC'b}T7;-, Gː^N^jK,> .4~-+t.w~}M[eI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒIxI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$'_;8$[G RI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IXƽk9$X$\_^߻=ɾ4/K얁{*ݮ΃}bv^^;N/!wݟ5 1Ztﯷnzw|80鳸vlc~| 3XcRӵvi?jK$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w}I%}B$^8I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.I3N,I$mԒIyRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I2Wh+Y_өQ# o^]Xb;N+^[xջDmRH!lJ%W_v/23nMbTsҪIm}y]W`FqTl;U=]R[ewhwZ{*1G?3DujVc4Y$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$ĒI$I$I$I$I$I$I$I$I$I$Ihw*[\OI%Z#)$dI$I$I$I]>L Ϊ8~$IWĸՑKseI$$I$IZǸq}~eI% 82I%]$I$GϳƷ!S I$3{gr;zչRI%Q$]ٿgXI-P$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%}ce?uog!ޣynAm+sa䗙wݗMc꽎ϢβxC.e#fJg˲1kŻaO=Z u6#\'>R^>۝1xr1oF~!^Qm+$iV).[\I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K{?M^ؿNA/bI%$I$I$I$I$I$I$I$I$I$~ۋܰtKs1,&S)I${?浽ϴ;~;I$> f$Ϗa$_5I$I$KįҾ>ߎϕؾR܌fzd9q4$^=_~vO,aRI%Oz{v8uLIt7avf;fn>( /x$Z?2{c;okm lOli$>߱h ~%Űg $%/U`=LV?d $a_eʱc_mC߾B|cdI$g־>OH,{O>i$`CWfl`aV~ $$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IR= `Ygm.>6sUբ)/4k~{X_@gHJlKͿf[^Ҍg) E%Wv>sOcZ\% `ܟbK>}EF9 [YYZ5Z,nQI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$I$I$I$I$I$I$I$I$DǴWhƷ I$ݻgxYz/{I%PLi$C7xb/oͲ;GoC I$oI$I$I$9XCP_EC^&?)$Y$]wo϶:y $/{3N/j,o8})$nĽ͇_[mI%Med}l>$KG{_~՚UN?-$I{O߃Knk~CI$oC1>d"?Ky ?I$Kq?m;I3řpoZo $íƽ2I$Կ "Wkx$IxٿgXI.u}UN._j eNw[}ǟp $?" cKquVױ HI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$=_GwgZnPx^e6PnA$^Sƿk\Itu~ BGl_%v[[mpm;5gxd}-̬l|NEMscĂ mvNjbp7`]:o! EIE櫣w Jٞ;d=_Hw&JmUpҦ 72Wq0pZJx*]e̺HI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^;;Bm>bv W{I/I$I$I$I$I$I$I$I$I$I$1^eT:񅎏VgI$߲{/w kI%7ŗwe}qsmh|$KTI$I[m k$K_^߽5$_'Kw-qz5$_Asλp~I$-`e~Wg!QBI$DI$I$ןZ8ۿ&q$JQ.{GZ\>%YkɒI./'.=WI%9y7#/%wXltGdH $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7{{96NvX+U͖l󟵟k~}ÇSVUo\ ;3{Gcf'1Ir쟻~j ,'ܫxթnVmPޙI?Kb+mōܬQuU]?jvfxt@V2Iza877z)$OXT"f<I$I$sc I$#4.6I|I.^h韎I{9mjSXK֤K÷XsҒI/I%:ju2OphK/^n:G줒J_ߴnMbca$_0w3בkwISI$ņ ӴWk")$'_;8$[G RI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IּC@I.3nojXhJeT>f]dECIpyceX}9t:m ]4;^?R1M%Ɯ>C*ϯ]hպmó5U\#KkZ <'I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$oЛ)$U^ĒKI$I$I$I$I$I$I$I$I$$I+õwN=M׭JI$KPnwOzs1$I$|;uγʺ˝{$UI$I%>O۟[f>G^:|I%5ۏu+qkzI/F38C۫u=88Z??$Ih F;&!JI$OYݚvi^g$^ [nAƹI%+3ۮՎ5pȷ/I$3迴l>K;|H?:}7χyƟ׼~  I$mvم̋>YI$=;VG{X]L[X?$I}=;[{=?sm,I$o'_;8$[G RI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K'/}nwTY1ΓGmu{2DH}纵d;o}V7fQO[} /+j+`{sik״C %%wfԝpIt];s3}O̱Xz'yƭBL|n{ⱙWvꐮ"Z)^9un0ع)s #sJ3K&1fhؓ-^{_ts1Ys3YwORJ5JoF3$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$$I$I$I$I$I$I$I$I$H9V`W6rI$:~q;Ǐs潳1 ${%bv ӓX.$Yj~wo}Q?鄒Iy͏}:^s̔I\߸v.N~挊N?!I$gٟ^G|Ww&44-lHavo>vnI$,۲u;2RI%<qu7=RI%o~(Qv^8v_au $϶e~=fw'=YsI.7|hø_gh$]?ٿgXI-P$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%o?dZ ̦͖s=>[;nMG^.їٝS8lq][;7Z-CM9I?w~>s07پ߅3m8sa5H-^ϳ}}d%0;f~݋KxG-T|Q6YoeTTJbeqV džpU[Xad2Izffsn0춦V#_mz %TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^;;Bm>bv W{I/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$q$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Is]~?r]'Uiѿ UJZNk;"tQ%'3mh^O%sRZkҞ׃쪘?Ka( Y*:vXZOIog` YT5%\q s}ۭ%E%_g;lfc(G zW랸wC$zI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒIxI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$'_;8$[G RI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$H&SyJB!ʒgtV49AB*2$I%=3}xݣѓql?>ePZchƤn.$p>,:gDel.kѹ?jK#a?ウ}VgXرO趯lGOϢKW6I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒIxI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$'_;8$[G RI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kg{ifgneR,~/* 8읾saO>wbGWO6X,}>RZU]kjE6>Wu3Uvwg<+.R]7cwslɌfY_%bZ}Kx(11ԧ䓚K8jw[ ^?Atf7l7g=T-2JI I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒIxI$I$I$I$I$I$I$I$I$I${iǥZ\~I$Y,ݾPv;'e Is99%c^u’I*$I$I$\I%  BI$o]Orc[I$I$I%v_?k;?ok)$}%xlK?4I,TI$Il/hЂ{gm%=:I$oe7vꥻuq5لIs$?ğ|S?ĒIn|/OmI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.'^7ael*ʕ@R^c6߇2Ƭ yJͷP8]ecDI-Owd?-X>R{:ڱ٘c%f{ڬW;Cq(Px5TEr=}KV*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K{?M^ؿNA/bI%$I$I$I$I$I$I$I$I$luk8$1>F1[>_X~IztsI!]>C~9և:$Kgڼ}ll7IyUaܻmSjxa$]_ G^oqy]os?$I o}OluQcOϒI$ħL}5m##wtI$57>ŷ/ /ȒI #~II$[;>daw}} 8怒I,/MO9y/5),f}Ew>/l=-g ]؞h}ۻdXssvgGVC<kvmR]a Ig}? q[ebȱV;`Ex: 0e^s3̤H$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w}I%}B$^8I$I$I$I$I$I$I$I$I$I$I)M7ML/1I/{c 6L {I%)$I$I$';c]|\"H)$#0{%fdn{>i$K.nOqv ~s@($KI%[[_?焒I|I$I/~FWe?~<I*⚶.o/RI%q%$k*I$K߰#?͇vX~I/ğ|S?ĒIzg,| |Kjד%?U$\_O?k]{$Ks;nF^Kȱ'8I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ڬoLq}OPlE ٶl [?%_m?~.%x۹c}Æ!PWY?նLٶQnx\7{cxۇSx" Pٷmމܒvcq\ p ; w e%)t) 4z`JlW3q|w[}E~x I,I$I$I{=}_X)[s'L7BI$W{ܗz0XzGtI$;lX?-I%?ߵbF { `ϸ.4I{gW㹦NGi?4I|I"P윪hok)$n7]v)oCRI%WI7/\vV|`I|ߨ|4DzY72>)$I/pnVc\iq0I%_OwfqbI$ގCkKʒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$zMm-UG\[[Չ;]l{X]bwoj12~^ᰡ+Oumٻ[+8/-{kwC=S\Ojo6.HR,TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$oЛ)$U^ĒKI$I$I$I$I$I$I$I$I$I%?^f3ݱ ?xwGy3TK3'[;jˬ8cUI$̯U}{gl?I$>/`vvoqW>vr`k KI$I$`_ڿ2{u88Ol?$^5ӱwGpo jޗ?I $ *tВI.Udߋ/ʏ׏k~\I$ڪps{SW^AI%nofy8x_JI$=h{e@G$K|~zx6oRI%_OwfqbI$ގCkKʒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$8IK4 3W,3MΚ+J2JҦ{2٪5'0|{v6a͝vf3m2JՀ9tIm`w.}ϪzLc~_ঌl}6 0&G9IzWlXj̮O |m+l7[qR*i(6ck{mВqdMI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$I$I$I$I$I$I$I$I$W;>e=]wߥIz?I?OAI/]$2{x9?Z'$TRI$I%O_{%r{ezm0I-=]?4Ip-=۱#.ڸ{$\e}:^s̔I+# *k]M;aҒI.˹!}G 2sՕos^?q:n͔ouSzK/بgw]y1MY0^ѿw:~tIzk;{M,&Sa9.Sq;t2BKQH$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w}I%}B$^8I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.I3N,I$mԒIyRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$o޾ox>?S Jk&I.Wڼ;?zog]7tO5}V7[Lk?bK\LN^e';YBDٹ]C).gwܬ욙Gm3?srY]li{>RKSw/>Bu [NзiW<~^msQ(w5zYh&9%mC@f[=NLRTlg{FhIi(.?*S$jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K{?M^ؿNA/bI%$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?ğ|S?ĒIn|/OmI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.Wh;Mԙ5o* 5jvwg׻}v2Kξ}wǪ&G/@Bu]gdxH'8e%{3mgf x'hmK7FvQ۽9 wNK_'3/z g'Jdjtc'n%x\5%"X:UWLCK_ou;M]gzF1Z7{Ib}1O>m?t/|HK;N[-o q .O|Y#\{G㤟\L }im4O .YXi$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7LӋI%w}_=$^TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$߶_flo|9ʁm?5VKtUFџ%YGx:^Vpr©uvgdjo>I.w1#q<LJ)/œUSg|~IzTI$O}*\{|5]-Hf -2I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$]ٿgXI-P$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%MosID4~s}Z[W56CPe.$߿;+/.H=>ިYGu.;|:.#3:0/a9ޓO[Ε#\*+'T>F}]W?;{V>]:SW'i/19$ ;W1P97N Y%Y$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7LӋI%w}_=$^TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w)Ȕt[PՒK';OxgݻdAgU:'.ɍu}s̳׋Pf!Y%i%%};';2QQ;'9,iǼ?v-GwAgf9΍sT[nԖk*j "sIdlp2O*-I0eo:z*KG}'Upr]'W܏{wUMlJ]pItI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$I$I$I$I$I$[}Ox9YxyY~/s[Du$X$I$I$ǵ_c㊪\0y;ϠI$|=<{]5wvRI%=g42Ie$KI$I$I$I%a??xMKsOXxyƒI+߻/eؽ3NǷLJsI$}YfGml]I9% $UݓS\_@T/^&,Gm#nsR\dϤ[gp;bq^N7p&B$?xurXS@.2}j?%ލus $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$$I$I$Kdabw_8yo_I|ߨw )ʬ0I*)$I$/#=߸W c]oIoT3ovkʿI/I$I$ҿ>XػCdI%znoוs3"I-_w_پv|` V?RI%Edv\>[?KF[~~TIVyǰ=ǽ}'n&?I$h7od3!3{?a$\mͻ\L[k-gŦRI%}Ǹ&&.I%OwfqbI$ގCkKʒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$e+dHj-*6w>_ߴY]Lzkkye^L%]Ά#GZvnj/λi0em,O~U}KAIp}ϼC:UWT]NwOeQ}$߳wُކ~>O.PQOjviXw-ʳq@ }6`]L\km6i q%+ $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$ĒI$I$Iv.~Ÿ-=G )$I%@v pi$Sf~:_ݱe<氹I%$I$I$I$I$K߱-&r}Z1ocBI$s{csI&I$I$aE_gv}*m9I$o7'RS󲻾F_~̾cP<It_Wo~+cI$gnC?õUmgI$b1BI$FI$y{yI$ֿ;7o]hGI%WMb_ona$_.}~oc I%Q$_\wih==fI/ğ|S?ĒI{_ؾwJ3E㵄Aq^?U$\O?d?]{$KVwtʧ_u2r99rI$TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%;:ce*B fnw{19IyzC_j4]hceog8uNϧEh˦i.b.x؆c>jcėbv4Oe~%_FCx#8JH2H&}%Wsm6Kx~% 4AivKqLRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^;;Bm>bv W{I/I$I$I$no܊]U?麧sO$^,uoh8F_Q II(~SOٺ~ bã?RI%~7c1coI/RI$I$I$I%_MCܝv\7_I$l;)ŚN\I%¤I$I$K{ʝGI/I%NojX|SŏhI%?Gv3^ƙm $Rvyo΄I|I'I/%p 7RI%[Q\/åNg^ $_ܲyƒI*$coU)|I$I3N,I$mԒIyRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$GA$Yw[20,ecj:썁¹۲ZV˪}Oǂ"U##$gVQbͼ *9]nǶ;S{o^Kkm{fwKKqml j8wQ~Ėϳ݌Gn];n[xỸ%g~vϳZ ҙq{hLkqѿ|API$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$W{/iΎ߃Wy=I%A׺dY_p2I,?K#ٛز,eB]h, $I$I$I$I$I$It_be}pEI-Okrp?~1OO $I-.3;gny0ʫ?_4|I,ԒI$I}S.m?UK{k?o$_+rI$M,}ohI$ܪn\W5˂I$?u|W_pJI$fŷ;#iI-O=whhW&/.RI/qz3 =7pH;I${2~e;WzvSRI%xp:+I$-ՏKxcC*xuj_71R^? bv{[2.w yJDf#+K]Z }ϾSܲ5%*#))QڷƊ?Tp*KO/َ ϲٚv2<$j`0C@'V|)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K{?M^ؿNA/bI%$9C.UzxԴs$>g$Yvɼuc*I$6kxB}ᱣ5I%Ӊ~>(sp99I$I$I$I$I+珍*lt>~NJI$}SvﳕA0^w;I_KôcI%*ĥok;LcCI%'M;2N3O3CKI$I$w+.Gج)26VߩfKKe6{&#yT? #I$[K[rw>9ؽ^:$gKq;|pTUtI$?_xǶAI%}'˸;vN󏅑'MG$W~d~tu~X[MV';I$?p[9']mS I%hnOr?NilaҒI.o;'q02|k,$I%W>wlxi'$\qۻ6â[D>$I[7LӋI%w}_=$^TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$P3qHoX "ŝ%$Iri;oLڻ8#U n{.sQ2K~}Ӹӟ{:i? Y,+6IIcC 2,Yw/"`Vix_W>, $+vmxưjuh/.:b4I>v.i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$ĒIvgO&~$KI$I$mϼg4«BI$Io츿h~bܧ5I%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.I3N,I$mԒIyRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Exe+Jsb0[[.ͱSARX huoBO- =$COi혿i>~JYn=z#Gc;Ĵ]r/޸G}2d/x).c7;mwzhkcX\ocIra>MYUUmBʏѳcG~XSd5ږm-^%Y$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$$K߿Fg`rqjote15I$n`I$ ݧI>z(vG[#'FH?g'vI%&?xb˰{on%)<{L$_I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7LӋI%w}_=$^TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$|~S1ߔ"6rO_hEIp핽 L6T3QXc;kzKΫ(_P}uum2#CQ֚+3ڒ=o"-fDq[ avgv^ :}/B-oon'W2;Gcc`KmJU;~mP90u)JkuY'IYNPI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w}I%}B$^8I-ޱO6vNw7fq@4xI,I$I$I$It_/*f@wKI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$q$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$If4v۪4 vY͎[˼(U{|߲y]׷ZCGl=qSQ1GmxI }FϱxϹ^1ޥ.#MEJN7hoW~_8Ǯ1#yX*32X_lvv}}R{eD3/OivVn+;G .Ie0q>|2g:< oն̳u X|BKsdw]ޮՖ,űK|Sʉh9,{~֠kh=Eyri$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$$Keo?fvf_qov}Nu )Zy|JI$O\I%oI/@3$I/<$[ayla޻K{spВI/>I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$q$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Isוgo?hDtm۬Σ[c~}nm^?s'k6V"Jv^!=s wzs)^(}}vqI$ZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$q$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IV9dU{-)@䦳omQՒKwz-lw0O(_дc=-$ճ;k3$T#J6wʟG$ѽ,Ϯ փ)ImRRN=^Uf>wpfic\VpOfCm;6Pr3grIc}]r2ks5CI\E.Og$_U꧅Oc!iA}֪RZjEM$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$ĒINǴYU!$]flc='~Q֬I$Wfm{SʒI%j~\RI%w߰kw?8[1I$W;]P7=-?K9$I$I$E˽.?$Iu,_nW;I$ے|{1o:ikI$tI$I$I$I$Il}Ao~^ځ$X$I$;/؟7Idp蔒II}}˶]_%I$*I$I${OhA=ݒ$Jx ERݺ8߉lI$IwOwfqbI$ގCkKʒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$r(š_` s Kf]rZ`&Ojtϗ+:Ĭa^~Mĺ$;S=h<J{};3-I.wY'_,6O 1X}SLc .7A-ykDBجu=2I?t,Ol _RB}ن;1@-~8X:{1Ъ5*^ bJe읷eX4mNNqoJ-Q$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$ĒI$I\흧wk, +K "I$%~wvSi]?I%Owܳ/VOI$3}lOng[.)$߷m>{-kpDW;=KI$I%*0q9RI%c}}6b}?D.<$C-}2َyK,O/?e$_&[ռpФJ)$I$I$g/gQio2I/Q'qGmsxyK4Izo G^oqy]os?$I o}OluQcOϒI$ħL}5m##wtI$57>ŷ/ /ȒI #~II$[;>daw}} 8怒I,/MO9y/ ;pmZMgU`p)ۢvy .ӶvՈ1R7@0\qn~%Jr$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$ĒI{#o=ǷW^kim ayuI$Ocw \OO[pCvI.O;Om)/< '$K{mݥo[wI$q"kO$Zb%_hcvmu,69I,4I$Ih},?#[\&yH}w2~M|I%M$_M\mtOc YJI$qw_vE7I*I$I$5Y}ַI$sC8~V ;YXOI$'SI$̉$X3=vk8$$K{lsx$I^=n`0qj $7|v7Gp,'߈$U?|M&~C?g~9I$}9kI3f^GÌI$0$I%gaU^'ۙ I$/I3N,I$mԒIyRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$[o\kS⢺,{3zvW㔗$ݏUAk^ULtp[5|Y݊}œl,v=\L :̭eʵ߳f}^۰NXx= n,m4Nww?uY.#L@HOwhn|6GhSѸ*# }cRІҡZIiUOc\WYaeue"'*kG-2I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$^Op#+]vl^ϻJK=BOI%|`褒Iij?/')$_, ? I$w98]kⲚ8\"I$I$I$I$JtSnMS hy$K:ſ9M*pg$7Ix I$I$I$3'>onX{qI$w!ΒٙfdKOg]E5W߸v\Kwe6߅o 4X/ 7B0 Jػtߋf-|4+𒇵w|JDe{^jʬr\_iI%7MRqIuI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$^/_d^_U8tw $IQA#v'juYI$v.؏𹅲I*I$I$I$I$I$I$I$ hoW}wO!$^}pAo9)$I/pnVc\iq0I%_OwfqbI$ގCkKʒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$8TIyp`;~OfwyyHKo-QW[M>\2=?Xgoisd2v76JKGq7n6{}O}gSoõj%> c_Զ$ھӕC8l䦺qgfᴿŜ]IP}|,F[=]?e1~۸riuWh'(@՞ϴ{]d?V~@hXZ`nMSJzI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒIxI$I$1~wKSd~$^?Ǟ&mvGuN-I+Gkfזc=I$#>KnE=ɟK{eK݈I$$I$I$Kgnic@~o>|g$gOG/vweYq}ܒI%_|\|I }8_e"M^}&8I$&I)Ue[NiI$ߞ"?m$KȆOI$>on.9OI/o=& I%>}#]f0?[@ʒI/i;v緅ZKUIlo}uцs I$k?ڪo?geGǵ.$@yU89=) wO/V  $7c}Q~Sx$\Ox=O`#YI%>?o=_geZt$/'_;8$[G RI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$$:K3{?~9Md7ĨW*e=Z]c'Hv:>`7RO?Q[_]oX>i/:YG}ⷸ}/?]D+;_w\@_oFN=}0{i/NÐ{/Ew\*{MX4ti r[ueQp<aN;^Mˊ)u-}RGEFI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒIxI$I$I$s斟I&I$ai.* $><ﺟ}gR8թI$^ .$IA$W;>e=]wߥIz?I?OAI/]$2{x9?Z'$TRI$I$I$I%+?{OWDDKI$l<,qu7T&= JI$.0j;,ʭΦ- $_/3;ۏ*뱅\w~$\5}:^s̔I3\896I.{U}nWv\$RgqgǍo/ʵκߑv$Kٝ2ܬݑi$K7LӋI%w}_=$^TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$߶f 7sCOz/[KVz>.k4wl[~7n2D]Ggd)gl^Gӿ]Uc3.5˗~ S9]pSڞռ{tǚK{Wmڰ˸*l4e^4Ew;nn6ϔ;>~nVކ?cUA׮k[w#<}L-jx D)67eRZ=o`Cmaw!_yA~Mjսt~r땥I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒIxI$I$1{~VogN+.:%$T|vԒIq$I$*ƽc+O }"c2I/OQⲬ̶5/.c-wI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$]ٿgXI-P$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I`ov@&8衅ڦci4^KzT1%X':MflqyGS{ڗMƘR^g{y{r mB^agJ?(d*/m4d;aU^:3yo)+զE>`g$3 ;2?"I$,4ǺHz~rI$tQq|}Q.cI%;p4d;k~I%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7LӋI%w}_=$^TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$v5LmA;G*J9@t}ϰNP칖{,}N?z_WXiGE0?ؒWGhC3F7w2ND+vT;MVaIubpkx=Ϻ2囻[sDtq+7oQK[g>SOߏׇ[[Iu^/*fvJR Ie2ۋ 5݉~7n%8ٌ^w)ETӳN!I:Eb{N{=ܬwv1v] TX;upxI]NUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^;;Bm>bv W{I.;.vn'`[|i =7I%7}}r_KcnRI$/}ۺ}2s,ewCqlO I.-gЙ<.-$eM1oI$9'bn||#$B-n?wI6znQlovIq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?ğ|S?ĒIn|/OmI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*=3ga0 )[er19Ϸ=v^+[E>}Œ-nSgɎ .nٱ~x)8vvCIyϳg=[_ ڒI/*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$HI0I$OEQV]_q.bs .}fownaٲJY]6߲OjYfݳ7xC) "/SFQZ>ś}6W\4Xy@حhFO" {Jwn7dOͶ]>.F0pXd2k˱lv&"kK;l#,BKseb:7&?C?o0n. oOsv{]ni OWL!n{GumTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K{?M^ؿNA/bI%CNIғoݩɥl',?I$Dħs?f}htA`l~$IdaO א;6;kZ ?!ΑI$㓟>[idey'I*g?WLwvc=+7$VaGF lUN'uI$'1`1?ᕴI7t7;zI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IwOwfqbI$ގCkKʒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$7~O{ ՝w NV] 塲R2Iyqݣww_+Ct%ѰvV,kOLlLG% lZ{ew[T0 /F9Ggī08Ϲǩ*W.K]Nd]>sϱbu u vkKfYؔ ER1ehp-9h+o[usϩ[iӿd}rZW̓RFr'IM$ԒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$oЛ)$U^ĒK>}vĦgӢ$Vٗ{I!}QE3Ɩɰ"RI%U~VvS^M$Y݃=? $'LoI$;ٯy=*e3M^fJI$צoI$I$I. q5[>'I%yRH>Q?I.??coydӺ?Ir$I$I$= ȸrh'I$e]?V9I$'\we&Wcޟ$\*I$MV\ʪakZ%ĤKOvN.Χ?!I(gi=ϰ ~9VW9$KH I$I/@⳹~w~~~I$ZU׷ەsK멳]$KϲqȲuVױ HI$i$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Irw?V`cz86zy>.^wL[[nƦO1RY &߲ ~LmT[+\Nw|ʒ>ڻ63sZ:S肯OcmNu-?5%f`f4}$Y`'5UU)N_}`cSY?6Z+mMOַH?В_5zwc)l @wۚi2c`R^dxuvV=HSӫ˜xUKqItjuI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒIxI$I$I$ݻg}m{msqd9$-$KI$I$I$7 1v6ܼuIbJm»w l:ۓk*gI%m+'T Ώ?I.O-V@;G$_Cdv-usi!<<ͥ$_#;#]>|Za$@I$I$?*[ܬ'A)$n~yxiiBI$l)sqKYYrَI/?c^C,x58I$3矲u9g8$^k1~~[K,uXkiyKgI}64G7uI$'WkZi9 _RI$ N߮uvM<$JCowk~^7ïI$?h/ =-3 ~N>Kտޅ)[G\YYmYq?CG_0I.I3N,I$mԒIyRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$UK8r"Y:9pŰ[MZd$'L`bPݑcR+PNPwƨ{~._os# B{;Į/?Yccz}8n[C2p]M[Z)XIvf>;у2^ Vs8kٻlk2,?YW;7@콟a l:̞>jHV *{廻svᕙWfOտh,j Oq;QÄRZEE$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$_`OI$A4}cI۬wlx&: $KI$I$I$/,]7q\pkhw$KϒI%}$ؾ綒w 띿I.{I.=$V{f~_kϣ7K"q$@.X9ǩ)$I$~ezVI|ܲr"e$UI$I%ow<-θߓlqGDITI$U~ߋ$+TxmPI/~+px}msRI%jI$v쓇1G:me2I/?noq}R`̆yp;I$Kbm;?$6AIr͹w𼤒K5$_YG#BGI$?ݛʼn$O\vU_ikvi9x6OtI.I$? NlO4IUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$U8ı\'6}2'oJoxyIp_߳wfߺUp޽_oTw`vm{r.ɬ~.F"3n܍%;p686HO'DY۽=WֶOE%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^;;Bm>bv W{I/&ѝ1kYI.m o;$_񬰁I%ݧ_WsG@O(vI*_Ⓖ]1mqc-8\O I$TٹX]ђ֚^[-Iq?gr_ku`;Cf^O#)$G;nGc*I$I/ b~Lχ I$z7LӋI%w}_=$^TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$/GE?jޥ:SL<5Δ2>ԫ9%qGr=8D9Z_žʕOB_qIyۻ>{;oƳYn:T7' h죨m,ܒ,Gܱɭү uԸ(ի{EW>,c /H?15 {N(~5s ܾKoZdrKo㈕qsNY\o}dzPhV-\z-^!It/cM;SH$ I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒI7a-p;&No./UYIoY,qM?gldڬᢩpI/3ޏEݿ5~q\>bRI%>^K+$H]w _OI$mnem}c@I'I%ߵeůd}ۼ|~I$ߙnFEۮq{n%$BI$I$q13rǬu cĤK.=,g=o)$Xcq9I$RI$I$I$I%=a~ϴg{duY$3q;:~M\$JI$>qcf?$_'rI$ψ{vNEt$Kۿ{f,,gIWŹ]m.1I$wW?̽$YI$úPvWX羮6'}}A$]OoϹ{ݷ}U챮y#>$-w|vĒIס?$WS}5p5<i$]ndwtc8 ;i$;Kؼcm9vI/I$I$܋UL6Ya kZ$I} WOWG,X1>$»Bwmhe9Ԓ\OI$>I%?G 3ӓ߻|I$I$I{;ux8kOG~@I+KwJ˲.2II*?_z$Kgv}´ߕ~y x}ZI$yn+},\Uz"I._k5-ޑ] $d3}-lgf#_)$:~Չgn$Am%_NkCmw߷I$?A[ <$KVUi?eY$]u;m[M/ʵMuI$'$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ITrO 409*}{EUROFv>go-ڜ&$$pVV).w7K̞쭞@6Pm RZݱٱNbZa}6[\_ 2Z=*en.%?=Ϸ`ۑP=~JD9t;~ע*%Opƽ~9d&ӶSoYǧtG5{Vm"ȒOlOWX\q $ ":$fcSn5֖hc_椒Ko0>v^.cO $_$}ܟI$Hs#?$KwN3]/=$JI$w/߻t{:RI$>/zO(I$I$I$gWiWSIT?tI#wj'o} \1| $I$q$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IC֫Tw):viJi&;qUfzUs%G9C)+m-~3vhʙCR(>uVj0K'2=0 Z8,Qdy+NR+dsⒺ߲ϱ1npl>< W7VwI%+kI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$v Li$]mewTwֿaWcW9_'$뮊[(k[Ki C}&$KgOyhm8څc?$K iO}˺Sư;k[[x+I$>ۊ>}}aAv[$KI$m_7G=q43 .AdKI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$q$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iskkj{381AutUl%Wd_XqIcd(kLZYl,I_k79t߁R٦ ;Cfwi%s}3m?q5VXL'YERIW(^I/:7[glvhǞ+I%@R-%V} n%D'dê}Tg,t:kʐin=63b7]Y4 D(m8;g+&$եQ[=@Nt%4RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^;;Bm>bv W{I)}⊟X]<;Jb7._$Iyg$K2GܻFEƚgI$G؟,\|eU;sG>II$[?o I$?ow~I$ėWa$Xk읎g5_4?Tmo/hIy I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$'_;8$[G RI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jpͣa]yo*Z) IGw ~ۨ'ҹ'po=P9v۲(~eW̥9i1 Hwb}^şe1u+|Jq?*K=ӹ%o(j:Ai K]}dKCQ]VAs}}n0.ӵdeܻeݽ8pCsٻo`Kf*0wqjKg[oa\e/dgVo*Zȭ{{ 7o,1It}v]0cB%ݻ KE=TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$I$]ǹ5a=i@~I$?Ɵ^q9y~4It9i~}70;?dIq_j>??/v)ߟCI.}$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$]ٿgXI-P$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%~vpmsNxe{S[\W\}OUIUHttmgwVg蒇mK߲Q;7?!+iێͯ7xV>ԗyS;!WiË.cyv ,/]Ӻ6qdR഻+kn#K϶ݐ'||ګx;{fwcEwwY=M_N.WB:V+UœS}[;E. ?xA;'v«_,>ﰤ/}ݷՓw,Σ0k2}KvMq= . ?V d5g1Ԯ_T^i$ǖ[{ڼƷN."I/;I$I$q2m8_ˏ$]K?ŗ۷tD2I.g?73kλZZRI%]$I$I$I$]?mm;8"d8$Y|w>v$&]3U_x7KL7Y^Z#ϵ%Y$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$v>{~nn.3I*s+RI.V6C~}|H*I$I$m+|ޏ2Vo7+0I.'y{?RI$W$]wN?\RI%$JU=`s:Kt;&MlopI}a&~]xϚI$v[[@e;gI$5ٿـYcW?4_#~I$Mcx{ I$RI$I%?+6&M'7t`uuя}?$>j;jcic hzKѿo_[AKs:I%oG6Omq/J>I$%+;~ ~I$s;ه;f-7D$IkOW?3kFGHI.kn}o_͇;41S>_$A?cُAU01GGQѿI.v} 1٬mqï$X_qh1r_kxt˴'I$?ǗlwnW+oUIa?ݛʼn$z;>_ ڒI/*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$XjGi{32[p?/m9=<+S޺{K KA>;v[ljk7y5=鈌sY{>}T L,+=QtTp{ )^-5mѯpeKasGa읟,TKpuv_wwt1')_+aFVMT {!U&6i rԮ홾LIdBϲh :sjz,SX=HȹIvSN5-UmZ+`23EJn-"AM$ձcCZ@$&EJI I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒIe۾voI$8g?RI%ٿ?t︎jzqRI%@l I$\nC{Cqoɓp3cI$GXO)$_`q?K9} =."I/;I$0{1ne1gI${Wy])Wlw$TI%ɶwHh0ՙK^g{5d[c~q)$I%$_Uef-~Ӌ=9$I/I%L`Nz'Lio줒Kސ-K8L?,p,sq? $^Ǿ'8>%$Wfۘ |I$ \ + w3I$O;SpĻ6?IOYRI%m2L1I% G4I}Y}WÉeI/ 7LӋI%w}_=$^TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ is̔T{Ox;%S!dg;RgIdGw #8QWim2Ijv޿3<^z)|Hʣ-ǁ>.ce1~+<nV/[4~,}/6e{=l47'k>ZK#}Epk|IЫvvZ#̥e$ }V烍^'8OqW;^M])?W~}%ۻ/nyy4Ue;'SƸĸYwng]3ox}c(|#Z#WW~V?#6 2/ZҒR*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$_F&;xsI{G_aeOymLmdϽmI%۾wbpǏ-BI$$]awnYKI$I$q6>PLRI%äI$I$JtSnMS hy$K:ſ9M*pg$7Ix I$I$@p9|I%oOI/I%>g%OZI/?ǻCi?m\$Ks-[ohpI$CI$I$׿o#+^l럿 I$oM[j]7Gq)$ONɵ$UI%}fû},?I$_OwfqbI$zUWZig0ͧ1u$Ke_7GmcI$}f?S8+$URI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$q*o2@qP$ v0*)(ce i"9$'ja`yX{zFxgĭu[ U-?$)W:)?G.Uay#VvBzk%_c{c995w۪w껨)$I$I$s6˰dRI%$I$I$K~/=k;\Yӂ?Iy]u\w $I$I$p8t9I}Y4;Zwxf:I|I.\r~vI{Й yeVlI$>wsLAi$%$Eġ9Tߪ׵RI%gn/jbt{kn״U?%ۛU#3XJIeZUvLo׸ܝ5InwOp㨶 9;o)Z=K7g*1 /3[gv܊ok9Y"6>>YS\}1v={w1~}RXq9ʖ0\LȘArMr8x$O_c>'#,8jڍUʶ:{C{KcnŏIz^&=x\Vd239r>|cK2lL1S7,*%vUmI괤d\ $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$?Mg .>nt $7m-i$\m>k7)=,;w 0I%m=euOI#Y%~ۅV Ԓ7]yI%[ o>[VI$_]m$YnůvyTUWSV=ƶoI/>I$I$y>gvp }RI,ϴc?Ə^op.㯅V$K2Uky'$@p]Eƚ\LqɃɭ2I.M$I$_I^[/>3I|0{vvFK=;I%>s?un@RI%_{}}f-x:i $Iv>}#]f0?[@ʒI/i;v緅ZKUIlo}uцs I$k?ڪo?geGǵ.$@yU89=) wO/V  $7c}Q~Sx$\Ox=O`#YI%>?o=_geZt$/'_;8$[G RI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J6=ykDzȰIU} b ;ElHMÅ6mn~K,}&[>;{MΆ8~]?' Y~7x#ldX*w7UlIrGd@.*-ܞ!ү+vжh1twr*}o{^I07vvXPk-$/=ûvwga-9>V(b#{ݸ>jK~wݮ͏ʯUdE+-"T\&z$})ز22Zd7[UT{շyהG%W /h2蓼߭&Tt!lVKyM p8Z8dpѿcX=FfPRֶݧլ-$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$/?j1k9TQPV $7=i#I%jjH^EqoI$S>^߀_,kxq-I$$?;BI$Inw'I]I$0\ ;Ǹp $I%sS>U،ͮq-_I$݀ٱI$I$>7ܒI/*'Uz|I%E$I$W7w]37d!|BI$>Vh;#lI$;eooގ͍OcϨ/;Ip$6VFUY8ֺw$]rC5LGqeVSlyIN{Um[.q;kI.Ǿe/{JI$stI$ogQ;l.e[I)vϳcZ]oȻ_I% nVeȴyRI%?ݛʼn$z;>_ ڒI/*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$@Ʋp~ HSeIH9WT+c_",#P$rHIyqo gvlA`<> >_A-Puj~vLNocsqݗi}|pUꜛÊ Ѽ#ޒ/8g񏏗Ayݶl+JX`Wo7%Pk=Xݯ˲rm_(_9Gm`F<$ecuL7~N;ugjK{cbKIȧvݓ۲ϼbD%PnhX赃ݒK)K誷c%Tu𳂒_0r!:ߒ~-ֿePR^k>u_kO{Te=o;Y0RX}go=*.efsPƼ5D[`Zd`Noy/̇ʹ+S0r{=_%cQV.=t" G.^s6HI,ߴ݇nhK<-XZV*@HH.H$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w}I%}B$^8I.'ϻtySdImϷtfV?oT2PJI$E0(I$?aO77 $]fc%^[;'}]I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7LӋI%w}_=$^TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w,nكv^K)Kl"{UROFfưY[D3K/Y^C `;UmP&Ko5ѺtG8;WXvdplM Dǥfv'߃GxZm ?Ŷ;7?YIyorx~}cDL+6YڀVm?} WuD6;jX#Sg;D}}#׷N9Xe]k5Ãq_V0%,]B{y=S$W۲q;&uY%8U}Hu2n!f_%%~Ǜ~b <) ;uRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$oЛ)$U^ĒJ`{]ں.qՍ"!5I$`./forsΫZHsOJI$rGzm`I-﷟SgdtIJWݱU;}aHV5ԣ/Wck1ߔKc_t$\RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$'_;8$[G RI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K6v<͍:+ccq%$~w5ӻd0 8#䢶ֆeh9Iy7 e._wg[4j-jKf9Y}΂Kk࠮_ SwN}fj$SFs*`Z2BӅG 7]ڷHl $=61MWm?O%6d;&:k;Ĝ>=% v:҂ڣY _o*?vIiw>wo.Sp.w)%\TQڔxI%U8 ^\II$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^;;Bm>bv W{I/:I/Ul>39X9,o,qI$Mw e{X I-?I-O?yzǷѦeCL`I!W?f*3,}ncZG(I$OfzȷѺeGOaI,>GgO$K3#۾rᄃƚ7I%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?ğ|S?ĒIn|/OmI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.i݃~bXEfF?4*wk^ tMVzgIa_0wwnf*t|q>Glڷ_ -.;n_s`g7c 9꤆ ~4ZV4iݻ_ggq5NJ.{mt"%Oxl;`W2s೴ .n5nedK 칯;;>B8IPH`E>6;^{LsL>R5TqpwBlS,ĕ,d,~#'M#,ՊwwQFfI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w}I%}B$Uņ'?!ْ]oi+famk]s["?'UBf$X;{[7Tnxc`,b"*n,ÊKn{3T |-?aWc-(_rpKwv,Ua_SWTkfo7R*i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$effEc* I$y'.ܗ_zI$ńo?RI$XOs$JUQS*I$qm_oǫЦ;j| I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.I3N,I$mԒIyRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$7`є2qt`N`$ ݻUFRYVgۺ{/AuQxЮdz{0I-^;WmmWd} ?ҖVF%Fq|%eqpXh~v܎عxh2lF2 ʼX)/3K޻VVe]3%8l/~q]bь .{.̯K#nw(U8Ro;VR^kʜq2Xt h ~^3?('9h~Rs,V~'I.үc>R~ ,)l*nhgHDG;#V}}}Ϻ^t> ֫գyI%+kI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$>OaO|VsYվ!$^߽]wƼtG)$^ܫ?"h}-.?$K>;Ϳi-֐u I$gd?u5Z߼eI%QX_ 7?( $V\LNt8~Iyw/]sp`*ghI$I$I$ 2)['!?I/p 'SN~vS;㟶Nm:I$wWwͭ:$ITI$I$I$y,ٗӴ I9I7yd01XcO}I$Ss(bv ,# $r?tm[$Zb~O`?I.ua?=ܚroǷLJsI$}YfGml]I9̷E.oI$JvonmycZOI{WIr;=}RƎ=ZzODIxjI$I$LD$_M2<"ʒI/?MIQI$I$I$ҟ L}‡[NuwxI|坉.ɬ}.,{I/Qy&ϵMB2ǟ7?I$792qr?x~>W[V!$^!]Ow$7O$_;ovyW>?)$}geo#E$^_`fGeum>5wI$o{ Y{ݍR|6c$K?Əsv}ޮ&C2C?WI%ۻoqͤŸֲ|Ze$_H~G?|{"mkrw$^;$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IEV繁๟PI#)$Kx?ଓFMOeC|fcZ]vګpIs^ϻ*)"O?ӥ\TAlò˴j1 Kw{}`]oL lU5n=u<^ϳpvܛr:w~*%ʞ1f$e ʿ:Q@x}*u5V9u_jvo̤+ݿ}-ݔz¹'[+kodI;nKc5u%QQX~=Zr?Izgg= uTLV!!qۭ廛i?tv; 2=clxI /h(W ҟ1$Ɏ=W$RII$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$oЛ)$U^ĒKI%Wڮ2keV[@$X$ 7tj$['_p0ɓeB|?$\I$K+X$V;q/dǭk)qI*$I$I$oA׼RI%}6 I*)$I$I$OI1C-YՒ':RI%mWpǽ幃̧Ӌ$\Ogcr?JzGQêI$Is\.;$I$U,Y[9(I$$o5o6 $gc;^wMI$Q-8,>|V8Koݳm{wrI$$K럳-;m}SRI%ٿgXI/tk,>V~~F]VH w0'$KwϕմI|ݱj7*.^V>i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$~ыN3\?A㵚 ׏d͗j/tIa|΀'kKJ2K_wyEn'H&Tw)a~rT7=6AmiܿIuGK/Gbv W{I/I$I$I$I$I$I$I$I$I$I$I$ _&ʒI/?MIQI$I$I$orϴ}׺Wh?\{ԤJ3wχK>~>6= I$afeՕ;\w)$ٜ_h;e7U+ ѶTvX+U͖i*e2o~Mϣ6g}RO{ϭSw _DkI N[zG8$ϵxgz\0%7=:Cot#vSc%Gw`>ѲU{uR\-}9x:ov[z$La}el2GhB%m>YoeNw kU5ʿJ %>}k-Ǜ(H6RK'$;W7/ݛF'u!gPF(fn{XQo?%=wlƖєG2CVRq7Ax'$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$$I$I$I$I$I$I$I$I$I$I$K^wI$]&I$I$I$Kn|a_I/RI%.睃00hq8꽝$KzQ~V=줒K]֎.^~ v)$?[D[cŦ I$>wݣ }\ JI$^/#XI$ul9\]4IOI$NǷ7kOCI-2Iewn|6.㗌6h*򒻶0$䏳ݷ;Vx5La1. 6vP_Y$$}wOoX mu:HJhȰ n}>^{`p e;ʩx: N(s̤?h{\Xmcl̾?"ݮxakgն[یHIs=mGk(EYDe9Alo;Vv}\]OvwxPƷUg8k6[ԏ֊KV:unƇ=RF21.QǦjYM, kzdg9NZH&I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w}I%}B$^8I$I$I$I$I$I$I$I$I$I-.Ym{_ܱ;xd{RI%'/ag-W&I$}=ٝ3{>ߙCe#'I.9$I$I$^)n?ټWv~?]suiI$_Of23,;K 25-Ih/_ݳ{;uk|l穱 i$>}Woyzuc*9I+ؾl7":$KoOpwz #"Np?JI$.^శ0%̬OvI.~s4Oʦ@$Je>wI^ͥ$]|߲?wLNWg `eX?HL$J|/?c{|xٗ&O)?*I$7vmoD|I)$$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IQ= =:ϙLgku= RWX潡2zC`tIy}d;ŝx7RZ=Kr874~"e{Uv}%OtNىՆayq7+8שiV[yWKUKSϹ}f7X\ &|B-) y-Ĭ/P?e~P;nVq]TW^И4_/4J,h7_mAܻgaNuZ{7k۷S,ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$oЛ)$U^ĒKI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?ݛʼn$z;>_ ڒI/*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Qmk\ a~jHJI YW|8{Y,ƲGh`WlJw3 QƳ %SC1{/fon1_+^Gef[IjϺLLreVR2T 6 '&MDwS8t}_]M{h$vv&OuW`cmpϒ8*FlN=jr_[5~}a'Y}.ϲx}ן~XϪ]V|aK v/H}OkrNLT{-wqI?aއ\nן[,-gD${n)- +`/qq{%:a{ygjKI=TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$]ٿgXI-P$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I% [[4'n)kěvHDoރ}.#Z|FyDYV>Вmwk=|¦n=@V|u}|o陋ݺ.nun>eQHⱻSgxx5cb?]s06>p"0{酘Aӭpȫz2UħҺCf{yix}Bo({uqWwvm7K7qKߑKxCgXsÚ]u}wjCzKV:Nyzg0X]EJZֈA9W%I:I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w}I%}B$^8I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.I3N,I$mԒIyRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_8$ΒE~ϷΟrAe%jl{7[{p$첺/x`qS,YvN}QGV-"pIy۷#3/bIYL죴Ѽ#Xݓde*\y3J(ZtZ;%܆1)/E7ݾ}U'vXfl?_tVo\=(}f§+//Xm,?4.0NwV1}=Yr-nSK\b?[FCoM5$iqonݿ#јZyJH5'MRѫY!!]%齿ᴻ IqxrZ1G믾--%m9@g*=ߺ<7*#.Kw2U${%Y$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$$I$I$I$I$I$I$I$I$I$I$Jhӽn݉fUk> $uo`{ k $I$I$I$I$I$'ؿ]una,?tIUA{z" <$I$I%v_?k;?ok)$}%xlK?4I,TI$Il/hЂ{gm%=:I$oe7vꥻuq5لIs$?ğ|S?ĒIn|/OmI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(]ny)#XdW?-__ **mbiy]:KiJ\o/y巽{@'V[/C5vWiU}St>.;Uۅ}*NP' D=]a/^w%Ϻ*{\~ėk>^).[>*䪄 wT?6tw?W7~^Yda9h.g~mOַ褹ń|OߛY}fe9R36p.sOv/*ב҅4L8 jm52.}}ڿSpHY?XI4Yh;58؜>2zl~̨w5"inZR[\1K/g 11YYU,ֵ hhrĤ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^;;Bm>bv W{I/I$I$I$I$I$I$I$I$I$I$a=KY9NlzX{9 $sVnG+vPÚ[)$k}I$I$I$I[]70p7d^4$K{oد?ϰ}8ZDki|I$?3/ڛ,p,Z I.-$^$Q[{~o pW[$Bn{vC0Gly`XI-)*{}cHp>iI%ϱm!ff?#g$H?o1H*F(rH:7_RI%϶]f;5qíqN"xu$K S}=6^Ky]YvI$ :۪s\[emjI,?'_;8$[G RI%I$I$I$I$I$I$I$I$I$I$I$I$Jooxok7ggZU7Wdw^ϕ]uoyG\YZnqHvIr?g߿G9\WkUZ#n{6y9\>1콢?kg wJ6CD3[{O?^kv[mIDЪeG;1 JKa{cvV_uk 8e*mrWA3"l,T3z~SOpz]?=fn^Nr*uSLe9="VyIzgٿ8#%uKBEa9,C$;c}>i+ {uIcř{V/pnEùl‡kYKCwwQJKW}+&/Qq{cYQvF6=$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$ĒI$I$I$I$I$I$I$I$I$I$I}7 UBn$˾}I$I$I$I} ۻ! u"/ $ƿp_m~`[1Y8e szIp]ϰ'?SuNh?2I,I}U,pXYc;5I%}9;K{#W{~gI*>vvl~?!?Ke$3/#c$K i$n0W*{g$^$vo$Kw6{jI$$I$I$I$I$I$I$I$I"q}]6>SDȯ'onIjo83%QK}K:稪;nמji XnwگN,n@F}$cX>~O)-d{e2ӇI}cd)Y+;ZͤMdj% eNr)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K{?M^ؿNA/bI%$I$I$I$I$I$I$I$I$I$I$oA׼RI%}6 I*)$I$I$*p}nو4 $K笏vb^"[MT')$Y2GCwhT3}2?G΢TIy[љ~tVcyI$-[ohpI$CI$I$׿o#+^l럿 I$oM[j]7Gq)$ONɵ$UI%}fû},?I$_OwfqbI$_lYu[]"1 8?I. o>UVI%vūfbӐܪ{9ZJI$I$I$(ǡ7NJ-:LId}vdI袴HЯvuzqKU;f-0Aoò[V5IGK{'؞Ӊ_0jyJ7huݗҶ0'It]fه+;o&yOUmֻTޖ'qp .C_ٜ__bndחa< J*9{DLiIwexc-}Ns{|JP 5[l|KaJ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒIxI$I$I$I$I$I$I$I$I$I$I$_*7~TI|;BmJI$I$I$V}[<"RI%jI$YO؞g$WTI{? c͙pQ${=߿?2r;O7K䔒IdSC~^I$՟w9\K|BI*O1}z;$KnGݻq#ɹqI$I}kp?Ngc?I/7LӋ294?Kz=ǷyeKI$=` IA$I%fg>Җw o?Gnvz]]lkX:zĴ/p|?/ܬiu4?A_fgj?8];,dٻmCJmq{ݞ63uKivSK;wLteJD;+^(}(xvss8=6>R{b,ņ1^ػ|U}óUF1 ptVs6 L$Ue8ٱ߻?Ҷ[<}v=Fhe^7KK*\f\\AS~#_Mڅrf{V?^~В{}]2;VKǩcr>5N2U hmuKW4I$uSxk`cdh2%%$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$I$I$I$I$I$I$I$I$I$I$_NV9y~I$&I$I$I$K_Kv\8vj#$Kڳ;vٌ.I$I(;e`[In=xY$]џh#/@#C’I-o>ӑ_z.ϭ |I$}vQ;sڭw*I$ahxʹt$KzUY7Ƴߗ?I Ô;'G~Ir㛱پg(?z<WRI.{c'<P?q $32Mo:[d~TIyٿgX\Kz@YG_xd^J~wn{cr~o }C|Z}uwl <\޾SivMaë _s`.bJKWgd8X="U vfl$`)+m?{W3Λ$N^Ԡ- IrGy3qq<ZwNAZ^ڋDݍ^ʒOYsೝv:$/}=F7 OYܭ]8ţn/m}wnƯgIt~Z3Cg𣚰lN+ :drnuȤ!W4iRkb/UP?`}=oiw&z㢔hPsFh[E"gNڛgrv&C}\~p)J>Ң/j')-*I!;\~}#Ue?$Sevgo9q%Vv0˜$KYc.sI&k4ÆI%1jw {?J]b3=;m7V[.. %ƇH3;eY#"/I\ϵ,Ώo_Z%HZ'_;8\mlpI[*ew}_=Sk.h.;m-e{iěD`n&;=CW*zﮯ}!4)U;?%]Uv'kr8m8>Vuɗg5YXgԒ!w bK_l|Tԛ=gv6ro:$>w&U>9Wk/TW/mTDw~=ze0{n1z S,tpٛȉY/t$iv7ss(; Guz4b=zgf3fI?uMTZ3 ݩHT+˖I /k1` zC)Y*' J88ccWMBД@`&q)#I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ic}} cv{)J+l0Zuf,Is]dwϵ=̯wa[OGCv*`x-=r$ z}wOwfqb9Y4^FB7C'[w-fKhfs- w6{jھфLO7>'||Vn{*͞%ȿyRw}Ub?\&fL`au^Iyڏv߲}vgIum:k,UݧWۆ1쭸VezyKʟ]jwvxZ@22hw7*%8\o-VӔ ,N;9&xq׭[V]%$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w}I%}B$^8I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$att 9Iq;RM؝Z[wT)cGkxOٷf'_;8aC+8vMvuձ:ʅ1ld?.=n|/OmCܻrwSQ |tG>e'(I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7LӋ-hi$?ngQl"$dI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IwOwfqbI$ގCkKʒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$oЛ)$U^ĒKI$I$I$I$I$I$I$I$I$I$I%{v~7nij*_ITkpIA$I$I$I$I$[8_egv[>߁GvpI$2I$I$'g|;MRyY-w%$Ad}orcWgI%I$I-SOlds{GI$>}}Tn&[0I.y$]ٿgXI-P$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$ĒI$I$I$I$I$I$I$I$I$IkԻUǥA mdzI/?nfdq_lgku 9;I/?MIQI$I$I$I$د9k;kOV9I}׋);=>h$_)Kėj>K{p$|>$H_{phr{fC4 ~|I%%>e_w9siGӿ#I$-d>6l}L~DITf?iWIGF+JI$# 3f8Xun?O4IaoDz}}1++.p^~I$_aUݻu^klMVדI%$vo$Kw6{jI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$I$I$I$I$I$I$I$I$I$I$_M/Л*I$rp6|RI%E$I$I$S/VCZq)$VW.~ggsk< $0i$$_U&}8G䄒I|cm{dI+g]{m>MVU$_F.߄$Jϝb]{,)$og?wy&}LqI$#I$[>s2p`I$?ݛʼn$z;>_ ڒI/*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c۾}κYs !:~k\I$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ksn6 ǀ\lAI.+ޞ;&88DI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kd1>}~]QEXϽތq: [y}^ ${*/vnuc8{&I%ϤI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K{Vd}~uV$HgG>ZI%$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$,{wri_ssE99I>9;ϖIyrI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Pmg?&jmPx.\> $o}÷m#L$JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Gi/~.uxq,''[[I$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^4ŏnw?:}ǼZ8~筤^\I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/Q_Ƿw/Y74S[#ki$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ksn6 ǀ\lAI.+ޞ;&88DI$I/p6|RI{b1;н$$I$I$I$I$I$I$I$I$I$I$K^wI$]&I$I$I$K>`b}6M}٭$Iysܻ=\ԔI}%ܟM$_2$K̶os[ɽ $ $I$_^{ۮ~x%$U5m]v0_ĤK>KI;&TIWI$׿`Gce8!$_=?ݛʼn$,?XU^#(#!Cz0I${oo[I$wϖմI/{oo[I$wϖմI/{oo[I$wϖմI/{oo[I$wϖմI/{oo[I$wϖմI/{oo[I$wϖմI/{oo[I$wϖմI/{oo[I$wϖմI/{oo[I$wϖմI/{oo[I$]g܌ i2x8@TIyG@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|Kѿ>#k~p}13-I.+'S~wLs0V^]>$?I$w@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$OO,ϴYf#&Kz~I$'Gue n{ý|I% I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$_}=VYji9ͣsq|n'󷤒IyG@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|K.ۿefL8O7;zI$ I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$Ob?}|.Ʒs2$_=tϧ3e{@{4Ig I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$@k˽|I I$_l}?l`[MVז$ x$K?_]m$K o>[VI$_]m$K o>[VI$_]m$K o>[VI$_]m$K o>[VI$_]m$K o>[VI$_]m$K o>[VI$_]m$K o>[VI$_]m$K o>[VI$_]m$K o>[VI$_]m$^6>wgq0-ke_$^Q7m-i$_}.I%7m-i$_}.I%7m-i$_}.I%7m-i$_}.I%7m-i$_}.I%7m-i$_}.I%7m-i$_}.I%7m-i$_}.I%7m-i$_}.I%7m-i$o?߾zwspqG$K>DI%I$w}I%}B$^8I$I$I$I$I$I$I$I$I$I$I/{ʿMߕ$_9woЛ)$I$I-]}} NEkyI$m+ڼb{*cbHॿI$7GI$' $/)}sgt~QmgK=߿?2r;O7K䔒IdSC~^I$՟w9\K|BI*O1}z;$KnGݻq#ɹqI$I}kp?Ngc?I/;_qŒݏC?$KwaI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$KF^I/ؽ $_.?z?I$]3b$IĻ0gI$waI%$K%#?/GI$".[m.{ddIA$Ix}6 K5_ޅI$q$I$I$I$I$I$I$I$I$I$I$_NV9y~I$&I$I$JUYe6ǷvI%sȆOI$!>I%A[}Kpɯ컭g䄒I{ϟj/=}dcY>Kƾv;~mVg?$[?⃰~va4ae\cI%~YwzQo˟I$?zUNvOasՈ#B?I$oo3gT?I$=Gl8~qI{oOW|&ַ-?*I$/Eov#jAsxyyTI[{/8`3wz]˅^?cI%0t\^3;u+`$\ZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$,{=cx$ofp$K?'divv=<<"I$$[cwoavrݶ詾%$]x9+e;s9QW픒I?wg>wlMPGIyI$I$I$I$I$I$I$I$I$I$I$I$I$I$O I%Ta?gouL8pW8yt $$Ihu}[ 'IzxYt%` NjI$]/c}e:4`>#~XkI%I$I$I$I$I$I$I$I$I$I$I$I$Iv?c?ŷ_]P,i\I-ŗbh=Ux<,7oIp] فpSVI%?v]Fog-kRI%wYӹw>mpma~I$[pwvuo$x@I$I$I$I$I$I$I$I$I$I$I$I$I$JUi{ao2RI%v]X8:|$ST}f'q*eG8TX'$K}eY$_t RI%$Kо;;g|Y=ﱾ# $>j=5ݰq'(U $/j⛿混w끒e6 ;ӗ $}b/[C>?h$KI$I$I$I$I$I$I$I$I$ϲ6OS1rI$uSa{vwTt'y$IyjI$I$O/}yض*6x:I$o*8je0.I/"}g##diIrI$m.{1nSƧI$Ng.yve>I~{wDyKϒI$I$I$I$I$I$I$I$I$I%}j>p\{l?g4IQep}ev9I餒Ir)$I$I$I,[EǺjOaֿI$wZ{pŪ}<|jl󆸄IQI/O=_l{m Z$^\湎-p z$II$I$I$I$I$I%WvW۪7EmqI$ ت]'" )$W" fGʉKŮ-}V05BI$袷[m c$IzvG;OљǺ]^EvO4IK}֌ge8܃v?K{h߁I"$IQI/O=_l{m Zϳsx_ku"~(I$7l1}g]{\e#n?&I{ d;odYOr_$_>K?]em[_q(  $KnjyX9.Ƶ? $I$I$I$I$I$I$I$I$I$I$I$I$I-0;uzvU|$$Ko.;n8ǯîyKh;bnGnηg;9I}S;FVEM#*ӓWI\>i$7b}úfbL*BI$۫*nv+.>/-7堒I/n˭}8ǒ8$K?uv}.w3)64WHI$ٖvž@x;KRI$I$I$I$I$I$I$I$I$I$I$I$I%av>^\aI$tI$<3^]dacZqaI$˩$7Ecy 8r>$^{fwٕk>SI.H{GJxA'I$A7ٖ`|^C8Y;ky$I$I$I$I$I$I$I$I$I$I$I$IzU}WnMG?KSu+kf{=4 *!$KRI$I%_Svk]qyo-I|u]k<9Ǚ%$^{&_isAIFRI%;̳}u-&$^zI$I$I$I$I$I$I$I$I$I$I$I.GbQ1p}aZI%Ey}b33I%弒I%go?6%i~$^-/>wmk1TI$e{\ǖC`I&I$I$I$I$I$I$I$I$A;mLwSV!K&O^$ z׷l$_.K=}00Xܢ^[ߔI$`wYAqZ`p ĤJ}WbeX3;I/c}uW`z6I|.+r,mLn0I%o~_gf^?8o?I|֒I/yg<.ct~I$1?lDoI$I$I$I$I$I$I$I$I$vڳ}SbDuI$޻qKY~SN7E{'i$z?*rI$$I$]Ok{xm>;?IwJI${gru Wl\H_4I|==’I.D}9 mm?G쟒I$ ެ__mo=IyMYt]Լ=I$?SXj}fSŗ~0I/I$I$I$I$I$I$I$I%ڻvd;<"U1I/>vf^,2̫XktI/>ǧ܏xRI%I.W{Y6RI%O~7ɏ;lʶzzI$e:^s̔IE$_Aj^~q6~DIx>g˸BV4I%)ݝl:*ɰcZ<[fI.诳,c>?wɎ$^"I$I$I$I$I$I$I$I-.0\9KI$I}۬Olnw^>I%I$2c׿ƒI/)oV=l{X7 6:{I$R|?{?OCm=}&I$s?#3!wdX|I)$OmFw;na`iI#߳,ij᣹\K~’I/-I$I$I$I$I$I$3] N }{~9|I%gwe\rK? ]o`Y\I$nEgc2i$[:#'7/OG/?$\W6w̗MxcWԤKz<Q#?9>a$^ٺ K[cR?KfknC8[EyO'I+?B3~CCoq?$^e~]94|4~II$'z3I$$KݿhяRI%LL4@ʮI$$I$I$I$I$I$I$I$I$I$I$I$I$ShTV9I$I$I%f)yڧ#*I$[lZ۳GI$ҟCYPqz ԒI|I.Q\híg)$o^ݙ|{ zI%I$I$I$I$I$I$I$I$I$I$I$I$_?en[ߙbT=\UP=I%sds}[T9?;I/ji^5 i$$_Ze?u|E0I/I%^ufc|I%ngbpI/I$I$I$I$I$I$I$I$I$I$I%ga[ܻ.?ʙqI}m]#pnRI%_ǰ_{|m;&iC=o$J_i_vvGhoq 蹼? I$˳eeWCy|$Ko,nmjI$XI$_(4~3pIzMn|但 $$I$I$I$I$I$I$I$I$I$I$I$Zd{f~awZ[q߶~N?I$8?f?Ʒ*%uZ?tƳ#򎿀K˻Wf^]\5A?I$?Ưómtc5gMMwcY߰I.&;dnvT?OĒIPz.?ؕ^IybI$y~wJz33I//8Ml{.)$I$I$I$I$I$I$I$I$I$I%wӲI.齇#$^*I/uɏvFc~I$kh\o=ǦS]~I$tI}[(3ŗgMVAcI.+0ڇ;Ƶ?> I$?oӍK?줒KRI%כ~d0aε)$OP7Ox~I$I$I$I$I$I$I$I$In?c*I$1I$˩$vW6 $I$I$U~zwS*kzd; $1Cea $/٨|VI$Iz~I$jG3oҹűOV $_ڞ+Y{3㋾ߢy )$zfVK[Tg?)$'puXLn#H%I/lc\v{.wBI$b7qe$TI%(V'3I$)i䱭RI%N. I$*I/3YvS캲<x}6 KWt$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KؿlpqI$ޑOl_Q$4I{?I.sk{0?)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Io/  >Xk$]k]?e!p3fG[$\/؇}v8ϭI$f?< $u$]?a vI%A}?3)h?I/RI$I$I$I$I$I$I$I$I$I$I$\Llܪ6sq)$Y8a>7o;oxg*$^^I/׍wCpI$dI$׿?I/I%k0 ]X$Kcj=$KԒI$I$I$I$I$I$I$I$I$I$Iu?.;rԒI{y};|ʯ|.q<)$$^ls{M~7Y0I$?}mĶa$]oُOI$]I$O,_0;?I{v5`8OLZ?$K攒I$I$I$I$I$I$I$I$I$I$I$IoXlRI%} 3؏tW#wU|WIwc~n7^_ԒIxO#Ƿ{㇮;>I$o87$ކ I/1I$:7R#ҒI.{lƏtIIyI$I$I$I$I$I$I$I$I$I$_#vRI%/7~V$KRI%p?p?$^1m$KI$?Kf~Id{wrf[~CI%F]$KI%G?G#VĒIyg浶-, $I$I$I$I$I$I$I$I$|$oz׷l$_.I$I$K_e[޻|W;W,.nd|RI$le[/?ȒI+΢?I.=#5$^I/Py݅n#p-'I$zkr}?I$I$I$I$I$I$I$I$I$K?nOs_Q$7kU|IyI$?N&?؟Oeܫ̺jI/7̻+&m8wRRI%5ԒIxO I$r$K?{ Is$FZ9ϮI$Οlml;_󰤒K$I$I$I$I$I$I$I$_J'jI$gz{ $YI$ }ݛWv<ъH1I%qOTIzoM>]aqlAI$ޏ씻vE̷p.I$8Y-sy;8$_!I$K߶헳k!$_!$I$I$I$I$I$I$I$I$K]^kzI$VI$I$y-?_ګ~Ec~χDIzoi_gmk͊αE’I-.o^NUr@)${jXj)ƻK_I}?7ƤKIkawd``?I/Ǎg??4I$ZI$I$I$I$I$I$I$eUǐֵJI$/>G4cԷ4<䤒K .$$K_RwأK $I$$O:!Nj!$\xw`p?$^1m$KI$ԟ5׶#}rmo$-ݭm2/$DI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IzoM?~6I$py2ȃ)$DI}v ;3,XI$KɿƏwo{yX*gʱRI%ʤI$I$I$I$I$I$I$I$I$I$I$I$I$KGd_h{=oh>$KI0v~}Y}qg;]I/7I$Y>+sll<ȟI}=2Mh??qWv%YLim$KdIwGٿ6۝aI..=ʰx~k$KÒI$I$I$I$I$I$I$I$I$I$I%soğunhe$^gsnv-rI$?I$w^0ȞIwn*:#˪I$;j}!>'gu msk= $ϓʿ;}3f_kGL4I|I-.?m&0ŗSV'~ I/nzg5  I$rI$I$I$I$I$I$I$I$I$I$I$Ng81I$_YTc?פK愒Iz-f$Kg}"|Z^#ԒIz5#]ؕe2?U~@I/I%fnb[nwɄBI$_cw*\I/I$I$I$I$I$I$I$I$I$I$I$I$Z8eI ~_q~RI/?}6K]NE.cI}?gq˨7=: +cMI/)y뺷 흸ot w5g~.$I]zKIڲ6CW͏'zI$$_Gq_}--RI%n{fw|X7Ia$I$I$I$I$I$I$I$I$I$K_0?e$]_{^GbI$U$^oucWuD깹 O'ƒI/68g cwƬ{m|l$\jI$+k~\,^~ $?{ϧv}"O>N)$>oEY6I%$kEb.+ȷmȺOlrI/?ߟ=˸,yuI%I$I$I$I$I$I$I$I#MloI$f?< $u$I$]دYjzyV}3I%n%u}=4vNbI.$]_,yyu^pC$^n%;9I%I$;C)$K ~wvNǭC(_,|I%$I$I$I$I$I$I$I$I$TjI$ _9$^bI/~k}uUc!I#ij,.I%}O{>&Uk$ǒI$3En;c\$Y6Vv}ܖ)$Ɇ?kk|?e$\RI$c>\1IRI$lu2I)$I$I$I$I$I$I$I$I$y8OzԒIxO I$I%fuPe^v_/I$i$?ſ{ KދɪKY, v? I$Vkx{ k ${Ͽv&#UrI$ݽQopi$$I$I$I$I$I$I$I$I$_T=]I%I$I$ny>Q ?II$lI$8z1']?؈;?I.o}э0lu#ߏUGl~I$KW}@p#I%I$S+x/8a$^wm=7G.I$$I$I$I$I$I$HLi$Ӊ,{m}۾2{~ȭ?,FI/;}7ݛsȹO{Hx9,C=KK1 I$=ՙa?qI| =roˌI$=$K꯷Ym-+r uE$\gͽծݨuv%8p? I$racpyZZ>&I$I/Xϲ' plA>&WoЛ)${F2Y'bI%)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$&5bU}/5SI%}ϰ޵XhqȵcԱ=߉$^_.ew!˓Sk jo$Iz/^}dfWt:v*sI%$I$I$I$I$I$I$I$I$I$I$I$I$I$;fgyxucRI%og~_ۛuY/7-$oI$7@d?˽|Juxq]epi$/p~Կv߹㱜;I$e(?n3QuO KK-v/XO3c^ΟO"I/A]VvlSxm +}I%_k>e]+NX9V$K!$I$I$I$I$I$I$I$I$I$I$I$I$I$_M4I|ȒI/O_Y;mE$TOy7⻺vǛ(~x'}ˢI$__roVVc<Ip}lп4׍X??2I.Y$I$I$I$I$I$I$I$I$I$I$I$^.v?eO_w-4ݖa2=$^yY}ήwq'Yl/o $ŦinfE~r >RI%l~E/3[I%_a~=ᘏeY< I$﴿'k 865)$?gfhe=-W ¿qi$^E_ڎ2돵mI$I$I$I$I$I$I$I$I$I$I$I$I%ڜnZ_F뽣4Iz-W|Ӻ8cRI%_}fk2Xk|NI$aپ}ennG(ȾI$ܞ۟NwBI$Ǿ6쮏gn%ڔIyk?l{rn'FF.dYSIzW۟ݗ}nVHвTd~{˒I$)$I$I$I$I$I$I$I$I$I$Rc\u)$+#/oc_rccn\"Ke;gj혮Y_8`^I$.კ3,̡vp)$/~8}$KWkXh~a,oi!$^_i}&- 㫋~OH:K̲L~pyrm +a5;Ϗ$K0fb݂r*cXFƒI/ɿ3*lqi$I$I$I$I$I$I$I$I$^65NL1\RI%˸:@!%$_S]/ny~Ac)$}SEݲïkفI$}mvn6h zCFI/,_hude}0줒K}]}>K op$x>CRI%?l]&guF 4~Izؽ ]EI< E$Xlz;F%׵[my$K \}Ssp׍^K>}_paS_ I.}$I$I$I$I$I$^&ŏh;?=>I &II$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$H# I$I$I#cebBI$eZ^$I$I$I$I$I$I$I$I$I$I$I$I$I$I$SEfmZI$Iq$%$LI$I#ћ"ʁI$$>)$dI$I$I$I$I$I$I$I$I$I$I$I$I$IJ,LqajI$M䤒H $I$I$nvmzvdU0I*$I$I$I$I$I$I$I$I$I$I$\I$e,I$_bIusI$$I1M%$H9yQYtlq)$I$I$$I${so2ܛl`׼I$I$I$I$I$I$I$I$I$I$IY,l6:IK?RI$;.,sI$vQ<H|,YbI%̿ş)$cAI$I$I+ e>rm~yI*$I$I$I$I$I$I$I$I$I$vtBI$̿ş)$_|,YbI \I&II$$I$Hu_HddI$I$cKOI$s2ȲRI$I$I$I$I$I$I$I$I$INm7)$'2XI^S?)$ I$I$A}I([m;Ǘ$PI$I$qr1Eϩ,t$J7[mǫIA$I$I$I$I$I$I$I$I$D3$S_bIE97=$BI$I$ӯ*3Z $Iq$%$LI$I#feϡe3$H/s'RI$$I$I$I$I$I$I$7{?RI$|,YbI%̿ş)$YiJ)$6C{p$Rw>xҒI!$I$I1M%$H9yQYtlq)$mo$/j ؒIxI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒIxI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒIxI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mo$/j ؒIxI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$vneԉ[`$Hߴ.˘Nf-e$TI$I$I$I%_i;cXN:KI$I$I$I$]->۽ev;׈c[`RI$]|>lvgi$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$oЛ)$U^ĒKI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%S==I/xi_h7猗^O889$K@p$JdUܻt}ز=3?[GI,,k=$jُۨ6-k~9$\Gg}ۍF=1'i$I$I$I$~_$K=#;`Qm{1ki:`$\ZI$I$I$I$nvn>-"mȱ0yI$m[nqp{qnjI$^&}}Š>cI$RI%'}!͚{}nw7$J_?oLՅGԤK]v8*"ƻIz/&@2%_$KDIz'nd a[8I%go+lqYol>$I%I$W_БI%_B 6\I/I%OC%VO$^a8c}\a2^f)$RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$oЛ)$U^ĒKI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%YiCN$^e7fw~SՑ%I$ `Iu⣱w_eSSlѻ$Kk|~ݖP⪧8OI%v_j;s "kԾ$I$?7_c̺^sq ФKI$I$I$I$~?䶼I$>_}ZI$I%O&G:.;O줒KI$I%⁕}5Z`I/ kOy.q=II$+$Kw*}O[Ѿz~I$}Y;woźʏ I$v2~f $K~׺ !$_ K $^/pCj$$^N08SOD $\=GdI%xyyq1ɴeM.w $`lxx3$K'[M>Y2|I$4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%&I/c_'oz$ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Io3s$^7pi{9~I$߶lmW&?)$_o>>WzȡvXKwuo;_s 1s $໯|](nnERI%ڿ94YM>ڬik \B%$X$I$I$I$쳸2MIxBI$I$vm<8I%$5Y]m{k@JI$s[_ُyRu67^AI$KוeBpI%=^;K豹?I$O~ڿOd2:G)$:r*vA0dI?$^OfN?9 $$]WؿH$Ʌ36zY[k$*/ų'N_p`L'VOI-6흕mh _vX)$qO2RI%=ǰ*6quXY9vO6s$KͿ^۳܌i<#I/KzGzC##:$^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w}I%}B$^8I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.Jչ&pI'}Žbw,[$\*I$?_#?$[CWI$cտXv߳?>?~I$L]vg MYdH $RI$I$I%?OڏX}3HuIz v^mƎ$IxI$I$ѳ#IxI$3~~`q79ʳOPI"1tՀ+>-%$\I$y__'$TĿx'I} s]kt84K=;e\~y$K7BqI$)$_|>BGI$ &ڿrI$kI$I$I$۾3}v ׇ_;|$P-.k[٪i_KZg~IyNfMٹw;o{{\%$AI$c'vOӷ$Kwo@$:Yen,{s\:I.;7Lv=&Hem$\N=QS7\ >I$Lɾ˭w8ĔI $^c/OXI/<Ǻk뺧p[|I$+]_;Rx]說I$̉${PrI% I$W_БI%_B 6\I/I$I%a뱷.=rpI/[z7w<ڳ(cuI$V.~̚#&V+w?8I$vWU5,5kzBI$/vF[#I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/p6|RI{b1;н$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JfgqTY^%n>06O$>}?#`c{Nn"6ĒI*}E'I$>bݧdI[_nGhϫ7 j&dkI;fՓgnG!$Yn2I$>^r+]b6/wڒI,ms>]ٽ gc< I$735yǁ I$e~YGߜgwo$\nfWpʳ'*}_eII$I%voǷF>V&u¨p3qo$K{&?WvUz{N`$0aFovGA1x$KI%׾YIfgml{X͟w$\I$ٝNf+/1Š$KSa`lGI${he6CiKBI$p_L*)23ρ$V,?o<I$;woY5ܯY[x[[䀒I,I$Ivjƈb%$Y}ڏ5rAIUI-7?ghgx4Iqsq'I$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix}6 K5_ޅI$q$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$VsޮfM6r$UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$oЛ)$UKȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGM~{dϮK~7KȆOI$yGMIus8'I+ckcXƆ endstream endobj 100 0 obj << /ProcSet [ /PDF /Text /ImageC ] /Font << /F5 3 0 R /F9 8 0 R /F151 101 0 R /F252 106 0 R /F253 111 0 R /F597 116 0 R /F598 121 0 R /F599 126 0 R /F600 131 0 R /F601 136 0 R /F602 141 0 R /F603 146 0 R /F604 151 0 R /F605 156 0 R /F606 161 0 R >> /ExtGState << /GS1 93 0 R >> /XObject << /Im57 166 0 R >> >> endobj 169 0 obj 9178 endobj 168 0 obj << /Length 9178 /Filter [ /FlateDecode ] >> stream x]gGY K˞Zd-4]Si.7r)#P@IZJ4V &BSF HZʥ 4R4PE~&iԙ33ϼ$}3),,&%4U Iq/R!KMJ[4_ ʡ{ e[Jo/B}@T<6byoUI$ZS!Kƨ). ƚ ک*X udhcikr ! T8B{>̋V B+:|V /&o#D3bIvP̷~Z)eq|l‚Kjos6Į6B"rM @0!fս &ܬ7|x۸oQ#mގXauo + vug7rPwU נ5]]5*+Q "3MN ##lG~YUĵCn)|=>0%wwCN*L8O`.,L Ss|bp/(A{F2v厂knЏ.gUzZg! u *HDn8 ds&)qs61{|ېY3b.C ¯Q)%_|> FEH}TВ#> ݐ8 T^Gz[ڋLMռyX AS10SX6y?J,SwՓK 0r#؜C1FlH\<QS-\||iA#&U?SIeiyaA$틧ZrC ޵o*viVZx~v O#+yx֝r ampyqI8u<5Pt: 嵬:WBd8>%n_Y'_a) ғ\un N8y>183OyR6[EK3K;fiZVvMO{QdvL)qU(ɍnJ?yf-؁aQF1Ӏ^-r:XF:=Htx[o;`^͵ YpII1bs7~m_P9 $S)"*CƒS0 ks6&%$ 6o0ZRi'G(= $$N? 쬵kHlM tIN*'wox\qlGpb ުX\/-гQ׈_7Zn0P,CE~P CO.O5:kq %nq1 wxUYPg:_L绠XGJsu48tM117oCgףŻ&ƔXY I︝`3*^Y˻qQsY\v'7E(s9*ηo?Iyso=u\:םQa}E`>96;)ER;u8&< 1]^fC蝋k:b:#؁v $GN .v^R~!w:}@sՌ%e ƆUWhܝݦ%4`mʲ%eʣۮ|2o1 潈ݬ'̪V7)-uoa Y3&,J]$}">E +I2b/RY1tU,lLNg e39ucVFnxH u(%DFet!47#\8ǷTṖ0 8VPsk~D7* 8A, 8_@h/ (͠P (]zD@m|-*iIBA_QZzPЫ;\gT1rN URгH>CTr|L&pXe2CAR!I1yb"ڶ;l[pX)7۠X)(V]7ܼܺwâ%yWJM)򤔞pշl(ZRI33huT-F̿AUol';:OѲ02u(rWFWF@ ǝhyU ,ERΒ|JjhMP/JdakuX\7qr$Z̍8CSt dQ&PE@%0YX4B-Ғ`^$h0̗r:X*?+곻]V:ezA hIJ 4DiiDAEpjDAHkesv<^"XLzvF>bᥬFq tU# &C@B*+2&儱)Jǧ*>wՂrbʌb!Uڳm!JeDԪǠbՁ (TZ]^'_ݎ SkP{֣mb,̪w4<^ Hz`Ԯ@~LnWL Eto J8Ƥb,mf`I{hIqb(|s5sϠflGOF$ WV S VltǿFI XG/g0<Ea8pua̞6dV&fM牅&ŜE#x&X|yUXȉI@/PY82?@ԯ BG@13ag 3A.^[8XqT)!V\}$V pc`Ƽ._,IfsQJary$VubݡKP&œL%(ݳVc/iwA6lC")jKTrODN $T.AJ-$x܇L͑f%m@B`K`q!U摱H=L0%`B5`̓r нRR8X"zO4ƠyOzP0tK4֐hY|FSR@~P,,QK"8+(?LI5"bAlnH G]Vu +;WUշhkTU\c^IX]^1?Cpc6Zëq߰4oe{K;*#5b~p %/BFx.6nxNy%2Yez{hM>db-2ÐT7usS\ =mD2P^n8ӝ;>HO`~dffsa&:2`b3W2o?8qp7d7}f<Ǽ!Mx-]j3'y@ދ~xjeN/ 姼2S^pBɈ l(GiBH QycAIJb,o!qDUW7ǖ"o%W1NeC?&mD$9l0z.Cg<;)49ݟB+ {?;@r<ҤZf"(إJX U³D ZsDps-8d{;bf&A pToM;v@-RZ@P%HgP!6؈C&$Z)tC%e]bͶ(]IP3$ *9vҀHL$%sq'Wȳ-5&vWƬ͡>LY61*8X0.k\KJ_P.:IZ[tΕpTW'~, ao/>vmáhx'))^uU zo4[CVٳ^!LA0U+ (jy}q{=d3*lρBSL9e2ЗCi5RO"P jd 5$ 7^̜锎9&j/MD2Ǜ=RA bnSjK{(,m\mc`bxazMg6'#*+#KMx9:cPeb ]4^Oq;w tk@ec )٬K17M:z &Ж*t`[ P;ĕn3$/mߊ=C.lGAڞe-()՛@9g7Fo={9_`<8#%_nbS%q7zyq#ciz=?BK2zϓk@m((fpREArн5 )^ވ]bi޵W3u4&SocRГE󛠹8`dZ\E# .<&ր7O){ ,I6R |6Ֆ<c&!gP_`w637l|QLT.R omsb9{{i2Uim`j*d|ћ YQ yxUNۓFthH'Cp1;р>醞Ab RXN3N!BA0@gTxRP(IQlno*B~YP!qK!j" 6O*}d FBc% (d;uD7ðf28S>(( (tzT;:ۜs#0se{-l ؐb9Z-9Go9 jreb;&!Sz yY5v(͊7.e߻Z|L.jҾ3v?8qs};w`vV׻26951Q3!:8)v ɚb#JO #o od7:Q\Yy)J%Ћ%1B'i>;פ3B wBh 3TC[i|8$XL.V*s>uvoݝ;!).t ˗;8yp"5LU3Tb ~m7QCͰ@Tiy6mٵG$?SWѿ_b_:)uxXdLkSPDlC %r9b6&PP쒴%cD:n'HAYx@CM7zsݏciW߲.qaǐtp(b wf T+}7QPmcΌx6Owj;ڭ*+dlit&0r@^:9u7ҩh#s(]ujB)vחR TNP (Vs+^ *&9/(S GsH;<\.1&VPP⓫Η%uTa[D.hF|4)( gR &RmFTn-"톚?tt7^n p;BGz+fPSf;⏕/{ϛǥ\L+WV'YL Hm|vog 5iXuE^1Diҡ$%Ę$Y,K e#^o9q JDXe5Bꥳ/ T[r}6Pg$p䩘\Z>&tY0K$Լ鷅L~j{AɤԆ0!ǒ} \ 9oU̥'va)fsK12MA#gvؓb8\ )r*HkJI*o/Kg=&ZEUDE#sUyC'm/V)@ N9$"RkqwLщW~>IRq6?K2> endobj 173 0 obj << /Type /Encoding /Differences [ ] >> endobj 176 0 obj 201 endobj 175 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 201 >> stream xcd`af`df``d`urv/-L- f!CIy/K7ܣ~YJ1,~yOD>Qo!Fs0020D;Teg(h$k*ZZXIKǔTbϼĒ=ǜbԢ2 `ˏ7|]6 endstream endobj 174 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ -28 -157 628 805 ] /FontName /UDZCXX#2BCourier /ItalicAngle 0 /StemV 91 /MissingWidth 600 /FontFile3 175 0 R >> endobj 172 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXX#2BCourier /FirstChar 0 /LastChar 0 /Widths [ 600 ] /Encoding 173 0 R /FontDescriptor 174 0 R >> endobj 178 0 obj << /Type /Encoding /Differences [ 33 /G21 35 /G23 42 /G2A 52 /G34 59 /G3B 60 /G3C 63 /G3F 66 /G42 67 /G43 68 /G44 70 /G46 76 /G4C 83 /G53 97 /G61 101 /G65 102 /G66 104 /G68 106 /G6A 109 /G6D 111 /G6F 116 /G74 134 /G86 140 /G8C 151 /G97 153 /G99 154 /G9A 157 /G9D 159 /G9F 160 /GA0 161 /GA1 162 /GA2 169 /GA9 172 /GAC 173 /GAD 177 /GB1 178 /GB2 180 /GB4 183 /GB7 184 /GB8 187 /GBB 188 /GBC 195 /GC3 196 /GC4 199 /GC7 200 /GC8 201 /GC9 202 /GCA 203 /GCB 204 /GCC 206 /GCE 209 /GD1 210 /GD2 215 /GD7 222 /GDE 225 /GE1 226 /GE2 227 /GE3 231 /GE7 234 /GEA 251 /GFB ] >> endobj 181 0 obj 14645 endobj 180 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 14645 >> stream xm |7>ki]Z[EAPk k\@R.I !!!$&{adlvfC@$F (TlKmmվg{gęʁi9[NY\J)SL55)i/??y}0!~ԣQOR>$$ݷQc?b?h? \v8sGsXq9q8.9%{pb-4[qqqYq9n+|qEWqewr\ i9NqF;qsFkcVqI;qg9<]^qW84ӦjML[>C3}f"W43ifL̘1S3c&ifT$̙ɚ 43kf5C۸s=q{{JǍ X7m3ܸaܸzم܄LnJjI{˸G):n4%Us3/pp/qs^.yq r#]Zw?Y{PgX*,ZVQ`IU<-~Qdvd6IHB$s#}g5R_mxWPn:d.=jAyI KϿoZ 찻d7^*m`VVE2mv{WG }$j*F |hI@ tH K:xACtybc5h+KjxTt$dYopՕBh:b*M^,# #[a=ɓV!~% :N~{n;lG[Ϲomve0ވgb4Iz]-,=T^pDt=@%{{wp=Ojy62g۽t!rUgD3ŮjūVwy@a!w& !1V= &MzάgrK7 {,jd#y$HfvQVOAoV*eHN7[Gl 9"zm-TjkqWD־ד4$Jt&cE3Yz"_EOUb, Qbz?E2C359BsS d@_)z&y1j7tk޼'\wga xVSVߊq# M[]B۶1n>jZۮD \œ :M>'E''E__G{ށ{/lO1mz@ Ll@kiOdLY̽A*!/BE⟻g,&2"w쿌KkD:nOEͧ$%ϐM&?@.9. t?`uY%H|OZA&:1`-O €/,翟'4qmE)P^@l4*Eb1du'LIs䪆Rl56 G];7A[_֓յ+݅7Z}M G$tIҵi&QX|^@|̓CU%ˋ`:1sf`D?tKїu)UACy>" A2YN?x[] d !G#χJ~L=j 3d\E\Szz 䄈{tS/&n ٘+C.kБ4\ZzϯJ|r%9d:f{jw}-=ڊwl`77!4*# ~2:vN4l]O;w+\N/C|<vBՊ2_]*F[x߻~Dڏx6Ȓ ZԲ͙=c$ā, v?lgc0m`ԴB:!'R譶DӺ0e>361]ERVkqbj%!ûYFBA *,]!LIVB@еz>-b}hx3v߃{oٰGK%RHz) T0Q>?+laq4@>]y:If`9_bK).%!&W]"1㉩_kc{bl0a|z%]f@T< cC;I9|A9|A,њ'?2}pKhyCr86(rV]^|eԞBH"^tŴIT.Uaw"jdSґ8u5eFNmE}db2_)M~VCKfI4/\%v]6g a>cI0s\}e{{P#V{ LtS lG(!,fE>T?ºU`:\LAwt:7OlB{6$Q\Lb[KtO;v!$_Ěg0 D*b MR ^PD >,ݩŞ\y-XHncQmiiRav\Kg!c- O(:5``2q6:tҗ&dJ'kiaByLe|e@cKrHc7.$fԩO3R,t[ .qo& ‰"-yb>,N Tg2g3U] lS>32B<,L v^`0= Rmee!K>ae@=B 1D Ky<' дtU$˗߼ч'YOk)FFmaGa5jT%!up5urHg`OnlLb Ebhㇵ@8Eߋ=>>Fʡ25O[OBDgzZՠr SUt|:rƨ/>LJH|+fB33ւΊ}9(ut%ʽW,zq7xU0crބ1JABu >^NVZ.Z5@tcf>V!tf$15lDžt>FhLuL3EC6*g4WD6ԁ`=Zz:a[N]̧۷mݑ5Z/zb]1' x@Tc$"(,&G, /psޣ`&>+8\`~?p`ȷI…w߼FX(*V˻MT߭|R+HRyS4HvFZzp4P_<; zGe:3پ\/o(*t[JS]r.ḥ]'}>=,`W;>ei@壇lH![ (~+lp|`>ζƼ  eW,VR4.]]:XJNXr0ΒhDbzCCP#~Ut*j 9O8#ݭ؞PGS/0DGn?Ŷ(?TGƲiOj 6HB6E"`s 1ko6سTQKb!8Df Vϟʌy惩*gGk{;|j%jTdwb3-pHWQmVDQy`]P*T{5=])T{ƨarQdRcAk9$:aO R%ߑ91n8xCnpWd !(ø8MNR27YjP?m!$vϙDS2E&\> "@#]͏T,39F2 > ;IFr9,H#"76\׻|zhMݒ|Ѥd(oe%EMW#)s(WVWLDn.t灵΢G@H +VeXU94nݎ09WtPC,&|{C(O;` ,V_=wfLy%C i k cn˖ {N`[f4C۴!Sjo:¼ lQox1(? w&}u 7NWy"Rj}oȋ1aʫLwaV@3*Ŀ1hJ46eni!kJN"GR2bgoGDڝ>P`h+[sN:A}~"h 58 &~'% X rn[&:ч&2T0iA (OO|i5!$~*8|p0 . ,.T:jC6 05ّ3W 1{M0v'J(?RrRF [&@!} BTR3N'L+F8KUp.I@.ђt%7S  ?y<cDXz[Al f>sVQ;aa<\>Ju(XKt:0?^&^W j/| f0|w= n Rv m\IjEZa=d5B #TD75=Lf\h_ravtD~ wIdLEHHā^f4ӔÊ٨ed{ ԉsHM:xzH4#}Tznsx*+]#P=CjuY*k^HR3/5;B\FpC`wЂdWb1 Ql7L57*%Hq2o lT55)0-^h6]7vViy*8迎Wu]'MqTwD'AYٝHeɐ :jzIR=YEΣҝ[O0/̘\͹|r`Хrq!*Jkv*xBNȍ uE܉%bn3.H*x7w=E&p#utT|&h3x6ض;\pT#Sh cLޢһ'H!7B}<p!zPihXf@v`ғS<)d1HH^q|Ju5΁R swL/d5n[R 90:2&uCWbNyA0]7].1ȣRa4P ZQ@n5ThhQoV._; 8|Qx,VM9[4u9@9y.P~ ,m~p\zw7:(5s&O#0ro 4hYL: ްA$r}'(5<}j<Po\ f=M6"EAh򰞙i`vRen_f+-L@I$YKD +2EJ"O׆6<ы4fY{)C&9tGOfC ٮOpOLԇU#X)Bh/K!K wU3WLI5a:DGI3P]qd{k9L:MɈ UdR'*/0=\I>Pd\Pn}JHBLa;HfOKW19zX>%|I~RFtZ*p˫߂M+RZ扉hHMSv;j{a˝>ZtUawߠd,Wjoq S|3_4v!W> Z͋lQ;hmtۉW;r"yI"fAdr N[WMk. 9J|`kkYȓ:<U36vD8S gkjmb-5|^Rd]7#v{()'1r ?i]{ø@NWN:{%g;V (l6B3*ٕז_rK 澋 E2@Bk yZƍ9wƎZ7'&2'40aiÉ}WYj!Õ:M~mO]43SY2#;+Ԫn2S)HyիmUjm 7צA}.̆&bnKg/w 6l7`ĚyKޖ?} eU5Q]4F6KIc* &4[md}\2JLN5`j%3fyB^e츷xz~a/[6-15 5$ T ;k^6>*{, ;ء9cl_qC|爛| [@-Yi?3Iݾ^ɊBOz!>VOCMǯ]feO~a*@_̢ӒnA^aWּtZ[٪)SNSs-K]-X~)X(OB}zIf(-O !,W ]=Xe[$vr(CHeozgky7raϤ++SWAM-"sf'M8>sk`\ .cI=/ܷ @FAdO/[:tu]뽃aRy,v%{ۃ@T#JeZ,?^o4pYky3D@L7i X+Kt,|Wқ/ȉ8H톿1d !c(vO*7s3xܐ$s EUhx(Eŧ̞!uݔs= O^h8uZ50IԳ$dZSMO+D$#Ri-kUGqir!lf5Xnp+о 7x?VwJU3^9M bC&IoeC[`cᄻ@&9ΦF?u . Qˍ. a[*{ $/4N:;`s@BӑqcLV&]f^V8ɧ WOjpW߿x Y@7A@'ÈE7ZFXӛk5mn0Yr#M@kuxp캢ٍ:d9Y9Ԏ^9t֎w޾9ϱ@YAw'4ȯ(UJ?[W.B3 fƆLMs =+QT bT"?6ys9 jԎ\^t",z;di-܌: dSOWXM"ދ'2Nħ;u+TuBAt6fUk6j&eojY ,Rf'* _H@`/ߜбs bdgn{g.wo._um t{5ZHSKE$!l֣ڠ.YLS1e-B3.m&SJIzHk[WtkkLqg0oYBs_TCw/37YB:5fwgYϟp".I 5n5Рk;֚P'~Qչi=R>`>w ,. J>E o&8*vVFTW.qG[l4h#[$Yq;[ ])E=bS8aeHIT9`-Ȉ"3Gᯥ(aeXهOl0tP_bCԷx5jd23 fbo&iqKxjȕ@k&dt'}utQ"ϒd/|Bc$ n_cck/g ?V݌g`ytY ℨ¼7VvAsmU|&/%- yUɪmTǂT$1r2754y$1f ВP1gpLB2"]Gg4\@O >$,GȐoPQQ[cԂuEޔ#y',@KwUA@_r<0h ap>ALtSC9S5b⭉jsO2g#X9:HOzZÊ8u䊠-Ϋ:5kAr}`&v>rG|on79d4y=9ē) ;E'P\@*=f ,V16`i`o**{!=k9  ˍ/c)XYXY!/Y?Bx#_?DEg^PGZ|{/!~桂T. AW +RWZ [v}RvZL\T/ 1T+gy2: etoo[b 2=R5ǦD 1v*_TfS.WK9(jpjYjϢnT ZRVu.%/ɌCBQ~5y55ɺwlp+]A0@QΰCl#-`"LI7dC ru#8VK'͚+0L0R +:+xE.dE_ `ԍ:&?W4 #:#XWJ 6Г{.%_~ͲU4qVo/@8ͻ|~ b}3lm>sbR$z.LJ?k9g0T44 tN)v0a }֣  Kvgm_ @Yh;>M)YtE'Ua2ܷE~ro 6(쎤FDc'9wfH._S .h%J^#>9FQf,=ChJ VKkT&%o I;S쑟Q>#N:FW1e^N"ef$cT #fd _M9nnuiص"2%΁2*tlmp $. TRvYI43i6dgɔ D}Q%<cND:EUMހ`o VYY8T[ݩ4WȜ$S+ W°lHZVZƟؙ?UA$-fYt|˚.s_Tb/"'|)J3>,DE7_1݇IڦK tLK9W&yD~Nh!k7?YLGhrK`W\-AٶvNsM~e!$$t}&7z +4 A 9#~0\{hx`~4 h$5c1yߌ)7tz򽟰;,ɝz,.?Xk;žr־;"/(S\PY7h6@kwnǚ>B?-8.{#TB*B P0ۼqggOy!L[RaX @Il:61:r"<ZOQ/lk@C?a\X: N݈qhy=*.ݖظLŽΊlc3Y2EZܵ<2Z,.:tY~p\U6[p6—?ߝ+o>sx6\kqK9 zJ'mf%[.$3yj1Bcwo{>[8rVMƓ`tG;ٌ+<&fFbjp*,OCRHbFz|au_.Vԛ%8.CL'%$K7- Tt`- 6LCpehi{uJir ~w]^f=4z*FD5{ԁiܹjkr`RW>!Yd4)pC\.WȐP K3rsFj1Co@JoioC24:f3 P&DSa:1c6%.}"~޴*9?zt h땹z;+<WE(/m4$BFJNs7=Z:=r-ZcoqоЮP꠶~=zؙ=¿ ]}uD!, |SpꕛlKlt`g{ W9l;{dž,1U,*G{g+)ܾVbb\˄8n8!ZIjaυH.JQt7 9B6N<^y3:Ve(3+)Q!"wf0iLv d.וÓٯL*BW38{@ohJRr2d8LOv),{|( ;ϐ()yNb{GF(CDI\3"yX$. <ŭ6 SZ u;\!/TB)=Ә+|0  M6}b+T)1҆cGPxd"1kɋ eyB.=y' reP(N:haR_.rcUx pK%bl endstream endobj 179 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXP#2BFzBookMaker0DlFont00536871557 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 180 0 R >> endobj 177 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXP#2BFzBookMaker0DlFont00536871557 /FirstChar 33 /LastChar 251 /Widths [ 1000 0 1000 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 999 999 0 0 999 0 0 1000 1000 1000 0 999 0 0 0 0 0 999 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 999 999 0 999 0 999 0 0 999 0 999 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 999 0 999 999 0 0 999 0 999 999 999 999 0 0 0 0 0 0 999 0 0 999 999 0 0 0 999 999 0 999 0 0 999 1000 0 0 999 999 0 0 0 0 0 0 999 999 0 0 999 999 999 999 999 999 0 999 0 0 1000 999 0 0 0 0 999 0 0 0 0 0 0 1000 0 0 999 1000 999 0 0 0 999 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 ] /Encoding 178 0 R /FontDescriptor 179 0 R >> endobj 183 0 obj << /Type /Encoding /Differences [ 51 /G33 71 /G47 84 /G54 91 /G5B 96 /G60 99 /G63 109 /G6D 115 /G73 119 /G77 133 /G85 148 /G94 171 /GAB 188 /GBC 218 /GDA 219 /GDB 220 /GDC 228 /GE4 230 /GE6 235 /GEB 244 /GF4 249 /GF9 255 /GFF ] >> endobj 186 0 obj 6642 endobj 185 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 6642 >> stream xmy{|ܵxlEVT("Q@9$FLACH @º$e6]id뒐!r "/ԢҖJ_{>=>p]}O7'\O8.XU0'S/1tAQmYe/oٞ>)cS322||ai ݰ gQd]ܨaGտܧ៑>=48ǍQ(ǍqMtqS9yq39nǽqs9n>p2_3yrΔ9Sr2f<;)9fL3ujNfFsSrfΙ=''kVN윬99SrɞҔy O]zz_O?/~\ڞ4)moLsIFعG~*]/ \0"in lt= ceBn.C@ t:ofgIU 6^!_DX 6;AlY2'l3$awtُ?~`P(:GH^;m5gs{^Hf:!ִJV:T$b;v;$H.HB3G\XLfXf :#J#Bzo1} Mgiw޻|Qv&*cQȟ0?y0_[F\6{&btc( +VT3C.9@[ޡYA\ xg7 W}* 6|d,w@.ЇJl~ )qE^&^Iޤk#ϖp_ =P&玙̄5:I:Mfs;}GΘ/糄gs@'v hAEuJ[*#FRU4C*Fx0)\Lc Ar{%ej;†ҩll:ͯ6{NjrJ>[*?t|5]dh"5Bׇo ܚ/ hɽY[q\ua˭7} tK!M⥠R$ i_G.r*>دACYg 5J-hܩiK]MBdά Ihs6{B*fQ;C%x( DڒضZ\-#`|ΛJ!{y{lv9ů]Y8bΘh遝jjk CD?6Gʑ".;@"UI\ӭ `^ a#ǟ@:%uJwQljakkɣ*BMnIO=vtA4kS(EܔswD39\rpeb .refvKn~fg,8ঀ?'>HItz˳+/?97}O:i9?|q$xȪ&y 5u,{#{<(Y5u+P>~o\ӀV6o7&.hWU5>YZ ֽ6SD/Q]&{xuY*8K5}ƃ" (ucA$_XCEC_Bi1K+g̫pY !*]Q|K@'{ֈZj6َ:L12POv J%(n~yBBdQJ6P*#rK+DxmtX_!zմE~Ea% MRԇ_r{BuM6P% Fv}aCq6ˌ-S 'üW]rГ}3YYllYvzϕޤ©:g6gֵ1 l`j[Aו} Ji.=(5 E$ΔR] a+BJy/ԱQ#DM B=+zPǰ~! aGq.).'twYgIjt>ҝ8[N30M>3ɯKAZX(>MN7 wFĞ:>$o'sK`?"2~=FlP<~ˮeieEPxklXAʎغf TU,&@}PF_FIFcT-IhqGՠ6ZIPxC?CM:͵ہ?yX4Huڶغ6,kt^.TuXɯ  Uhy7ꌽMl\SwY:c=M\~x[Iw`K.#-*C+]E4"F1 u;M$?tpXywCP@JےG V$"e2;Q IO[넾eGbfLl|2W3[ < 6Lz*JB0U @0@oc)|{#r7M>_+5Ayz@ 2Rw%ժX+uV"rR62RZ]UsN:<~?kBێ:PjHf'!&/)"#EABJ%hu&Q&rH5$?$K]m D͎m+Q Ξ *WV~n-[6NzpaĄwބHwăaXɍu^Xk%(wk3춋zWLHH^,?6Uūgkl5~HȳC\/Ў2А:mi{$-&ҿg$siT+PZt)㽵t(/ݒI@ yS< Cv,iuxq3-h)_KN`CW=7KH15"=LtBz%Žm;8 YLy恽ޮS>5:e&EO|Vjua7ծzn7Y}m_g-ޘDUOc:ZRPո-)׃C4է^gñv&:,N/]=~Q[Ѹ ٺn9}e5cGGƮڶ$TωC:V` OlaSxivZwRqV~9GJ¼-U%P WϽS;P%.^ =;[EdӭtCѷ\4,{:_ê \%+ch!h;7Ǒ*3}t 7`n>Q*E䇻TQEx!| BIX19Ȣ+G@N'lO; ydj%_|5 j>g!voC9psRJ\ endstream endobj 184 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXQ#2BFzBookMaker11DlFont110536871558 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 185 0 R >> endobj 182 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXQ#2BFzBookMaker11DlFont110536871558 /FirstChar 51 /LastChar 255 /Widths [ 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 999 0 0 0 0 999 0 0 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 999 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 999 999 0 0 0 0 0 0 0 999 0 999 0 0 0 0 999 0 0 0 0 0 0 0 0 999 0 0 0 0 1000 0 0 0 0 0 1000 ] /Encoding 183 0 R /FontDescriptor 184 0 R >> endobj 188 0 obj << /Type /Encoding /Differences [ 113 /G71 116 /G74 204 /GCC 208 /GD0 209 /GD1 211 /GD3 212 /GD4 213 /GD5 ] >> endobj 191 0 obj 3261 endobj 190 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 3261 >> stream xmpSוǟBBe@i. Ï@O@#vؘ`cc\FF==׋,Y,#L8PBK fL%nNa{ٽϤw9sd!XfE~T[klŠ=-__3[}KsWde:|SY!%#t#;ff=Jgyskhcw NS}~F s0_~( oa ,WrYʗ x iA/g?+X["YdϢẊEv*@X\U*OWs|rʞ'K7 lzs>p5=6ź45H,0<NɠP_$*DkRТuThWV1+8gSУEzZM>c 75v@ԅn\!;NZUncBC 'Юuſ! #h߾iڊn C:֭|S,);3`pZ=N6ެ Tɺ T `Of[ڰLZ]BRm(MG#\hg_GК,?J&mehjN֡!CQ/bdcMAx$uSa94&ѝhheFqMA6M襋h<Æ܌&nL%=$8 WDJJdJ>kCc*9A!^}M5,᲼oa+sP{X/R\plV+UC h~:vZ8i [F58|er.:_.ӶdW[& ̔,3Eѷĭ@|罱kXqpͯ3J )J/̝twB+ FlSKz)X3h+{g&'(2^l&iWG1'.ڵU"ǂ&3,8MG*yxVv'Iڭ%0A$X:QT"A-N󍂍V1{H]ǫIJꌄa6i;؆}*Z{UeׄJOz Cid1mzP@|o[8l:,Y?`7q;/:t5./#^& .u{b`$b*s,B4љwP(TUpŀ9sr9SY;ÖeRⱍh`!@3F ҹfTի-q2w}tN~bL}oUԃjJr*e:L.G8\<0ǹi }2 H"[:ڊt!>q> 3%qh4zZ@r W[yW/k0Ơvqv({V@j}I k`#E뻜8-MOޖw%o9o,k>S9esQw'4Q%㜱Uh8~+5bGnKy  hO)_t /M*perL};#nb/FEH_U5(GeB>``Cr_swgJ8< xUW>m&:ߩ(>FH4Ky02MCUq>tJAY=|\ "ڇ@߉\nb9* !Xc |bb.o';!E1?Sj@UE N+~[{ |'[|\͋ Ӌ@mF MNR8ft~Z Z~c@%o]Q.60>*G9 w'6R3ϬspJ}>Wd NԻWu[t P2zGT":NaO٣[LVaU()H"~mUIyMKT>pL#KۜhwY;Ї(/78VPL9Շn=Ç1IƲQT] TGɰO 6v>a_-{b=ß2{OLjuj6I˨Uac6j/nk4"r2@[xXwx҈ "pY0{!0%D g mb6=$"Ɯ!OvK|W K_Gy|$UetK.&:{y7ʿ*vC*žqn}8+ypZ^^ź 蝍{dcmQc Q:vw$\q|q\z($*yVbkz07WWG9Ukc 5b$:ͫ)O TK\3bx|7K]kEN&6݃'wӻ샵f[S?5SPeTqtAķ&vt}t'̛w9x;y ;[Ʌ ʰl51vj3l "kIٴb"HJxݡ5b_EF{j^+K6xlxj,f:3,JN=$c&L2[ 4j=nW%dF+{09?c>%,CLGsO0ِ00# endstream endobj 189 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXR#2BFzBookMaker23DlFont230536871559 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 190 0 R >> endobj 187 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXR#2BFzBookMaker23DlFont230536871559 /FirstChar 113 /LastChar 213 /Widths [ 999 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 999 999 0 999 999 999 ] /Encoding 188 0 R /FontDescriptor 189 0 R >> endobj 193 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 48 /G30 49 /G31 50 /G32 51 /G33 ] >> endobj 196 0 obj 1292 endobj 195 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 1292 >> stream xYlWdզ,UiP**R%Jв8vxlx3K1c;IuhEQZ u"֗U%'DڧssGWCjBUB}?y|ǁz{k;.ڧ;cجݲywdakZZhj7͛6nzl^^<ܪHZSׯSݺꕲ+ D˄+l!d!o!; QLHR4 BRqJ[أR*eJP)wëmy}776)Sx*H0(乕,!vBDBPIR"Uj+yV-GSk\kRV8E v80J @].3f,Eb]ћ v@Vj?^Ԭ+/[_6akrk]E} W*ýRD]xv(Mv5;/pေ#;T8inͩ6"$r~Q[F-=tݳ1Sa~ZoRsl 3|vwGw=#?s3#`\DN11}bz?w» um=tknoXZ%{l"C<\98&Aǣ8\&hӈӒs[X>[sn›d>FKxPj9KvLtv!w 0qIV&)f7I{QgҭB2%M[jjNmDC[P#YKJRQboHB\QØפizӀЍ3_ȝ?ɖݲ ?uGNlaè}fe.fnv\dNFKae'm5ql@&!oy FHlʀd_"u gq_)8\x6\BdxN ɚ2!ƇTL4Z7@b~,Ee8(ȻȟNG?c0azXcؒBY\ ;c4 G^.x.U;D|щ$[?K3x'') XBp422Rr,T}_ĜqEH% JY ͆f"|73IX'' |7Zn3\ nF,9Hx qeX<54xS᫖$| endstream endobj 194 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXS#2BFzBookMaker4DlFont40536871560 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 195 0 R >> endobj 192 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXS#2BFzBookMaker4DlFont40536871560 /FirstChar 33 /LastChar 51 /Widths [ 500 499 499 499 499 500 499 499 0 0 0 0 0 0 0 999 499 499 999 ] /Encoding 193 0 R /FontDescriptor 194 0 R >> endobj 198 0 obj << /Type /Encoding /Differences [ 33 /G21 36 /G24 49 /G31 59 /G3B 60 /G3C 93 /G5D 95 /G5F 96 /G60 98 /G62 101 /G65 120 /G78 121 /G79 124 /G7C 125 /G7D 127 /G7F 134 /G86 145 /G91 150 /G96 151 /G97 154 /G9A 155 /G9B 156 /G9C 160 /GA0 174 /GAE 177 /GB1 178 /GB2 179 /GB3 192 /GC0 199 /GC7 200 /GC8 215 /GD7 217 /GD9 218 /GDA 228 /GE4 235 /GEB 239 /GEF 252 /GFC ] >> endobj 201 0 obj 10891 endobj 200 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 10891 >> stream xm{ t׹8af> "4 %e_Bhb KqLlcccl;ckazѿ9q{)7sL{p|[q/q2K丕rzmq;8u,}p\1Ǖr\Uq\-I;?yޜy+L^*y䅳M^ yEKL^*y I^?%/YdEg'/OJ^1'yWN^(yUW-I^<9i~rҊɫqܴYΌ]WTU.>;W~|?Ÿ# rBS`M% GМLp%< - _BkЖO$'B o%&t$t&K$t%O&tsύF>eqc +9"q&p{xH\ΰ{<={/SpO/&pSsVpoff9,9j8mAKוn-ˀ'sw<9&,+t&MW-Ow}:r:u "\EJI~ݶTS-SE06\ѐd~dX4ȚMdT# 5PYz"!^:&νo]ϥ;fTYhTFϷ. [c th y#F t>̮q:r߸~aLH!Vဩn_.:Si/JV{/~kg6Z] Ae(D=Ld>(k]>k)dY@Ўk'@YȨ 8DY6$ õ#:Gyʴ[ ~kٮW"I(/Ffß@SlV ˇx)@XHSY4Ա TC?Ȟ [;[[,>?k/p[= q)6{'O y,׶I*Wq ?ȓ4N"_OW .D\l,Xm|,Sܬc0F ˖}8-?tst<$$\" ' mAQdisU6TGs KMV f43!ek0MG,O+ >鲗k18ZѺ?ffO=h7ٿ{tAwunG`|l. ;SP4oS t8(uVZKVj[RZPc؍$3^㯚.ja;Α"]Pk,H⣻B@+U= } _?4 U4 =!6|+ʊp:Y5R %XtTx*; JhfRpyeoYި*X7Ar;WW_F drZ{_oq$_*dI`/)7ևϊ-?'itZR:43?rL)V͝^~M)HiakoA+_dko[^wXa߉jvCCm-U6H JYъ|p]`a h\WHr]DJyY)|Ń, P@w+DQך}aczҰ gp43]&nCp.nL$|xg]7҂pg{vdVm5B N,_p+8x%YD<95H$d+ˊbW jH'SvY 2$~fӰVn4!M9k|:l"`#C俽#?RV$dd7Uѭd^k?(it)[\zqa` ~6E՜->i6٣8}V0:0OQ:c㎴,|n@% }4~"O PTs[l`2JzLb  >">zy2݅ět,Mz}78vPr|I[ _-̓0kUi;ok 6kiEjrG2PHgg6Xڲ%Et.:~s%P##|BsTbO W@b"0{€X 6 af~@L LuXl_9<,ސ/,T1qتWzt( GBE^+lmpud\eS gdpzL?Na0CF F\!*/ѧPIIqIbBjΐ) pakd^S ]>3y:@K AϟCdVU֬ZK}SOp6d Gv7VּYVV([_r$7Y/JXfcܮ]۠YɊ8Z3rUO!fˤvCk#mʟմ$7zy N[V }R=[nO?nwumK l*hlm"="Dӈ)EyŏMP dq_,M"Ә1P˿z&%5zDaѡ h|.Np2AIjz]H+DnXkkYbakNh[z=2qH,(6jɬ4xQtjg5B}e?s~W MmMuL,~/gU">l鯽7ģg ^FI:W)6UH&z+~;B8K횋>uIB-. KBm0,c/ WD& O.}$L}wJ{m!vVa̒by[yUT6LGԢ;A},p>Je7X2*@j '®X_w@Ʒ #Nl778荷AϞzgm$k}YצspjO@A#2JKڲe&CeI(5f!|Ucxy_ew%vY47WW]#,Y(/sAn#5-X#z^˛FjT\gUҸ:=y(_ΌkP[gvegݖē>dkĐ lr#o`8݁:غ˪2?ygpz0rX4ESTmld+6"/6vx]aQWg1p^:S)߄, JhGW҇Z6< yBM$Y0^`fԀ>(4 E-,♹HBSƜ|s!SE-Di~*mdFx/NGm{KȎ `䱌 J%̋eh5 @iHUtb'oC Ie&4Ƙ=Y+},G8Zd \W{JgCtC; w͛b|X>[73D@l0#_JPk t3(~G(UkЗW_faim=({~x!ǯ q l;ˇ&TFG2S| CWC]PѾzEWhsЋeF<7a _Ae :}(y5_>.n16,f;|m C&#Y}ZmZ4#%6mH(8;_WtH@8Ҫkv3]_J?PǑ@nK:8k\2DTg{ìFP1R4d|=G (TØK0PNBrҼ҄Ldb_/+C(,l0~z"Qfq;}k~s۱z ȑ5 hצxAqijlɊc+yj2#[˿gL g<,Uuc+~ ^1;+*$j lbdw+b >JBĭ7Q'd`|@ 0O`"Y:K+k0#0za&.)PIWWbl_ J! cuw.lE) vw9; LmP)m2Yt#/ %N_擁<.;/1|qrj*М>+snnY4 *:o8 OEގ[k%0b:%k7=vvtlj?1-s4"A1xp2ȼl̏l]lV#GNh{^s{QI1҉P)ޮ-3F%ʯ=ݖk0Z$[Q@|Oʯ xss֤.j%7#md,cz B#(8fg m۴u)F̅#}bC?ЌH3b$3*:Y/;Ձi\wIjWaSh dmW ,T"XѠڢL.VGa')@pz Á7- |wICz;#ztL_ rLʱ)MARP'tPKQ  : fh$1}^='+Gm[,v=0Mfc ݭd$v(G AWƈ45@V h9v{ śEVji1 2PX&Lgh&1`E]h=JkN&9)WPT\L LV3/%yGQw1g<}(t0X¸KuUPYqM+֫=Wȇ`zn7Cqz6^.%|L{ =E^;U_ P~=}'3ϑ\;tܟVftC5gAPDH`sO?rLms"݅R@F/deLπS5Wo#y߅xM /2*Ovxkoq9/{!܇Urt|?[d=v-ؙEќex!N)CiY vf@uMT rs(TZMA&O/_oNƐdE՘8PF?m譩g]'*'@R6 J 1Zz4'u{PmEv@ľ tW*}hB/Ĉvf~K藬jh@61Z;t{bY)P®X>ٝ_sMPyP&+iD0jjŰVK)`_Uj{@j2)h0rz:L^6YR;?dEJ@4LX0wmC<+acUM\p[4fhi6 y2#6_NduD[\6ta?^RmJ,l DM p=nY!7 {~5qH1z?nWYx$HoE$t%! {n'jJoq+prϿh$?^קSf<{;z2׋vӋÕ/! BYؖW_/ӵtrPZ޼9fB'-.sC5rU:V"ge]X!G񙉌Nvuw'm6LiDH4ugX~awMۧ~{ >[(W8+[^Y6߳ A?םgxsʽ5Q\_ rȕc|kI$#>B_QCfտ9] dPUo9BSE\i 7ILvaq^*^یjk* ɮ3;mhYf^ 9(׫. 2-,ecMѻ.6j#xQZX;Wn6ľ/R^ }oK0$ gG i{i T8TVO-v4-i#yꚆED;įl0|$ |Qqd/1餥0]ŧ]~v`hNgh +:(b z,f,lK3ff3Buj]ku.Uϡ! g 5UPZYGSr& N@:!_w`?fKpuǾa ʃ^Y)%ry-era>f& /6ZNb;C\;EN3B}>菞MDg G:=Lam޻b5 1ķ҆ѥdGctO$e65߳hv1~s=F9΢/OM3K0i1;l(UrՀ$[VǧҩP|0$OQ-nlt3Dֆș0`-EXZf!GƿCPW]\_ֹW/̓X;D&2h[]Ƚ񮾬ou HTͣ6+*6+EmPr' 2=;'Dr^B>P>_2!у%"r M{^N y{XÂxzߑu.\G-Z|~a7MY5WNjF&ĤQh@ EWLgmvl6!v9˅kֱ@~(Ԩ^E|Mc vnߔGqioi$uԝۚ.oG ])' m-̜Q~tWdv- {&ң4u MШ( dyo@J{3in3Ct}a3>#V |oG@uWkݮ;e,Us>>G[Z` I$ȳh%-i1y0\=W ϶Y@ۅ`>œJͣ.2ʇ ^mt7gȭ-J'}S5Jnu?rO[,wu9 Pu35b6:Įm;!7=!_(M]t3am<:$ʍ9I!ò$fOhG9_ \ʾP|Ւd܎vv_s%t3- -z)lPJ.\6Hd&˛Qbп|oe[<;a"F=;W?/,Kk*5qd_gw['x {K'3ԚGwxZckP}kH]e N% M|*OčvTg73P4'2tɳ+Hx;]ZyNv|XK!}q"QcA!r &NjGu:ZQ8yR0 *V|^P*mR~ šQT 6VuaTLWyEv0;H Đ_rQe2xKZۀ7S"#,}2 '?$հ?@B]+'Xtr,W hafDx\27">knI3!Lv,v[E4ϜʎL7ʈlOnD` I^p\Ճ>")? H&^uZ-DR<{=UX˛%1sPJgg[ax %+ˉұ(|HG3k=(xG4,m""z^Av5m7_GJ0I2A]]\}Mᴩ|r`)shڮd]{-'QaT$U@4̘*Gu{ ,63t8 T0\i`KbTc{8@#[9X&4p"@氨2R7϶qS_-T;@O_W4Aղ,pVMQ6ɭD2@vtr}=dg{sroKHl"Պ=S!G߰沃s|`N;55REsX Yo*4$P:tWU|~s{/ 2J9ܕ豣/=oXSA)ժ2zx#m m _߹yBG_G0wgMy:v쇣-i`BF;lGt!AWr1c*ވav*f`.h3*q}"p@io79-w1s:){Џ"R-;ZQe @'%'P+> Yic endstream endobj 199 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXT#2BFzBookMaker10DlFont100536871561 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 200 0 R >> endobj 197 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXT#2BFzBookMaker10DlFont100536871561 /FirstChar 33 /LastChar 252 /Widths [ 1000 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 999 999 0 999 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 1000 0 0 999 999 0 999 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 999 999 0 0 999 999 999 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 999 999 999 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 1000 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 1000 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 999 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 1000 ] /Encoding 198 0 R /FontDescriptor 199 0 R >> endobj 203 0 obj << /Type /Encoding /Differences [ 37 /G25 43 /G2B 61 /G3D 65 /G41 93 /G5D 94 /G5E 108 /G6C 139 /G8B 143 /G8F 145 /G91 192 /GC0 233 /GE9 ] >> endobj 206 0 obj 3753 endobj 205 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 3753 >> stream xmWXTU޿ܯemf/ru°MM4 1 Wd!hD{\3 LbJbn[-Kieoo=nxޞmiСgzs{IүҮ4AX)o˚͛?ꆆۑWpC}SF沬{gߟ<ۋR7 i[I3ޝqF4̛?'O ~!܂Y_H]_ϟݍ^/̺+7 A+vAX a , AOߍdfd.7ྌk Wd?\"`ͲsrzNr_ZHۓ&MӔ4WNiii^+a]H)/],ꏄ˄k?f}&ubD >R@cG\Zb` ?u0{,dtCr;2v:J:>NFmOU1V2" hM?/`w̥P\x\dET1ᵔF]'ed4w8: ץnH Sd\$B #KID 6S+.W @%i~ɑHz(f_YI,|1`˨DF࿦u,{sD~7s8l|M8 hKd0iDFAGO&¶ɫD9 ^X;rjʊ,)3T˟Y<V;'.>ќ>q=ed}NPDz/oy3AdwRپl>MRQA2)[%5Je1RrL6vU9mWɛξ?rB0`;ɪoSR<7o*ڒB(ipFCF] FI0'+W>߂G+/9`#pdSi5b `e ,lC`pA g^)SWl>7Nn&T:*V񂦹t*!,\if/lG+I6`OG~umnXH_ ڇN.I7D&\A{w`k֝9\<v-Ctlo5^ȥ5NS@F)UmTM yd.dC*S\"^Ҭ{D,"b?Y)$ӗ5.0#*f@9;;+{R7ɜd3*kb_'R$E೒_с@R YpH `5FQ֗m Z%uȭnإ7'Abj419 ¼$'Z%Cv4z4x4]qaZ}Mk愄#g;戱XR9B$F^+(AUw(yv({bJ~\)B 6>|N 'HuΉ?ř}:g憈-~>o4]/c=Db։341Rf@ݺze>+ I7]#^G%h ͸Xï.BdPEa9Two CԻMrHy-{ރ => m{$ .*өC 9ջfSs$ >G.^~p a/*.n`g z;'iga蕡߂{TCx0߀mɶꧠLu0)q}\ʫUM[;A36 {$XKI.v+yyYw6فYxPBF @s5A+ RqR}V@7ܤ;29oxm[k`EdzAO96TtߢlX\au-и怜s[N|};y} nK#l-[-oZ>Mľh%vVTF:PulA.ÍGӷۧ`L=`LBKpΔrWՋ <r}U ꑐK$S9GRav4B)"HqK JUp ~ a73&{ҀՠZRJC@$>Z b;:RrĘq2l>dW"(8J % k<)̡7m@ :8>j*ť}rj`C$U]$*~[ȉSΗ]{P.cPL 1zQ'A >M{eс=s |>ǦY෤ߡNK'dZIV=m 3~Xi]]v:v_ Usv.ib.U]ϖ'Q~@sxf'zLxzL|4XoH-. ۿ'bWlDK6br5ߜZ⹢fs=}Ҍe!žL~| -#? iT:@S ;d<} ;bMiQ"E'c. KاCps_3ZWNEƧ> NmZ~+ĥ@K~cb!gʆDK@sh CK|ӡ{?mm[:MnUsw{K #H }lH!ݚfNo5ḯ7PV.Úc0+L /$8 endstream endobj 204 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXU#2BFzBookMaker12DlFont120536871562 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 205 0 R >> endobj 202 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXU#2BFzBookMaker12DlFont120536871562 /FirstChar 37 /LastChar 233 /Widths [ 1000 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 999 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 ] /Encoding 203 0 R /FontDescriptor 204 0 R >> endobj 208 0 obj << /Type /Encoding /Differences [ 36 /G24 40 /G28 76 /G4C 101 /G65 117 /G75 139 /G8B 176 /GB0 227 /GE3 ] >> endobj 211 0 obj 2744 endobj 210 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 2744 >> stream xmV}pEEs(k%!\b"_ blafgw25m6$H`Pǁ"rwQXWweyUٝ~ޯ01ghŦYy bMi;ZQjw\kSO2)Sq?OG3m44!f7xa{TI1f` 3a1̯fb9 3:/_ڇgg8ao nh0i918ɰ/_&A;=rHŒ8T:$ mGgH[c 85$3JYAm&hvh:DҰ[[Xbnuh&/~U{bMtC-,z@(ȒGTxom,읺;9 +G:~if9#< 7,wgVtbkefNrZuJq9@RwCR| n޿S?9V$H 88la k#==;bo{PrARq Ac/Hdo3J4Nq  x~_;P]RUZ +@C$`Zx80 rBJz[[..ݣ9qfs-Ƽ( AJ|" P88 %oED9 o V D$)l[F1W)]4{P%IQ{&׆JUeo)$8l{v˯-h.\os8(:ɭSv(t?.4:ZPrw{Q'C u'Yz`|k( LDu.>r8NF ͭ(nf2h9~NvղBV?"H`5ɳ a:s!mm|k.rDP='%Ttz J_<3Pc%.(%VGzaCƼ]оYR6 Ѵt.=+vXnZD)H^AW۹*y]R#BThh3X҈Õ -<맣,L& ,g谂jn yRXMVUBK v%Qy1"YXjvVuGQe3Xm2U>|GWFo%SY場BՄY- `o8 ۬ADB%r/X_õO/]D4ǕkJ!'K4ߺrLyLC0(9[`-BO5 l1TC> endobj 207 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXV#2BFzBookMaker18DlFont180536871563 /FirstChar 36 /LastChar 227 /Widths [ 999 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 ] /Encoding 208 0 R /FontDescriptor 209 0 R >> endobj 213 0 obj << /Type /Encoding /Differences [ 80 /G50 85 /G55 91 /G5B 92 /G5C 118 /G76 119 /G77 122 /G7A 206 /GCE 220 /GDC 224 /GE0 232 /GE8 237 /GED ] >> endobj 216 0 obj 4340 endobj 215 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 4340 >> stream xmW{\WO̯խڏZR)ju,L H␗L&& BBb *(Z~klVmﶟ{w?瞉GL8d}nC:C:^{j/5{UEyE9oⵥ%M}nER.x̡_&釞ť(!h.MGM<MnJr'w8zD}ʣ  :DnN7Eftuguy:nNhZܴԴUi/-ZhQڢi/I[bښikYMOOٸuGvEݾ:!=zA֋zޫ zY7~PQn#:d~s]Jn̷qwu\ҍFCn9K} v X*`sq+Ls^O,yMXpY7іMh?ПX@- ?dct g` vz\/_ SɄ3K)훻?¥-gӺ^o\pB%g7z‰DWg} %7āȹ6Ghie gsVg  Ib%B DڡBP˖Xܞ9kH&dǍꖒ>pчb#׼lU.+9'^Io+3 _CdV,ZQo c1. O `,r5S /ôEgM{X\^}t̼{n")'R¥3xQȼGE]@N4A\8g,X~iǍʻZԍW yW@+b%RpK')}J{y>\7w DY CJM0451 997R9 )b%!u::iȫWy Ǩۍ]Gti'|^{^I!Hn@ۓVhu즥3-+Xa\`/k8Ha@>%Tur6Z lͦ ѱ58PHhàf1j&3N2:7ʻߐ wRhḽ[ s 8yG,viH j%^.|a^;S 󴝯4IK@cE E>sXXTV8aX3"+7;}l2}207">hD[Kr Ą#\\ؕ,I"CxN˾-N}rQ_32mòWX9ǻ/[00AgU m,)+wuBlս,ftbwb&A$j v,{(& f};ꡅXV|G*XFjZXOiB=<.T[ D'yb"r 𻞈NZO ƙ%b!`.'("=MM |SՊ1JU==~W3[Jf~WYC6ה$Anܶ# #sP/s_)l* ))AWBۭc@>eCDquW'NaHGC FQȡ cR(RȀ,nh1=p<'b1Mn^wM8=IYW ebۋz[L ߔS8Z"T AQ>z #V8,o\ј CuDdJn`ԉl@s5-1`C< 3pH D^R(cq6 U& AwNɭ8όEb9;X:^dJlˬ]\)dbΡ=EY{i4@V ,bEm[NƭAۂz ¾"/>".5,k}NnPQ!:rg]:6&cpdr7":|ԫ`̐#8\ }Din ʦXfF-Иqpt3IYv'kUOޗAd`EOw_s{ CXhi)K3 qJ>w*GF]V|JJn%7U$|t\wP`),!ud{{ٔ/Xy뾿|[H!U?:Vc#s:{ 8qBQ_#$gy!=j۞[!/ TK%Ŀד\X+M:@eb+d,C8z+T"7S"5iMXK!J7V&7^[#>)韆 sk6?HeūAQ2QG ӠPJXUmցNXzhex L*MX 55lR`9d*D([HLImG9qg.:_}C=#z nj)~9JA; 3rQڤ5Qo*·U0 ǐ77C4Qɧs'd<ѓ 9c/\>Aft# - wuR"ܒ,Pxm x2@SJ䀷AAVd ˕v~&ߐ`2<:#95;o:jW][0QpddRs肫X>IY2t20]m* 7 E";h>EˀM֯"Q7G:/z 9ൊ6 m?žZe.-_GӦINkKB/#-#~.D3ȋ $%̿3t>m؛FWt!9IaE6 &!H.¥ prTZr,Ԛ?MɁϿw[–dlH,Rqݾӯ\)s[A[&=@M]< B8kl|+ZNi, F6'5RvMhq|g[I>\M0Y0/{;@X5@*k#qPf(Kv(LjQVŞU-!(m"3I4<|VWqO)Y cT<&<ͭJ{i{oݠ]n8i .MP0ȐPxF* #fd)-\r.Qi쥅tSA+kOٍ3~@>r I=2KzQ6Կ'oUvo*;yguI!FMJ7"Fzj]]m-XMuu\_1W؍S)mfw'Sx@W<߻Uj*@Hv_̋f7fO}HiXlքp3xX!A-&[*\;drT7L 7&Z:k:Yh],Qh,Ygͬ,g/ׁ-Y +_ga!?b tK 3bFXهzݚfnVx_zsT*CrF2n4{-> endobj 212 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXW#2BFzBookMaker14DlFont140536871564 /FirstChar 80 /LastChar 237 /Widths [ 999 0 0 0 0 999 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 1000 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 999 0 0 0 0 0 0 0 999 0 0 0 0 999 ] /Encoding 213 0 R /FontDescriptor 214 0 R >> endobj 218 0 obj << /Type /Encoding /Differences [ 37 /G25 38 /G26 39 /G27 51 /G33 62 /G3E 63 /G3F 66 /G42 81 /G51 92 /G5C 97 /G61 104 /G68 126 /G7E 145 /G91 163 /GA3 164 /GA4 169 /GA9 171 /GAB 191 /GBF 202 /GCA 217 /GD9 218 /GDA 224 /GE0 229 /GE5 232 /GE8 244 /GF4 245 /GF5 249 /GF9 ] >> endobj 221 0 obj 7582 endobj 220 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 7582 >> stream xmz XWnubW-pNII&#a6ߊ"؂` Tu5eCC4 Jqŧ1c2LI83qy&9wmsmUkإ gx 7fsVzmޮyyىiM3//`ʤӢߘ5-Ir {`aVBG>?F2|aqlcgh5on{ϓ4<Ǎq7p\Es ⸹gKEVp\2ǥp\*ǥsϜSSa:<5{"{rgZ=E>FNPV*f Qę?bԀO+%KW^lOK@tOvJR;¥=җ _rzz!1O!@M<,PځUdMVDݨ2nc76(fbzgG1V`LBB_cJ=HI^NCv?exX As8&Jt6otynAbG̔v%n8.}!}nɳdY o9 F}.O;M__BY k*d|gGwLlBB#.w]ݼI!B'CMu@uRx=~ڃHRm8l>]}:ٯH>5̥y{̃ U!`_@2i[=.ZJ H'M{nI~U[<pG ۠_ӧ}D>@z C3ڲ ܛ'iq@]JXNdG't@er]s)/V0%^:(}V?| +od 2^OX v;ᶰбDZI o:s9Mz⁒@R )*ص蚚 m$8H~wG82HXTZ O#鬜 {83?,hֵW}ΩLN~9!J{رAJHHU/+E-=/OFE?FI;h _܋h:HI;VH)dLx=M뼞* DLӷք1acu땜s0ҪBO0v]S }۳;πa'T/(dՒojZ y{^7DZa@~/y* ۾4 h(,u/׀ތ4Z%q08E )b3Jt7rsdwBhY}U+ik2W\Sj#Y&UrFlq]»rFnvj$Rc~@7:~a_M&woVE%[p -fU,Jz>z'H2%tdc>(URoZ*Q(ePHoLJ[F{@  5ַ`U>lF[zIvJv|qZ[4յTAZy˿6jlI_πO;u X ev D~V1וCX p#"6) B/kN ¢YRKUiywrd dƙM¬wˠW A=T: 鵔'*0JǰMXMJİ& dE2DV $Czգ9i+A@Nft#LIm~ci9U. E0]HueVbNMpY rR u]JgٺȻ ' b }!+|9+f\&wV`@%*f-NX- +,*NyޤO.M?R{?}4RjU|nkϱ-Aۭ">:Y5aOMtY'|E +CP5ϵ?xL_gd9S}K@eٞJ$PnQ,"q{ؠxI5 ڭ;XR&Pܬj uʉsQF1ř? b>"hZwݘWx{R̒I f$H ltx-bSE*SH1:aG@T reAl#3eG>80fP\B/hzT-e* (?"#c r*.׃/Ȳ$H]I8Z]ӌ`SW,#nw3͑#KtGc Ox5]QJEEQD MCU#[e: ?ċgEFþj[pwr;b<33a٫1oI\3]xg W4ƃlW+N1/ϭ3dgZlK[Bl/6z%01ac9a=Ǫa"giK3&C@ by٧AkRs{TU❣#ʱ[$l#b;APKnI NHem^lt6ЗdsPArԗ.y14މl0Y]q>-ȋ'^)A/Xe#pdoi\)ϪDZc9/x"}4?39Iˁ@+Jـ1F_3]qlsɦtd'tl=YLx4_H4@#BˎP~jHj~ twҼ=pfڢUo(OO+˯VA_nIcz ҂w*/ADݫe鐛oٝQ (1 eR^Vi 8 woZI&dOd&g|t?qhɯ/>䣿ϭF&}G(!s-acQ~YF@|Kݨ?b\|!BEؙj }aEL5aN=n>US[^ n©|S.^"˹+lbln .?И<VzL>y 57.=N+nASfP4^[`k8 ~}Xp*T8[* <^$ѡ3_ \T%)n 6C8s+:5[0΢sd }NWBT<G^;_\yacUD8P.m}Oj&SjGĈ6$Yt#hILGoÖAm1z3 ){{Bl4$/S餭/,Yᢺy?" X*rXIJ ;<}ij_BVO.|7XʧF3V];F\[44VEc{+Ly,^Լ؋a@"JNi?俵=iG::{`/ԞPZa>gBbcf`O0rI:R:1Bw~\^rZ:!A9 )T7 q +\7M >Xx#"0BZpſNI=IO?o.}Nƻ_w@ѵ_*GslvתmAүuUiA}$~h0k˛ɚ<& 9^ĴYpϲvE|7x:l m 󠭳kAp1w :Gond ΦFhlg=R*lp03an"z ;|lx\]s|Tݷ`^QRZT?LqdQ6d =}N9pw7-o1_z .?3EewhnҽE&^KId-z$v_!Ÿ89j p2X4]՟8l~MVn7 >&/ Nxa` _;3$t\yqFHlsx^ĂG ?E}Iw&)-mJHq[^w5 $\AY3ABUv:I&jhZO+0C2,[gLvi ar"d;CS K1|&2qfcdت+ns@)C.5~{ k V(EvEY^U42F@EBJ= 5 ȋ Tj[aR1$ AwXi&dؤ 1J>X+NnR g-G_&9rQd*p֯jAk{VK^?se:>y2釁 @{U3 *P' &6|e4|1J7L~R=F4"%b i5= /aO/¢iB7UA٦o"0@4 # ֈ b/I"c"tӑŢ)<'v2Y;5fd߀4Q' ӯ3$*F$AxgP۶03uTU=V# XO #|:Ћp99(;Keg/dUCd٢hH_M3LpI(l+GjTD~@$jU]YbEr_F >!)[ dbdxR[vPSuennqC%kT?\ѐ{ ger>^D\ Lj%-&v-!ձ\LDۏiL?T>J -d+T|l1{*Tx2fh C-! $x݂nhk}jP5MEW+A:-5ͻZW. )C&1{[~VgK鷂fWą;)UiT)V.6XW7&vcQgԳɨ?'4.FGUcMVր\yxG}f+7BEx-ؿ2-O_)J=u b#j ߝ֧I. ~"%!ۉ>s-HM'K˱xD&jH P_^][<qy"CQD0O#T~VHB:̔<&GLBa"̎vȧ#m~`spQMfT*SLv!~69/ձ1 ˤ$^[[;Q ഽ,ԝ ό|wP@ {C4R)A$,7mG90}F[hۉ@%ӋAn,m,//afMzN!erNxB_Ⱥ֞)*@~0}*[Yᰔ75tv j&glT?렇1#lӬ嘎`*o\w}mZ]&yu̧;$jXӍ'^MWO[ ߷$'I-ZV -YJ:I-l !Bjr >P,ɳS hB8AO_Dߌ8ky#㯆V`a߰f%{!ɑ"/IWi-69(;%tcẑ%a2*Mrƿm:5`z\A?g.^>6B۰=XXx?z&8sw ۜ&K.>$cbK)h/o#st'xXY遁w`46\0Zmu6PEKO2 o+ypS%ןɅ@Kmc}> Ѥ$uR6V\ eKȋwzͨ`r)KSq⎽]b1[wA3aE](FOfM~Y!_>CSLRMGsZ֜#9(<#/[K ґ~׽&iüx0 wc::]+eGѽA纠q_.-[*uj5]RY6 Wk^Z D-@xFV{]ޣWWձՏREWC_>f endstream endobj 219 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXX#2BFzBookMaker2DlFont20536871565 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 220 0 R >> endobj 217 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXX#2BFzBookMaker2DlFont20536871565 /FirstChar 37 /LastChar 249 /Widths [ 1000 1000 999 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 1000 1000 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 1000 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 999 0 0 0 0 1000 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 0 0 0 0 0 1000 0 0 0 0 1000 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 999 0 0 0 1000 ] /Encoding 218 0 R /FontDescriptor 219 0 R >> endobj 223 0 obj << /Type /Encoding /Differences [ 65 /G41 68 /G44 73 /G49 78 /G4E 83 /G53 89 /G59 106 /G6A 107 /G6B 108 /G6C 152 /G98 154 /G9A 169 /GA9 179 /GB3 210 /GD2 211 /GD3 212 /GD4 213 /GD5 216 /GD8 217 /GD9 218 /GDA 219 /GDB 220 /GDC 221 /GDD ] >> endobj 226 0 obj 7344 endobj 225 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 7344 >> stream xmy{Xg:3w}Z[mŊ[V^<"A0If0 cB SA0EQz(vi-ݺmwow}'0g~wx&p/s/0oֽ6cl*>;>ziIYq/͝츹s^:83D~8ކD6!wrd6'?)aQR⤄גE KkUFQt}|C}~kqƐ)Fq(15f'ii 4ǴĴ27NCs"̄ab(f01kdexI'+6)iO%ruxBXȄ8Oˇ 3Iv`qoe+YmU>MB3yjU0I@ϖ2^HJfZ {+$t6Aek5Oҵ_26֒7}uyԀ77 5B([!K2֏OQ䭘<]ϭ!RqX'2R$IXdFZ WKL"G1 3yKpsh~ί>԰#čxiEN<|qrF u,H-R#úQHrJX" a% ` yDOEK;8ɄSp&U*t OxMuX ] G/=Î3Wf["N&qŐ˂jox\Í4'%p-d7h{1k0t]Ii?;=l}f2 'AD|A 2,RD -ϧNO MSQwSy-8J`nrqo/ noQSlj1'o"B3U6HW >i+^HT2Tsps/hT6hO򚝣O?9:0u/8>$&7,ۥϏTi'-_@] a!E @*p i$ANd_a r߈dz煳b_)uRamTbNI`rC DTZl1rĺա7!\U>=7ƪ 3i[x!Ī8:F[xgrU Ky"+ Ӥn=KwR͂φWf}̭g0XuR̀J}KzR|AF"/*(eF OES%jʯغ*'&6I/8)WŠ a]N ]"DRDisN49!D&!]m<ȍ@T}Ԡ4^+dH2I2XZ !>1"[$pa oF,jr4cu(Xfv/ :Y(1hΉy4xU!M _fhJ)޺}Gp*'h,!HLӑVd]ϱxqlH[c^ZA1+Z_OE} Z{(!>mv.g#a*9q4fC8Er y%&ojaaB.ix*Mn%•(`*xmWnnõA6tBrV"`| m{ڤ$H2(nguPbMbƎf nArocj-/`m&@fѭxe:!%ys%tƱ!Yt$/"{u~\1KTm Y?|B?m-~]X\u?m,`KڹHD/Aʼ>;/~ K2mQa.;{<@̐;=f1 z1 Ed !qi2)|M"JF7,Y,;ʡ^!>hFvH\v]cmux#P/xFuQUm3%n 7ٜuGdZl]^5]_gݩ6]IK]ub.SHɑ( DpdeGZNh ϩ{SCFB8BqY54 zs%ϔ.(ڐ{S!g@kD/rD{%x\dΑ>BǫB[ՇE^T-^ٰ22YK[GQ}UKBBW[!a-{u0|]骷`/ޠz%pՅje8%"U2 76ڥՠxn""H5u}ISٳ(;`By?9.kR `wLAI3j!z0Ko{|"ˠu֒Loj_s%Lq5Y)j>n̎9 (] Og'3'WʒYJ%S?#{ȣ@Ž6*o)@̑/\)~,&?`_V,ArKDTvz jD&H4X>K޻vCR*) ; PTz$[tdB*(PP%NKZ.R!D(b!wϱHty,;/{צ\˸$A*7]Wvgr 4?)ǟY]t :}Zېx eQ0>6x\A} yF)-Dd*"-k1;ySP9Ⱦ|!?W\7Q8>]%u-Bs)\S6.E]_2haN~ >S]5< SڋNiQޒx= BlibrT zNuAAw+A`:"`yDQ%pLQ8Rxҥ{ :[[Hh0n,+5rIZr;6qN5?>GyORi7*ms MFQ.4DU$Fq1N$mǵ]Xqma鰄O+!1 c ]ONKadvn8ZQ7*vmA ^ .MȨ=b]QlBϝ=9R|Mh35ypJ^1oR lʘ##4w>#>Y{:2!hk nmmEޯo+Q-nCHJM\ WLCU?M.Px9 ";[qEQˤ,.Y@sVǶt]Ҳ)2z+=oXAYZnQ7}$UHFdn]b|D).6΅oӋgBKm[E߻x"_{- lX 7`?l0ž9SmulcGy#Ʉb.NavsB P Om SWg-6Bqٳ3=?Sg׍`'?`=i:ܽpYY!eW%Hx)76}r¿jk "*Y[%WzdybYǑŽpBMuddt 4eWPQO6iN]q9Ĥ1!% Nk= VSj{/%4c6q q bvan Op|6\#!TɤZͺ%ą/II'\Ɠ$M(Pa *4yf@ Y&7BPHNu^0S $ EvWt7ЊYS`儰>_n/c+[q)ٲ/vWZ%O qO*!$7r3-p3\?iշq}Znz5äݧ}6u[./L..Zi,ʠ5lI݈=k~/~Syye㱉dtI'G?i>#h+o~|˚ =g7RXHjO* ɐVX߀ntc?GBo@h6+u䨦+(7Ci:^=[F;%4hyr8BfrG/O{6,@/?{Q# endstream endobj 224 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXY#2BFzBookMaker19DlFont190536871566 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 225 0 R >> endobj 222 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXY#2BFzBookMaker19DlFont190536871566 /FirstChar 65 /LastChar 221 /Widths [ 1000 0 0 999 0 0 0 0 1000 0 0 0 0 1000 0 0 0 0 1000 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 1000 1000 1000 0 0 999 1000 1000 1000 1000 1000 ] /Encoding 223 0 R /FontDescriptor 224 0 R >> endobj 228 0 obj 208372 endobj 227 0 obj << /Type /XObject /Subtype /Image /Name /Im58 /Width 1806 /Height 1057 /BitsPerComponent 8 /ColorSpace /DeviceCMYK /Decode [ 0 1 0 1 0 1 0 1 ] /Filter /DCTDecode /Length 208372 >> stream JFIFAdobed     "#()%$%%!'+,,-/4443.4444444444 ####44,,444444444444444444444444444444444444444444444    [!1AQa"q2B#R3br$4CS%DT5cs& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjz  S!1AQaq"2BR#3br$CS4csDT%5& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjz!?^I$I$I$I$I$I$I$I$I$I-fڮOmo{[:KѾbs޿sl!ϐ$D7پllL1X\Ǐ?$^_۟_:RI%I$I-?w,ȼCğ I/Eݫ/uXY.G\C5LٟI$g9i܇pSsIs7%b;Lm# $EIq$7.~՝[g"C q?I/JS7Kd>/5ø8:0I/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$LHi$.[}k{]awd#{'B;HEm;>{:R]Eem.{Z:ebeII$I$Xm㱙%~Ԓ[bχ&x帒K $I$I$I$I$I$I$I$I$I$_Gkd^ ;¦RI%i{\g7'_$WgO]1 cl#E$^Od<^[MUƷ$$I$^P`|dK+zvyVR`i(I$qr&>,ۘʣI$+I;, <_$,j-ɪZ_m cGRy$K޾}LϰݛamslkMI $d8b;$I$I$ٯ}87& tk $? _XrKRI%_f5*ik;RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%[? .hYZ rRE2Y$/}? ٪ul#m8ۉ82mVw2vIROGu%lAaýtLJxYOn66JJtMͽ qv=EI*BLh{nmg8$kqcvg~ηg幓uMSt7.䗢^.=tUV8[&U3d*),?jI-ϱ??rI%I$I$I$I$I$I$I$I$I$I/~S-0Y_:SJ*I$FI$ZAI$/s޸<`I|I$I-hs>n鉷v.![yI$I$_߶w+;@ۏDIs $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Hw_Mg$фz{n݁^C]KC_Puĝ*imnBI%hpnKٰezw&<:U񠶻*KwRŖ|] &ɍ^9jl]Y>C\/ ~܍_Dwv7ь>[E`|{Vm}#*旒2#Çx»Wf{CL*v˰}ws~;۫`(*Y9nnmA@m;1;{^☊~o+-V{ZW_Ua,6碘I%i3{UVvln.!y쑕sת[ڽפ:K}~'sgUXPo6LjTd.}%;_I%'<g[$I$I$I$I$I$I$I$I$I$I%l{lدo'v<$K4I$I}yu]2|pI/I$I%_~p6[ǕmI$}QcS1f<>y$]}rcq{ ?RI%_^Sr~_nw y/I/+I$I$پ>~g]ޭ>E$_E[1{g鞒I|ĒI/><P)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IQc6}*LY-OEA$O ~dT~(鰕^[OtIao?gK֨7i^*Hcnf?s?i>u0v>%}yh,bq2i$$_F}yRI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$*1孺[`J#^jcvW%>?=O~>)_2hm$n^52y$;#rٱG߃jJ?o>} 2hOrgdkk/E+VR\>s<2'G5#EGw4m67Y.}$MU}-5v4mCU\^{j̟%svMxR]Wk%+[oc⁦8}-/ݕhּ?u>CW1.nc@W]cq{d{qIi}5s/Ϻ>z-]?Kk`\ٛn[cx It?h޾67إFZYԦ~xHw*ڟSqA?6J6]΋# -FvkmX8+mW+ eI$I,?jI-ϱ??rI%I$I$I$I$I$I$I$I$I$I.]~[}l[4a$]7gycbQnN8?qk㴒IZ_??C q{{5Ӝ$Kw;|vv@h࢑ʦ~ߊI$O!WCǚmʏMI-ܾ;;e++8qӈ>I$}S=Z?I/BOiظ zg$\_kٖ] %ZI%4>?LJ;7gv~F7_I$_}Ը3г.&!I$fE)I$NͅS;sٔ*{O9Xi$l;͆8iMME$X $3s RI/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$-W!Ǎ>)$UF8- I!I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(_h:0I $EF[X-i=^`~4CI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$LNߤkgEu]hvfN$ھٻVV8caN䡝>Ug]rhɣ#YSoQ£*\I?϶f;fi[[ZLu*UQoc.+nR\C22{E8GmqT~ kk- 2,q;6q͒Belg!t5qr;w-WȤV;~giSiݍB1gs}8\7\w<#6~,O%~ǰccVE3Y6|FW썙^hU=,EY:Vvۑ$ns/Yزnm98.㹵G_0&zI2ѯh/I.XX$I$I$I$I,?jI-ϱ??rI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/><P)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IUm.8ޣbAA$\ѕ鷊ipl=URI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^_h#BVx+o I<`!3|zI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$gǿh=^RI8Ŏ>CdAI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xl]G{+ .'qҒU>Owi,km~g*+d%ٻm%Kd~]wo.3u8ʬ]FIUmn__lg_kmGgӵn\=%avݹ.Ynv\_om-UqX[oGQS_nyL^GaMEh[a?tܝo/%n{Sul/OrQ/gݳ'; =LX*;&,vaEϵ%7{.f黫xwR- 6\lotnɳ3/}6qx~FZRڲXτFY)$I$I$I$I$I$I,?jI-ϱ??rI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/><P)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IV 'mmqh/硱?VpɊdg9lYI%Y$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IVA´:?]$\ju#UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mۍ_S< ԗO;E9v cHk yϦnvfgve }K}ܒT-U!K@Sv#g\].']q]ﳌLq1z0Jqb7v7%i!v߳8 Ϲmz!F/R $I$I$I$I$I$I$I$I,?jI-ϱ??rI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/><P)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IWˮ ?hqi$Kk_>FjI*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J}v]c+ӏ)0Jos+}Z9Ĭ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$`&JU,ivzV/%_u38[shp,S:)a5Vꣶ9[ ީOcFO%6?o<#.SKջMaOF=w i$kS'!څ^@kv ?ds}cY2w,%6At};x,}sdRLkJ흦%-p}+!&J1 #]Waݑ;Zs6Ifi-{Mc>QGp][=Vn ,eh#kyL>-\MKOaػNOmɭ#47'Ā1Qv>:R]~7pij&eV ҈bn3⒧j;7JiKSI$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I}9I$i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ju.C8.k-s$si2:\ocǥi$TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%Wkk8˺$n>}V9GH*I*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J6*9)$QᵇY ֵ$3gdXc'J:I $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I $VG-a$?=Y硯$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c`Y~K8#ȉiV᱾tYWX#~.ѭ<X]KwWscsϮM^%Q+Fv{1z,\{T~n5Ϯ,}Tm7[4enǰ@Vzt9IP?yW~VZƴ{|&%n3?`\c{?u'If mNkIOe3}֪;Α@v_sG_Η}7{&23=6q[pirڛۆ'Lzv ^^̿7Iu}sǭ[ I6۴iF[?*JSQc2U|Z^*ʣ\GIv1辿 c++O)vS,n;hm/pgQa;ۂ vI\NUI$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~Ԓ[bχ&x帒K $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_F}yRI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ǼpLt?gJ8p JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$0-k\|ʒJj{+ϩpkGS+"JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jt|B\vCl~)$;!GI?op?4k1ꊒHI$I$I$I$I$I$I$I$I$I$I$I$I$Hy9xĹǢ%>dG4^g~ˆ{8s^>=Eʻ3uo>i'\3tsZdJ0{gb쫾~3m5;>JkۂWA[yưL$ڻӚ^p?OI`Tr[G쫟\GᏂ]F|)ڟNy#V;~D% UU4 RRë/wJ~5?-0=Oljgms=uw[4Dp1?)-ߵa읖w?_,nf_Ȯs%c&ڻb>pemp򪦓Y^li-1c;{Z \U33tݧ)(`BKЪoLo^\I;Xh NHsI:H$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3K$>ǟLq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$cGC{_ԤK4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%W;qxvl(>Jeqp#դURI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^ x8<ڸ>W珆9 JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$>< I)'!`q}x6O/=&߲8c|ps:I $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I!88Ν$E%vhGƿ"I!$I$I$I$I$I$I$I$I$I$I$I(et,pc 1`\͍1jvn-|yem:dJkq{,[H-p0J RHNl!])*=.p-cK-GFt Jw~׵*z%a}݋vL}ۋTw}óas^g$q+sl?bSno ~ߊHĵz nvWLuH1U6'e/I #?`(~G =|5{J⌣Qo1xI-bj=94r6MU->M1dU~vNߙk.ȟȔcseW.Rh~x"|Ql9va<. a⼇:kׅ4@X{EN)+@sNPI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3K$>ǟLq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$cGC{_ԤK4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%W:Vq`ڪm1J6m3^ȎQo_g{3/ʸ8Ccn\ĸx̕W|v%WٌOaK],iٱ+[${g_{Ƕ^KO旇e4nIvԌ|jEl 䭀sO\̺bI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڒKsOyIaI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K϶?47}JI$sI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$U.}Ghi1?Vpe#Ix)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*YckTV{m,ͪ滠k"JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$RIJcGxV::,qGRI6ә}mX|#$ I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$h}6vuHLop/2I $I$I$I$I$I$I$I!Zz,Mm.1:!niOߞ͞1`*X&q z=ou'0{^嗈iƲZy";$(v;v]v|fq>g m)q{k(ʽn-}!I%vnU3f}Iog>k[+7MCKIfMuhim(W=>xtI5W~Il ,z'oboH0/W;uv 6vۜA8l~Kvƕ^cc ٷzlTqgrwC>+63Sww`Nǃ.SHݏ[;eo=:'W~sQ;(7k2 R\x};ls1gWmEp%^7}bۣ =ů&ouNh{C>.i-7 |8sK4vV}-F֝j7[f^i!YS?Yۮw=ka*v/ɚJs?z{[ae ]L{Y7o3>%-Y$>lۋS w~w?fAIQF9$>ёkk붧;eKlY8v)!v;>ei<P)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IU5SlǚI+X ]\R.4|URI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^knʛk:Gi$V}|ƕUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mI$AI%:d26K9cl5M$&x{s,yt@I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$@}{=i"J9l $cǫ<5t@I$I$I$Lp1 9Iq4VGjeVAOѸTI[tRm3}n}Q1I]'25,VV6Q ߯]vrȤ/_ks) tBggU}MPu2mXeIeee{{pkDG鶟]srBlc?ؒ<U ;/)iI ^+eOxn°7aO?uO:|s/鬲n3h;|_o7|Kk^̶&O3?{ds{_q {[@w3o6Q'OE*wv>%WZc؊龾:upӁ)P,0#(pIZc1{[inCm%_'Cn"gG$,<\|,Z+֎p MٙRFEFI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m/|?3-ĒXi$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$3s RI/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$lTӏ @l:71?ĒJmpI.εcՔUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$nꙅaμ.?GI%g* ?xUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mM I)U>c<"ak[xdɈ?$3Cۙx Ŏ$RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$9>O)$Z>O=O:|zvf/o~FUYBRTeXr3װ99a).Gؽ N]pkEVKwwfN}%{oh̷~wX"I?ShV{Kgl#Isb~s[\YomS;?78Ňz1f]vI˽*9/7=F}CXI%]$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IW 8q?B\Jo/z|_VIWI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Q7s$ѼPGcuI$L#w }?O$TAI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Aq5emBg$$E&4q??65л_rxø]T#&baŸqm=(KW%]XOTK$^ڗ75Y Iw\߱=w`ſZNą}׶ }${$ l۳3>[m.5d5'U:,630d Ccu-~sr:v7[,ؒ U۾m%Ew=N~#w<dV#l[|G=ݻu"kN[u36|RYh{.ucIߑpO݈[SȕoiglsoTm#E]k[keݾΝjw[qC  x]kshv_qh?؞޻g]{px⭤Is|W3]zʻEAI] |n[Vu1cmA 6= b=%} ;wZiT\g)WoRW;̋uOknoR] qzѸ 5NSI5$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%;_I%'<g[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%g?$_9I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*ـ6}Sc~ $DT&dz)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*aX ~#򤒳InmDT2$"JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$qRFv5⇄à{y;\ʒHa;wː$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$kkKou{o}pL;͍9\:_Q %>j$wG,#l 1wn=ė=$QQE;Gs/|bIWr7:.oG*l|-iIh˪Kڱ}[H\5 vwLʺ aWO(,?RK\\>7ը[[g#<.bqwyf{{ɂKchwlm!KPU6 %#f]\.uh~E.ޯ ,_F` It*uI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m/|?3-ĒXi$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$3s RI/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$|ƒIXĶQku;VIWI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$UK+ $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I( s!$!4@b1bMcAI%<ܻϥq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$nE585g87>5XGϵ=ﮎ**ӣEUѳ%wleYq"z<v_f{Nmڠ~wR\xǾew9|_L??㕕0$gWCFҍ[2IGԟSo5Ku{Msܵ6?hneLO2ÿ]?oGNekjx|;jw1]v˱nU/`i-QW͵:Mջ:YAIt^ Z}ϳh9='?>T{y fGĖOg]|k-4nvi}v5-$:I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I$I$I$I$I$I$I$I$I$I;Z5\tI.Uh!OsI${mgv^9˿I.$I$I$I$]k}2q{$J7R?uLyI.vv6ESI*$I$%s}t!~}5s%$Fob=ݲېkܒI,I}9I$i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ju.C8.k-s$Hʗ揫{ZI%U$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IUt#21I%k|s8qx$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$h㜂JuXyAX5-,5yi$3gdXc'h$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?vwY݌/ku|6:4rM/r;Qm8?$OkG[ a-s)c}q_+68xx{y1Wj?b?ⅧLO$Of~d켉#=/(aKwnM7lnhG9y$مۿwqǮ16y5@Gpbsm]>_%O7}hk0/wk92Yv[ͯe$/l7FUm_|%OHC0Io)bI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڒKsOyIaI$I$I$I$I$I$I$I$I$K|#N]˯cwˢI$ll.űc7kLO򹤒JKwag_ӹ8cޜG?Ko}Z{|-7n?KRI$I%bޮKCہAkOWLH˸/qu΍ߎRI%}} W8[EwQI$%j]bziwi$DI;1qTI}!*WnGd ;v1#,I$~·SI% $3s RI/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\=&: ~$+M.z?VIUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$U{ ZƗ8o>oI%o=5r+"JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jt|B\v[dSI$L5iǐG? #I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$]a!2VF2Vu3#_irGsXz~aCDݑN;|{~'lYYvzT3 k‚A+SeEÝu:"JsNOlm@?[{jޞ 7˂K9WV߼]oR|t_~}Tl?Ut\]g2}Y(Yw;~m?+cwh?Iu?}X{C<}C]1{I+_c0OxZ>UZ"@+]}=3Ĝ~ԖOq{;eNsIlïLv=pYl_w])-,~Oܮ2 ȺӯoIU(x">ќQ6zvzbI%nVrI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m/|?3-ĒXi$I$I$I$I$I$I$I$I$I$^c7@x?e$_(\I&II$pFC>lkI$\HicrXgJI$SI$I$q'}c]oʬԒ?$KkgteTȉ䳠I/0zwo흮S%>K7ÿI)j]]n$dIzWf=m|LvH?lI$yhfYddbLI$go$KI%g?$_9I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*sgyA$r?JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$8o&yRIZ| r +I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(Q|BܱlLI"g#8}G G?)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$'}6}%ֿ`ͱЮװʹ#݊K}摇skA>}?Min{"?Tju$]mM᪠8[蒯%Rw3U~}ar2ZmzC_q~y7V3ğIry_m={+V +m.bnсi (-aT_ /G~NV)ol<;ޣׅm_Yz 8\|>K v\畅ު.L{ ;7s0qMvf6vh˟jKGv|Z[MCMoxGrO}_Z.u~4w^ّ zjk(ykfl{_ [x}X ֏S :ulROdOUCyqgwӿĒHOt͍~4DBI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~Ԓ[bχ&x帒K $I$I$I$I$I$I$I$I$I$__`׺KI$AI$I$k?wӒI/RI$I$k։qI$ {!]ks}o'ķU?ȤK_dpsO $?(}Rz8Ϳu?DIcu=r $?y I Vj"I$$_F}yV?.ϕݫgݻGo$ϳ}[g{^?p%sooɱwڜoy.$wE1m]ֽ=#Ϫѫ ]nWhlpYfl z>#gz p%}A$7ڿsS5&b䰗 =盞G]>?RI&~^3i95fEιI:%{+ A+puVVOi'O[ׇI$͡cE KcFTozqό>I$gC8x#>5 mUL[hlp I)ݛC8Nqt޼?Ud ]o}}A$7ڿsS5a.{7?OI&wϣ<>?o]cusMe wI$~X~Ԯ}ZOȻl8,p;$fn=lx}*6ad[op}}>ιI:IutpkC|OnΪi >3z $[mv:\=oc##G[*t=C[~$Q\3S?<WXW6u G|3:,mBCNqt޼W [oO87$VfxWp꽕^ƹ,%qy=2ԒIcCM^XZ}@T[W\G-{:NI;q]&MֆӤr{鿢LKԽʆn gӭodx]~|~$M7͟G x}^iuZ}7C_I'P>ul']lIzo{G <I$3qmuK@QK /od~.Kq"=0I32 E^0̵ۅjm}}>ιzqš~]G7=w:+m4^-$jsims}_c##T%QO>3$˫}1}C8x#>5K#&`co#&u>P7>dUj6=/Q8G AοӴN{O鲶q:tW1uvq[I%^eMۢ gӭodG|S$oW~I_Ol8cQ8W͖sM`C~k;I$:ck{]R϶]gw]-E <I$zx]RenzvIYl~꽕~ۮ_觯&=?RI&/ƆZ}@I$ܴT/~G Wܯ՛->} w$+m w}J>w׭I߇o Izox08w $3qmuK@QK /odv&Kq׶!ϏL8I$`-{\L}*6di g-Ou$B]w{nήijx}|IDO=O{yՅ{iZ`zǎɐ-%:,m"C=:ㄒOׂva ۻ8oGޝ$gc$U]Wm)ɭw9zdOԒIƱo`>}*-ȫi.lz^pv$w&VkD'{]Кy{$}oug֏2S\8_>?OI&9ܴT)gGp՛-2}oNѽ $΢+C\=R϶]gi߇w LYpI&ff=q?OI(.X>gyՃ{iZ`zԲd=ui$vuH#Ӯ Ova ۻ oGޝ$gc$U]Wm)ɭw9zd$k2hakXJ1-'&G&tIIsdbc~7,Un>؈ֽhM\v<V{$U?T*n[]cuL \8ŏu$9ܴT/Ml8HD_aizonѽ $΢` #+dzw].oxI&3&T6k9a3^NLA6׶!ϏL8I&n^3d ;Z Hִݨۅi,m8igg$dUj}GG{JNǷ[H tޛ+i\Wk&;}|递J?~ձTݘdz럷2S+=pk~Eu$9ܴT/[><>Q87k6Zeޛ=$RV,R!z>uI>o{0-sC7|F$kǧZ,x:LtSm{xaϏL8nI$ܼf;X HִݨۃisieL@줒Yԏy+&LpR26|dӽx~P2 YgxcGխIl>{gI$˨8V=MpzGV i4 d{ $.ΡYciH$x'f@dzY.wo $jW\0{)ȩw=2D~$krhaPj-ȫi%vJNǷ[H tޛ+ik\2hM|v<V{$~Scl1gugL ]u?$HWw57lϣzDaizonoI$3 =Rθiȴ϶]{o0IFzCʥQ'3^NLA6ǷÁ$MlKOcPkMڍ91cxiC]nÚԲd34D:]eK\M#Ӯ O'f@gY.>I(3-Vk3vrE=X8Y.G"u?VI+rhaP{QnE\fI-G}} {Rvv=@[Ӯfkl{k&+}O0IG:57f,ற}:钜aYε1_N)$ίs[Sx[> ?s8츂X[ӱ|?$-t~u͏k}BǸtDFI)dbfU[L=$:[3 }Vl;!}] >=0nI*lKOcPZvnAնo $vJUgccq^u=pS5m xɟz?I(UK\Ǻ!{VzĴp}==q9u$YQpzc} oX7V9\}K'C $-uXD=: 'n@oY.>I(3-Vk3vrE=X8Y.G-OդJܼkZ:oZ}Htn>DadUjcaL{Rvv=@[Ӯfpms-vc=>I%Sc_Svb!{%!g:pĺ,-:Ӯ_褒G:AmMl8\7|Q87Xmˁ77$v=BU"GWY+12--sq{8=NIFzCʥ>60?dξodLAvǴ7Úw_I$ܼv8 \57҅9VO4RvJUgcGW]q\4n%kW3CP2uCCl3pa{#\I5u' ǩ3<}[V l\}K'C $-uϱkzuߒvd뷗 =%۽;I(3-V֚ݭ\OV&ENsd\NyZNI+rkX꡼0S{QDadUjcaL{R9 i:}oN~kJG k]5X_O0IDgTݘg-}^HaXnkk%cirE$9ՊٞMl!zȴizoo=I) zD4GԮ)jVbdZZY=p{7I(חHs[T1u=֮{n%skπ[ۧ_? Q^v} $v \=w,\ڻdz ,i䴣5vBݡyx(g-xskg ;V7kylqKo҆#"Vd]L32-!S_;/}]x2-;gSZ,菵eS{槕}8^ |sXyYykN鶽Elms;s#1(H?/i}u@I{X%WLuXX,Z6n'#ܠڃ{u =c-xs[&^ 멣;>@'S/ ;~5k ۻ3?|yc;'to-;r޻F_8G?b&-\٩TKK>2-isr&#)wb^l%(muC` ~󑏓}*K zD4GԮ~jCx[N 5e-qfL}:; ] ionvI73Okеۭ7҅9ۏ4RvJUgcXGW]qiE6D7Ӗ];=I$%MWo5x?.1ӭ@.q8V8{xV l\}K'C $-uﱴc?#jm].qNtJ.'-15kG[nx9Knyّ?VI%n^=k]T71(Vlz>#~JG;m"OX?T5#`eqX\w $340C{yHaXnkk%6?떝oJI$s0*C{Q89m2}oM͏fJC;1U"GWY?T+12--sq{8=IFzڥ60?lɏZU32{vi$s1?c?t-pMtnAo 'Բv?I%Y}MϢ5C k\]/\O2RI#XeMqVϢ7ȷiO>oI$3R!O>mJLK\!~<t@{Q$jǨ9[c ̘uS; v439ݽ_I$prgYkZnnC}m[R;I%*{,u#zuƏ%3.3ӽC.88yX1ip3cJܺ^8{xD}[AKkud:I$Ks{m#*\s Ov8?˜}ӷ$1c?t hkmvx9KnyٝZNI+r kxwF q2=Q͏~JG;m"OXkJG s],ˎQ՚T٘ l!Zl06ϵ9oJI$s91_l!z逢p-6ezo=I) zT]n?T+q2-s\!~<tj~DQ/[c =uS; v4W O{vӴI߹jƸgCZnn lR}K'c$mԏs:4K1->Fڛd8$W.I$I$I$c3K$>ǟLq$I$I$I$I$I$I$I$I$I$I$-˶ zI/ \A $.;3(guI$Կ㋸Wڿs n5cRI%I$I$[翳_q`5l|pIbTG K+N7#Wl^$^7p_ggs^n-F?+JI$?[ gx̽xa{9OXI$1#$It_a{7F߳T۝̒ԤJm'﮻U5gl?$ԤK篵vož[RI%lhokI|I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$f\? 1~c~ $RˆG'_?VRIVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$U²ʒJmVK]?~Ee$dI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%O n>CƏutX>JI"fs/>G? FI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%7]uO~Ξ*+mNA%~w?iK_TzPNg%hlls>,1k_fsýLv?֚-aҏu!W;o3_aI}?d=?6浩t`G}Obߨٮ_6( :5]װv1mѽmX?2I={Z]2amn鉔O}pzzr.gu2Wһ-:;>|]Oؼ^ھ>PG宼;m2\wg9һn詔Fn!'g`f_KSkwgwlVZ'gv5G.BJ]bZ[j;>)-ݤJ r8I^OUI$I$I$I$A}|mϴ'$?r`FI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%;_I%'<g[$I$I$I$I$I$I$I$I$I$I%7hmc俏rmZ~)$l_krϤFe=-JI$ğLmdvUN}#RI%oy}E}W ykɾ?Iatɪ̿ⱯK'Ihw$_e<*~EƤK|3/sl~>= I4$KRI$I%<oI$?|+5?$^pI/><P)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IWsh͠l砒JZ/,@VIWI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$U; L%$ֿ22@VIWI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$QUSRv7q B]I-%Dk$3n] " I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$MÓ*u߾ w@?h;ٯާqfʆ3uYV׳QRYk6p;> {~䙽W?Śe.*_j剈kG(>?bkgط띞$ɏ?4(BceSɳImz;Kb~@<yI'ĸ¿Sd3ggdRDfpqi,Er۟?n=K7rItKf'{(E@O?Ŗ~-;tQymߣۭ;mA}x܉OnCC[,};Y5Xٚv)=yrV{^>+q=U F(nN\]I^OUI$I$I$I$I$I$AۯyyIܙv?FI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%;_I%'<g[$I$I$I$I$I$I$I$I$I$I$I%a}U0MY,e`rI$}S0ܟXF`$\I$~gs݋|p`E$V>}C;g;+ў hl4I,TItݯՍ|nohm I$JjmiI$5m]cq9e$QI$I$bofIƿRI%{~9 9I$$K϶?47}JI$sI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Us@q&~iJm#+W%i$DI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%Wiά#VSmv}B]K>cJI*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J6Ǥ 褒3 Xh$3,yt@I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$XlNOz6 Nkv%}?+hsZ?|WN嫅=T/yu}Xl^\wSD;K*;,I۷wn=iϾxmgwt`qmƣo1c.aZ0+uTc4lmOR31I@ uN:,-z(ۏ~5W~ELwipYJz6Wm ȉ..G޾]?z3&=g;!vN\i=j2IlZ-;C>>=UvӍ]}6 .vl.߉i]Վ Օ[ĭ%k :q]- l!6+fle$tTi$I$I$I$I$I$I$I$I [OwGsXF՞z~:I $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?jI-ϱ??rI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/><P)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IVuM8am.O$\28 DTK:בVRIVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ufμ.?GI%g*-! Ee$dI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%#tR}F9xeàC m2b~|._wοg r~OK1 I>mRwhě#1Xbca$]sU,[w'M1ϮI d}+m׻=3Ż+M$Gɏ?]{kl*=~ߏ?%eBv~V)6Bp<ϪKcv&Ove0Yflg]Q*f[ uUKNI.; b*m/nQ W?MS=u)'ƯU5k[ mveIĒI$I$I$I$I$I$I$I$I$I$ޜQp>I$Z>zO7SNsTBI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~Ԓ[bχ&x帒K $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_F}yRI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$M\?$V0r3חJI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$|?B\Jo/z|_$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$gnˢI)Wysꡉ1)lz˯I"fx>䊒H)$I$I$I$I$I$I$I$I$I$I$I$I$Kur~vQƽ3 qp{c ßDGڧ}·ʹWH:J+@_ѳOav$]ѝd 6:9dbbefsuVԐ{{{nX.[^ \}]k/CȒ婡j6]{.viadMw_oMOӾ . }Tv~w!\$q yx6Wua{-ø4w})lE3!).;7_cܰr;=/_Mʧ0~.[|߽->?x'κn'JKǣ*Uumsk5BW-Q)'T! HJi&I$I$I$I$I$I$I$I$I$I$I$I$:wI}٣|nlk$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m/|?3-ĒXi$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$3s RI/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\<6.iltJh]48>D6GVITI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$U{i~WŠ)$\Qn[: I*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J6ǤЂJtϪّX[8H"<Iw:&evz{((Lp%JRPmU0W[5 :sYjI$I$I$I$I$I$I$I$I$I$I$I$I$I$H!^D |e$11cѺ#$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m/|?3-ĒXi$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$3s RI/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$l +kGO$HSO)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*aX n&#򤒳InmDT뿀$ȬI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$gnkI)Uu;C@~v?$3L^K sc?"2I I$I$I$I$I$I$I$I&/kKApi"%}ٝX RLb+nvdE;_>sN3q8I(_ߵvweJ?}VT2i'_lM4=MoiFVыK\>wv:\׏C+m\Up9[{.Y:Gڱ;O2h ?)IcMu}-iUko;FOqJ6N~G)vE< Lvm=;^c 0/t{kュ3 ׆\=߁rۛpϕ.@ykf>oq56n8}'ڥov>9{I[SEn~aYٿ4뇛O+T=8Fq|]G.l撍4ӏP]m NS:]%4RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$A}>ӳ$G$ɃdzGhnc$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵ$؟ɟ9n$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$џlhokI|I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$e̴8I%c}E_¬$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$eW_yI)$vk2,G8!XI%]$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IF][BI)VClij5($I$I$I$I$I$I$eO Iۡ'Ne۾c;>aE|k$+ݕD/B.s+/?e{Os$hgY.V{{;}nQ"qIa}U>,}ߺQmbʎ(az+^Ϗg~%:OK5k~ҿeTǻ{ߞI$I$I$I$I |wTmmfp3E@OS$>gevﲙzVc(w21B ,^3~ǭpw_U`&3Z}[ ջY茒Y}Mor6"~xoJ& q772МKi>bva33ҡo[IEiV| ,1MӶ˓o;̒۰{pgL@U碱Odn쇊b$~[kd28, G?j{>~TBϳn{ۍQf|Y ַGqnyj-ܒmp=F\:ZRJ~{#~I:aQ5+C,$bI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Hg$Vxl $cǫ<5t@I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~Ԓ[bχ&x帒K $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_F}yRI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$׸pb?gJѕ@\ JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Zx7?7򤒷ڜg/+I$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(ۺ)$Nd,+lϗSI$LgdZl|˟~AGI$I$I%_#;)fCji?Q@,(șD`3IQW~پ}ය\Z2Ւͮ6t/]kK^hFU~5![V;N>IsFFgnKk^݋a\VpFB5N>I,i+oqutƱfC ۸.c?6KtD$$']>kN:j.?wnq7dEܻXXY}퍵H:--`ǘ_?sϴdgɲD86*q)]g=݇cFS'.P>ڻmw>-nH`QR%:76~5f)+n}psZeiwN@%.Z>oj>Sk:b];zI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$HANoi8lHwp?4k?*I!$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?jI-ϱ??rI%Sjw[s+Y;?$Iz ?-~v,|W*L~ $aůw9nml?NI$#>ݾcXӝoI$7,nm:6)$ I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$cGC{_ԤK4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%W;qxvl(>\\?8RG I*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jtqqt I$W^8^dƭ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$oOJuGX<_q/M3 I"g#8}G G?"GGI$ -QN oODK$'ۻ%ܬ淆syC-QZ=\e%>}[iM9CxԎH{F|BK$}='u**>GTnLbOS߉5Dl\sxMop Vía/?ENҐ۝~P,suA|h]BQhϵmQ?ۯbpr뷅NԞLUCv>YY>c,|`/BW><" lJHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Cyqg}ߝ;I$K>?͍~4DBI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~Ԓ[bχ&x帒Jgc=ʱ[gAI-߷+̆ww\{ǷOI,\Y0ڼHI%weAe\q 6qI F>_~9܇4g4Ib$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K϶?47}JI$sI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$UsuGsZyoG$ hʖqpRzVITI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$U{?;^>i$~}U3$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$iy@)$Hⵃ牋e~`y#-a3*c[cܛq;~M&,װZ6upFAq_.]ڜJ0cja5_dqK/7&ef;b͎CZֿo~?ʦDPo)F+Is8]ýPʛkk+]1 ƺn ~$ |O]U.>O]2IQeՋVL0,}oQA_Ku9[i~mϿ:&4s\io7{<@v=N5SQy}ėUWJ{ؾomx4_í7]oĨuJ]-hۇX-Cwn)1{['!YYJojP}~;WbµϦ$+GDXngly)-%"I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$g׿khzg_/I$rLgLXtn$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3K$>ǟLq$I$I$2p`餤K7׃-SSg5$JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$cGC{_ԤK4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_2qHg$K.@*/#a$dI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_|;,aU$K23kG~Ea$dI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_7;ٓsik RjZՇI%Řs % /='~^ae[~4RS_U= 4RY_i20x9m]U-2'M*}7uQ>^<$/f~-Aͽ]kG]]X's7Ku"6# GIId/EQz2Ĥ]a^Gbn?%QM7 ^/r0;NVkxLS;CuDt]._ OK%>u"BTaH^v=o0,V*yh̩,wl:GIe䢔[-{ͼ']gX|~m|^0GL@\Ԥ'(I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$A}>ӳ$G$Ƀ;񡹎_4d@I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~Ԓ[bχ&x帒K $I$]?NܒI,??7#Ie$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K϶?47}JI$sI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$UZh6 )$a8dMQ: qyla$tI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_8+ JI+=a~ G̐UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$osu%w@,Jii(`cgU`DH8N3\?bwgO/߳;M?f{ůk8hcԔxĕ_(ښjR/).Վ?Ok\x ~5fv&tlb?l$ֵMtMa[tI~c V X{}G]7e`m|KI_gq6KMa$vu[?g ΍hyIl/m#gƁe#՞˴ϔjwݣPq_yHRCĜ &enR[f{Q읋z\C$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵ$؟ɟ9n$I$I$>wonL{s@qmu#$Y.X"mhw8sI$$I$I;Z I$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_F}yRI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$+k~iJm#+ӱ#GZI%Q$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IUkm;I%o6w V:cJI*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JpV係)*Z) ̤3?{X% FBAU:fa1Ipe\^&[d}D~ENUt&%ϴuvyf|*xu~Ύb?ؒ䱲&NKsnƮ o>cvݶ{zIK˜n+mV:k Ե['^I!WSv >j_K-^7O%]dK9|-;c&EͥTe3/x%G`#axMBeڲ;E]Wh_g;19#Xbj3sW}{|%>;Oi=pxUDY`7YVI^OUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$@}{=i"Kg?I$w0ŏ`=_QI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I$I$Itfo^pQMM'$^O*+pRV)$@d?˽|Hgvܰs,vEaoI/RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%g?$_9I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*;vF'Jlp-Q.l\cՄUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$~هa8ORIYͱCq~?XI%Y$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I3\$I ,BƯ#m6 kAuLaIqcr;rQ_f+ %hU(&r{Vm*GZ'Id;"wcg^_П}^u :ƧXͿjlM'Is]ۿr̲KxN[7pX{¨k/`IWqsw78?5Ѷnˊo.ܝWI`{C x|Jr7\o?wLmux<ljsuǻF'7IG`C+$C]:>ޡe,z{J6Cb=%}7,udj9tLB&Y;ņk~vvvF,6s.=I楪:Vvxwq R*i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I!9# $Z>zo7?:抒HI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڒKsOyIaI$I$K's?li*:Ə+.0I.<8&I$C'}wK[Փ/e:ӣcb~I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%g?$_9I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*aǫDp ߟI+edpn6[<;C?<v!wRĭ#Ofm44oWﭢ>ڲ?*J6*6{"GD}W}!alm?ũk ;{94BnDG^̇$I>.2WSӷ Xen:J[[^+"Ѧϊs-nC 1TI[v>ۻooOcd`$%we->2>UD6FդUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^_h7RI[N£K nNBJI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$S5oNL^p{ ÷ԯ6۝Yv).?vĭEo YoC3ki, +1-ND`(R}nC5Kޏqٙq.o-Dblm,(D K鎘.#)$HXCMȲ7Q]gjj'.=.߲}vroDDAoX[ociբdѫ\3C%{ڱjAX=z8}t}k4i|{~9ۤΙrT;ݧim_#;r7=Gq^Ju ݖF-h>HIj[B QS}VF̈BV "Dx$&y&ƖXlI I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$g׿khzg_/I$rLgLXtn$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3K$>ǟLq$I$I$I$7QlsJnDq<@KOqqAw`IG}]I$?o%];Q~&EpⱰ $\I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$cGC{_ԤK4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%[0I(-Q>-?Vp :ɨ {yo`YI%Y$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IV# @ʒJmwmGuhVRIVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Y]»Z*8Y7\jƯyspgO*?w-cæc=_%߱ު=-'~DBT|m/KP{tCWhs^[gY_9Xp-톩~OIg]u}-u};h,s̿?I;G7Ī٣j0KqDR<$ϲb{{@-n~xt 06>T>J״;}ı5Q˜g;o_ʥ:defF[T$9$I%?sv\IJ:{f{'&ilw--I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IǞϦ|΢yI&6Gd{Ɔ9|ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I$I$Iz3߻FVy=/zoaa ~I$;^ȽSȥVII$اmI$(K7woggsRI%I$I$I$~}g[I`Ȼ[?lI$׿?_g;>%ٕ4}/-#ǧI$3}޷h} pQL?d|I$|=ەuVV)$I$I$yj?k</򭃙I$7-2/hζ59 ;:kJ_{r}]lEty|I, 8jpI$fgyݿ FKI%dvߌ~wfk"[^8>R|JI$/]\Fق;]-4C"Nj\?`I$m}g_I=0̈́}Mi$\*I$cGC{_ԤK4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_.hC~J%/F$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$eW_yI)$vk2,[VIWI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$HI*wL__- !M~ݼZ5q}w}IU2?Ye *Y_m+h!e^}== ג{Sox{|dR]c=s;Esg7$=uG++yn%TI$I$I$QV:RyUMnƃ>I$cm˺}/{?4TAI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$AMg3~I$gL>C$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵ$؟ɟ9n$I$I$I$K7K}'[]6S@I$~oI/{G$K["wEY5z\E\#$KI$I$I$W~·9\QoI%zw^gՕuI\ܟ>֘rk.,ÿI$NﲕwFݺ' $$I$^󕴳k0]dJ;~[8g?^ր[$\aa`cmȵlt?I$.;7j>|u kHe߉$^7kg]v5v=WO~/4I,dIu╹N_' RI%#ݱ-x>i$4I}9I$i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JuNC8.k-hI+X6/*I*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jt[[Y]JjXakjI*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jk=C 3Zl7\y98εƏǧ>Ug?Ynk(ͱYսӶO_8%>㔒\pehZ 럦?jU=`N/yIf23 }W]o%blshԲg0sNc'd߽~L mg$i1UC+o:ں-8>~T]2yvuhXFJwn\Imw-Y]q`?'K<k)|WcגftL8=7W'AXB32YvQIk)I$I$I$I$I$mUxIgKw.7 [kXODI} /Ş/FWkDS@gI$?ff;۬^9$\jI$] UݵW7g $\*;oV3{~I%?Noٮ]m!yLGl|3.oo˗I%z06=ӯw>/Eÿ75^r{$EFE>_RI&_[M3[?xI>{O4QekX=;D hM> {.i$acǢ?>73(ȱޟnz}1?,yt}~\I%/?w{N$ÿ?oh׷/ƒIz=w>'cёc}O8G唒ILO/|w!;ysϬ3˚I(z,w 3|mOapc|NNkǢ?>73(ȱޟnz}1?,yw~4K׮^~^i׻?ėxok˗I$zX[q߻?ē޴dXS5e$e8HN^9LGJ-"L>I60w 8H1:I>9 DF7EXLXO|u!$}n7F5m>S/8~]˗I$z{N$?F$^rz-#;s};֌}1?,L[?xI>{|sI%E&}ß$SYg =I$X=7@o(ȱޟnz}1?,l8~]˗I$zh>#K<8ok˒I&W,?w=w>I>FE>_RI;/LHN^8q3>\IE1c_Ip&T9, Ǹg\I'6)cxhކ()SO$$ƭ_oFo^\I%.o^ y$i|<}{yrI$wϟ$lw7_RI&_[}ǭޙO>;^8q3{|sI%ED|2՟Yg =[:I>9K D73(ȱޟ9'_IItcVS/7eTǼφOW#hVrh|⢑ʼn߁[4>sÁF~I*~_{~|i'chȱI2N=nϺxI'VYÉ0#˚I(0z,%>ϒfT=, Ǽg\I'6)cx`ކ&e4S9;nj}1?, pX_˗I$za/$/hֹrH_Xs<,-#;M!68G唒IBqwe_$):޳,׷ϗ4Qm c}f]ϒfTɹg =[:I>9K D73(ȱޟ9'_$}n7F5m#8G唽! 7cyr~i$\{3[?䑥<}}ZI!}a?w𰴏ww}6;֌_RI&_[} ǭޙO>;^zP>\IEV-$?̻˟$̩5w8LǼg\I' "}z,hr,w3#Mxxxp>hֆ~I$/9$lwo!?,L[3./|w!IոzP}ѭ rH_Xug$lwo!?,L[3./w!IոzP#KȰ}}Zi$<,-#;?I޴d=ƿ,L3[3./yHR5zPnzDGz6@p87cyr~i$\1su/-}}5I&Xug$^Z2PCc~c_RI&_[} ǭޙO<$)lsWYè|i!\[ϒfT绁&cg\ $cC!/fQcE3c9'_$}n7F=m"# T 8yr~i$\y$^[`ÁyhkM<,-#糾{h{}A ~YI$̺3znO<$)l.\gyIIܟ.|27= 3[:I$k-7g= (*>:$q1o_oݰ;/v{w1<}>S!lgߴ Z3K׮Ozsqs;s+Wk1p뜎_^s#.ƶ=Z~Tͺ<,-#糾vk1,O '[YUEo7c{Dt|߹Bcx0~;;+/e`ýv:-J{u\R?/g~m>ϽAV܋}{-nyt~m;3oCq\IHnxooPGZhR]ϱi{_ٞfxBw]vQo]==|I2I\/?ʱs=ghn ]?k] :F*t`ߵl%q{ٻ~aế~w,BZT6}MsbTWkX, :a߁oT6w]kF"Tx86Q OeOo7= 3[:S,GzC!>zL,hr,w3Zi$o:zKH<^{;I>֌l68G5e$2;]<_;kw]88xuϗ4L-oC'˟$̩&cg\ $ެPD|S2*L>:$tc0"8GP}YISMwxL9l$;Պ7= e64U9;|uI;ǭ`Dq~ʗdHN??O._$y$^[`p9hk2I6ë?w - {0{h ~YI$̹g./yHRzGǗ4L-ox?|2қr?I'}w1o>zLlhr,w3"I'}# T #Eqo)yr~i$\ݫς=y$^Eop9hk2I6ë?w 糿Ol唒L˘FqM'/Mާ|ysI$ޫ}>EŹs䙕=p7~$;֊7= e64U9w$ȒI}n6=m/Bg~\I%3zsw8^I:`A>ZLMz<^{;L$^Z/{}F~YI$̹g./yHRqzGǗ4M7[<|\[>IKwxL$;֊QB8GC|)MNCI3$w[[x8G˖*oBg~\I%3jsw8^IM=n塯I$i޷p4'OlI$̹f;wG7z^Q$z}ϒfR3{z$lc0/g-Tޅ"87<~?4K׮gqsZ>GI&_[MGxw<}/w`Gƿ*I&eo41ޛ<_;]<:.i$ox?|+e)9|bD;j#$k8p6b<,ù2*gG_$}n6=mrKв?Y򟧗/Iz޿#>|O =nG*I$iz<^{; >֋Q"8G5RI3.c}gG|]<<:.i$ox?|YKw;{>Z$/qwH {x$^Z/{}FI$̹f;w/yBStp>gsEzm|wcDp9rI$}m5N=nN^Z/{x#~c\)$1zn3O#_N/UèIV|>gsEzm#%>_~?0=FI.u$I$I$_]{O}{ $KDI$I}u.שӷ[WI|I$I./\h*}wI$c )+W 3%'ǩI%_޸i.W 3 y;Is>nW[y?tRI%$I$>}d;vc\1'خ>Ǐ>i$^Y\=9=9$$KԒI}9I$i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jqx8<_6xgI+XeqprIv;+Zc) w2]9Xcg(nZi{syn\>n+!] e{a{V3WzضMJy,vyI%w&WykV[T]dq KaJ$I$I$I$I$I$I$I$I$I$oOJuGXǟLq$I$I$I$i{}Q@s?f|:I%]Pёc?M~ mMgI$?1FJ/dpsݐp==ՔI|I$I$I/G|}n7v:Ʒm>I$׾v;OyCn}G%$Wv}\qwI$ ߙ^~X {I%ۑkjYcְI)$6o9{ ] I$)ǾVcuT9< (I$7iޅk\?X!$\Ik`D$K鯶}.&r2{v/I/I$I$I%,5#{m<9RbaI$$_F}yRI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$k8;z>)$`TFT8sǂJI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$-uI%oTn%i$DI$I$I$I$I$I$I$I$I$I$I$I$I$I$I%Cݍod,V;t)+&z\[$ʭi>S8ioQ`-:; ڨocgܒͮ3l+m=W}ђH9ጭXA-cyj]^gت;7qV0|eIm3}f}ުTz)omn7+:ڻ .ӱg:RW~:{7wXSO>w%u2ӹoIn}3;owg{:":216?¦FZYҦ>˃|$!1lw$f2}!Zjv]%TI$I$I$I$I$I$I$I$I$I$I$QI%:,pq]][ :޼I=xClxzߚ:I $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I ={&WuGs11cϥѺ#$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m/|?3-ĒXi$I$I$Iݲ_߶&1)xX]GÊRI%E/9tYi$&G#9I$߶Ϸߖsi#}"llIr$I$I$,'6xIulo739݇dUK]:"I$}awgQg~3NIp_j>/+_[z4y$Kk;Ngu Ȩ1^-I$ecK{c;KMioI%E>w{zs]ƞm)$_h¦uo$\ka0rs@{~탍huEBI$UGܻf9]I$*~v/m\ xhqρI$Yg8|s5bZX8!I$)ۭs%~O,U8_’\I$k;6UߢIb$K϶?47}JI$sI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$U.}G=?I+8t>ʋXI%Y$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IW?M򤒳۩fFmux]wVIVI$I$I$I$I$I$I$I$I$I$I$I$I$Uɾj~*Yd"%!%}T۲Oh\U]Abiɰ;GDw>hs>e՚宵kTv[Ca..wwo{( T#j؛ፒfC`vD-K&r/--M.ºfmsԮ?}4cc>I*=:lo8hh>ϳQï3Im}.O^? M|O\v6>U6)ogH]cvl;s_˚#fϴk{l@>_I>wq޾Ζ~U-J2R7QM\KKg/,ȲP ;S Yv?-Y-$I$I$I$I$I$I$I$I$I$I$I$I$I% n>$V4[MƓ$[i̾,{'$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$o}gQǟLq$I$I$I$K}w^ٗ70;;锒Izw/s;׮v~q[;i$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_F}yRI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ӏ0 x| I+8m,d+ $$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*ŘvX.$V{sC+W@@jI*$I$I$I$I$I$I$I$I$I$I$J}n /kh{띀SuҦ.1R\LofiW]6N | wh{ ̤1%_wdY}py?ġufKٛ%%i9XUkZ]=vFzB·oQrl'{<%?]%u>m}яUvmn߄,: I1։'oڏcٛ#^$?"1EO hy|3wn[qu;&q|R}?c$vn;OmO뮗?_Y]e۸سkř%Y}Mlwi)AZVpz$=-ǧ?%M15Н{YcRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$lڝrI%*tn|%'2XhpI0p^8͐{~DdAI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$AMs?H~mq;>C$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵ$؟ɟ9n$I$I$I$K7K}'[]6S@I$~oI/{G$KO^E3;<=3d'߂I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I}9I$i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jsԭ~a$E.P$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$GT MukVSnwpScp #JI*$I$I$I$I$I$I$I$I$JsFÒh/x=wz^GQ AmΝϋh]uBƏn*R9v?hjėOMֱJGen{CLH.TeK%] gR溝bvq2CN )˧SK,qȤ}i}޺\'.ZݷtHWY.e$~vo5^WgĮ~q#p .뭧yȹ""Kf;mݿc~m-2Zv7M\KKsQ1{EO8QjT·sYoe p/ YT5$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%c|RINY ,`[8ZMH^cn2H $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Hg1[O᳿$;~0 h{~_H $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڒKsOyIaI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K϶?47}JI$sI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$U[N?q@o ~{m_ )R]o|+0;ٻ6FZY;>զ>ˉtIl}Ͻ{77SLZ&V}]mC.R[eI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$yGDR}F9ꇆXJ $4du;Dne%g#$ I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$sI$Rծ)iI_}7bbKs`{z5?b'Uqo0< OrH=v?}#.:̆K1\͗GƓa[ҝ#N={R]]g>sC ?ec+.dv.^)MmN?FSP}tl,`.XX$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(âI)W>cǪhĤ7!ܺD.9wpx BH)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$HA˝/Iukx@$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵ$؟ɟ9n$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$џlhokI|I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$綗_QsKd:I%o4ezls8[#jI*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jtm.\]}\)$\QZH'^!ZI%Q$I$I$I 8y}b> 9$ܳ{_٧߉ooLƷ [vn7-%~fgb`oi_VTd]t{59$ϵhx}r?L䝏%j`44Ϯm?S3IdwuY"ǟLq$I$I$I$O;=dEI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/><P)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IWl ̟wI+8n#dy彃a$dI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_ꊿ@ʒJnwmg7#+ $$I&.hpi#)"430o`uc=u \-UܚJJڿXi\2ꌾ=5ӫgQ?9-jwMNH»wPZhĆ0<ёz_yVlpo.Q?%vzp^M0XjzH>֏EP%R>Ғ;^_g*gyoq0ꗇҺʿR7s1g!⒵~_{^,\dsY \Wlelv~.ށsϔm\Z=R]AՌGwX~đm6ݣ'5Uo_ڔtx 8[ .ZXI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(JU~NƐbP8ŐõdTD3y5͎$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$#>}6vzO?I#=Q r$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m/|?3-ĒXi$I$I$W5>vޞm{MA-1$UƿУ~]cNl,}a:$KI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%g?$_9I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*u>GZwV0eC#-Gz+ $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*§߇elL~$v]}-d~Tcc!HoR?ʒ:K:~,c/+xqP&a[j;fI,N|`Y*Ʈ/&39oݕ̒\ϴ!U.oh`vǗMk_cLxFKᇟޒ˳,~;ŖS?ԈJvrݡ2A#YcX!QE  nY-GJdX\&k@Y;ۦUz-?uVr|d~=ee7]U?Tyvuv7K\eiQi.[w}WfEpev_j1ؒWp_ػenZ]eoo5UhdpDn_MGX~i.[\I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J6PJUOB[Ħ}LcAH6ܻoOEI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$}g3~I$gL9x|ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I}9I$i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JuNC8.k-hkjR:\{I$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%)$tec"#jņ8Z{ɑ({[eO,{y8,ϴw\n<*OL~?0,jg)N͖CYE?i>[ji^={Z!mZ^Ėi73bX4qpRv]k~U6r_쿕%5BIFڝ4ryfdRVngu^I#̪;tT+n_g$^wg]MLcd\> _V{ؕ `l컧|ol]=ҌzI 8$ !nӄmiƳ#%n߳8.k}8F?a8W=%ګkI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IFS9$<6k5`[[[DkZI"g-Ȱ;>ǐ~{GI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$׳֘]a$?щmoQI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I}9I$i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jpy8 m H>`G5o[XiK=›Q#&Jgq^WE{g%/ZI,f}UU-YˇLJvcĴwȌiF>e,1亝ҝ4TrowtىsۇezOwmT+NW'9EQ_vL}$tTi$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(_|Bp[g/$3NvAl<$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$YlI$RծC_TBI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~Ԓ[bχ&x帒K $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_F}yRI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^7 w͞FWo.(#ď+I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*}0ՙq}>0g-1%OǾu).*ߵf{u_aYc~kG5ꝟit^BH=E_hJGzuѻ_gqYGP픾{X.߁F+=Kx[,nbnH9:r;s;2VHD#C3˟s8! O $3`7|ps't@I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$B w\p4q~q篂I"7ox?4ho⊒HI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڒKsOyIaI$I$K?Ğ/ٌj8yŦ>PhoIe.gee`}ʣ imdCI$%򟍗Cg]I$I/ek|<|U='I$.&~n}9?}ǹC\Irl>γً3fs=\<#oPGG7I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I}9I$i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JuCxkO-SmR. \[ҴJI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$z4Yg>~t#@$셶a{acG;t>]\L~eY9fjkq8և u7q(QP09_uѻsN5gIr'>1jZ8Z q/7wE銡1vd|>%JۑvE//q s\&ްݎCI>%7gfWW"ϥG=Kˢg_n?Igx3[ڻgzdS袲E\o³LEZm7d}+G}qi{ <꾢9Uk{+!fP.aG { 2:~?V0e#}=JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$n7}v/ŷ^Uux:0]vrLH$w]/FڊV?BߨiiN;5Ipe~ڽ\zEv6y'e[+u*weUf孽ؤe~~c7nwO6=N뗪]"GWUu|uID{4q=̫;pI^e.{? ;￵wcѱKw2q@밿ۮGb/oCSC\xzS\h>;B76lB$wuw{ Ց?knUqXMFiwS? `qz5\`˜OBGEFI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$$`:ƃԨaq)Sc?$3+m9wߥsD$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$#>}6I$s?rg;9|ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I$I$Izwwު]E@I-?'atWp]W8IkO`v3;n(hƸI$~-_=f1~I?$^1ww%ʡ{-oM$K'λ6E7VӧPI/=I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$џlhokI|I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$;Y6}z=RIYo!*'D.ZVIVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$H$Kk~rYcfHUaBܷc_fnת,zkMi1sR\/Oy?gߞ=^)sxcQݮPï Gc1">ğϽ%Ww ]&5ǯu[n'Ŀ~2)<ԕOkL),c/mT1;xohn36~G]wF8]h3_A\ͻ/%亟ky] {n>,:ahqqO)QGm zE%}v,KԦpVjwDø:}ż'|YH՞,ǨjH~VAVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Q7ju$ѻ,JXhpȒH2l$QI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IG_|mdzi$gLW:xx|ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4ImG-}sg.q6<$X$v=սc\ $0?,oDw?XV8|4Icc}}g}'yaaI.J%]"}bKI$;;Oh`;4㷂|8rI.#`}?m/hE2<ԔIr$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$3s RI/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\T/[_77&I[m^dP6FUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$4{Ӿ`w^a7A kcCce6nX}V~LV?e6ze;(ScogIygĮe vnuvCڵYvlf'{4{sݽ/]^۰iKG\%}?=*N;$+rRQs\!eII[}`tvo2Xas4E]?e[ӟВ3g}vU/>S6x[ du֟G(zWshnוT>!q619۝cq\Z`p2g\<|;G|8Jm*m_^{9pInՏE.]QS2̕9$DSRU{ne}Z$۝*9HҴJI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$>D)$LB8涆0HXc,6LI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$׳֘]a$,cǫߗ죤I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m/|?3-ĒXi$㏼}*sp͖Xc$K?k?mw|vZ?\I*}Hv]~qaE$^w\NYHˏF._4Ir$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$3s RI/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$|Vӏ@HI%g 8dpj]ז5a$dI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%Ɏw*? &aSoƁз>-ߵowlvu_B_,^Q\jAݻto¢YnT<:2GeBl6y28$ݳ;r?#Ӯ |5;]ظ oh;]³ߏy{RT%kuSX]HRWh31v'm%66f_I['rߴ>u$A_^w7+%]gؖW Y$h4Y2n4gk/:;YGsAzI+a g{3/=>o/OkW7nߴ=YqlF{I$?w[_-cG $dI$I$I';*lju5g7Iz>_f}9k;Q#$L?~~V}׍s=;~_Iy[s굆+%kI($I$Jtm,y kZ$Iz}흟x{CI$oڇ}߱}wߢF>e%%$\WtvrӴ im$Y`sI$=c3'd[Ķ+~c\?I$ް2+9~4Ix?s~rsv<<P)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IWmd I%c 4dppn^[|UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ {=(|Mz ֘}[r=Ig}TwAwl}?K5o(R>ƣ$Oj}W˲>(\?R0mBn/R@'wwWڎxuN1nq;;}{/c}2y1QglrRE;ҶٓI[аw};qu,;]?}d.O7CK.=vWk/vѪ}]|]ؿN{Otoݻ?Տ?BuY}goGI`M_{=L=_$^[1;h~g[-ouy8K/w16LkrI.;ee`\LY6I/uzK݃e57a'ВI/<}tqyJڟp}>3Z|I$e4;mx]2ߐM'sKfZ=~ku{c$K洒I}9I$i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J{jq,k"I+x+ӭϚ~ڴJI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$~}?viST{'$( L#ԯ:_93IQv߻wJtZuGm75g;$P>Ʋ_Z}DYY+J**vUww剙N9³}`KGfS='/,~SettUX`#"k\=v^voHInoz?%s+wc:x]hn;LX];-eEj|2Iwc~ԜşutR<4\fve_hVRO,7p콣*ڽ'!!Ki\P7/IugmZVXf?qUjI%~dfv=>N.!$]7/c갛wlǡm_~ KI$ hyI&I$ݗF;~I${-=fz<=TuIIx"I$I$G/ }׏9e$_%JtZ/}U8|BI$lFh $9$I$]gTϲk)θcM<@)$#^яXk')eWy~DIyؿ{ol`1ϗI$ƷӻWv݉"I.5u[{]e@^[BI$I+ፍO.0I%W]޼/CK.cxY'KԒI}'/ AXI%Y$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IFƒIJXN%Y oי?$3e6;@#$ I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?g3Iܙ=G{cu$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m/|?3-ĒXi$Twsf8Xv=LIo?E_`I۾au_ݤIsA<(_ I$_gڨw֏i$/ݓ{H9sǟI%{D^I%߇r__oWm?n\!$^^I$I/?c%$_ I$Kߵ7\'#I|I$I"_V>=fۭpcn%$^8ߜ333I4I%ceg^Ù﮷K3Ovo $I$I%?[cד;P%'HXI$)0}Ens5G+yIs)$?WPo}۶qq I$jYe /ࣃM-2L3f4yo$Ogpx'E/C:}<ԙ#`s8͠GAIE#5I}?E/6u#I)?T8M--.wuxoZ?I&𥬯ѥ4x<.|2G=O]cIK}c|z(溿JR -?RYR盝l<'{c~hZ\p$#}.K\Zoz`k8ŤOIIExs隁g 5;}l};rJUw tW"?Fţ=YUos\]a͇pQ?4MN}5_]澦k[Ovq>?O$>WO!}SB 7ԥeN0 INlӹ}Kwèj}l&iƚmp xOcݮ\IJUvz.P8x}|ۃuYf4psa:O$UMvztBZow1S\~}OxOSI%U;~TCz)kYSL4CxŹSSeEޝsowuJc+[,S>Ǟ-v_ $>/Id6pp{uI0xg=RԒI -zb"Ap[w`"OTM4RT Wz?smxp[ #k$}\Kꗃf'n_rǩ~qL}^RI7qzo}|1?OEs]_sX)o2x I)KgKt<7Kc<}Qkked-_LY7` Mu8lb3~$LqpQ)We|>}}ų!$Sm`*xg= I$[g*$g *-_klmm io hml$M4RT Wz?qyZ8-~}Cy$5RRx]ӿ-ܲ>z_SWTM^Q85nkKxi!$R—6Z=;xn\opmmlVx\C[$³o>akx }:߀66A~ĒI:F4loz8wk$R]ދj'Clw>i3}KAe0Dqj8i$N}5_]Z%,}A1?$NeE3!}Sut=f2ph:I"])N1.2KwèX}V8Ox}$Y+}^-=}<^;_GdI$wN6X}G Kr0]VFQ[n;Ak~v?̷XvN6xbCSx U"pފ3w ?貂k|?ł2id}^?9R9D5ķoO^ah1}Ѵ GET\*Dm²uU뱞kK;wB=;}6[@$mqG:-4׹nSg :vMםYOumopcq[b!d#!A/.k*;[쇬ӕs{yڒ9!>جTLK:3z\oS_~U[h){߲WXKp~.ox]rZg1k}"D2|%]ɜ‹3O񺎨OX~KS p[= %.;qNȫAs? %t{sN/V1. ֟3<O_ec};rik[MޗvxZb#5ċ)eb_wÜO/I&W7T` q4@` m8I&opl*]CZD}?Fm~{$5WpwI:>n Wg[Z ,w 3#>$Vu5_]Cogs˧p?o={c񤒋*-,qCX>vE3֭e 7ByLH+}/,{{x/۸yJ _ascϻW/􄊬[ e`88V_GAxI5ӭͰWq"8|[wc io $joV.pw.'w7Ǜ.kaL?IC+`4x뗃f'm@ a8sI$7{}|$Oy(sK= i $R— =j\\Cd4`Yq9È|_M_pn>on\YVV$]ƪkpT161<;n1oh,& ="8qsJgU[:}m3ׇOõ[6 D8*ps='zn?t>Huv7ԥ4$.4}wsˮo쑾B0,k8}VKOKoL[;˽%pq,| y$ksZ=:=."AAG{}m=`֑ $joKuS8;\Oou6\ 8կ~=$}VCkj6lkNxL=1ŤS]w &$O¶ƿ,w w.\YV~ޝD=3ׇOõ[6s-/.i$<97K8autz)hm.0AIMEޝ.b_)3Ʋ=VKWKoQp e` ӯKՀXP=3Iihs, Gm2k,Ҁ?hci$Mo$;OҎ'mm,m0L֝qjd~^zI)e,W\QKZj.pӏI峌,sGæq7_WH7:Px JF汴)I)K.n!q)])YhƱwL<%!-pz`?QcCKe?VrI$=-p|ۭ7o90 qi$4{]軂~q$O¶ƿ,w w.\Iګs?DN ˧zg VW"[^\I5?7˜8>HuvR]a--ƛ/ދ;]sxĿr7å&X}ϫ}%rHI(V]>=uIzRƽZlI$ҭ̱􃋁Ck{cn[qcJN57ХպK.ڑ½Ϲ/!/=$ vTCk'DociS-'RƗ\Aqtf墫1mi0'z$j sn-pz`?@X.m{O3k$I&Hc=-p|ۭ7o905ŤS]w ]`;%VןUǻgGIHuf[='zu!"o<pokO z^\I5?7˜!=WoXY-:I"iwsoFtǪiscv\J.OsZ}_O?lkGxI5sz`H5ۭwslmp?l~IIƦzS>sø%R8W94lߗI(vTֲ4x|3ON !p7tn#G796v5oskm e{cJC^X7p?t|ұc49_Q2Z%N~\,sÚg.I${6MnW_{XZNQ[e.o;@INMwދ)t1,'|;D ϪRcw_qti$VmUIޝp7Hg$õ.[2u_DqysI$f&N.sxAutxlR qm$m4{ӹ{xĿr7å&<[ sWKoQwp}'K{[_O?Nlk/$Mopg }*L8gDpk{cn[qcJN57ХպKWjG Z>a%7J#;x|3ON W潷4p-wHc1<75oskm xO?[i$;.uw O 'U偁 .gI"8}n=.״9o rϞX.m{O3k$@op`$!p>{uR㹱{ < qi$4{軂M 2wôKpxq[>Xp]'I!՛Uew\=&xz$õ'ok]u_Dqui$?7!=gC]] o:[5\[I$K{6^z.{xļLIcau{O3oPwpa .kk= h_O?VƽDp$J1g 4ծ\RI &KZc \#"6묡sbpyI)Ui;w.%dha#|;8O4C6pIޛ!o՞39%V >}FC#sI$ͪ;Ӳ^ <=']c}fإbHl]sxғps}.q|$ T-mv`>]ױH?W$J1o ]ױ%I%opd7ҭ{鴹_wslm qcJGBVI4<tCssOw}^c %x|7OK +k\˚cæK59}&x5稞kx= [iD9{cJC?^X-p~])ۀV5k@'<^i$Wp`kZpplT{deX'[sd#C\A_%U,+a>w|2f0S? $gg~s,q,IEsI$I$I$Kv3?ڒKsOyICCﻶvrs?ӲI.ew.ٻg8Y6ɂ9фIX!G϶W[3lSKߐI$,OdcmȰ9IPvȳ&+.qsSRI%-?`}vc<[I%߼e³‡SU]@?a|I%Fv];8I$I$I%o̯>q=I%򥵾_[94I;w? &)aI:_Ni,?j~A袦g>ʞOE%w|53[WNmUL7$NaºJێٻݸy=Xڟ'& !iٖoD0;S|xi,r/|ٕ뮳g[}Ugu#%^YPcsj2z6'I^읱hsr=վ#_r޳tm=4\!x%xq[1~~+#ok%[)UI?bJ_aq}:'$[4{bOc%g}9>p߷ Īj{CqM2SI$I$I$I$I$I$I$I$I$I$I$I$IU: kk=B7[ߞI[Vs0޵i$DI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%GOSBa%F$Dϰ[`w}!H $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$H!^ZbKvwGs?1Mh{~_H $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڒKsOyIwtJ~fqkѬ2Ik?$Zſ `WQX96WиI-(k?;?uʜ8$A'lg*qYoI$?f{}߳^S$vKb*’I)ݧu!BI$wgx9a6|ccI/G/;_Y?:I$RI$I%_?e=1I xi.7v?sF$KCNȯ7'yg{f6Vo}I$ۚ' TOWnI7~w,`'Ij߰vWio^I{AyvQ;K'N}'}wk=+]ϵI$O:>gcRs3w.8ͤ$K>}C3ߪcC*1I$ݫrFK]4c WTCg$^u/wѧXA<GI$cg[{f = <)$1FHϲaCopoom0}3I$ WFţ컶Lei ^,.knDa LkcS+ű;H8'?%3)zՂmuHZZ{tEq&|ϪJ_f4{jѥDs$'be':*Kg{_p}꿜⻉JBKѾ'DOI-e"I$I$I$I$I$I$I$I$I$I$I$I$I$I$݁h`qwfyTVYcs/- G/0ȭ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$oOJtǪX!:x6/2)I$Lӝ[##I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$s񳇁=IukC_TBI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~Ԓ[bχ&x帒K $^1w=ӳ /Sv?q@10I+d>{mъi{]\۾:I$̾Cܿ.$Iu??ww>s{rMX9۳I./++3!\\K$R;3㽶VI%cwvvX/ gRI%I$I$I$vw,6bRI%;tw TIRI$22f5lŮ0I"wܻ9~ITI$޻lrq?-s?!I$>ϯ,[o{)$I$.;{\Ғ2l!qs7\^_b̈́GqxTߠ~l~v뷺WROˉ|澰w\{Mݏ/~D~2/Lz0z[KZq_n@+]d콼Iuo9ع."UtVl3.v}vֹT1In𷈺=RYII$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%WC3ɮ$ #UUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mRINY>! Iq<| $3`4XȟQI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I5ysǞ $\ߺx?4ho⊒HI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڒKsOyIb.s:I{?l{ohzgk60IS=#cvNpqS).~Mw|Is??I%cY-έsɦxO1Kbvel9V\I$I$nߗ*n~o? I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I}9I$i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JuCxkO-SmR> \[I$I$I$I$I$I$I$I$I$I*=.yc26Fy+;fC:K[]0{'_*$fUnͨh<w[r]Vlje}_qglds-ӋUKC;sS}Vq'5nj~~8k[B0.jRqc"?kĿۑN Yu4^v1xG]W4m} nR]7ؾcfQ v>ssi%ݶaI?vn4rq1Z[ExڝkJT7,u=b3R]?s%FO >qþޟV_bT<]xe̩pt),dp "I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$-ud~v=$کmVzߛjI*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J6y@)$Hⵃn=Eմη-$&}bx,x޷t@I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$@ }{=_RI?qc=i}/|a$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵ$؟ɟ9n$=',|n_uK~I$~I$~I$_ۖ͸ϏyKC|`\?ȒI+kŷۯg|GOI.#eb-c/'P˧ud I.]$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_F}yRI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$k4p}]?I%cZ282᾿JI$I$I$I$I$I$I$;L_軁M,mHN޳1OnקwqÿB;lOW,}.|z+-I,/÷hK#.w"˙TOmՄ;Z6*!+nl1q,}F6~wM/ S[}/]x~Iu`/ٞ:[9uy'1.sa${ٓ?p$_]gwCT~{c#kmZv_RI.cvv'L5mS/ٹHE}k떿{ꢪtNGڹ>}h~> "XΰX >Lf=g?F=<ˀ~}i;mY.FHKNЉzƺ}}|tCT|G "nωؿƍx~;aY0W`[7m=_%fWuCUv-pdl{`WInc$Z0qvOϽXƶZ8dN>x +)I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$~;- "I+=YT6$Ƭ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$gnI)UwC3A ט$3Ge;b]z'$ I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?g3993yO/2I $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?jI-ϱ??rI%S}s뽂HjI$_g;ٽ';W^f-TF莃^0I/1ʧ.c?9ǒI$=^wqmlS_vC$_>~OwʻcL7is$_pojgs84`L$J4I/KsI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/><P)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IUu-8vJnps"x#JI*$I$I$HLȢˬ5UmmIb}̼lW@~ Їc73GcUna/R\+\|v]{.I4~h%8yw ^. o2oA}ów`ˁ}6=UGZٿv>j~ǰ KsIIg70;5w|԰|?{WH 3fwoC"* gOkUvOCK=սԷ5cÎ\}]$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$WR MWk$۟)95UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mI$AI%:gd2 n51p@HXc?It@I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Azz_$;ŏ=_e$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵ$؟ɟ9n$I$=}k3nm~7Ũ> $&ois¯#36連DS|3I `﷟n;{ܬo!$Y;b3`dϣi?ʒI.9igf8,?I$?[k+ q߭$fwov]}6]BIxrI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$cGC{_ԤK4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_,8hFJ^FG3זUUI$4cI2K_;ō CUk0@[}n???bK+WeY;{~]S\X+yHnrR\Os.T]]Jê#vNZTawRkkYkv}M8u -;~FIkF--`(͞Q2Io}) 5Z'p.sݝ#m꺈v=h_4e<%cl2;Fg.*s6is-?rr[wضʚ -kvn;ٶOҒe kgJT$xYkjdž%!3ƎiڳIkUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$~X; zn~ $vٕptXI%]$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IF>IJ=T0N%%\%3.Ԥ&`p˼;=! " I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$s񳇁?ĒH].7/:I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m/|?3-ĒXi$/񁟙ڳhȣnsއޒI/Mϴ/ ;"HgK$K{nuM W;qI$~%;dV\I$9$GʒI.j$DIr$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$3s RI/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$|]Ao g~z05Ι<2Tve$MolX}_M%ԕgbōН{I19ԫ9$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_6,. # ۝c3k5? ʬ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$dznQ$Qz7 lq1F$3 ݙyq{șw($I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Yޛ#=|Iuk}G QRI $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I/O_e޾?e:U} >'$K?cN-hgĮBYI%Z+ۿj\Ƹ_$X[}/߳m`fk:ãI-{ou_dyT`}iğI$n+MfYx{Ϥ0|I$*~3%e?sI$O}ȒI.U$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_F}yRI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$~{{CM>>@~6m!#Y +=}=3]̊ Ꟊ;Cm9zl +f*cYXOe_o{|IeeQ]up:XE.eؗY[7r;C>܏"K1]=4D4@0\qnmRW{Oi} 5`Y߰-z|(|Vm}eˮ>1].ɧn3yAG-NoSmωZW;%?wbhL)$L&F`=p!$3͎605e$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?Mmξ_HyLX~$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3K$>ǟLq$}hl_] 꺚{ZI.w;H $tIn?c*I$?_ГI%ʤI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K϶?47}JI$sI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Yi/ed1kmp?V+UYÇGIs=ӽ?h]ٳH+'Tl[^Uzn*_O)so9;MziS,1RY,L;hy`<^}H[[NnG#hv>b[c+d?{$GGx' RIk/=%հmKĜl Gkv%%+K$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_7 D~I%g;2 ?UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$lۍsI%*tn|%#>p$kRI0f^x r{H~@dAI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$AlMs?H~uq;C$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵ$؟ɟ9n$I$q4!o^I,0>~Vtu$VR}#vRIu?j8Njv'Y~s)$N?b->/N$!U[r†I$?3fUgrvEvU"d~I$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_F}yRI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$*1孺[`OaGe5sgxH}g>ѲN{Zk?P[l>~}Ya]Y_f0,[-lp.L 5Jx%C3Ngo=30˳;Rl;.Ug1/$:͍į\֞]^dz(z[;csWɖƒuk)>'.}F}!rvnx~aI17YkHxl.G}1n'#@#O[~wܰ{C;ڿʘ2VZ=Ғy?fns]UoA[ G0UM= xIvRLƵ hhII$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JpvVwAߑ$s1+*JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JUOB[Ħ}LcZc$3,mٗߥs$RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$D}Ϧl{9I&G|Άy|I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I, q̪̜R靖|BI$ߝwna\KZDJI$>P,ϗ5}̉yKwj!C5`LKe}ϱWgm68~)$;ӛ}gZI$;yiwGm$DA<ϚJ.wWmS,{wLLHUdWep^kѷ ޻!nOGIvב.;s 8>5LTkWlp8䖿G;k[FS}vZzJ~&؍*b_ ǧҒ-hs [\db\$USC hHJi&I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J~dn|I[Vs0'ݽkZI%Q$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IFS9$<6jao mlkZI$Lq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$C1[O;I#̘@oQI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I;ױŮiGDIkO߾YCk;xkK$KI$ggp]6R?9`w򈔒IfI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K϶?47}JI$sI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$LI9Ywl<,e7?BLVӲl+k!%6HwdQ?8orRY%ݻ]28R;$ȼd#Os$oiV{x/6]pXs3ns}cObHWZKe.s2(Up sz` )**w!4Go{2_o?b/HD~k|2-]2=Jsn|KK{C\Z{9TcqIIobN;_BIҒr1ʥ_Sn >kZX۰0f#1*MF"!OİIYNPI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$@ow&yI+}g׎#pJI*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J6)$Tz0qlL'& QȎH $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$HA˛:wIukƊHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڒKsOyIaI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K϶?47}JI$sI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Y}qFmyuϒvM^BK7b;6׶`=JQJU?XqX)hww<*:.27[my=`F/KfwްƳl#o<䰻Kiw>?gc>}~ĕ7y됅MtEa.˧['=JJik$X x7|am5;/Po=w}.SW/jf^&[Gs9kw㎋&>W%4n?~$W+Z8Qo 4zBo-䤻g߻d,9\ Xt]:+8Jvl߅k7O?(@@0Kssiʵ8eqb1GrUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$U{ K  ?&$ښo9yZI%Q$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IFܟ)$O\rKm? $&xks@ >#?⎒H $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$HANwh㳯I"ǃFEI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%;_I%'<g[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%g?$_9I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,{_e>)&NVo%SkE/n;Ƿ!;W ww }P?K`x\"3+{NmRkYo,;\ݝ'w?Gc^ސ~v%KEeóq^o:cL4phos]vcF:j ,׸(cSd{gݿ%_}m>f#ËDKohjUqRRKyڷcY?0Mmξ_HyH<_#I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m/|?3-ĒXi$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$3s RI/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$21pÑsjpcx2P25%to$}X93Neo# K$K)n7ڟ̖{]c{<?R]/iF}{8%Wx8] Fy+^PvilvzcI.n)cnecmA_ȹ7H'M7I?c {skVe킺 KՏqܶc?8r[߶釦y]gBO?/%/݃8?QΐgĬ]Q],>lӅ>峊QT<<·N+v[_)&3lyY_~6UVߍ-q%Y$I$I*vGuV1)ё XI%]$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IWK,O섒V;}5ߙ]v}.?` $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(KkqI)Vh=J%='|I2՗ulX~H$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$#>w>g$ɞvs$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m/|?3-ĒXi$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$3s RI/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$v]ckHN%?t:H">ӛ\qE6yHl̴IRkd\jgb)w4r#bROGz$vVwُ+ͪ/"O?*{gsw4O:Ze{^.qK4Y)'I$I$I$I$lBɴsz>)$6FG]\T~=ܵ?gତI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$wÅap$I%g6꺟ᴀG#)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(:JU~xr0r$3Df^8͑cvʌH)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$H !o1%F9ݳ}k+G _Nx,S]Cv桫%Ux+S'ZGڳgi^ "|CtaW[ѵ{{xd8đ0~>#^>(72)=+=K_b;ky?U .Y_Gu9nD̑=K0gOV;Wwnӵe}pINfř]ϿU&0J=he{R]n.=8K*pV@l²Y#9fREE1$I$I$I$I$I%W=Դ$tۜ27E/LFUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^YiwRI[M¡Kvn֒FJI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$>v 34dB8涆0 I$LcsE/X'GI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$g VunH̘@oQI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I$I$I$I$I$I$I$I$I$I{?ϟdi˾9uwX߯tI$5~sͅض:f iW4I_in?lw' {[ӈTIm4Ozï=ŷmCIy*I$I$CvL^h{p(9 i~ IywE>YѠ;I$/> hp>i$^9]@OW5.\?$^I.߳85߉ѳ!Vdy؟$K?ǯ{|xI%I$I$cGC{_ԤK4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$<~m> Kb).-f}(yɮg,؟ڨqV.E} ?\L~/Ovfz7w_QO4Snv~ė}]`6L rV/wwX;cklܬeeZn.>-gS9^w;q 2>Ԕ)a&qh~}aaǢo)Ls)-~khqqt *uٽQXd|t߳i~YE[ioXUϳHK7m]T-3m*z=:,Y;btIn^ٍٻe8R?;*x@B:Bge.rRI08e}*I I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I!?.o8xI$R}ٮߛh$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3K$>ǟLq$I$I$I$I$I$I$I$I$I$I$_Ƕ9a}^=OI$IRI$\YUm/+NTmQIhe}S]*yy{١-=8mn]N]/Oi~UNFmWuaȰaT8_i ,=)-̾q?wor'Lc\>Ԏc?ϢKoal6:9SUWYݡAIk)I$I$I$I$I$I$I$I$I$|\"[ߞ|RIYuj!Nkğ/Ĭ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$;xȒJnuͬ_Ӎ#I*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J6G $Tr97- lq1D/velt>2g$ I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$iӝ888Hoqѡ|RI $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I$I$I$I$I$I$I$I$I$I}}^-)$$I$__}uNJI$AI$I${Z%@$7q?v aap__˧I$l;1p _uWcxO"I/~cM>nok$KI$7K^?I|I$I/;o~1*Gueq6 czI.o'.=WVgoͻ6e=*![4^o0Oj=lkgoǗ>JŸ9{+qrs\l0.7*l#c;myWT+Ӊyv^Į'ĽW]FF0'ڧ~O[[V@¨֍letTbM&R@Wj{]˕k0kpç ]WgَqW}`7Kѕh?kdNGbn#EPXN;0 .3ຎs~f>:j5d˿e6\YuvN XY+kx ~U~e~9-#xmV\`i$3h45D𿆱pH) ;k\O)$mNk)a 𳊱CEyv.,/Wұl{II GխtԭʵyÃ8+{I% *k+43?֒v.Qh.-k=2ZeI$?`s6_(ۅh}mE'tGȒJUf co=6``=4zlz;$7lkEn/Ohk}p{:ڳV.@kO < áI%Vܼw9mMM`%(U(mn7Q~aI$Ksq ѻ M}ML.q i$G@ƴ+o֏wtXT9q8:,{,L F?I$ĸ5]m?ADa^kGԱR9 ) 'lqOH/ss~͇qֺ͠q}.#ZKwֹ<8a?4H㶧5xkm{Qv]ˋ t7ĒRnn%?AI%;sq ѻ&O@_I(+==1-6M*67Cqɟ=J̼KZ[/5C[ʨqq`cDŽzI)KCޝm }G]m6vJ6_KHCcsç{>OI$}mOk)a6/pJ.˻qa|=$JxtG]ޥn6]8OǸO[I(US |CA{O@ZIE-3YkYG{,ۿIٗf:ѷxHQ (s":\H?Y$Nn K}鷅8}?\i3IRI X5ƦÀp7dbd1Xx{xt?)$ܼw=mMͬpqm!B)$nn!ѻ_[+\[^lq-eeH+2QcƂSs tWIsi{ǸdϞJHe\TyQy=RC IHZ,'lq G 6l?W1]ͣᮥK?_s}spgN}>^|I?q[ZxLWX=Wy(.eŅV8Hs1)[Iwzv??$$̬pM5[o ckxæFRI=xβSd68KŷH !6Q$77qR=6ö4\}MeI$GOLcH!`h*6 X a>z?)$x4y/Qy;GԱ)$sqmkdޝmGx.?a$mw 41Xx@i7c8aӽO4OvVq636ZX_>cooI%&bS+<2=/Vp>n6]8OC^=0OI$VN%L,˘PςgeZfG{hve $"'Y6_&(em֟Dq g$9u-zo @#طh{3'_I$6cqzQ W]n@63:2IuXڛ Lp 5aCq ;gI)ۛn/m#gdHqKI.{Yq:I(+7Ӏ46য*'2 X aϞJI%f^%-}A"^kKȏ/pHL0sw9z>:崒NsqmkdޝmG# ~"c$3hiI7c8aӽO4OfVq636ZX_"Jk𤒓s1)VsO)YcN׸LI(W[K=>!24PgeZfG{hve $"'Y6]&(em֟Dq G礒ONn(K}}6>#o-O@x$ەjdp:X-kmԞ3xIX<^#ӎV&HkOx I%;1m6\P k$Bj\.G{G <I=&?DC}!Z)ٍzKȇ=|IpS3*'24_c-`<^z?)$p5 U'ɭ,oKt;I$sqlcZ'~ӭ~=Sqzt?WRIG}߇gxby6=}o};|锒R5l{YK]bRߋ']_iat=+G I$Ok<6 ~m%ljyh~6[AGI(ד[K=9˘ U݃뿆AeuSF?V[3 _eYO?D?3'_nKk]P8;>HSkԶ\okK~cju>xIX<^#ӎVKj\s[P47>I)ݙlZzCo k$BUe ]i$;=Y簒I66C}!Z)ٍzKȇ=|IpzT9ձxRI;1.k kVAy>[ <2;M^:yo0Ikƾo[}}>zLx~~)⤒h?11ɱssxtgI) jW[}^~OʻzV88\BI$Jx]AlZK INl;Ԃ5L;QfN#[,&\Ϩ[k12\-WoKRIJAolѷta+p]UCZHQޒI59Keo=6&6[}SϩR=8<a䊫:[ }&̹WcL$_}ƱkkxugLx~~)⤒h?11ɱssx_N{] |I%![Rp>m6]y02s,sYXx>{ $31)k*k`KOJweޤ!tza$feb1elަ(O~=O^f ˭}[ [ꬭzG.9DP?=HpG?Uګ:wsC~᭤%٘KewM%.xBZfmw,I%ff!WwCl8Ԓ^D9LMfN% -cg 305^[VxRI;1.R&J8|Mo{s&;鄒K1}-o}:ۦ>?oO;?\SI%~EOc2cc_sv;o夒Re-wCVse_~&U.}q"Nc!$ff%'q kLݧa${^kr2myÂʜ!svS}#3ǟLq$I$I$I$I$I$I$I$I$I$I$-˶ zI/ \A $.;3(guI$Կ㋸Wڿs n5cRI%I$I$[翳_q`5l|pIbTG K+N7#Wl^$^7p_ggs^n-F?+JI$cI$7K^?I|I$I/><P)$$I$I$I$I$I$I$I$I$I$I$I$I$I$Idw^)=#g_S'y9gm.RMk5ct UZ,ηen K;ڟ?p-9.SDWU{:S+m#$ߨظծ=}?ӵlUˋ[-#%]WO -\۸ )&p!v%aav^H~vW~kBIc%*jXu8[osf|]_w?wFz֠Zd~P^veƏ[|j?bJOw]klssOj*'R]{tl%:[JJi I$I$I$I$I$I$I$I$I$I$I$I$DXGI%c "k/` $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*v`$GRIY ̬ͣ@~D$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$gni$ѺaJAw1IyI"fgߔTAI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$AlMg3H~uq;Q9x|ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I$I$I$I$I$I$I$I$I$Izq/wEX/ƱܛgV~_I$_['ܳcOvI-'S#}YuHI[_mw:{_o$Zo$X_(q2j/k-I?m$Zk]8WdY~&O?OlpG4IDiͰSGqW;l?$V?ǿf{{u_#$xuݥWo#IV}̴<˱-iG\hvtl岰gon_i .&W[QW7mܒrqwW}dư/gTe=fb8++bxqg1C}/B5=#ƚ][toPUoSt[Y>8ѫ*R}w8v1yK ?}ox8=H+C'IXEDI$I$I$I$I$I$I$I$I$I$I$I$I$I$K8 {-3|RIYù"}טJI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$i~FxȒJnC[*JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JU|CíbQ[11I6ݙ}_c'O($I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$o=gsi$A#w}CQǟLq$I$I$I$I$I$I$I$I$I$I$I$,/j;r%,I$wOj{;[#$KI$`w;^[ol`褒JOh~>wlez3! &I%I.cڱ xCI$1xMT)$歲ˬu<28줒J)$O۟=`g݌#><2I+)}?_ I${~sb7?If$K϶?47}JI$sI$I$I$I$I$I$I$I$I$I$U;p.N9im帶5G2e}ח&;PÄͥ\پ煁2C*ULFknͰ$skFw}yi$[F}V9OzגJI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$jx 'PB X8-- y$&{Ź~h$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$}.I68z~2I $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?jI-ϱ??rI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/><P)$$I$I$I$I$I$I$I$IBǢ˭wu=HN #Jh] Xvzl&&)[[vxvR\_،?jɚD}N| ^{^mMQOĖwt߫݉;:)*ぷF[ʷ{ XzLIrŘ7w<몤zWYH.g.U wͼhۼp\kGXto %䒒wp z- |!sHbzEvgWe=]پ.ȫިַ\a+&xĭm+m@Ş AVYUw2|C 9_.m"q#$_SsxdS=AbYڛvW!%Y$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*sgyoV8#+GsA_ZI%U$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IUg./L 4V_ϫG/0GVIUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Q'ǁI%:d,/cOII$LdpH$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ :wI}ٮߛh$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3K$>ǟLq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$cGC{_ԤK4I$I$I$I$I$I$I% ."e662 @t(2 R\iYn{jtgmUWJnnvUSٴa,>vvۈ~O4Qdm_n;hm%`=).'>|្Z:r}'y:ΪFe2?Qel{Z6m㦨7[s72="ܒFaeon?\doYϗIw=G~(˫7&(sD? .kshXt]a[*"]N%@I7_g]hƨԵyo#$ }ov~$ϫEMWaeز{?[.K kK>jrtI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IUsqIsA??I%kp."|d~ZI%U$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IU{0-,%o>wI%o5ϩw._oVITI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Q' I)ӻY>! 8ė$|I<5r?QI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I4 vuI$RV|47ϟ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵ$؟ɟ9n$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$џlhokI|I$I$I$I$I$I$>ޭh;gʥhBr[vZ7UQI`?sOaΗ~Q=b 2y4nbKIeYUNS履y}uzc?vm\RT@̟tmb{Cs)YȪQ>~g%S;Z.evdGe#ϗzKao~Q,s=kB7;=vؗiS($? pw"Y7ӗwecכv4[ND^ݘiúM(j(7dn{[{oǟLq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$cGC{_ԤK4I$I$I$I%ͷ Y=3XE;? ^Z=a{or?a{3= o-3k_X3Kw^ϵ^nQ?)Y^ylx;oe!|owJ9A{ʷ(J=N}R{jܤ +?$a6CYoUVv?%vǼ3^3nmhD|r۾G@WS;+pF,~ +w4ywlݏgkh=r m;Iik}ONGd#-CV<k)<Wc%J]FfaIt`v)>: jdd/}YE%TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$UGu𤒱Uv2VIWI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$UK,O섒V;}Uߙ]v}'$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$a-s$4Db=NcI $[j˺},{ߚ*I!$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I dms<~I$gLq;Q9x|ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I}9I$i$I$K#?a~7$2({plk'䢕VUvvx?[1x b}} cOg UضVl}I`}}Ǵ^뗀cj`wˇaS})͌{H2>w_S^yөa6w6Or\8+v\;>&"AyIe:4-*, wzAq}̢Nm旐8W7崋]_g1~`bKk>-l{7tĭ~!m4{GSxٲHS~pRZxX=W}e[;>[U"3l1 o]B؏Kg1{?qyuX>2)*uzMhuUuH{%Y$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*ل&6o=?I%g2?Jc~ I*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jq!VSn$]PᰀG-I*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J6NIJ:m7uː$#2lw7o$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$o=gsi$AyO/2I $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?jI-ϱ??rI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/><P)$Qwv=\ӛfO*-|v>i.20xPU{DZ"cUK_ܳ;oǧ23ucY?[x_'J 5diVgSE(f'I,i~NF4; lˑoҗyfpRYX]c |ꮨeuVIvu d^.edF}Kw;gfbIlgv߷๴udW'=}3=gm{oU39%ح_d;{FeVv_ i<3 z閃;{NTDlItܾ Eq˔E4ik UkڷR]eI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$纖_QsCeCVsWءe?JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K0-70>.I%o6 /,p洺5UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mI$U" n5pfx&xqX,"$ς:I $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I ={=`bKvwG,dMGh{~_H $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڒKsOyIaI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K϶?47}Jq1q-ܮ?J;'YM W+"0k5h{'γ3ᡣşdnuU_%&/ڊ豝ؙ4ّǸZnɻGU>է'*DW<|RY;+d6 pcS=y\&}}Lwn> *<8ZTӣiV}mh?8~v>}Թ_Slr׿$jcwu&߰h}%sIvfgv;1$p%RYOϫyWv_Kcܞw'UF=RQ_1KV2I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JY`4qq#IX##Ϩ'^^jI*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jp,vrI+=ٕz|_[6$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$gnˢI)WysꡈZq)-lz]˯I"f øx>䊒H)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$H`.Lo$Hgݚx_wƿ"I!$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?jI-ϱ??rI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/><P+Tv[qw1K†s^uo?zfl{?T']n毪>_%UemZwiUen7s2)+xۼcv,9 xi<P+SۛmepkZ-AYgs\~ztԃq!5͙_RZchVd?[;.#_<9u?>m%} Wego=X^/Xo(Qxzw!ųśWIv=װvuVQjuFy q5R*i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*ͨn;\\/0tY>w/?I#7\z>h$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3K$>ǟLq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$cGC{_ԤK5z|##$dA$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%[2q@<[?I%g R28uzJI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$i~Fx~DV{mͪǒ 7)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(8p$<64[âhǐI6ݙ}_c'O($I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ǩh?I#~=G{t5䌒H $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڒKsOyIaI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K϶?47}JI$sI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Usus\ykE$ [P.h罅i$DI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%WT-cYOI[Vs^R$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$h9)$IXyAX 5`㰷<4Hd=I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$׳+ig?I$rLDv($I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3K$>ǟLq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$cGC{_ԤK4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%W;qxvl(>~4V8#+GsAJI*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jt\]8&yRI[|G/0BJI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$>< I)'!`}x6/9)$1#I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$/ˇ88Ν$E!viߛh$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3K$>ǟLq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$cGC{_ԤK4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%W9i$M:??I%kph1KGURI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^0uo>wI%o1g״9r3*JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jun|B w8[d~AI$L hǀ)I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$iӝ28=O;:$KUh>gHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڒKsOyIaI$I$I$I$I$I$I$I$I$I$I$I$I$K;,w퟾6Q;dq}9!ۄI_Tfw,[.=wWU6CI$L1jux^Lj-)$ I$I$I$?`; 7g4UۙffIl ;wk;V^_JxxKO_]?,E$X$I$3s RI/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\QƇ֞[ $`FT8}ZJI*$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Js`c_[<|$nF}Uaߚ8UURI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m<5<P)$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IW˶hi$J_7qa$tI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_>)IJD<°JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$G0IJcAJ#n-/4GDScj˹ZꊒHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$H">Y>w/?I#7\z>h$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3K$>ǟLq$I$I$I$I$I$I$I$I$I$I$I$I$I$y׷~^geG㔒Ix9_oɘ̶I$4I/>_Yq3#}&$K8C`J)$)`Gۻ_up[~I}-he1ozyC$K;oWv{f܂?DX;I$_Ӵcb[UMid:I$Y$I$_F}yRI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I${Nkn;kxG_6I/5YLfpQUmkl $K)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^!?k?lﯸW]8VZ\%\lo.GNI,4I$I$I$I$I$I$I$I$I$I$I$I$I}E"d’I/~DI%I/?{~xI|/I$I$I{G}Y=f eF&I/U}c\ >=BI$|3^X{z*I$TI$I}9I$i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IRU$^U>h%O\I,4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iz?mIai$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?ݛʼn$z;>_ ڒI/*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$џlhokI|I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/><P$$I$IagRIn}>I,4I$I$I$I$I$I$I$I$I$I$I$I$I}pnG9&&SG㔒Ix8o\lIsI$m;*~Mv[?I$V==q8I$RI%Njm?(I$øf5T}r$8OI$t?jGPI/vWo ڝ]?noI|I$I/w):vϳ]/7Ʈz!i syǂI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$K'.=WI$y!R__q$Y_j_k`xPX1w)I$$I$I,?jI-ϱ??rI%I$I$I$I$I$I$I$I$I$I$I$I$I.R}oY'`d/)$׻ 20sk`ڶ-$Kc;g~c2orI%?'iek 5>'|RI%c>Y&ieSaNI$oCgu;m0CKc̍$K]?l{wr8U]<}ߢ岒I/ c\s)$a)*"ՏTDI|I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3K$>ǟLq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$/ߴ}FqΓI+o;Z]͸WLmjI$K$)$6fWn̫+S}.cͥ$[h>G>~ķe̫V~I.$Gub .)$,Y={n]SuĒI*_iŗ|u=Ӷ0|HJI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I8$IwU}xzV FpkK3a911ҳ洁c,I$2I.~X{_mYi#0I-NGtǵve_U5YOI% ۙn.eȨxI%]$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Nֹ h:KҬ*p76;?)$M;;y3eC쐒I.7+*l]E$AI$ggZۿ|u=pI$?#c߻ww $gm̷2cTaA $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.ӳ=Ǵ;qE'NI$I$I-/} ȸ&zIvwg~'I$~}EC0ܚd$\I$vݝsj¡k6RI%_+Phojȷˇ0I,ϵ_!},D M,?jI,??rI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/Ob#&]s~3]i$g,2v1$$_A߳XiY|=qǎ(I/K>wލIzg_i./6[e-?cyDIs>xg`~~GBI$tI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I#7*lzͷ\1JI$-3>޸r3`sǏI$^7{e]aX>||OI$TIv>q`_ ~?RI% LO;k[ȽHH$7zXoᶇqէȤKg_d`23?$_=$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kt옹+@u^ƒI.7iwAecH_׺wE$Kޒxܘ%o>I%OWŃ=|ro)I$[71> \jmo"}##Kw߳aV"I/sgq~M cI|I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.-8<;3xhwRI%W\| {C)5I|I%$_I`W+FV[Zs}!i$mȹe9KI$.Wڿuyf,0F4I/[خ5;ۿ w0I%_◰} 2W?$ʹ-h7?I/3<=K^$о>;7Po;_I%wԯ;_#KRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%k版9]]_0I/Ňs8(z$_,$K9Gdv:Y߲I/GzOw(U{;gbI$ $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$W;~m |Ol}~$TRI%:[cck@lxK܇oYXf'~&K˿}vr?ka$[?Jwnˍ?mpRI%I$_|ŝUu6\$^{:;k{o|?=JI$tI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Im7cmqUnI$IoݗG~szK7zWKV5=o7 $l_⯹cUQ߁$A$]78o _I{7]?d1sc߇7’I/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?:ϴ~~=>i$O;F߉^]vIp_O~ewlXIp=˷gvc!S,RI%_7ogǿ#+MmI/(?z1FI$$I}Y,>+;]WgW $c3wcaI!$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KOڜOi/̰Uܚzli)$\ٚwG*I$M.n?{{ok%{8oOI$V}@b~Mx_?SI/Ly}>=^khIyG?47I%$KeY]c?I$˻UOsI $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_TO4$_+$K=ex93"I$謓W؜Zl~{o'?[$KI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ә{tWJI$ue'ps=FȒI/I%C2;FQ)$_ڻGmu I$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$[d>}aC}(gI$Mgo52K{F?􌎹u?O I%$;1>;f-RI%1ov1(8$I{Xƭ'zI$sw&/L oI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.OvlO=کX mIzu_gvFCvI*cF5I$_g2>ck:8}$o~NollKپݽVw,v̎ XI/I%C0; `Le $Oqb`Ͽ3$ c$_:$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K ܯyH}$Ko?/vUywRI%I//_y)s΄Iq8w[g`1O$^O61'"&SIrI$ZvOY.]8e;.I|{k|II$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_9Ȼwn9Q?HI%/wI}I_owF6v>O cKށc=l+Y٨$Up rczɱ?JI$lcODM)$I%g⳶]q,w\]g)$c.e]׹I!$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K^f;KdIt㸷}O08OI$mpÜ~I/RI%_;bd_|'i$QǰUYwly>NsI$3}5s$Y$]9ʷYaa+v3?ڒKٿrk3vuyLrI%*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$j0~}q1lemE$^߻6`:NCyIzagN[g7;I%I_#/]߂sqI$w?aWٚaϫ9=wroI$;cQ$ۿĞ?e˿w6]۰쪖x`$^WY+_xkG7:$K1ov_ea;4 {=|$_>Eku=-cDI$Ί2kOI$t/'')$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$o_ڒI/I%GsN+kGڧso~OI$sg'e[$^!~l]1{(OKk;'8I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%G?ٞv}*)$am:WJ?'sIy͝v*u'$K?gڜYf0nɵk[ZI$چd]?rLti)$`9Yj;|ddTG$K~}S1v *gWI{']? K7"I$ $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^|>ܳ;>U;`ߟDIso`Yֺ/oĒI.[bh-p\|I$~}ð>? 7X=>g$^y*jt z91ѧKdb}񓅑SkʶKkI/5%s?O|l2G\RI%wogS =?L5rI$ɮkpI$I$j\Zc6FI%f&N]5:w ᶔI{^wC7ΞI$?=# ~go7G$K'ڜ_d-)ܮ f;כI$;f?ݲ;vu~Ժ<:RI%#ύzt>n|ofߵ$-ܾBqV3O~^kq$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JUYeV6XkIt!}s+m'E6{ I$}Qq%XL0$i$X$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$=ٱpY׏SW{9UVI$"I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_aOJ`K$HҲE_)miI$7cc2IRI%Imv?hnw(?tI]?wݝWqo%5S?:ԒIs.sq'I$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KI$?YLGCYh傒I!YcE}mîg{kRI%\I&II$$KkE+u}ENWYC$Jkzk1)֤Ks8ˎ=RI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$j{ae}qgDI$J_onWI,}s>Au0%$Xi$6^VK21n}W[Ky?9_m:I$7z^.yrDIg$JUXױŏi $A\e+])%$YGǟLq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m/|?3-ĒXi$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڒKsOyIaI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jnÿ l:ݓk*YI${7tYXŸ~k?I* $I$I$I${?Od,3n-?o $I$I$I$I%m{_o%#c'I$+ӳ&21w vVqAIq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڒKsOyIaI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KWz{7 $^<~}oh<?Gt.I,{vOI-*?_j[U8٦I${t>z1kxK5$I$I$^}SoᱟI.[nfߛ0ǩiSoൽI$I$I$I$IYWw.ፇ@rmeLI$ޏ˵Uer*hi$/hVYoI%]w߱xcVCs ܴ$KI$ڲwX+o!|I%D}kKm-i${ٶ\j7`^hI${q>~CPOB89Kg;iħ۬紒IR997/aȰ~\ $K.qO9|I%ʤI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?jI-ϱ??rI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I-_7Iz{^GbI$U$]?NܒI.ܝ0Y˽ȼlKȒI$I$I$Lzlm\n l>I$s?ŵVzyj{oS$U [I$Lٝݻre,ai}R$\ڟ ?i{aUؙ~S/:>Ή$`u[?)m$^+ş٫Wqe-?=:$^;av_x8Y;u$IcK7er̗j:-I$oo{ֿ/RI.Qw<W0!E$^9{G  WlǟLq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$~oWf$Kމ+wfFAisI${%)$?_ُ?o>FWeǡַ$Kcz/Yyu}ΦCٗu$\Oeks/Z7dWX$Il]A{l;cS<CIyI$I$I$I$^.<{$u־%I($K?Q'yg|I$I$K?3YGVwdq+|)$9I=RI%vj?n' $]ʿ`m~oo߆I%|vnRI%ĝ5E^jD’I/u'^'I|I.U_$~DI{Wпg $K洒I{86{q{ķIrwOLw{}>LIyoC ܫRĒI-qGwI%a^2h~="I I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?jI-ϱ??rI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.^Row:gcI%em;X2|646;$^wwڿ<I$U*;{=U:2˞AJI$opX=?"[,isI$.d߸w{]p8~IfI$I$I$K g%{-)$I$I{o~c$^ I"cfMSx$Kۿe ~c7Ԏ~ˌI%$^oG $]Ӵ_?K?goŤ3}p? I$kA8ݓf$.I{?]8$KIu_b#$KF/j q=V}aIppI%v]C{p sf6/?)$smhkI$s\.;$I$Ge9ooAsZH6I$\wyNe46ǀgKޒY5q-&?I$ $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IwGnb[-&? $#Ne RI.!$]?NܒI-_$K_T}v3:}o'I$58>}9j-!$M:;M8Q}_JI$TIza7~PI ~00%5fN+u $Gb=l g84Km7[\OI$?dvoӐI/RI%}ȒI/jz8LzI|֒I$I$&4Iz?gY~K;~3'I$[o⬌,w 4AIw_H[I|I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3K$>ǟLq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$sR~_ls[Ϳui I$&rmqkԞi$I$?_#?$[CWI$e+qcCЄIvY}UjtC+I.C/#&|M JI$I+=7gUC2.0̤KqcӘ^o|&xOG$^#suv/q}wRRI%]$Nq %$_BxngcdzI/RI%fET Y>I$l}־ԔIE$^$KǺk뺧p[|I$ҟ;UGS}UMUz\?!$_3K7BqI$)$_|>BGI$ &ڿrI$kI$I$K-;#9$^_f7ߏn ~$Iy={ڮۜ*5`}/ltI/Yz'7h[mkZ9BI$v{/w]k{$G8I%E$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagRIn}>I,4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I^TwMuduѳ>I$E;wo 읧ى~ŃI%^|gTJ$Beu=Jmukͫ/v2*,m.vI"2{Glʿ3`-$T?]vi$Slvۈ:?I$?}{곸b6QYk;I${_؎v;s{NxSI$fݛ%_cO,7wlW? $/ȵ]aKI$I.1`F6u,{x| $.w?g~ۻomQǴ#PI%s`m8Ms;n!%wyy$KRI%[˿]g&紒Is$s^u99*?4KKJRI%~f䜛8$Mgj:<2EG8I%kڿ?fs{VsE8COrI%K/K;pvUUsZ I$1_ی\jXʪhcRI$Oݟԯ$X]yG],[[x |I%I$I.}Qެo/UIfwi`ߧ $wvp q~4Ir$dI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~Ԓ[bχ&x?=D2~I/G=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/ 6vV5Yϵ~{dϮ@=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7!>I/n!i/ߞ"?m$=7]"]XͯRI۱UMo! endstream endobj 230 0 obj 67176 endobj 229 0 obj << /Type /XObject /Subtype /Image /Name /Im59 /Width 1851 /Height 883 /BitsPerComponent 8 /ColorSpace /DeviceGray /Decode [ 0 1 ] /Filter /DCTDecode /Length 67176 >> stream JFIFC     "#()%$%%!'+,,-/4443.4444444444   [!1AQa"q2B#R3br$4CS%DT5cs& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjz s;?I$I$I$I$I$I$I$I$I$I$Ir_^iռM^3K_w}+񫮻M$^ ѧm/{?_ -^Bj?x׳ڏi/{?_ -^Bj?x׳ڏi/{?_ -^Bj?x׳ڏi/{?_ -^Bj?x׳ڏi/{?_ -^Bj?x׳ڏi/{?_ -^Bj?x׳ڏi/{?_ -^Bj?x׳ڏi/{?_ -^Bj?x׳ڏi/{?_ -^!m}ΨbӺפ$I$I$I$I$I$I$I$I$Cǿ/YO+^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mA$I$I$I$I$I$I$I$I$I$I$K;O7t2} $I$I$I$I$I$I$I$I/׼$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ctf|$I$I$I$I$I$I$I$I$I$I${$,  g;zBI$I$I$I$I$I$I$I$K7{ $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/9?9z2I$I$I$I$I$I$I$I$I$I$I$^CC/N^;n#;%<+X&ō? ~F^K[zyx,?/`ۨX._{K#]hspd[7k7591rfjt>/u ޾vߵxu31g/I[[lc-pBKK y]߹QQ2olFraa`ݻ2"Z߃ ʾ^nƷcs\OGggϷ?k.oiPp؃2[}?ӈp+پonȣea[?ݗ1j͠@ܚk{ox>1X#a=?td~x~mJ,I$Ix?~_V$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?ۧ7/FI$I$I$I$I$I$I$I$I$I$I$7w_#1coe?kU.}f[] ol{dy/Ʀ=ot+dҩ/;nvpl?lX_Uymd=Ѿqf^’ew;}glߡ?]?/{Ƨz[U, `q㟵3?m1\ w埒#%M[hKIfuxWl;W'ٮrzsLOuR/±?,|k^&-9>@/~c5v #_S^7:bӰw\*lðKo 柰õY;SNj`I$Ix?~_V$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?ۧ7/FI$I$I$I$I$I$I$I$I$I$I$7w_#1coe?kI|7_#} m `.'|{egͳF{ ]**?d%^f۾vkR;'X-{=FB ~vY{W|vgO> 0WJe:ɢZIfuxWw$mfxIFV_}>ܪxj%wc=dmƧGq.B}7cƵb ̎W/'O{v?N}bι᥌>wx/޾Q`g{vn/oij'*Eb\ f9-;wIms[[^w91=8B懶o _k_ױQgl5/M~s)ʫ~voٮ\[W?~5Yjg8yOG ?e}KA/ogߋh5 ~d_+; /ӻ*8~>W##aت|Nc~i^%hT32FnG:=U3^ڒKA/qnNZ"6%wb;}_?SO~sпA?Guogο?ٿħot;al$ϳN6sxܪi室v߰yxx]Ŕl>7U_vcܞ%}ٿ̌WIx?~_V$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?ۧ7/FI$I$I$I$I$I$I$I$I$I$I$7w_#1coe?kY߾GKtL|1_qSgkhh߻/}QEaÒ^O3>{blH}3ot?g?hm]=ł- |A+vwۦdzKjGE};G~OonlwerShZ@/ ٯkt7e8>+qܿF7i?eۖ||^K7ٞGopǞel$?_jsd9Ʊl6wS{?i7gzbLgnY״;/g1mt~vd{s~ƳQoߍyIv\:;eȲ7F?Ѕ(>v>kmscGZWo]ёyȭO悼 eefqݎMÓG^?ٻ'm9OзN؞t1M6[`Ɖ ]jfO38w\?O~<|P}U}Awz~0h?aȵWjܮ$o ?kI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^s1ͺ3rqvc?&?$_s?_qixiO??$_s?_qixiO??$_s?_qixiO??$_s?_qixiO??$_s?_qixiO??$_s?_qixiO??$_s?_qixiO??$_s?_qixiO??$_s?_qixiO??$_s?ڧ>'íQ&6ػvm 2qJI.?n׼G>bӺפ$I$I$I$I$I$I$I$I$Cǿ/YO+^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mA!ߗ@,xI$I$I$I$I$I$I$I$I$IxS_MzGv?NI%HX:>wZI$I$I$I$I$I$I$I$o ?kI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^s1ͺ3r7{ $I$I$I$I$I$I$I$I$I/z0kH@1[ $^CC/N^I$I$I$I$I$I$I$I$ g<{I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7Oo\o~_V$I$I$I$I$I$I$I$I$I%AM5c/; a$7w_#1y=b 6,%CZDup]oMeʙԯ%G+_J_4}*gRMeʙԯ%G+_J_4}*gRMeʙԯ%G+_J_4}*gRMeʙԯ%G+_J_4}*gRMeʙԯ%G+_J_4}*gRMeʙԯ%G+_J_4}*gRMeʙԯ%G+_J_4}*gRMeʙԯ%G+_J_4}*gRMeʙԯ%G+׼$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ctf|o ?kI$I$I$I$I$I$I$I$I$^?`S^7:bӰIV8}C _vI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7Oo\o~_V$I$I$I$I$I$I$I$I$I%AM5c/; a$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?ۧ7.7Cǿ/YO+^I$I$I$I$I$I$I$I$I$􏱿I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mA!ߗ@,xI$I$I$I$I$I$I$I$I$IxS_MzGv?NI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy6ˍ׼$I$I$I$I$I$I$I$I$I$?#ot;al$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ctf|o ?kI$I$I$I$I$I$I$I$I$^?`S\m?5nضa[1SGph5g/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@Oٻ}ٙUoĘxgwRd)e[_ipWxI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mA!ߗ@,xI$Y׾vv bEfϤǟ!W궻mXl9ARI$I$I$I$I$I$I$IxS_MzGv?NI$I$I$I$I$I$I$I$I$Iqwu??_ֽ!$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?ۧ7.7Cǿ/YO+^𒅖_*z ;گ}nD#/,ord2kp.?{'ޱ3pc։$ir_gW.q|8x|?]Cee/f-cyد޻/'_ܬ+[7y.g)il;?m/mXwͳwϴ#YfcѦ㾣Kqv.ûӧx!hZ\(?ؿq2iQk||G]7UK-%iB7qAwnVgr9ylDoޞm3[,-6VnQ?.%ck׿qh?_~l~7n]?r?M^AxNߌ1O2𮡎oYa/h,Om6{$􏱿I$I$I$I$I$I$I$I$I${$,  g;zBI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7Oo\o~_V%߻iA;0ȭnȃ ;}j?;_j;?rU}>&ls߼ OK?g{/n,{u~~s9ĺ^}{4[Ǻy?A kC9 ,﴿ _>Ի~qs 7+}YXo,{z{iŶE.ů2[{_|I.Cfdg(;?ߏߚ;; e鷇~q/Y?5`}Y-úʏ\:$;쯱ښ;־asR|콻XuioBWIb}-{xhָ-h;W<σIyv*ݵ9Ö?%乿{nrww𳅀Yܿ%McŻ s?`wϴOv/+!׺9s^ه;XĤ}ύB=wF/(yӧ{BI$?#ot;al$I$I$I$I$I$I$I$I$I$^CC/N^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mA!ߗ@,xI%}9wsf7+V{g\OٿnK]_bb>jzOqe\ſi>}5[+ȯ[+}[ھpk?u]yn|8YJ3ޟ7$Y $2^{# VmrQovRafaco+ݿc.v'{V0p(my+;ﵿd|1o-?ʽW8X<{ C _vI$I$I$I$I$I$I$I$I$K;O7t2} $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/9?9q=yZ^00ͣ2dSpX%U}++λS1 ϣ/~'?Y]_h{x02w[_#`/8t\7afyeSŦy/P\ɼc}=h #}^c&?#֯@\w#?j߰Y Fd\` W}e{{ڌ0v("wpua{R(4[Ew&Xwpg.ų-2>C_5~`g^/p}ʚHۭaXd}ɭ˪}U?;컭WJD/ՏJ?.mzݦ:uyl7j=Skhwufv}k,Х^Ff7t؛d8O^?Gf럒qDs\Y8g_^|W3~ywI%AM5c/; a$I$I$I$I$I$I$I$I$I%HX:>wZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$on  g<{I/1_739u?chX_g>ot}}|%t`M>}ȫɶs|^4ڳħqowοdžZ솎udW'پ݀~i;wZ˕_gX79ovFo+c?{'n.5;dXN3' іwv]VN^pay_jwLu86.b-`^ʼ[S??݋?qAX?79ovF[R]RDwuӁCG_⎞%za}QتϫR|3E9_i0>qlczvO;s{Fkk}]`w\V&~ueZI$?5Tפ}c-I$I$I$I$I$I$I$I$I$7w_#1coe?kI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^s1ͺ3r7{ $K,/?` 6)7@ xsۻ.f%5VzM}Yy<~=)ȧ1}ܪ[kZ[-iqS8ڻ`I^gC?WګUvn,c'!Sq3B??= s}kCx 9f;?wq}g]`\kn>Y{5׻bw^o̬{Ev|?itOwp'K?e_7!VN=ƕ?Ŗe?oŕ_MY~9оgwNs?WgOVgoz-}9:MiHV]#3}?Z_psa+Zhuqf䵎?ECvYo2G;#WF@/O]b]knq{]|V^o3r]/c:_vxN9z{.߅y"Ge}c-;:Zc;}WUFIoW}oFx~R􏱿I$I$I$I$I$I$I$I$I${$,  g;zBI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7Oo\o~_V$}1.}l6 z*I&sCZ yOڏIϧXm3z?aA*DoRQ{]K^Ulf OQSKuVZhDI$I$5~./L^0Jϱ_t}~U<-vi,?_g[쏻c^<ݟvlnێp@u̙syǢ_Q(.g~v̓e3:%'_n!hչcI$^?`S^7:bӰI$I$I$I$I$I$I$I$I$\y|ŏ!㡗CuHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy6ˍ׼$I$I$I$I$I$I$I$I$I$?j۱l·4b>:kJ_۳ ?_oqn?%_۳ ?_oqn?%_۳ ?_oqn?%_۳ ?_oqn?%_۳ ?_oqn?%_۳ ?_oqn?%_۳ ?_oqn?%~47o;;3>j~B#LN~\>+k2}vJI$I%HX:>wZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$on  g<{I$I$I$I$I$I$I$I$I$Kރk>C _vI$I$I$I$I$I$I$^CC/N^I$I.?n׼G>bӺפ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ctf|o ?kI$I$I$I$I$I$I$I$I$^?`S^7:bӰI$I$I$I$I$I$I%HX:>wZI$Iqwu??_ֽ!$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?ۧ7.7Cǿ/YO+^I$I$I$I$I$I$I$I$I$􏱿I$I$I$I$I$I$I.?n׼G>bӺפ$I$K;O7t2} $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/9?9q=yZI$I$I$I$I$I$I$I$I$?5Tפ}c-I$I$I$I$I$I$Iqwu??_ֽ!$I$\y|ŏ!㡗CuHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy6ˍ׼$I$I$I$I$I$I$I$I$I$?#ot;al$I$I$I$I$I$I$K;O7t2} $I${$,  g;zBI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7Oo\o~_V$I$I$I$I$I$I$I$I$I%AM5c/; a$I$I$I$I$I$I$\y|ŏ!㡗CuHI$I$7w_#1coe?kI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^s1ͺ3r7{ $I$I$I$I$I$I$I$I$I/z0kH@1[ $I$I$I$I$I$I${$,  g;zBI$I$^CC/N^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mA!ߗ@,xI$I$I$I$I$I$I$I$I$IxS_MzGv?NI$I$I$I$I$I$I$7w_#1coe?kI$I%HX:>wZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$on  g<{I$I$I$I$I$I$I$I$I$Kރk>C _vI$I$I$I$I$I$I$^CC/N^I$I.?n׼G>bӺפ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ctf|rv/gq 5s/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@ĿݟqWcv\K/q/78g@O}σ_[gM{v+H6ccSKyKZI$I$I$I$I$I$Iqwu??_ֽ!$I$\y|ŏ!㡗CuHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy6ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$7w_#1coe?kI$I%HX:>wZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$on $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iqwu??_ֽ!$I$\y|ŏ!㡗CuHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy6ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$7w_#1coe?kI$I%HX:>wZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$on $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iqwu??_ֽ!$I$\y|ŏ!㡗CuHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy6ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$7w_#1coe?kI$I%HX:>wZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$on $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iqwu??_ֽ!$I$\y|ŏ!㡗CuHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy6ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$7w_#1coe?kI$I%HX:>wZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$on $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iqwu??_ֽ!$I$\y|ŏ!㡗CuHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy6ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$7w_#1coe?kI$I%HX:>wZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$on $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iqwu??_ֽ!$I$\y|ŏ!㡗CuHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy6ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$7w_#1coe?kI$I%HX:>wZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$on $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iqwu??_ֽ!$I$\y|ŏ!㡗CuHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy6ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$7w_#1coe?kI$I%HX:>wZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$on $I$I$I$I$I$I$I$I$I$I$I$I$I$I%[?`vڅUbOu C eesk_m/W_G0?&K eesk_m/W_G0?&K eesk7/sd\GcJ΀oe?kI$I%H\]ʫ7bs^kLzl_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K eesk_m/W_G0?&K ՜ٻ.㍕`EZWI$I$I$I$^s1ͺ3rdI$I$I$I$I$I$I$I$I$I$I$I$I$\g~2}LFgN>^cG{4a&ɱw>AYi/hh韘W0[}_}~:G?G+[?W%دlK >_ؗA}b/b_ĿG+[?W.7jS̓_k};04>.$I$Yh=vی7!ӑ >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ĿG+[?W%دlK >_ؗA}b/b_ş%;- c_\lY/ϲٖ)m>g,wzmcU9>bMǣ=7Gsk>oh:_f#ܝI$I$I$Iy6ђI$I$I$I$I$I$I$I$I$I$I$I$I$n㟇n̸QH{x{Gwƾ9{Dۑ:=ܹrP#(33+^px7}bMvB />VI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ݻ/i5z} hqsn[nG+a$I$I$Iy6ђI$I$I$I$I$I$I$I$I$I$I$I$I%vﳽ8*fU֏^ܾ1Ѷjo89ϟ/]}gLn&8JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$W/ݧ 8D2OV/^'Oqޝ;MS[<-:QGއk`Ƒz<OOZI$I$I/9?9z2I$I$I$I$I$I$I$I$I$I$I$I$I*?ݙpo}kQxb"O|/u=w^|3dusy-$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$PZev5CW}~wJckn݊]/Qkj]~X)ˤy^|WNI$I$K7Oo^I$I$I$I$I$I$I$I$I$I$I$I$K?Ƈ[~}ݰiWIȹ'\_b>aV]hߩgGܮ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IV8}[a C7Clɣ7MmŮI$I$on $I$I$I$I$I$I$I$I$I$I$I$Ie}wk33pquotjo?8^E";=}3X} h·O|׹$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kg~îv\x8<|')st??n?}-tͣcXkrg?o .dž1޿Mwq~+xly*`8W-[ȳͧ!eQ=G^~3w{ ?|9[: #iPe;'cwz8rcivg;NξitW>ag}쵶9]˜DU~eʴ^'G]"Dop;z㏁~?/i*ep{K~ah߿<Ɨp{V_c! ">+I%CXd{?ǔ4|OyT67olc/S_|VڟlUEyTxivԻ?rK2sA` 3?~ڿk*N7}⻋w?cc03qv>Wc}VYc#ך>}oػL:K^_ιSI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$nGeF%7=@E~⇒l'Ā>#vi$I$K7Oo^I$I$I$I$I$I$I$I$I$I$I$I$oϛV/L 9vK#ɅPLGtX[xI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$efwpWr8_z586ue{?kYc?5oý6ic[H0z&~`hT}wZ4 8%:eӲO7t=>W?n׼G>bZG2c_i$ ڳ-.Q!L=;Dݳ vpjqx}ݛ^hV|_WڞvUQM;?ͯ0ܾqx}ݷqcT`c1k?69I@xgaOޚ\_HOH]e{-.S]ݮuxZO }]dv#j;!ߞmov.Q۱FC2o~KL} 32ͮEqo#>K9ϼvܺ8i7]t/{|}߷~wLJ[eoX⏲wv{5./gl~ς+3A>}'I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$V؞Ug?W {2UոԇH^ȒI$I$ctf|$I$I$I$I$I$I$I$I$I$I$I$KȿނWcw9GW_^=-pkGJ_mrGa ?᮫ҳ(?⣿,8ewLL{[s= ]{ycvrGq{~qkw7SivdY{kxh*'q#-ss!ƶOe#$կ魿&»oF~՛%?W}'غ_ȏvϳ#y?>+̿lu;xTxWc={H8VGg+-?-Mq ?/o9w\PoL$6y]c=cYggYNUgNA] MAaʿ=_}Yw,kJqZ\_{/Ī[CMJ2I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$FGGc_-wi^I$I$ctf|$I$I$I$I$I$I$I$I$I$I$I$Kރk>C _vI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ngVYh͞ZQ[[ؚ^eܩ}1O? o'nM}pl {E]'rW+uUa+W72-~wX?Ħo ,'*kćg_ٿհ5 3+5;?ic}}u4f*7^SCfYc0|uݷtbvWUg{/fWnƮmM~%}%_K+l+j\\q~z-bUPᮦ5/eapnC˳w/1ǏcG:ϵ}f6O=AutX0_XsR<ע_e~EgƟV? ڻefxڜLlF>Mbl~?/Oadz  =㣰v^ذ.H+GkRغdY׊uI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/mWSŕٛ4p-a{I$I$mA$I$I$I$I$I$I$I$I$I$I$I$I/%zbv\s?+߾a5 s$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/Y9[EHs r]+5xǮv Ggև'_p8>ѻh zm}}ܲ+O^?o88_ǻeWSW<V=?iSxet;O'?ヅ{+e>^﴿g-~&&y7Q!umk;5dNϥk\|51hڞ\yx'/8}Ϲ3ĥWp׳./MߜyƗp{Vo5_:>wb?q7@]"KaUMX5Mf{g?žG=aOXk?m +s[11n{sol>cI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Pڨ]u9@W{xV9H$I$Iy6ђI$I$I$I$I$I$I$I$I$I$I$I$91m6]l. +Aﳝ;o^Ɓ^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c_g~sпZ?f5~ghV]"`Z|?gdKſ3U{)[O~a7w_#1M ~Wl`kX/Pc[[ֈkDqwu?ppwv9X[sx굥i ?e?ioݪn>zn"[SŕK\ 5;nd$[we{.?]w#?jƫO|CN]'7fh IxڪNg뮊:}L^e=_?_ ޾濳~+k_C\7'gg}#I8/pI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\ m84@`8UHNxgBԒI$I%?ۧ7/FI$I$I$I$I$I$I$I$I$I$I$I$T;˱w*d]KKKF׋'f7UM]\LL0$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IxzuW]yenkl[魵0RY^}^>`lzV]7ݱ^Yhc3 ?ůjc01t:4o޲{v^ISzѾ%b%ڲŹOͫGd?tScvs[wxLocl3o؜nՈ\.h m%Zcvs[; _h!ϴhUm}3cad>oӽAZZ, _!y//{g>ۊCޣ9 y](eYPqįPڳ(u_2OˉC ?fĻ;|\.^ټGQ~nEc8.ɶ?\NuOuVLj!o+7nw=/'ӟAkKm [ęݕz~~1)-;siGG_DI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%pv0ߑw]o bpS,}w}?p֤I$I/9?9z2I$I$I$I$I$I$I$I$I$I$I$I$K?l;ڞ ܚKZe1%?g;*D7!ӑI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%Kvߑ~.%u]h<;*I$gؕ;,q`$I$I$I$I$J;_mgp~{q*}W3此kZhFSlnֈM$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I|߲o;6v*bP:{t<[.I®鴷ݑl̎[NS+*{x MOsx&ə{u^ڻ_nf5#k|Nq$I$I$Iy6ђI$I$I$I$I$I$I$I$I$I$I$I$I$If8a%˓.wou}p3%O3bJn1~}>m!'5dLl\a31~zsuw4vKi.K'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!ֽ$I$^?kK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpjpqTQϏ{Y}";{YU>NW1f_'p2~5AtI|}JY!fv/Up@"{kswr[i$I$I$I$ctf|$I$I$I$I$I$I$I$I$I$I$I$I$I$I$߰h׭q*/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _-IyMWڏkn=tegyYZŻZ,)_@?K}<beاji/)_@?K}<beاji/)_@?K}<beاji/)_@?K}<beاji/)_@?K}<beاji/)_@?K}<>,ߋڱ1geT10I$I$I$I$I/9?9z2I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$r;*? m$I$I$I$I$I$I$I$I$I$I$^s1ͺ3rdI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?A~9?wdTxI$I$I$I$I$I$I$I$I$I$I$ctf|$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kނ˱r/C@-I$I$I$I$I$I$I$I$I$I$Iy6ђI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^u8~wUvv˅$^~riU7o+5i$_s?_qixiO??$_s?_qixiO??$_s?_qixiO??$_s?_qixiO??$_s?_qixiO??$_s?_qixiO??$_s?_qixiO??$_s?_qixiO??$_s?_qixjpu3{g߯Ԟ_G8׺ {bٶ,Ʀ4+$I$I$I$I$I$I$I$I$I$I$I$I$Kނ˱r/C@-I$I$I$IS9߽;;1ى^'Gڏ,K?_4}*`RMj?ʘԳ%Gڏ,K?_4}*`RMj?ʘԳ%Gڏ,K?_4}*`RMj?ʘԳ%Gڏ,K?_4}*`RMj?ʘԳ%Gڏ,K?_4}*`RMj?ʘԳ%Gڏ,K?_4}*`RMj?ʘԳ%Gڏ,K?_4}*`R_k+ffU,ǢJx]g| $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/z0kH@1[ $I$I$I$I$I$I$I$I/z0kH@1[ $I$I$I$I$I$I$I$I$I$I$I$I$Kނ˱r/C@-I$I$I$Ic|_7y7W/`I$I$I$I$I$I$\y|?c?ۏ I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?5Tפ}c-I$I$I$I$I$I$I$I$?5Tפ}c-I$I$I$I$I$I$I$I$I$I$I$I$I%?A~9?wdTxI$I$SofUgF_ۿ++S>ϻ6nz^1#:>}jϳ!qz{{$?/wN?{I$I$I$I$I$I%H^C7̳@I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IxS_MzGv?NI$I$X_i>U>ޔWowv\nUnsai(c*ϱh9܀\Qyݻ/:DdwM3c`~]K?܏n,sneqۇ;~_gKY+cc89BK/wQ3?ԝaV; pƾn5[W\csaN1UZckMsl>5;9XrK@y#aٻGڻM]L&?^r;;Qk^Z.<=8gM_=?nKs5>20;}*wfG;o󲱸G]/cmٌhai/z0kH@1[ $I$I$I$I$I$I$I$I$I$I$I$I$Kނ˱r/C@-I%⳰vY1Y{@cl?ެ݋W3;Wlؙ?tcH삽w =>y5kbw,*-Qh=UXl?W;+|I$I$I$I$I$I$7w_#1y29$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%AM5c/; a$I$T{ Q^mCxs|<+ٞ{` t ˽V]R־Ìr/f1ȴYyk?X=콙gxwS_A?iߒ, '</9;E]͵?j?d,s?Lu7ZU^9l[M{ow{,{Km'^KѺ;E/ TTjg1 ~i??}0KWk {C;\\){g|)0̩wu 謼1nȴtyW{*?s7>V~^?`S[:>wZ?ۂ{-o}8o/;.#U3?5Tפ}c-I$I$I$I$I$I$I$I$I$I$I$I$I%?A~9?wdTxI$eh^yz㛰<3,+wvfv21/~=0~-/m{cr(w'2;pʿuvU{\^n, ŵא֓^9#~f0]vtnT/YI$?/wN?{?e5-9"/ }X+}W>_{>Km$Iq]/Z_kHcOI$I$I$Iqwu?3,n?/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^?`S^7:bӰw~ۉuYmǶ810erc}4уG+hgC*/ Lo71#\_W3?}@_^U>?ox߃rMLkा]I'>+$\5^s g~UWi_}_RO;סM l-+k+7  8?7>V~^?`SC]/ٜv[ϪfH]Wpd]>iC׹Ǒ}쫾s3={Qv ރk>C _vI$I$I$I$I$I$I$I$I$I$I$I$I$r;*? m$Cqf5 ^&O?3pW8G~Ļؿ}F0]Ym#}c/!;FzU|E׾C vW ̎W$Kt;eyϟRQzq̧de=n^][[\iKܿv>0q+v3pnm9>Dc؏|9XãZ}648|IrojX?^+30pն=I$I$I$Iqwu?3,n?/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^?`S^7:bӰ޻WoD%OnLV<7a-L\ʽ<+kAq]U}$ۈ/j@%3QiYPg9_j;wڎm} ? ;Wl5R(M K?ށjop{GTg4 Gx_L*] a\ʜ{_ N߷8f+,߂!Gp`?ynKk6`;5+9[EO6IA17#8_Kş|5uf[.roIv;%wFރkcCC/N^Kރk>C _vI$I$I$I$I$I$I$I$I$I$I$I$I$r;*? m$@ΤR>arKce_x/O/ºgvZݘ.-c3Xm}3B<k5%_,omk\pqY>6L;}ݾ1uu6_O7iȯ2:k+I$?/wN?{n{YM >J0p??~cc7=P:bH31%Ow~_5}>ﵽّ#G^oЉ$2~ G9\JC` 2O] a_; QGv}o?ٺڨZ[9X}+W1CPr1(u>,?erEwlgy7l5ί4\y|?c?ۏ I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?5Tפ}c-I$I%_&n׎MR߶_fnSy ׏C 7'wfVc83s`urF&qOs|GE??nc7՞eaig~d~ ̖:vu%o"_sV~^?`S[:>wZ^?`S^7:bӰI$I$I$I$I$I$I$I$I$I$I$I$I$c^#9ݓQ[i$I$i;etx4{ fbvg 24nu~Ov2A D?~}G||r/kf]i}X)p{~?/\I$?/wN?{q;'jw T7>kw2>wFc݌^Kj?gEyw=B4GׯIxݿv>%4}_[uW?ŏi?i6ќ}X-epTgOoůZj?owzqv ]}gՋs/mGhhsH=t⋸~b~;DK/ݿƁ]ۅۨk0 ;` عXUYQ=[=1,{.bce{փfpU${$/!fY _G$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?#ot;al$I$JpXKK뙀ȹ.8,'D}齽ds2]+y$_|=ٻjor",u?دgk}Y٩-A} ׇH`&V6oOYvvYu/{~h]=٩5:ALlW39! mtՍEthcG/z0kH@1[ $I$I$I$I$I$I$I$I$I$I$I$I$Kނ˱r/C@-I$Gw}' 7^' \O߱?f{}޻p[vG3vI6<t$_pk鱎~kI$?/wN?{<ơ\]U9ܚ#ew6_pu?fqvs_U]52[ Z@)$~ٷ9e{pCSsk[^=2ƏbCd0R.]w޸87OW3jׅKM5`;O4rw; X&`/[]3gj-u0IhZyr^~&jo/;soi6[h>A$ Ӓt\y|?c?ۏ I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?5Tפ}c-I$I$I$I$I$I$I$I$?5Tפ}c-I$I$I$I$I$I$I$I$I$I$I$I$I%?A~9?wdTxI$Gߪ=̬kŘD>dx+] d:+/.ko\kklx/J~]t.ѐ[J GI$Xl?W;+|׭j}<2'9܀^a`^!mT>leGdx7? ?/eơkZ6gmwi5/j?MIC:WP?/r_m?ƾof1c"wɇko r+S~GׯIy/?;/]h#rw; X&ヅ{*[?]_>.{Cwmk4 vّ9(ifq/RI%H^C7̳@I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IxS_MYom] \f654k@׽_S?Ŀh/Tq/>3_\K&LWWS?Ŀh/Tq/>3_\K&LWWS?Ŀh/Tq/>3_\K&LWWS?Ŀh/Tq/>3_\K&LWWS?Ŀh/Tq/>3_\K&LWWS?Ŀh/Tq/>3_\K&LWWS?Ŀh/Tq/>3_\K&LWWS?Ŀh/Tq/>3_\K&LWWS?Ŀh/TqpKk_'"|}c-I$I$I$I$I$I$I$I$I$I$I$I$I%?A~9?wdTxI$[LjsO"fƮ==}׋d}?w?Pw_+;V,WA۞$-[Uc Ex{P&ohnk>W:kk$Kt;eyϟRQzs}<\{cwz.{#_W39! mtU^=5Sx+h?b~߽vېy9ퟏ 11ǬUMM cT7߾ǚI%e#vEǻsho /9܏Ī`e]kc~'>칃+-w#(Yawrc-?g_eNuy]U<vG60#O sTYCWO]yPZ]vэ`׍_8s$^~$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,s &lߘ?0 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_40 !_5UTTʪ`kZt i$I$I$I$I$I$I$I$I$I$I$I$I$Kނ˱r/C@-ITgc>,fN0vw8CxO/[{>_pǬz^qP.'q;L+a>\߲]&d.Xѳ a`799+???:.%y_f;i|_Q%>Wp$C vW+U$I$I$I$I$I$I.?n׼G>berI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$r;*? m$Iy;izO'qYaiٖQ#7; po؇7fh ?Ɵ}/g^1?_$e@2^ooԯT^K?lw;nE]}ob95bbW@I$I$I$K]߲2}T9 q:GAYeaƾъ+:lH^C7̳@I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^C]z؏vOGmI QvUখS?}۽Xޟޏ7[?]_a۟'>q<./`;7pw7rKgGCck׿y7NTF_}OOQ;$Xl?W;+|\Gu2}Ӹ%*7>V~Iso>һvUWgG̸/S3wɹ:f\_FI$I$I$״eXj/5%;'otE3PdΗY7w_#1y29$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy_v?Ob??I!S^N=&ZX1j}}3g}َ`#!k'h QyĬ?̬߱t8ݛ/<xWt=JKt;eyϟRQ{S߱>[O&i.sWa˧ ?wowwls?k3?_7>V~U~/k3)7q?a2wk~wJ]oR?~DLHh`&mQg:22 ]sp0Vf%W[?5$4I06:0YψrC3$NEvρ S{*Ȯp%%Gc;ܰ+fd1 6 ?{$/!fY _G$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/!z .XGs'I$lC. 畑~.Y ~b݊?=jWmtÚA'r?YcRoRƃ %3;3jqi{1{rI$C vW+UcKxZݒz/8wWh1ܲ-okг?_G~E7>V~^qݜ[lo,S>~KјƱ kD:/>o^I%㳱vgk~&e[6=Dp~1̭ϰ]?gq)*,8v~qq95} ֗w͍Ϫdw/QsN3^Cj<'6l~g.bܻ;][1/^w{ߙx-s,>%"~puvN{q¨s2?X}}xM63`] k~kGΏ;5~}òqKǟc溯/S~ю{*<'6r๟Kgo]; Mvwϲ671ųY}~cwKO[\߄Yzwl15c2w7w_#1y29$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy_v?Ob??I$caj?"yvs>oqGD%a]Oh,fGU#[e]o7Z/??bJϴNaO ^I,_+>JE_:m6-q?pgCxX8l{{*{ilAkFb]?]?j;y5wZa~+^?`S]}&/q+z'e=2=}B˞/c;}VETq*ށjMlj-vcM ~Wl{$/!fY _G$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/!z .XGs'I$I%_Yds;?ܪaeg<<~k.˻SrC+~W'/>ua/s4Wl\I:I$C vW+U$;/{I/o^I%AM5vov_[G~vcM ~WK+W_e~E?.o~sп[o88_ǻd7w_#1y29$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy_v?Ob??I!e1n#D1ߑyWevY_nصUG/;pea졣S-?ݰom~%9mU?їG'"췈W!?wZg>ljm"*'z,.{Oz;?sKkPFϲXgߺgYSXX.σU/_{gwkc;"kiV9cNnqE[ ׳w{LA<>GdH;[]Xm9VMew_q{rȇ5dqO-Oe1>;nm6⩒gMY_vm:Z*vDY?4rƜKoO/]N&.5xk0@$C vW+U$I$I$I$I$I$I.?n׼G>berI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$r;*? m$A#O.'@Ɵڼn Y +?[̮Z`ʼ8""O=??l{p8UVglL;3i O{8w5^'`>?zI$C vW+U$I$I$I$I$I$I.?n׼G>berI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$r;*? m$A;|sq8.h[x]->+7۾l̼!:EvyީƮx{;ןqV?m_ngk8}O]39?'GHgM<q}/Oُaw.>/P^I,_+>JE $I$I$I$I$I$K;Oogq}I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.{7F?kOWjϊYX~-]Ȱ|W]w?fj32M`P\+eioq}{?k]$=sO'T;'d]1̭^l庺Yi?}o~^c(8ms̮k'}d l22)5d٭~d_O3\/[gx}np$Xl?W;+ۏ|ߥ'akK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkK'!֗NCc_/?ƿZ_8ִpiD?5ZkkXkƧ$=z>zQ\d3,n?/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%˴YwG8^A~w.{vk_z-th!?wbvӍE-]G̯n]ca=m I$oNm>OrFųK?xNkZƆCF]۸^śUAo '~>K_pSرr{#1%RR湶Vߌã $wGR[Utxg/eI$XS5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WIO`_S5/ x _%>WKwšpSCZ=$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J|ݟ3*} }> m&O:npXǓ:I$Jdw ne57'$]c9BSSj[y5DI$I$I$I$I$I$I$I$on $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I|6OW\W-WԯD]gr{6o+i$I$I$I$I$I$I$I$I$I$I$mA$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/.}+)turc@;[kE$I$I$I$I$I$I$I$I$I$I$^s1ͺ3r_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_irw ;qlgqigN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o /yUIKw8w_igN7]<q$wӍW%;o bwr}c\p~ endstream endobj 232 0 obj 224497 endobj 231 0 obj << /Type /XObject /Subtype /Image /Name /Im60 /Width 1890 /Height 1976 /BitsPerComponent 8 /ColorSpace /DeviceGray /Decode [ 0 1 ] /Filter /DCTDecode /Length 224497 >> stream JFIFC     "#()%$%%!'+,,-/4443.4444444444   [!1AQa"q2B#R3br$4CS%DT5cs& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjz b?I$I$I$I$I$I$I$I$I$I$I$I%Gܲġab`xr^LJ.&ጞOp3I|*}emXd+s}ki-2>`cKd4$RŶ[12w,iIa8̪ 2ٛn'P~$iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_٬l߽vn-;.>cId}K7v/ɷo!:=?M_2>simƿ`qzNx88I g7v[+cK8by$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy_o5zI$I$I$I$I$I$I$I$I$I$I$I$28le{mhMŠ<,g}g 7{98~I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy_o5zI$I$I$I$I$I$I$I$I$I$I$qv'eg;㛋]2$Wa'z}r>;[vFmGd{y\-I$I$I$I$I$I$I$I$I$I$I%[;:߿=k`s.8]My{x9x /tdVktG\$#I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$jDI$I$I$I$I$I$I$I$I$I$@Yy/[cxZ%pw~69V:9W-tn|N^I$I$I$I$I$I$I$.E6s;<4I$I$I$I%?;wb>;MKx>!$c^dI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^W<_^I$I$I$I$I$I$I$I$I$I$Ky`{xO.1- WkbS] /CUI$I$I$Yǿ.p?ba[sHUOeCau%̾C.$ٗ{o2!Ymf_d?!W'od(Jse./*<GfXuškڤK;6}4 ^1&GV'|5Ozsko}xyqugqBǦˮU[K %|xu3c˻;2=pFׁip~toRW$I$I$I$K˿fcmW};>'z?I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^W<_^I$I$I$I$I$I$I$I$I$I$K˾ܚ-kV۝5QۀF=I$I$I$Jsݣz7ҞT8߲vxݛvߍ5QD^~=oǻoUwʼn[o _7cݷ*Vw`]vkô0 -u6;(R=kZr~^}ceXڪ{̒UMwScmƇ12" 샰?λ )G##W:^fk&5Uk>w|/ {imI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^W<_^I$I$I$I$I$I$I$I$I$I$Kʿ_o}}Ӈ^~KRI$I$I$I$^Goayz{Z ÿ^^v}NdxxN-/wI%- /Nw9/+gmYꭾ1c%<\ eجa੔K.po i/0>w.eXm VG>﷟'S׀C0p8 }F'ؽae}xi>gv 2GskA_`~wosdX3F)~Ï7L\?A$I$I$I$ՑM[mƖ0Bnϰ }sjϵ~Y$QI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy_o5zI$I$I$I$I$I$I$I$I$I$I/*y9TU$I$I$I$\vw r12{:\x\?]3b/+k}ݾTw^KF^NʜLq}ZS%y#?/>3COc.k}`|qQ9x /tdVktG\$.clwj??"[ ׌]KC/ޟXWϥzq,oi!ޭfS? gS'o{3hk3+xE.-۸}|5Hgŗi/uݳ|j ᖴGէD+[w.cic}BO8s^~;Wį;n=mk,?_:zO94?-} ްӾ{yd/_]vzsƪ8.0$I$I$I$7?o-TLky 4~U$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%mϙ%x$I$I$I$I$I$I$I$I$I$I$fJuRTI$I$I$Iwre8 gc]LV9jV=6]w_UU[Kh]}:j6CA!*nUclhs-3#D4I$I$I$_[תI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$y?Q$I$I$I$I$I$I$I$I$I$I$~oV{gr>.g*O$I$I$I$I/?jeؽëlz_vor'GtN% k\&NNc󏶟`~w?Xi{gs~F+bS: tR'N(݆v+^Cr1<4 ˒ĕNE3O -|5\c>{JaMVN}mswqud "BSEη浿QON]yCf&;kooܝisO :L"yxnCq7|lz'^]M8q~F\O@5ːSI$I$I$IyWϿ;'{oCrܼWI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$y?Q$I$I$I$I$I$I$I$I$I$I$CnCG$I$I$I$K٬f?g AZԝ\W)n?7~K_X?ao }=$_.;V_o+b-А\8M?ǧ>sca:sL:ϑ[SI$I$I$Ie}fr⭯Ʋo= ^b}g8q;3չ`y a;n^]=JvnGҽE% Xeh\/$}'ي>Æ|T)w5}f{3IkIO3g]ؘde#VH7f@"d0{p?j]f{wxw~Kt~_ga{r?mp2ʓI$I$I$^s=2rSzvew1Sx v WkbS] /CUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$>gW$I$I$I$I$I$I$I$I$I$I$Wڿ>w>[euH|{Vo_3+w`g]t$I$I$I$Wj9ٻNMXί&˜5Q=S U$\;]'Xe1Yk7w.% mSliiqi߁~[]$=I;?5V$$6NX~e>5#wW#ٿ߳V^f}4wD.:׻j?wm :~̭I$I$I$\'> ]ߍZf>vd:+I$I$I$I$I$I$I$I$I$I$I$I$;?o /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab5s7}}÷C*G8`:.#^2r>+f+.&$I$I$I$I$I$y?Q$I$I$I$I$I$I$I$I$I$I$^Uqw_}{U}&:/ENsKK'tI$I$I$I$I$I$I$I$I$I$I$IpyoZI$I$I$Xl;տg~ZVz-1#I?HESۏ_kx38em,ikǜr<2?^G*?ƧtOտs5 v7Ԑ8W{ev_?ӑE$<9]oT.ѷW]Ci?{ӿLzI$Ioj;3 uD\7?ln 7:?xkԝ堽)$IcS>Su5M6i-'~ka$q}߂_m{\=l{I$1>ذN'2}%lwϴ=v\2î|̎zl>ƒI$Ywg_mnsk$/wWݨd:m!UG\R8fywI$I$I$I$;?ϰ=POtոI$I$I$I$I$y?Q$I$I$I$I$I$I$I$I$I$I$Y_j{?Oݪ̪CQbaaq_vfGخYSY^)aHl+`HrI$I$I$I$I$I$I$I$I$I$IBǦˮU[K %y7O &V7>v{uV}w<?ĒI$I$I$I$I$I$I$I$I$I$I$I%=kI$I$I$I%`}9ؕ\aYX'g ߰澔9Vv<݋mc:%%ix̿?Sr>7/9p8#7VӪNn>&]w݃g?s^Iy}}\ܰ=!ŷ#I%r>7/9p8SP.Z5ύ| _oc^yeck<.oEug{]:h1-|No1R^;{Go8k{)UQ"5z.oڏ=]Ki!c9KZc^,)ϭuN.#H^K:kW5}z3dGC}V(_MYMնڬik!/yT'UV뻷Lݞ[{Ywp\bND5zx?l{ ;+WӺb"z-G}?ፅ-k8ITٗ{o2!Ym7?e>ifSXdKW;Gf9=ûaakew?aĘ==d=K}]_K_9/dXxx ot8ۨp!#gyov~v򛕎\[$A;5I$I$I.vױ?-O[a{q$I$I$I$I$Iy_o5zI$I$I$I$I$I$I$I$I$I$I$'\c.n#a#q<6Z}Go_\!Ek1^ڤI$I$I$I$I$I$I$I$I$I$gO7[_bfE^Ox`F ơ5ޟUI$I$I$I$I$I$I$I$I$I$I$I%=kI$I$I$I%enwr3s"_h,xjw}M.Ikk1qV22ZAEy/~~w8n.8{yG]Oqtʻ~UTb_ccso}Ew#+^_eoя< -3K'gלmiy?V}wǶYf`//X^e--hX_X!Xs>Q˖Ы?fev{lwWmic52r>zݯYLgr[K<%bN%2ʓf{E:~Zט=I޲ݛ;]:>Jp{o;c^*o_ wۻ":s* Ȭ<f߲v/C`5f{z1F6n}^3C]{qkGK?7?d;Om+]ڛ[ey_Dh=w`0m}:\$~j? !XmJRad? W ݷvM8t]YX`'I$I$I.vױ?-O[a{q$I$I$I$I$Iy_o5zI$I$I$I$I$I$I$I$I$I$I$KwݰcokOKaL@`.aM۾8Tl4et8|ۮ^I$I$I$I$I$I$I$I$I$I fbvgWC#˜ιCdw9gm}#gc {֯C3{vWK6IwW8'I$I$I$I$I$I$I$I$I$I$I$I$g{R$I$I$I(^mik_o k`+]ŗ}dw6|G[^Igm8mͫQּ Ȏ7:5Mf浖63{}kۊvC}I1#Wu? N\7?$۱ސ.jƭůƑA<|W/ c}Y[#}m`e5fMd%q.?2鉇iϱ1N+ҿٗ{own;p{Z`t9w^ׇHsj˦DK˿ٻqgō{klr Y KOg/6nM}G/:{?B48_p$ 8 Z)^{1ޑc1ml8Ich!{auUM}kwqm` J5x[$sGfdG V; 5Fpl)N[?1ͻ1qdW=Ack>[>7Mz:RCL/{^7_D_Ab5sf-Njpǣ"lEMoK4wFu'e4;K-eLkSd/s1F&K8ȭXَ&A^;wX;~-niv6KDwޡ-Hp{o;c^*o_ I$I$I$K{K_}n':jI$I$I$I$I$^W<_^I$I$I$I$I$I$I$I$I$I$I$Ku ?{eee꯮#b&W}v߶;6L[Ȟ-Ͽizfa7/חC:;v$I$I$I$I$I$I$I$I$I.G;F~Cr;[¨q~9NR/mf&_7 Yiy# 꽯`F ơ5ޟUI$I$I$I$I$I$I$I$I$I$I$I$\?c[ֻI$I$I$^;WoCٰ{[[ 2r݇(oQ64F#z>W}%?->_dzޏx=3:o+ضWO~/[g. DBS/i}?#;cnj1Xc1yk5?{?=?zmw ':=~?Wrk<#ŵ~=};s{0m7{O|r [;/;cf_UőX|5}^48hwvzG~K)>ګS<<.DD8vׇIsĦ_̆6JVE6SumZ?s=,NxnI{C:mG~~dWEC: /)-8,n8Ν_|N2kGcvȢk]U ~^ܾ}ۓ] [PK O ľ}m,.~wlϹݻc j[8Z]}}orm|3Y5=b}}]>M?fx*l}So LgRI$I$I%=ks/r>75n$I$I$I$I$I/+m|/ƯTI$I$I$I$I$I$I$I$I$I$I$I$/lmV4xy7v̾Knwb;ulj淒oۿe2_DZpw2_;zkYJ/ʜ᜾A`OI:ڨ/?m;uWb/}3s]lc>ϳdic#5Gst+I$I$I$I$I$I$I$I$I$I$I$I$I$\?c[ֻI$I$I$^uMqs]qNc#khYcq}+3^7>s>@S@i ࿺Y}`}Gӧ.fJuRT/lmV4xygvʻKomQ8~Ğ|?_CPܿt7Y~w:Csxw[xny/\Xn{i{hWڰ1C :f#ህG1o w럳,ޑs#>K?/tw#e[]Pd~hL\鮚kmUV1@^u5_ Ƈ5;n"BC` Y9>bc5\2)-iz !XmJWZjjUmke2 ד]5erj{+ ik=B/mvw/Q|kGӢgKjw? ފN/\nA$Xt⇵~řS%wnO6۸qt:ΞH @7!{Kc{ͺ痛mmx,ApgB5{7g} Jf"O3_W[Hug:71j Bl~ۛc144Ta7淏0xIle>߷ &^;+k,ot =\jպ) Z8?|y/k]>\˻eٝsr"qSyLٿG2߅g}jj\ߺKI$I$I$\?c[ַ>#Cq?VI$I$I$I$I$jDI$I$I$I$I$I$I$I$I$I$I$I$\sav,fzsw~> )7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|/'_h}e]/РK,?i7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./!'.<F{7ٿcb=^u27֗w5NWqzQ\ۨN+l^\9ǭw!OWL{^+?{=/?}\ؽ_?KGT#3/ qecc oq +6Yֆ~ڛ~aw]^Eoc?s|Ϸ72|Wmѹ؜T3 7ZC?ٟ[g+/ S5{IgW$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kʿ}/DRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%=kI$I$I$@ܲ>wO{xq<ׂ}ieՆ !sg<{gmu VRq,LG-x/KKMzi5oPgc-g)?<4cZ@"<NOa}?`>,]tW[[ l`iP>b!hlֱcݷ+[~nOp$p|}N~K緌tVs,^1}v~˕N [ 0?^#{gi;YNnM|R zH}Ifqou;0)%_C 4 @r??y?c>`gf[HUď~OOϷ|-1طȯԻ *ȗ-UyHgdV1/XT{pøz~񭿂cįy> Ծ^ qH8&Cr\ClƎׯ[h~]gpIUμ_uOa`w{>ښlxOiq?/'{7=?zy<yg 't_=vf*ܮk?6hiis}{QfWuO p5}GS}w%)ޮTAd|v] Y}}õU4\KA0!W̝l= X:>9qЍN^-7oi>묾<0 qOn}!Ox,iȹսظ~/9f{o~N}n}!/ǎa I|AaJujrc=8[Uƣ8\֧+*f9wm6KyFj;wלgbU+Ķ||6L^]vV~e=k,7-s?Ȼ?Fbq>vlgN@`qo}l){zML O.-$yI$I$I.vױ?-O[a{q$I$I$I$I$Iy_o5zI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$PbK޽U$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\?c[ֻI$I$I$IUfuuuXzunw GA$Jv V]6P`=aa} ~ӔnNi̇}Ӫ31F&K8ȭXَ&A\w؟e>w^M7 Ϝ\'؎W쏴_-wZ@g!wt$_b;O`˻.}}>Zt$~ngN{qWxy_d1;N_p;wΏgdG{Z}?.BhKZxO^?SYv]LVcpGPF}6{n'a?\9ח^WVE6SumZ z֏OP؝ϏOI(Xm⯁-.$8DZIB[[i#D4×3榒JKJֵN]:t954I$I$IpyoZ  M[$I$I$I$I$Kǟ3KI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_>_V$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Qq>,ՖFG ;/?wϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVק`c,|LfpQ[j<-hI$I$I$I$I$y?Q$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^U(?1%Uo^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kǟ3KI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_>_V$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$y?Q$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^U(?1%Uo^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$sf 7d_GǞ F[s-^s[%eS(h|agrczwTV$O^z?ϵ˸wnɋn5opo)[}f9bI#@^93Gey}S[fccan9waKF^]3b%/ؽ]սѷ5zF+?ŗ۬z~~/ rLa>{9Wmx3Ueg&H+?%m[ve-4E@vW1#DA/CIy?Y?e=*mn܎(oӄ+Z+f=P!-'?ؽ Ļ0gK%#?/G_.?z?waTmyPa\Ďq< %7m7pi kM}:f1簁-?~w]8yw;Ȯ&˜O$i_!;goů+?=DѲHZ+f=P!-'?ؽ Ļ0gK%#?/G_.?z?({nk\ C4WO۷P?g'#О%[iGS;]f/ue`l5uH:,qMaRdޅƗ.'`tzKcSUy+}0~s3MP|f0,Ƿ6ĊُT3KI%%#?/G_.?z?waKF^]3b/QVߴopsSu }COS /9-bƯ'?"W\4}:2{~jiۛ^5v'A}^=:cْ\Wv߰ܜܷ=@-ηR&Ww.rhlzx4N3Oؽ Ļ0gK%#?/G_.?z?waU6vvn20r&XfW$_?h*~}zt㇆~+̾|zؘ?q*AsxUMwScmƇ12" ]ayno}*ɏZs^޿g< ʃ A_Ə۶xﮆnu%2ûOUcbSt ( q[ԒiSӆWמMIqn*ǧCH>?TwaKF^]3b%/ؽ ;;?peiܬ+m`YLi-u;}I/+m|/ƯTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_[תI$I$I$I$I$I$I$I$I$I$I$I$I$I$K;&}tϤ5b_{%|e}-wu.< C܋m85`yN2%]ee6z2K?gَon5zw3`sOP;^~鉛21GZ! t<%1޻'闕feu9 Up_?ckI$I} >w_rv'ߝHA~IoO_ /?d;9MsO @: \Nyz]'Vbz5A719wws}~nvKϳկ'-☨R cI$cbwL|+1=whX;sI|4~}?j{mV;2[[I6 KV~v;a]^O,i}7,mW}]7Zgag]eCĶgF\,%$I/wb~vnz8tk1M.6i(^Ԓ}}_loU8ZA̬4#|'QlʪT;|N)/z/tq`3ֹw?)TI$#v{حL}p?/_;ϲ}%uYgXرgj?ǜ?f;{YqL]wJ ,2 [he ׸xIx?cɫ "X">29f;ڞNٌ}YlNt~=6IptE0W۪nI}OkXx|Oޗ˩$I-f;ڞNٌ}YlNt~=6Xl~vǸcjc)l?rG3W5ݲs@^ٟ#zRjDI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IyWUzI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$#CrӗK7LӋ)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kގno4??nxk߸QC2ow uz7ټ {WׁqkĢr%϶jDI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IyWUzI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$#CrӗK7LӋ)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JVE6SumZ,&޽=}WE;1}( *AQ/zU'gx%ů, ==ӈvkϤ9e]"UI$I$I$I$I$I$I$I$I$I$I$I$I$I%9hN:]ٿgXI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$>gW$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/*e?}~3W9]Nya߀E|]?X`+wOe麞U{8X>0aO}Us{^rwY$nC/Oj)U.c8X>0%Z_f?gL'ů_L90r_[I$I$I$I$I$I$I$I$I$I$I$I$I$I$l kee,?k}=-aW>׎|.k/7lcƏ i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IU=˷vE]``'J.0{otm%ͬqG8hו>gW$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(_MYMնڬik!/~ڌ#SŎdIc+I%:4w]"\$I$I$I$I$I$I$I$I$I$I$I$I$I$I$=w[2XۻonTp0èOi$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IxG= P%oO͇u.Umnc`DO<[俎,{ltGX%pmϙ%x$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/._b*};m'V.ˆK7~f]sj֖_鱥8p#v:Khsi_hs*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K?Pʗؿa{髇m|/ƯTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IBjȦncK^lj!|ݿdfvq,w%NLA\'A}ok쿿,p -gۏ#޸cI$I$I$I$I$I$I$I$I$I$I$I$I$I$Irlٯz=Qs]އZf~ۭ)~?Un4RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$G W/~#Cq?W<_^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KʿO_8Wlӄm}'w^'ݿk>a ,M=H__QMXM5hkr)I$I$I$I$I$I$I$I$I$I$I$I$I$I$K񏗑{۪?6p74+rhbݍa5Ky@I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$6{j/_}n':jǟ3KI$I$I$I$I$I$I$I$I%ÿ_ow^fѷ?Q__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1raB")[gU-{y=ܾ"u?`]N>Ƽ>/M-o؎憗7:&FrS贏{=^'q6,5~=?J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 mƞ,wnһ$kz]rI$I$I$I$I$I$I$Kc+~}Yvd鶷}Ա ߱wo~/mcH+n I.eoI/5_S&{٬zy68,"nq(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]Մ~4nc{U,nEꭿI$I$I$I$I$I$I$I%mK_=POt>gW$I$I$I$I$I$I$I$I$K{KpI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$AQ/zTI$I$I$I$I$I$I$I$I%_>_V$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KxK;}6'. .$I$I$I$I$I$I$I$I|w}_=yR/r>75pmϙ%x$I$I$I$I$I$I$I$I$g{R$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$PbK޽U$I$I$I$I$I$I$I$I$IyWUzI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ɵ?$pI$I$I$I$I$I$I$I$?迳9vYq]lĹk8f>1Wvݝ84;#&p[z_c}}xLJ(yg"X /wO{xq<SfvoYz,5?ZykJ^k7>{~_nɑwo .##~Ql^m3]ṵYkXxkekro0ȑ< I$I$I$I$I$I$I$;?$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_>_V$I$I$I$I$I$I$I/Ƨ﴿j3nwlǻƥM_4xgh~3q9]Ŷ~t.?A$IyWUzI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ɵ?$pI$I$I$I$I$I$I$I$}5dSe7VjcćػU׉io ~=,a#@Z+ǟ3K:܋oudIq?:D/U7}y UUX8Y5^깺?Žl~>f'1JS~SGmOrrm9YE}7zQ3o_?z4׻;'ń_/Zpr?n%uG-uwS{V=V HAרI$I$I$I$I$I$K{KpI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$AQ/zTI$I$I$I$I$I$I%9hN:]ٿgXI$^U(?1%Uo^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$) ;$I$I$I$I$I$I$I$I$Kǟ3Kscc}}oCgG atpjÿo~vO }9r+gڼd;ëL<ـxw /+M|]*_~c0 Ui~[{hʰx[ˤĴW׷=BI$I$I$I$I$I$I.vױ?-O]I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kʿ}/DRI$I$I$I$I$I$I$ۯ}n_:rwOwfqb$IyWUzI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ɵ?$pI$I$I$I$I$I$I$I$}?g{yM 2d ;#{T>ꬱŴ{k΀Hmϙ%xky}}QK|;c}N>}m}HZ.w{Q[g8qD_'aSzEo4G7i|) ^mZ!LyH]5we#6X>Mb?hos3`%QG+*9{@ī73=`?Of}}K.Ͳ2cysi$I$I$I$I$I$I$\?c[ֻI$I$I$I$I$I$I$I$I%onϪj@%#WrCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%ro][K\ 3')$I$I/*UI$I$I$I$I$I$I$Xn?ݛŋꔒI%_>_V$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K]I$I$I$I$I$I$I$I$/Fo- CQMWM5lpk%/~՝GVͯqO]^y<_^ukh7Gc=ǿ\Zpqo0G]iv< KV%5d1%xwu;/諱q;ݵ:;q3#ȮkۮUm}җ10ZEvt⮎W؜ ;qwp)yc$] j㷾]N^}YC!!}I$I$I$I$I$I$I$^ǼԷ?w $I$I$I$I$I$I$I$I$K?ޏݿ soR}wo /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_I$I$_[תI$I$I$I$I$I$I,?_CPܿt?ğ|S?JI$AQ/zTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?HI׮$I$I$I$I$I$I$I$IUsnF5ᲷuOBw NHikl/38cumϙ%x7#'p_cDž01y\ma;ΰss^/rMq?&x4~Au?G# UӫWs9gNV_o+bI$I$I$I$I$I$I%=kI$I$I$I$I$I$I$I$I$_=wg?'W36S1ZkG)$I$I$I$I$I$^U(?1%Uo^I$I$I$I$I$I$I$#CrӗKї{qZɼu9~g/ac?mnktIyWUzI$I.د?7ퟡf#K|bzßRC;7ێߛ߻/DZX߾Xx\%_b7 kn99ko_dw^01~dV[[@'ę%o|kM}>Ǻ}gGc|_n;XQ_vA> ~gsoj3{~+`־j'' qUcopq3$ӟ}??wvܬ$[ztk>G4_=ݍayeo%As$I$I$I$I$KG~w[FW?ٿ*~+QضxG2d9?iw1ػs- ck\/m3}EڰȞï n߮79ϳ)?Qa$^O?}]kUwbb>tm}B\W׬$I$I$I$) ;$I$I$I$I$I$I$I$I$Kǟ3KOJ &ghhf~,cO7V]WwF_rw O^U ;V^UN{x/qZcդi^z;9_Z=POtx[neWKać;# &v0r>^3ȭ&HGI$I$I$I$I$I$I%=kI$I$I$I$I$I$I$I$I$_;.2o 9Ye4߃6I$I$I$I$I$I$_[תI$I$I$I$I$I$I*=vNOK&yEpLrp|)cddՓeLf-bL-k?pZ_f=/乞}'鿊8oDP*)C+?8ຮ۷K01;32q2+ɡe.k\:Kʿ}/DRI$I%ۯ_=rkbQC9ahwhk5ك8]3iVK}+SI?/f^y9>շvٱܮq$W`-.oŧت܇z6uuoI:]rI$I$I$I$I$sp/[v+mYL?xOucSc[v @~fI%~n{&+Ɨjk|_b;')ۻ+#bO g\@ǒIp_!wg~tA6~:N-_.v|g_cm<.i-1}eW[+U$/zlUUy9We{~cUUCOQl4I$IpORvI$I$I$I$I$I$I$I$PmUV@IY]W2p{wr/#uӣN]Vj7u=OMLzӆx1WhQ`b}.` l.#w񛛍,f,779]kyoMXM5hkr/-z;9_Z/q]5 ?%۶}7s;l YtQz46t#nWnϰms=K vMwFޠ.P`}bqޯ8D렁;TI$I$I$I$I$I$\?c[ֻI$I$IaYa7'dz~[DGrl~þ}?Q,-2L;\\ڿnNKF:"Zx[z\?^7ڮǍ[g!O ؘ^Ogc[בz|>n5 I$I$W\n=.͟_o6W7W 'Ǐ_P1~d6dQw7wlEr˳6n_k4{7c4I$Is7>/և{|nn?jo}ji'$F_rw OY_7-){}u:C)FI$I$I$I$Kʿ}/DRI$I$I$I$I$I$I$\cwܻ[n- u39O Vw|!kMۻutnE◗9ݺOxKW>o$ڳ{ߥJO㯴FZݱIo=ε<]uYu66ڬhs! -UI$I$ϵQٻM{[\c~˜^ 0{.پGh; "̇7>r3%g:z_t8=ߝ{qo;z?'L߷}ҧUl507|Ƶǩ^I$I$I$I$I.q}oo流ǸbϷDp8^%'`FLkg"=ǡJI$VKӊתYN^\g?,7e=\m!]f.&3q{kr)k?soކ yq./B2qx4 ׋9ٯ\-yY]y(x'9l[Z5{ K|zFevrȸk馾Q oLsg{.ˋ0K>KebRI$IpORvI$I$I$I$I$I$I$I$^%oKknx[HcyH#W;7&qWcz_c}ϷyܼJ/xg ^L/}ǥ|;,'OG$UMwScmƇ12" I$I$lzkZ留[il~WgpdR2xlqCgu$I$~ӈf屯Sel83cV뷻u6܋x.~, »Ē^3o&{Np}$~C.ߗs=%N-smmh3_DI$I$I$I$AQ/zTI$I$I$^sa흗сslkͥ:A{WoƒKmi/oƒKmi/oƒKmi/oƒKmidOw~}Y>LpΦ9/I%}g]1̫Ug)Hu^ 2;Lʽ i;WI$guc꭯){ Y K/}K}w;hg^|jeyj{O۾G>_>r@_H8s]U/:cClK" t{7L17+`}_mn{<1{ez&?og3ֈ$I$I,ﴙ>[}KH<)vO?k]{%m_<)voo5~]20q3k~=vMa0g^̒Ko߿~8+YMLj.(^!~η}sr{Wq"Ȭ~W%I$qowY3{*.Ucu{9 ڿ{?#leYx[Eis'§5<"i#G3c_nldz</kT_Lk/s{_s8 gZh__v WkbS] /CUI$Iy~u}+m٭g}/c=5c_ۜ֒+geBHbkŏ-ۭ4ǵIomi/oƒKmi/oƒKmi/oƒKmidOblsz߳y_>ۗE I$I$I$I/ގCk*_bGӦy?Qseq[[p%ބx߲_n>Z?f3\7oe|xy;csc_w/BƇ{?m7[SE_tkϼ-%CF $I$I$I.VʿNvͤk5cGSI$I$I$\WNm.8u6acVQV=;=BaáQI$I$6͝6Y qu"W߲qz9:l'{qW)$}K/}$;{u)C߃ c.eVױ59%}]_I/ /eCau%̾C.$ٗ{op1;32q2+ɡe.k\%UM]cj=02J g0X=܋e>V,?5__$I$I/zW>;dޭ{HvW.;o=_UGG@W@Yy/[cxZ%xV ̢ϼ,eZa0MbA=v</#?{mnsLgcbw,GqQXy95y$I$I$I$I%_>_V$I$I$I$Y* ;$I$I$I$>v3||#;̅iAہ)>Ied1|66&B$j;[|_oO>UhDp#/~bzC#ɺ1z?aԮ/zq~[z2I$I.Gmgۿ|R(x\YNOc]cl}OW[}̳`^E.+o] 1}hzkUU5`9ǿnYڬac#[duBc;*?,kџrz$I$I$I$I$T{pøz~񭿂cį).uXC i$6пlȌls'9"_.>՗;'moV _f`c,|LfpQ[j<-hsB?f*j~ ¿is_MYMնڬik!/W}QܻY ƹ¾2 5i} #~;}4v}Iјo 5/;ëdWV6O χ>00́p$"<ZWԩ$I$K]I$I$I$I.vױ?-O[a{q$I$I$I$_9|/Om^T  M\?o5zg{R&2~8mY.]Ъ>Os!o!o!o$v[ޓa˪o)/wI$I$I$IpUwv&F7{lg˰iRO2"RI$I$I$#6.6ig!zUvNUcTU ` @^I$I$_"Ylmbp q̙/~fbqn'vx8{0Ĺw$&}]tϤ9e{%}#"1ž3V_m~z޴+/pg*ĸ~!pog.n_Kt$I$vQklFpceя齢=:=״8>ǧEJI/*XgqYwk6'5̹}xf`1k.wssI7o`mw˩ـ4ѿuD˙sxIx ^33{7mmnn]5}V87n9?`r< fe=]v],XG>o #ۑ_t`2]Yy%26qq/3{g{7{ cF1˗ $I$I$PbK޽U$I$I$I$+?_'pXI$I$I$ȿmwnŹOHq_DÌg F`TY`t#z<]ٟcu]Fݱm呖x2 }D} ϱ|8%̞mm;B2w w ._]Uk܁c_ksܘwרc]\kG8 JkѱO^H$I/5z>O47.,M/)ޝw~\2i~c 3\\ueVK;S\j!r.uKI^/{;>oڋ1,콪;.=&y^ƒJV=6]u\h+51>}oϜpcNtscI$IQwsƶ .w,'9Z ~֤߷c/jK,'9Z؟ʾO/xxXr RXl#}m`e5`k0_/RI%k~6t)f'cǮהh^ ûKSu,®ƍVc>Cre%_dw7pXv;%DH\9x?gsvWz[Rd"e3W$K߳v497r$O;FocmV=pmفa?1~.%/}Z\\s-e,fn_k\8]㺹Rbo7/jI$I$\?zI$I$I$IpyoZ  M[$I$I$I$6{j/_}n':jǟ3K;?cZ}qg~f'ڧvwW[v>+c?iYt~~[O=;b]SimxoXO \Lfw)u>ܿl[)lmX=CASI$I$I$+?_'pXI$I$I$;?$I$Ir?k>.:G v?e;W^xls2kG y6J1$\D߳_bs܌}K#|x87wXګl`/;N]R\)!+ʾ*?~v7d7;# ~֤߷c/jK,'9Z ~֥c_j>wzu i4ŧ/ zSf~X=:ߕc1g1­(uΦ,<"zqx9wGo۸z}@Ŕ 7=JI$K0-E59Z=nl7g%I/߷O{\\*$G~6F\f^k>η=s{SVf@~Ga>[OFsocTDUMwScmƇ12" Ӱwk ,:^e(>[ZKim>&Y_~ՏMt[j WVE6SumZwgq1/c Kg/o~׌OԗYo "n?yk=уCqo uzi$\w_e5ѝOC{?KQG/9o_]佧ʈáv$I(_MYMնڬik!,oC`~=oǻoU !XmJRad? W ۻbW;^&% h3gڌKq ?Vd^/S? 7zyؕOn?_NR^8?Ɨػ̬X'T';̍{NA(2Ix{~^6ʩq0ͼq1Ǵm{ՏMt[j K+OcI{;^xY_w;]L: /2;~nF&K8/DZXٞ4__}nȯmv-ح]O3aGտ>Y?r'_txdsSAi?ﭥeż_Gd,⧶^ݲߤ:ڸYhu_f{#>uy9tӪ[\-TI$I$IpUwI$I$I$IpyoZI$I$/WN^W$vo/RI%Wퟺp>Ϭ{A G翲6,IKM uxDd{ h{I$I$OawXkdzmGw_ oڼ=:Y6RtƸx ^_w6;CLjM$Y]cC޼goAj?qoisq-mv2eՏsr;cv$t׷υz>߷# WYk7oť^(?cQ~mm͵.l7+\v, vE'Gۯ<;_ xhu?Z5g}&I$I$Kʿ}/DRI$I$I$IpUwI$I$I$I$I$^U(?1%Uo^I$KGٮ}xzK?cW׫?. jl{A$ιI%n 6gpbhzJvMY_g5zL6et G?~/fn2*w-C+"`;!zJE6Zx@'1 ۵|;]t۬sbϻ#sbsk;5etWO|>g\=I$I$Ɵ?$pI$I$I$K{K_}n':jI$I$I$I$G W/~#Cq?W<_^aJuj??]}y=,{lwpsz'O_/w,lK6ϵKF}=_vGԟS"/y 1W>j^-6Wm>չI$I$I$IpUwI$I$I$IpyoZI$I$13;My§4 oy._2M;˴'n8[07 ^k6e_e)wmmF =OU3}?;~;̸kҮ|w??bW`F ơ5ޟUI$Yh];xKq)}.wMw"]:lH%b{!v%L&D /ćqwoi-lxl~v^?o։)` ,|gё[mMp3{}nIcV_c/ }, 1 i-=B$\ES.8ʙ[:L_."Ucd8D5@ۉ/E _6/;>Ō/ݏ.(]RK{vC'9Nl&ht{$g߳m >?ďO8: ^x׋S8ﺬzlUUy9WȘU?wn_c):Ydqǚ%Vި3ۘ뛇w=8wD7>$sQcۋfAsɱ9L.$I$I$_[תI$I$I$g$pI$I$I$I$I$PbK޽U$I$I$I$Iy?n{sO`3w$7E sC#7=w.ghw[j1tbb}=1*ͧ(0I$I$I$Igw~2d=?%8~2l[u=yl\=W7=JUM]cj=02Je~ULȞ2.$I$I$I$I$4!'o^I$I$I$\?c[ַ>#Cq?VI$I$I$I$}z?g]zty'e6T[ VZEbA m|/ƯT^Uwr0%_:Q?SPfn¯+' lsD?^GB'v-%k8?'ѳk;Au~ 3nO趪_jԑ]e%s_6Wz۽844adCs3s_}+|x SNPa{Oknv+Oz]6P q7mzՏMt[j KηaZY0,?oOOڿ_6NWlψ]gu^sM1x9~qhOj1%/9:m#D7C_vmlɲ hǩ+KuĿy!R__q/~W\YhخseYt'QS tzv/>}L[nN]?rVX⟦^(%x],^MͪV@9ίw&c~#_ԗzRI$I$I$PbK޽U$I$I$I$+?_'pXI$I$I$˿o_ؙ~Ug{ٹdVp"6$IyWUzI$I$I$I$exԳ^6dx,݇b5hl=k#ϟl/9P}vV5Vd}zR Ǵ\!~Fv ƽU޿I$I$I$ 2)ȳ\|W_k>*~8e@?wJ;w۩sKe沅j~E9e&1꺮:>\_vU9-O"<G`[82"|{@bh!=}8Np>-kSV=5Mm0@h i$I$I$I$I$) ;$I$I$I$g{R9gNI$I$I$I%iEtnV9pw ul|O`c{[i -m?y|WNy?Qr?/}m>'nfSq^X x+xêaiǯ'}Vws}Wp|;;N`ƶkZ Y&JGگ߿|?}ޗ/R~<Ok^ϵXý:\>-=zk8=߷ѝ{r1ov7zi$I$I$IpUwI$I$I$IpyoZI$I$Ix wi}wV+  .g|kŎcI1c+߲߱lWS,p__QuYu66ڬhs! ^K[i綾ߔW0,a9q5zI0~,zzz3O$tI$I$I$IcOE]wb\\O2L-Z)馶Um c 4@4I$I$I$I$I%?HI׮$I$I$I$;?ϰ=POtոI$I$I$I$Kǟ3Ko /k7'Gneqͯc]{x`qo}"vڻrK^z^o /iwVavϺ"/J^ɘh1֋ȦcCM$I$I$\?bI$I$I$\?c[ֻI$I%Wwν7=elj7`vx"D8?ONs}~׋]qzm]8`6SFM-o]?na2/*GC>[w^_2;2{o؞egpˆS >7Ԁw 3>^Eɸv:I2RI$I$I$I%?_Y6F6Ξw왽Onƻ+MSSdى#e^+Lya {9} I$I$E?hp9cI?@}Ss{lW6Z)$I$I$I$PbK޽U$I$I$I$+?_'pXI$I$I%9hN:]ٿgXI$^U(?1%Uo^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$) ;$I$I$I$g{R9gNI$I$I$I% .Um.{`4d>}]'w*r1Xڝ:=A8l/+m|/Ʈ/] cY}V>UvSiE/?/K"/y 1_^7_D_Ab4" cvػe=b"cvd*I$I$I$Y* ;$I$I$I$^ǼԷ?w $I$K;v.颞ܪlĎ*7cݷ*YYnKﳲV׾$R+oXG;lg8TO-p?bt]GvaO\,8XA" 3j<5ֶw#I$I$I$I*=bwїrFUfr'<ǽYS(yd Dx^{͸WwgVCHxWI$K~gteu'}h;sm3rp5>#$I$I$I$PbK޽U$I$I$I$+?_'pXI$I$I%9hN:]ٿgXI$^U(?1%Uo^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$) ;$I$I$I$g{R9gNI$I$I$I%Gwqwd2Ⱥ!鬙}Nxk9ݣQ{hwv7z7ټ{ןpkmĢr϶jD\WگGw%ٙ!/lL./ac?mnktI$I$I$IpUwI$I$I$IpyoZI$I$I$I$I$I$I$I$^G9ŧpIOwV_Qpi#Q13@Ba1;eߏ:K}9@]I$I$I$I$I$I$Kʿ}/DRI$I$I$IpUwI$I$I$Xn?ݛŋꔒI%_>_V$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K]I$I$I$I/5z>O47.,M/@8vׇIsĦ_̆6I$I$I$I$qSam{zV`^{}zpsG\^HZ>y?ϴ˽i=;Z{knqbnZC*ɲo4po-[}ݙԟD5kH"}">wd作&Ʋ9@?Ɵ5 >{n36 76s"w o_]XLؽ =V9l]}S/5\4Ya<_Ov ^>:]d?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(޿|^O?0&m}=>xNI$I$I$I%_G# UӫWI$I$I$I$Kǟ3K^4{mUM]cj=02J-v ƿ庻NI Ϳe'IU .ޚᶶ'm~DH^I$I$I$Y* ;$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.VʿNw $I$I$K+f&Gp-11~FEUcά6quVױ H]ٿgXI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_G# UӫWI$I$I$I$Kǟ3KU[;p¶Y[F =Yxo6NwGEx}nGʩn]_È ˣKٳ^'p~6_nC㊻" >}?6/ed=^` yT'UW/ڝOA{I$I$I$g$pI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Y* ;$I$I$I$MߟsfY&_}2ſvNWs}?W2̎xI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KʿގFDVUI$I$I$I$^O=~}c5c93dp 3}wos4AloVubݓO5WL?mϙ%xJn68wK]>&:Y?_t[٬+76՗kxSO`>*{=bMɧ zo{Xwۭ)mzFZЏF/?Op^;I$I$I%WI?.$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IpUwI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_G# UӫWI$I$I$I/ގCk*_bGӦy?QxG~?ǫb]G?s< o=(?]5c[jֱS{7[ۻ^/#Џ޾ly wq2:+q,gOfrw/?Op^;I$I$I%WI?.$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IpUwI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_G# UӫWI$I$I$I/ގCk*_bGӦy?}l3r>w|l#{-qf#[6V#ֲ=<.\?d?eo^#Crӗ~vߞ?zΙO}\z&ҏ^erx},mN=^?g#+TI$I$I%WI?.$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IpUwI$I$I$I|6gKGl16 geϋHwcwlt"yDx $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$aJujTI$I$I$I%mK_=POt>gWvnq;n%x7kDgj񗗏=>WSgnK~?\xgYVَ':^7 >e~}>2r9W'}]]SH]>nf'o~N^Ex28lY_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau.7[9~0u lw 8o`@woScfQ{Z0UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IpUwI$I$I$Ix1~w~5~eXOC>|?߲=/#7Ci+O9רI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$㑅Q*իRI$I$I$I$G W/~#Cq?W<_^,{tg+ r+`8+'OzI$㑅Q*իSvVXu>C"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_O?ovd|힯f-?p/@9ٌ^Nwc>ti$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$g$pI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KʿގFDVUI$I$I$I$_9|/Om^T  M\?o5z1>>bvƫ=cϼ>Eɿ`_4d/QIoX(7 ~_asJ?iav_;gbWEg8`Xxo z;9_ZU$I$I$\_m[O$R"d~%}{V9Vxkސ%F5gI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%WI?.$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$/WN^I$I$I$I$vz>Gq§5|h#'_bGӦy?Qx ^2ߴjW9<՘xXYgGx[ȕ$aJujTI$I$IpUw)mXױCSI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$+?_'pXI$I$I$oݙޯ7Mxhn1!>]$: Ks?ys]]e9xu]>}a$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$싾zےܼ?B}dsկXm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!QlbwыOc4/'^o>wr(ᜁ{0RI%۔U)ج?gk3#;_keM[8Α׮}qy_o5z$?jw? $aJujTI$I$IpUwI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\?bI$I$I$W̼[e?|,ktO Y!|m}]eXm{̗̒_'_;8}RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kʿ}D RI$I$IpyoZ  M[$I$y?Qx  ~wlܪmØc=H}Iy_#/CNOI`>W݆>Vݙm _f{h. qոu0$xِaJujTI$I$IpUwI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\?bI$I$I$ۯ}n_:rwOwfqb$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ZgR,XMV5i#D[_Il<Ǐ쩤I$I.vױ?-O[a{q$I$>gW/z\C- tNGG}V;+є=JgL!Nhy݃]gvc GBh*z;9_ZU$I$I$\?bI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$+?_'pXI$I$I%9hN:]ٿgXI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_>_V$I$I$^ǼԷ?n}GӦĒIyW>÷C>xj=~>k;]ڻ7 nqo;ɞP5{wn}&xx JjE]?~qY[>|<|e{KP^}5dSe7Vjcćr};Pv뱰rEvi²yfx[? lt߿?Nx8_8x_:< wr0%_:zI$I$I$Y* ;$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.VʿNw $I$I$Kr>7/9|t'_;8}RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kʿ}D RI$I$IpyoZ  M[$?/avus75I^WgK}W(mV 'g~#f&?og3ֈ ̾ǟ3KhkN~@sߺp`;r'gFFLsgg }$?jw? oپ3Os\\qZycJy?f~vͧGs[p\O!O!q?G# UӫWI$I$K]I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$g$pI$I$I$#CrӗK7LӋ)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$o]KнU$I$I$;?ϰ=POtոI$Kǟ3Ku_957'gk߳7&Gub8yH g;۫r,kjc]?Իi:o7/9|t'_;8}RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kʿ}D RI$I$IpyoZ  M[$I$y?FjǦiU[CX M$I$/WN^I$I$I.VʿNw $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K]I$I$I$K>O}/s2l{\=CSo-^둍s鬷 ~KI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IyWUzI$I$I.vױ?-O[a{q$\kW؞ߛO-CS+]-na̸~2WOuYu66ڬhs! .m|/ƯTIxwOVwlN2Ek.oDG;_qۑ{x+K?,[{muø_s2LV5_X<eO}_ѿW}}8g/WN^I$I$I.VʿNw $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K]I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/*_/UI$I$I%=ks/r>75n$Kojf\Nup?u/_}n':jǟ3K[eec~=Nh2#sz\6khƇ1yx?c_V$I$I$^ǼԷ?n}GӦĒI|w}_=yR/r>75pmϙ%x$WNÅS]Y,~U|_l5gǼ%jsN/ ,׳etpI0\4:B}3onF5OPaJujTI$I$IpUwI$I$I$IpyoZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^U(?1%Uo^I$I$I$K]I$I$I$K?Ɵ&WhӏV "e-932\wYNG{OXI$^U(?1%Uo^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$nՋwø6bpw'I$I$I$Ip*׃>ǟmw}㇌SxߤI$I$g{R9gNI%mK_=POt>gW.G?۸_cm>0U" c g?a5 ME_q8Fr_^7_D_Ab4" cv>O`ڛVMͬY$,/㑅Q*իRI$I$I%WI?.$I$I$I%=kI$I$I$I$I$I$I$I$I$I$I$+4{p_a{pzT<8`:29g>ߴOY?y 6 W ?pK ?pK ?pK ?pK ?pK ?pK ?pK ?pK ?p]%~rO5$I$PbK޽U$I$I$I$+?_'pXI$I$I$ɟ[vO]e75n$K?Pʗؿa{髇m|/Ʈ_ٟhnvV]c<:Y=2~6{qFgL.gR}Og|_.y97{8s5ga{r?m/30=]ܮX]UA>m9a sſj;),ϨY{kO[1I$I$K]I$I$I$K{KpI$I$I$I$I$I$I$I$I$I$I/1z/#+,ͪD}MshKLoOp+6j37zrI$I$I$I$PbK޽U$I$I$I$+?_'pXI$I$I$I$I%_>_V$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K]I$I$I$I. vI$I$\?c[ַ>#Cq?VI$sz;>_ ڼ}9gNjD}/gX߲mk[tWq4ŧocګoxZ]3b%cwfE3wjks]c(>1̈7OCvshme@p4-p 8z;9_ZU$I$I$\?bI$I$I$\?c[ֻI$I$I$I$I$I$I$I$I$I$IxZ)=H§)dpcO]V@Ͳ=.%O`/M6|pק8< ' y}eV379/@&ܺwVy>|I$I$^U(?1%Uo^I$I$I$K]I$I$I$I$I$AQ/zTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?HI׮$I$I$I$;]I$I$I.vױ?-O[a{q$_9|/Om^T  M\?o5z?h{-oI>gk1*ݺNlXqOKUyWGӦė/WN^I$I$I.VʿNw $I$I$I.vױ?-O]I$I$I$I$I$I$I$I$I$I$I$vz>OIƦ`5dX1/x7oj;.-uPDZ*vϫvV%6^d1axwُc~hWrsA⍿h}RhvzMyCm rn7o;oO-Χ\q{3#Du>޾WՉ$I$I$PbK޽U$I$I$I$+?_'pXI$I$I$jٮu;*]5>NssNx)$Kʿ}/DRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$4!'o^I$I$I$\?w $I$I$^ǼԷ?n}GӦĒIpw0 wѹ$+3%fz~`u+sVt?3cc3zUmkD_mϙ%xձް퇋}k7γ^Cw$lG6쿱`/쵍= msWKF^]3b.u}+.'jeoc}h '4~ݟ'p_U.<.m`Z.{?x ._ks-3 w]Yh?qߵg`܌kuv7I I$I$I%WI?.$I$I$I%=kI$I$I$I$I$I$I$I$I$I$I$?'9pjhn^^/w,_O$l }|[xDFa^I|2{MvʸïI$I$I%_>_V$I$I$I$Y* ;$I$I$I*=~N=?Wx1bW]ܲ~Us'<]#܆Ǣ_RI/*UI$w]k{@pnoHq~]ygv~wGc+v_/e ?`p=싲 KF`RMp>kj{'.߳>rڰ>Yz3/5}HKW'p8?e{k|+w]5_? ˛w+=-Tqkq~ͻvinnK[.? ?WM?em85fT/Q3nK.fg+q$I$I$I$I$\ۏwo}Vܾ 1nңImt ~O?{>ϹI$Ismp>|ﳝõ^lg>|g}ݿ7o6݆DW { I%﷟#)~ol S=v]VE5Mǰp<*i$I$I.iCNw $I$I$I$=-I$I$IpyoZ  M[$I$y?QU=wZE9tTXx I$㑅Q*իRI$I$I%WI?.$I$I$I%=kI$I$I$I$I$I$I$I$I$I$I$?gj9 yeDy$T{u}/eZ͎'OSy5gspow?i=p׵/XI$I$I%_>_V$I$I$I$Y* ;$I$I$I,?_CPܿt?ğ|S?JI$AQ/zTI%mہUg{x.o8tz_{kl|<]Y7EMV}skV:ď!} ϯլew ݍEO`~i;1Xc^U;}]cw\?0p}:I$I$I$I$I$>}_ܲ}ޝ57-Ӗy_Q>6 @/t>"6i$I$;!ھ,nf'}5Hܳ@r ]_k~9t<(f_:gæߜ]I$Lh~@s]pGY;s2MX9#;bM`~M{|WKڼ݅)SA=9lΖiʷ;][oC\-<+I$Ɵ?$pI$I$I$K$I$I$;?ϰ=POtոI$Kǟ3K5ghgۋ`w+Mew o3 Nݯ~Fv ƽU޿`ϹLgsܪ8 = 2%_G# UӫWI$I$K]I$I$I$K{KpI$I$I$I$I$I$I$I$I$I$Hx #/%cltO Z$~/`z.ĺ1^O+tPmUV@I\0}q~5?|k̒}$I$I$AQ/zTI$I$I$\?bI$I$I$ۯ}n_:rwOwfqb$IyWUzI$~;i>M?\R|t V'Źٷ_}Їzz0.7c[{,ԟN˿m}ӿszU6 3z 2_RԟU^}ceXڪ{̒W6wǻSq29kݵ{jI$I*=.C7D'\KF^]3b%/ؽ Ļ/?g]ϴ}>VOhe;K}#[yxuᲶcLp6]ҩ??nz=O ?%$z}^*^C|yp&G5`{+=ͶA sčiIBǦˮU[K %c3;2qVݓgS*%u̅]x7C})ۻbp;&eE1hK]I$I$I$I. vI$I$\?c[ַ>#Cq?VI$֯=!7!ޞ5N=c=x[xltkDTnu"ƛXֹ̝pI$UM]cj=02JT]VE5Mǰp<*i$I$񏗏 {+?:75`UgtyբhhN/zlUUy9W}ݗ?~f_|wq>P=NqK_?pu<)w/ͦ;GiK_!t/=zw::p~D{n-I$I$_[תI$I$I$g$pI$I$I$#CrӗK7LӋ)$Kʿ}/DRI$/7dw(c*&?:~^v*}OS_1R>\Pocپ+5䖺 93ˇPތʪػE8c?oٞ{ma̦W-fzOG|۰)ѱ̮\Zr1^KOڞ_kȦZ_8"ctUG+qƲ> [l"[pϬi3_g{}!Ȗ0+Nŏf[c|3j'}Kq;1$R}Or{^Vk/m/`oX|O9ax]/ԧ 0;|N^.~j;uk~Qk4>:^moou.{:2 f>vs}>m@TN{jK?MTګmm.u,$ɒIw,.uv}Yлėw6:;g2Zkc?X4iW}xi>gv 2GskAv&Gog:3+׃ cn$?q}W{hɮ[}.n& :l|1$>ϵ}ӹ?Pܜ,JZ=>7;}Ѯ꽷;l2i AqI%?HI׮$I$I$I$;]I$I$I.vױ?-O[a{q$^O=~wo4w>eۈ1m"86@x/'3->wV%'RwnF]/kko$ؒ]vzsƪ8.0y?Q$I|;:wOn_F(YuUƵֻO` J㑅Q*իRI$I$IU=˷vE]``'Jo)x£d0q0ὃ⻚>ɭ識aZ3!7o> -up*ɬ(d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau.7o9?vY7ᮜ9΋y9$I%~]_3=64_hqsXqubq63ًXgZAI$I$I$Iqav}۫;~qvϱ_l~Uf_.퓇X57pp؍twOet7s)q%Z칝}/|E/w-ߦUVNG}kssNNCM pE)$K?ۆư-kVr-^E5c]4ڪcI$K?}X*fEBo±ngn{s}'y[$]?{rrqcd~ . o>UVwϕյo/Qez.r^[?$I$I$AQ/zTI$I$I$\?bI$I$I$ۯ}n_:rwOwfqb$IyWUzI$}K/{7Y݃b[o{ó{=2HÝyiw`>5۫OQZ^kޅzpK\M߾65}py?G.:zEO+aw~o1 r5GzI$I$}bf3;ݾoO\|<\Oky^WIńo?R_a?ԗXOs%Kѿo.r8=N9eGudb~i&J> u#yJO1~޾Y\+m&GwdžJZ}{Uy6}fhm],qKlJ]pyoZ/}K}I/*z#}7peǂdI$I$\?c[ַ>#Cq?VI$I/+m|/ƭ} ,Ak Fc!pG`}ݾv8n,nEwKƹ r}'w_h=*c2y}Yo߷cIͿ~/5dr|v8{ ünݕvvsif?v=OvCX9{bgdI$I$Xi~vWwnSiw{sKgͤ" c߰8q+'_Ǎ8;|?o /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_)4= }֘ⵀ踎E{I$KĿޒM{Odaiqq̴Aı]?=?yXݲe8x?9|eCau-\,N̜Lh|K0I$I$I$>|kÎdHc+ķ`Y+wy.ƻ||'տzc^31F&K8ȭXَ&AX`{+=ͶA sčiI$0~Ϲvnk~ k݇74ϲ# ] :*\~_YI$K?ޒϪzzEL -,/ʲm3;,w$I$I$I$Kʿ}/DRI$I$I$IpUwI$I$I$Xn?ݛŋꔒI%_>_V$KO;;g~}9uLlˆ!z[v?-N+];/ֿ}kp_eu#0e}I*=.C7D'D˷wZMT_`xBI$I$Ep~v\לq[0D||nYfOkt[ȩg o>+.a+xnUfS}7 _wpip~MݭݿpX'nD_ ;z>FC~OѮvױ?-O_9}b֯RI%鍍]ݬ7778xMw3˚/znҧ3lq`8_TK?Py}wR~8#ٙ?55y~}+ãȗy/_Iq_㋲!~Qq#۹Gnouq?"o'7l_duYu66ڬhs! wߵ߸ zWNOWxQ&I%,L~g%tdw*l\ ?D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_ٯf>uݧۛ=<%I$I$I%=ks/r>75n$I$jEMo?_9Ά]ۗщ/*z;9_ZU$I$I$I$I$I$I$;?;^.sC_x'XK>;S̿bl7:#K?lzs?Ev?yq^'a£v_py}TbH({/_ove=6ր}Z{sSV=5Mm0@h i$??nnCzuYMvQ9?C2o!b_Iď7 %}rۿ{_-3$%uI${[l\Q^7޸D9|J=g~M xlFaoI$]ayno}*ɏZsX_uIK]k}ָ'8I,̼,oock1/I$I%YJC{OYvv݃;}847[zVI$I$I$I$_[תI$I$I$g$pI$I$I$012YFEnq5 L)SkI9l~ >dw} 7۬#@'~?I$^U(?1%Uo^I,yxY6BV}C͟GWyI辭鮚kmUV1@S_&w˝iwnׂr2{`o"O _Q}?g{./k͆&L~$I%5}3݄wǺ3?Wvױ?-OZ `p1TDuwq*c'` ̢̟Fm-Fu=S[[s ,0HM$I$I|bf;c*karpƵD{'O u^لX"7dO]n$Iou;0)-mx@ _ v{,<}Z|9/YwL2O@T?k~Vn*Cg~#+x}7wz~ٌZ"n|s]'zkxw|lӢ\߼z#Pq+F侍W׷oTw W}'V?zk vS=؟̀<޽6ތqǻw%OS=[xBzCy5nOxH3YKy[^Kyf>Kң6c}Qly# O hsڝ;5Mgஏfwk{>O)Xi | iaVw/ۊ5Ǹߣ?8I$4!'o^I$I$I$IB˪յ55~PY}5=m| wCtI$I%=ks/r>75n$Kڮ?~PlmLe-=@fǟkެNzC ֻ`*I$I(_uXu6iss$e ]}vՒvVeZv=w)0_wrsr-윋 7gG/a}JI$I/~wLUʸ=2"gK}m|j3gNѰ$?_P_P_P_P_P_P_P_Pz{mk5P#WI$AQ/zTI$I$I$\?bI$I$I$I$I$_[תK?vݱ{N;rsri46$Y294CW٬~^?@Z r]K+>v˳;|=31C_Q߆$^Ur3%g:n=ks/r>75pG# UӫWI$I.Ww/NYe.?ޜ&ϸf/׉is &=Lvkk?b}_wiˡ7?Uޥr<~}ƷOqY[<_`~ݭXu谉a-Nz}^ڇ^{|9*%`{Ӿ}=ζ@qXk m^c;~wϵݲ~S:nH\_#22FO_U`h:h|tSV=5Mm0@h G?h{?wW}SHclϦfw|_=ޕ8ۄCl ^UM]cj=02J#P|rȶ=v8gys+z)馶Um c 4@/h>[K.;%"Z݆c: 뗚{_/{}8ipCxkk#]A?kyOGKyOGKyOG\?S2>/~ۓ{+5A'i%lggځn5E·X_cN×vj}l#uĆlkgWZis{ovIM\x}=vwnӥ$V;zI$\?zI$I$I$I$I$I$IpyoZ  M[$혅 cc5y/r>75pmϙ%xޚN%wpLR֞^F_ hO!{?gp~vnوհs>%s D/^Uwr0%_:zI$I$I$I$I$I$I.vױ?-O]I$ܾ 6>]e%Uyײ gtxpwqdb%7euX,׫$X1ˋ>ݝ߱;Oe}=n}7O`L`]:I$&>l626'sN}./@d?˽|7r*kK}v`[uYq :}$^+G\f-c(}-?\y,>U=4WΡ>kE$\/8[;We5cVn3S1EyuI$gxeb{V_gx>ѣPtO|L~߅ 1mUg/zlUUy9W̟ܿs Cp'-x_O$I$K_802scO/I$I$I$I$^U(?1%Uo^I$I$I$K]I$I$I$I$I$AQ/zTI$I$IQghw}PViyw5U۰xSkǹ(2}'M߶7,o+/sd}7CS jϲݟ'=l,{=:sah_PoڜU܇w:4<djva$I$\g>w^?OUau ~)^]b;+<"jmwM? ]%oyX%S#v|wcfWer}{9h5߅{KW٬f\zr^O%W?_d{.vMߣ?<;WI$KǏؿl{c..en~u;ψ[?6w٥$I$I$I$\?zI$I$I$I$I$I$IpyoZ  M[$6{j/_}n':jǟ3KڻvYMv˼to;~vS}3ZC鬀E[.o/CI|;:wOn_F$aJujTI$I$I$I$I$I$\?c[ֻI%s7~F-e~s%}5vÁ*-ĥ5W5qƀVpWv/ĤŜ2/ѱ#C_yl}H1sgo~V[u+}v0phn>5 ᮶OR$>v]ޟCwz{i01#\7_EݾOϵ e<3N~kڏ%}6|/s56{;&{3_b 0d תw#?"xzMb>I.soi;rݻ#ճ_kܸ4蘎Qti,yxY6B) jfƁu>p%$I$I$I$I%_>_V$I$I$I$Y* ;$I$I$I$W}woY41G oZ?`emK7>m-kb~-fΧ!u$Kʿ}/DRI$I$I% \Gk;Iױ3OKvױ?-O[a{}Gӧ.GTŧkp#efpׇ.Cw$I$012YFEnq5 Kz}ncs.?M7wS~_]LwCY{i<>[r2rٌ/~Yv!cOT;?{vVJ,ߑ?SǶ9ǁӢ?g_َWnztdusRZ$a/mY|1NcZ=JcK3gUZwG'ԍI??]I$Kq޾vqqww.pR7cw؟s?}NݐF?$۠&{I$I$I$I%?HI׮$I$I$I$I$I$I$;?ϰ=POtոI/ގCk*_bGӦy?Qc}7׷mv}s~S.خh}܎ע^J߲?㯻6Ͻ3F%7LumįsIyW$I$I$I$I$I$I$^ǼԷ?w $I$I$I$I$I$I$I$I$I/n|?f~anm_7Ƀ?}_W'{ӻ']f;vx]7I_V$uNun-u|S[Ov+Z-$O½$I$I$I$I%_>_V$I$I$I$Y* ;$I$I$I$H8yedm&_V$I$I$?nUYV;\q_z =->~ ~wܗVaqVex-2'NSj2Xe;/]v t'i}qoj;.%bQC04KrϷ|-1طȯԻ *ȗ-k?=I$I$I$I$I$I$I$I$I$I$I%?HI׮$I$I$I$I$I$I$;?ϰ=POtոI/ގCk*_bGӦy?QxGy}ْo],.s-k7[ٟ]_Ί؍eYOq/!e0~dvSkysI}~}ϟ"t} Xmݧ}κo#g>ؗ{8gf{:o9fMapAtp֐y9mv8/dv6x8~5cΧxЙlkg߳ݢ\<_Y^M{t\e? i#++[݃Lw=ϥo7G9/_I$I$I$I$I$I$I%=kI$I$I$I$I$I$I$I$I$PM;6Ɩ `]o="Lԓ_%?c_q\|ldzn<L >k꟱_hq5]>W*{`A[[˿ފ㵖9>&F7'k8Ym|ҽ9$I$I$I$I%_>_V$I$I$I$Y* ;$I$I$I$`]vk̴7?"<$+XXxؘPᮖA$IyWUzI$I$I$I$012YFEnq5 XXxؘPᮖA$I$I$I$I$I$I$I$I$I$I$4!'o^I$I$I$I$I$I$\?c[ַ>#Cq?VI$sz;>_ ڼ}9gNj~}_ܲ}ޝ57-Ӗy|Ls;ww93_/ֹ4x}ڿnfEmff3]oN|E4ei]vϴ8_>=lq{vi]|bv׉?wq)1vd=^%2>v9?x.8ۡ|گׄq?G# UӫWI$I$I$I$I$I$g{R$I$I$I$I$I$I$I$I$I$λ/Z,zYk?wOϊy;ݑť2埁{7SIw# [Jg[6IUvn>5 tO@%E}7@~W/n_d߮ɫ{r,uu:uY$ C;p=X彳s+V8.Z~I$I$AQ/zTI$I$I$\?bI$I$I$I$I$_[תI$I$I$I$I$I$I$I$I$I$I$I$I$I$I.iCNw $I$I$I$I$I$I$^ǼԷ?n}GӦĒI|w}_=yR/r>75pmϙ%xQt{rֳco.W觵aqϨg~>+h?N ;XNL}cv ߺ;W*;oVe_7Gmcm8݄daMB+pM{`r_A/*z;9_ZU$I$I$I$I$I$I$;?$I$I$I$I$I$I$I$I$I$w>W~9ܺ__Hӣ'a|w?+gl\êd.0 9H 諪;Yc\*m`+[ھ ]n&%<,`I$v;3n /1@,~JjǦiU[CX `U{^fͫ.(yg00Ry_3F,.=Oh!}nI$I$AQ/zTI$I$I$\?bI$I$I$Xh1k{ㆽg| ;cIoY屿PoSNƥjI/*UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\?zI$I$I$I$I$I$IpyoZ  M[$;vڮɡƷ~\CwϜ N/w.F#{.^?ri{+gGzm}YػOd~Uq\ ayo5z㑅Q*ժkazߦkΝĺI`_#ߡ?$GC'K|?i}+(ͳӸCŒyW$I$I$I$I$I$I$^ǼԷ?w $I$I$I$I$I$I$I$I$I$ww}ds{j_j#8=xC}hyufzl83p-kǃI%ǽ7~ hv5.5ANj Ŀtxhs_kkjo\4~KUw7Z8[oi.B}#on2WvkEx>.b$~l9zI$I$Kʿ}/DRI$I$I$IpUwI$I$I$@Yy/[cxZ%|}ǽ;ڎ qnM5iǃ@ \ZX[MY=oy$IyWUzI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ɵ?$pI$I$I$I$I$I$K{K_}n':jI$I%mϙ%xʿގFDVw0>eN1^,q\.1]?n]n;s*/Hz?i?Y~p]ٚݸ6KyRu\ukNxźܲs li uW*z;9_ZU$I$I$I$I$I$I$;?$I$I$I$I$I$I$I$I$I$^k>η=s{SVf@~G}{5eV/:q2|9ٍ-g놵pI$;wf پ 9G?/ӑٻGvU?z=4Lc}8NyɏKkbbL5S_{Swiv3wHAްI$I$Kʿ}/DRI$I$I$IpUwI$I$I$Xn?ݛŋꔒI%_>_V$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K]I$I$I$I$I$I$I.vױ?-O[a{q$I$>gW,ػO.p{+r˃L##c丯جެzxz*ŧks+k]ka>wϳy~eWC;s-J~}5w[KnMCn2O>\guc=ָ~cH]F|-Vv ƿ>Wcz}$I$I$I$I$I$I$WڎÉd288Iuy@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ?_lgemyo w0 a˴wϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕյ3우`cUi9wEc>z1-lIx/[wϕմ!]__m/{W[K o>UV׎}-viYu,>o /{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVWhm4D4~I$I$I$IpUwI$I$I$Xn?ݛŋꔒI%J3>ۗu2L~Twϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕյo_ݫaәq.\HѯJI$I$I$I$I$I$I%=ks/r>75n$KOnSכuts(-.ۿhOKϿ ,vK[V]#>2c ǟ3Kasmgb6[,ٝ1 !XmJW~v߲W-fT㖲3T?``<[>US]oͥ[ad? W O_=n0roX5E8yj4{%_)߲vy}ç:tŘ}7zI$I$I$I$I$I$I$I$I$I$I$I$I$I$I/*y9TU$I$IxG= f o_ΗtXY;y.h:E$Ӱ$11zeﷲݗmsjФ7\?{+stv- ctxsI$I$I$I$I$I$I$+?_'pXI$I$I%9hN:]ٿgXI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%=ks/r>75n$K?ޒλvhhԲI>~W_r.ku1K_de>&K8/Ǫ𹵀W<_]_]f㛐٣9 +eös_q/#1 []B %_G# UӫWI$I$I$I$I$I$I$I$I$I$I$I$I$I$㑛Q+?KԯeN ŧ~l|BI$I$k;-?T5eI<>}}$bݓn[ilD?H_QW\I$I$I$I$I$I$I$I$K]I$I$I$u? N_.I3N,_TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$g{R9gNI%WvΡ׷= 3okm9!8qו>gW$I$KʿގFDVUI$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_8#7VӪI$I$I$I$I$I$I$I$I$I$I$Y* ;$I$I$I,?_CPܿt?ğ|S?JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.vױ?-O[a{q$I$>gW$1S^76Ď7NƸ%7W[31===Ǜgzn;G>c?gM{+#uv,mq}߄4ǚ^Uwr0%_:zI$I$I$I$I$I$I$I$I$I$I$I$I$I$I/*y9TU$I$I$I$I$I$I$I$I$I$I$I%WI?.$I$I$IUw^יqsj˦Y /~{~b\0 X?#ʙZ?K}2I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^ǼԷ?n}GӦĒI73?'/"jV\ֶu̬z8=Sֺ'y.ay_o5zKޅ}eFZ'qmly&#azOu}/mcx얻3|o# a?7'xL~sį\IyW$I$I$I$I$I$I$I$I$I$I$I$I$I$I$fJuRTI$I$I$I$I$I$I$I$I$I$I$+?_'pXI$I$I$wq.xRǐ<$>ٻGi?{~6wS^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%=ks/r>75n$K?ޑ7v0"ןq.cz~l;afeddY{'\Zι/<[俎,{ltGX%pmϙ%xw,݇'广i&=k#ϟy3{zq߫srr_Aw <}%zKf2s{h״z3Fv7_06wխѹ# .yW$I$I$I$I$I$I$I$I$I$I$I$I$I$I$fJuRTI$I$I$I$I$I$I$I$I$I$I$+?_'pXI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\?c[ַ>#Cq?VI$sz;>_ ڼ}9gNj.Um.{`4d};qw껷qeRufVqٗ#5>7؜7#!u$Rv%%/h>cefa[陘:U^ 9?OiGcIq%qٷA?yk_ec8C={FTFVqߵg`܌kuv7I I$I$I$I$I$I$I$I$I$I$I$I$I$I$IyW?$I$I$I$I$I$I$I$I$I$I$I.VʿNw $I$I$I,?k}5=^3ɍV}?hxyM.- I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%=ks/r>75n$K?Pʗؿa{髇m|/ƮM쯺 ^Aɷ~\ 2@w覬zkUU5`9_o?Ƈ콡zZ 449oԽ߱N1;n#xhŬVR|u<Ϛ{r^ֺ|xFrl .oaJujTI$I$I$I$I$I$I$I$I$I$I$I$I$I$^Ur3%g:zI$I$I$I$I$I$I$I$I$I$I$K]I$I$I$K񁕝۽:ݐܻis}# n4+1qßM(n%Z:I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IpyoZ  M[$6{j/_}n':jǟ3K\bWw?Ueޭm|1ù7ϔW=a~ ؞~s!w ;7<߳ls)&>?Xh/4/WN^I$I$I$I$I$I$I$I$I$I$I$I$I$I$KʿqFoDU/UI$I$I$I$I$I$I$I$I$I$I$IpUwI$I$I$Iploϵ.̜{6ﺖ4>:a'~{l/Q@y$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$g{R9gNI%mK_=POt>gW,?k;,&LOh@hRW#/w̾Խ߾4LMYr2yץ$_;1"gWľtw#`^m#_fC}.ӰzS_ו/WN^I$I$I$I$I$I$I$I$I$I$I$I$I$I$KʿqFoDU/UI$I$I$I$I$I$I$I$I$I$I$IpUwI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%=ks/r>75n$K?Pʗؿa{髇m|/ƯT^%6?lܻEm2e ?%W 0|L7-/q}6x~Uۿć؜KsKcȺakK"/y 1DmMUڬ-\(//WN^I$I$I$I$I$I$I$I$I$I$I$I$I$I.G'`v^#wN.cZ,'"-uӁ13- ,ǹ x+EyW?}ǹvH?2:C, I\oگGS\eXNcH3vs^UŶk?E͒˒I$I$I$I$I$I$I$I$I$I$K]I$I$I$H9yPeȦcCM$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$;?ϰ=POtոI/z?~v 8F=_SnEMn0Iq< 쟲xggXXٞ6 >ǟ3KI$I%_G# UӫWI$I$I$I$I$I$I$I$I$I$I$I$I$KʿO_8Wlӄm}'w_9^cy8m]͜.vh;fy8tzsAHYKe?G}j0c#&Ghr$I$I$I$I$I$I$I$I$I$I$\?bI$I$I$/zlUUy9WSk\n'`|F]]aޙn,fi# xJ $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$;?ϰ=POtոI*ӷ`~~u ƽ6VV`c{[i -m?y|WNy?Q$^+ff_o1f5 ͟Hs  Dﰸv.ܪ[u=1w_?u~olt涂L;{ky 狆 _G# UӫWI$I$I$I$I$I$I$I$I$I$I$I$I$JVE6SumZgW$Kޏ?kik_վD  M\gsw N'NđUl6ƻbbQY 5~z;9_ZU$I$I$I$I$I$I$I$I$I$I$I$I$I$Iyyށݪb^Tz;ky WjY=[aV}\3Io /kzT"hqq6'gW$I$I$I$I$I$I$I$I$I$I$I$I$I$I$>wn߲j3;cLw;}&`O}}'!k(ܸCLZjS10- ȹ$x*2!Ymf_d?!WW4Ƣ[`ocZq3!ȩ5w;c^gWcz8gHKCg՗.i`pvd%ަO ^Uwr0%_:zI$I$I$I$I$I$I$I$I$I$I$I$I$I$KʿO_8Wlӄm}'w^'ݿk>a ,M=H__QMXM5hkr)I$I$I$I$I$I$I$I$I$I$I.VʿNw $I$I$Kr>7/9|t'_;8}RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K{K_}n':jI$Woݯ?hwJ_G[9.W'wk99wS[Z~.y_o5wcC_LgWAӣ{%_+i=zہINwݜkbq'_V{7 !XmJRݝ3׉]^MTQHk;Ņ;SXfUmq  /WN^I$I$I$I$I$I$Kټm.o84~3ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM…/NE6Sw϶Z?!z ]Nned}T:(~ICh/Iz鰏>Q#Dfĕaz_w.7Y@{mA(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_%]ՄQ__J?kw/kVGcM_(uܿXK%5 ģ1ra/~:_.]f_u[,]Ʋڬw>M3-2!v)$I$I$I$Y* ;$I$I$I,?_CPܿt?ğ|S?JI$^52iݷpwm75n$I$jDN%v\8iphAN~i}㑅Q*իRI$I$I$I$I$I$IpyoZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^U(?1%Uo^I$I$I$K]I$I$I$Y>wLfqߑUms /{Ux9s#܇X@'@_RI/*UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\b^67=k&xsW~I$I$I$I$I$I$K{K_}n':jI$I%mϙ%xꊯq]R.̧>W=e-{;}.ƃ}W? gG7[OsGuZew~MnvyexoOX5s{aowc~[qĻ n/10ܲ{;O ?<4s~:r/ [kk,":-ySaJujTI$I$I$I$I$I$\?c[ֻI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_[תI$I$I$g$pI$I$I$o7~sokjGd9e\l>r=R2w?c{u鱽ZF݋~vN=?K_3bW>gV75>22߃{qd[ˆ~R}Av=߻]mpw})uMʹl0KJI%/Sbw߿u8{[1h0U6ӭ7[42>}9Mɹ,9תjkO1"5>CVv_|ſg$I$I$I$I$I$I$;?$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%_>_V$I$I$I$Y* ;$I$I$I$I$I/*UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\?zI$I$I$I$I$I$IpyoZ  M[$6{j/_}n':jǟ3KI$Ir?kOwYlk[wpKƿ+({/h޾ܿu $I$I$I$I$I$I$^ǼԷ?w $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/*UI$I$I$I%WI?.$I$I$I$(kmV49ayTI$_[תI$I$I$I$I$I$I$I$I$I$I$I$I$I$I.iCNw $I$I$I$I$I$I$^ǼԷ?n}GӦĒI|w}_=yR/r>75pmϙ%x$I$㑅Q*իRI$I$I$I$I$I$IpyoZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^U(?1%Uo^I$I$I$K]I$I$I$KǸخeml>-;3uY-`G}@:I$AQ/zTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?HI׮$I$I$I$I$I$I$;?ϰ=POtոI/ގCk*_bGӦy?Q$I$^Uwr0%_:zI$I$I$I$I$I$I.vױ?-O]I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kʿ}/DRI$I$I$IpUwI$I$I$Ixۏ%;;>d_ ?ٿbvfeMDu3I?CI$^U(?1%Uo^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$) ;$I$I$I$I$I$I$g{R9gNI%mK_=POt>gW$I$KʿގFDVUI$I$I$I$I$I$I%=kI$YU}vϣ/hL|֏GZ$I$I$I$I$KW?dyeݧ[,`syKM{-N6[;mg|rjc{)%}g~9ֹ}6~OI8ɿs¸/ql>?ZʽK~/dh6U#Ԧz=9M-I$I$I$I$I%_>_V$I$I$I$Y* ;$I$I$I$I$I/*UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\?zI$I$I$I$I$I$IpyoZ  M[$6{j/_}n':jǟ3KI$I%_G# UӫWI$I$I$I$I$I$g{R$J|e,pыYܤ y5ﵶW[is0t}N><2W]VE5Mǰp<*i$I$I$I$I$v\gx.F lKHA-5DQ*oXFF{_qubʙ{GO WbƟ}4k?ZgÜį\is{vyN 2I ?q;į{n{xlЯ~_#vpQcd5:G+p{o;c^*o_ I$I$I$I$I$PbK޽U$I$I$I$+?_'pXI$I$I$I$I%_>_V$>?wqݎdכzlx=SwnZ>Ai~k{0{667 ,m|xaǗ+]^zp?rO?%qõ2g qFŤr+c??mgnշ6Y.iN~??_z|{sv\Yp  \8nG'3gcvl}[*ĸo]}ϋb8I$I$\ڧ?L}_UoMyyǺn[[^h-##]ߵWo~v&feM 8Ev=GvoW|vSo_L4}?w0;shʧ/1ȭd)VVf@w!=:/Q9}1Q<]]4 mc)/T/]8ug"zlֿtu\uyr\!@Z?ǟ\݁m85e6y=Ec?OpvWyxx74Z.L%q#v$I.iCNw $I$I$I$I$I$I$^ǼԷ?n}GӦĒIx';ӷi4gm9/r.ku1K_de>&K8/Ǫ𹵀W<_^I$I/*z;9_ZU$I$I$I$I$I$I$;?$^G7>}au/ʱg9o0L6l-?l{+]\_Lxh>Տsr;cv$t׷υzI$"U{y{nT)è?"Owr֓ve9p$I$I$I/zkS9TyT'UW$Oj}~p݄wpc[-oq-e\S1 |xKo21}fٍۚ*@0 ?oS7_A9F_>%mhNy-44uIu_:fo..K4 Wt?wa$I$I$I% .Um.{`4dkmV49ayUjS10- ȹ$x*UMwScmƇ12" Kʿ}/DRI$I$I$IpUwI$I$I$I|3|?hr{GscYQw Em2A3Jo{GONvuY{uĽL𖃭9m{I$AQ/zTI%ۯ_=r_SUa~϶[N36O̙+}|:~`l0\q)f+nalGzδ_\>5XHٙk~v]zqdW.) >f;E]U͒~=I@ijI$I$I/D }Vp1 0~d[o?;-o0l]1 ~Kz-g 2m?SxZW/ٙk~v]zqdW.) >f;E]U͒~=I@ijI$I$KʿގFDV?Lya {9} ~wKC@cOyW0>Ò/G>_[h~vҬk>%? ;)d9\*hf?K9jy/fI$I%?HI׮$I$I$I$I$I$I$;?ϰ=POtոI*ӷ`~~u ƽ6VV`c{[i -m?y|WNy?Q$I$^Uwr0%_:zI$I$I$I$I$q;'p÷ʻH{CL+ľꮧ%m:mB_=NƿXm&ܺwVy>|\?c[ֻ@Yy/[cxZ%y?v~컬fm<\t[HSϷwjBq\84 ߋo&?c ~ߺ3w_O$}dv .q~}Z3'߽?ns}/GُSܽotgvOZ,,­pBXZu;g/K}}}3?OW~8ήܺYg ]Hg'EhN;}׷Yc\KF^]3b%/ؽ Ļ/?g]?`ァoݯ)XżBDЃZ)$?MRK_RԟU^ݏM#bEd~]{|}5L7받ug"s}|^6:yum}v=ǐs?\E_k`w˲." }Ñ ~l@>߲́C tk?xOx&BoOda~]{}Ocb?MRY_7e3Os^] TI$I$I%_G^Ti+.Ӂouxܻ{Jݾ}^Kp[lsAgc-cfGyqqkl{`w<5!#ׁQ$PbK޽U$I$I$I$+?_'pXI$I$I%9hN:]ٿgXI$^U(?1%Uo^I$(^陟pkm˺L/(zkUU5`9ݱg{#\ƴ\szoO}qQ#Աύ qK'^dz?^lq}.k~uJ,?;F?D&dv.ww;߼}MbyO"BdI$I$I$>33 mwY{9I#k^ѲY^uZ+>1zGL7R>45Ly/?6-;+mոCi<B1=f\=XtwS M}]w_}x$N D$I$I$KޚN$o12߲?Am1Շ~Ӹ~vuơVX̟k_?}ֻp]M}gd ZL ܿs Cp'-x_O/.o]ڱlh3m5/?H.j)馶Um c 4@4I$\?zI$I$Xj>_ݽ}%{Iэ|:x_/;ٙ׊e;69fe1'ٮOq˳_qq#rO5I$I$I$g{R9gNI$Iy_o5zI$I$aJujTI$I$I$I$I$㋲!ޖcQq۹vn;krn]<GK>\ڻ r*՚I2c ~%g?՝^[L4LjVg{R$lv8.5pmA?;^V'c4b+o)>f:gOcI{;^xY_w;]L: /옹Xy= wzo/Zl`KyY@gnsFHϱfUW d]Dv+ϷXes~a __߲W{8hXؤvO'eQH;> !]__m/{W[K o>UVwϕմ!]__mvbvﱝ n.7A2Z@?Uo7SI/IRU{K?ޕϪ0wE7^-p ;vpteP۾x2_K'zYfnGns[aztG-Èryf>WңQO91|C}6e7V꭭ůc  M[ޚN%}g=}o].1i 1@yĻ/?gK%y#?/_.{w^KF^Gپ?/dXjspp!jK7zⱏn3L}˿bC-$T8}v0phn>5 ᮶OR/c0,iot { ~i: _[תI$I$I$g$pI$I$I$#CrӗK7LӋ)$Kʿ}/DRI%Wgڻ^f}Ϋ/xg20AMYl;7Vj?cć`Bw,݇'广i&=k#ϟy;;g~}9uLlˆ!xϷu} F?v N/GC;m5Þ+;3Ƨ99,h;7w^ԒI$Kʾ?+3~}ޟ~ƻXa?ԗXOs%Ińo?Rf/Kshg}Ϸ}LK`"XD>SVGMնڬk!$]ayno}*ɏZs^'w߽~kx+t{2k?^-0n_hm?%:k˪خU}{HJT6~]3wNHo?{kv$I$I$I/ޏ÷lq sY:>Ly y9T/q{ʏSCYჾ|61?)=/eu/Z[g33?nڞ 'y:[o:>dbc~ޢz6K9KξEu`>5۫OQZ^kI$I$4!'o^I$Ic_g~δܩphw]6LH`^3z 7ܫ,zrn:/#/ȳ&8΍s+g1 +ܖC`r e $I$I$I$^ǼԷ?n}GӦĒI%Gp5TzkK`fDyy_o5zI$I$s?n޻gM78ez?m q q6r= 뙙܊̯"o'I$I$I$I$I/ގCk*I 3/'"k<6R6u/c <2+bfs(ghG#+}Gn]yt;#V`;^UM]cj=02J?d~}m2CׇۘaKh_g]>Ƶվx@c`X?#?rIUn=w ]k\o?~5WgdRqkatqKx_nkʱTvy⯉K;_M$LEnO2,w5MּokL~߅ 1mUg@ȯG85s++}]_I/ /eCau%̾C.$ٗ{owr֓ve9p$7SI/IRU{K?ޕ3w}7P*p#o̿yzN?S/~Xn f[ۿ~eoߤ_BZvW[cpm͗nxگz_/?WkahoGyv?^-1{C#%]88`2+!]__m/{W[K o>UVwϕմ!]__mvbvﱝ n.7A2Z@?UoKޔ8]5՟RXog;+;f'm_ΰS5u~ce;u~=lHqdk_<nqu\xͤGci_Q$PbK޽U$I$I$I$+?_'pXI$I$I%9hN:]ٿgXI$^U(?1%Uo^I.sc}^; ꁏα .!|)p*?ipkn7|ii~6z7q1m}Wk-t ?rg{UՏMt[j n;}&&xxLJrw,Aӓ2*q oaz˃wᏌod'LI$YYfw |,V]9Ѯd ߲v/C`~=oǻoUػU׉io ~=,a#@Z+x_`ºco _9L|+lm s>ukbEf3גZ$lw.B)馶Um c 4@_vϷL[n]^@a{ϳͭe4=FB/ex!3$ɒOęZ)$I$'SھwL pV&]0$Lr<Ⱥˮc.'%A%:cwi a3wbcX]]Okw#,LLr+f88m×H?I$I$I$^ǼԷ?n}GӦĒIxѿi-?gkmo! ^+whg`|]}o>wr(ᜁ{0y?Q$I$_.Jibw\o'cWE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab5f1c}ڇ27?8W?g%̻[,Io?:^^Gwܻ~}5ニACl@W4]VE5Mǰp<*k~=ٰYcՆ%&3..hȐoݕg~Ch o"|\I[ .t}ʻܞel;oOnouq?"o'7l_duYu66ڬhs! zK7=2[ol>C'> ;IUzL/U^k!}ٿSswH׋^ƒK+GaOز{V[eNk o>UVwϕմ!]__m/{W[K o>UVm+njy9%tVI/zkS9TyT'UW$S}ѯ?r1{S97hYs [bN6A I5Oǿv x"\~_GOecx?Oc 8$I$I$I/Gw}džV>Z=|Q}~}YN3=fqLZٽq?}CO7KZs"Zzpqw̙^.>c=^$V=w?twA? +IyWUzI$I$I$I.VʿNw $I$I$Kr>7/9|t'_;8}RI$PbK޽U$\?c[־d쟾teqbkYá}a?XK){}]g)s! 'ڰwk~ˍiƹq}N#ڽ ;/de係zmkD1;32q2+ɡe.k\%UM]cj=02J/- H)oNGKa$}W>ghݽ?燋w.?߷c/jK,'9Z ~֥ݿ^3?Yz2ǍW-;_cZ]?Y`|+M=VW+޸5l:֟a`,uR]Cv{}]g)s! ػeߺ x~=6I/>@ ѐ3~F^K(ǭI\_vOq-3Ï< 3]I$I$I$H}a۽?O$?N~|2;#f ovX%:]$OF8ο&38(ǭVٞ@GI$+1>}woRq]Cv..47<rjǦiU[CX ywo5zI$I$^}g=}EHs}.q7d7?$I$I$I$I$_6 'UU>q9޸/1V_nŒ{kԯg"sIA =ze=v pZƻ`<7|J5NZw{iw}70C!&QsZgZWj~Cc/&zx,iKP~ g$Xe%?C2o!b_Iď7 %[e=fskHC<%} &2{ L,LP,gl#_L zw{˽,7}Πr ~O0{o=Ȫ[}Ŝ|S*s#+a95~, u }}G6ﻃ,n?Uu^I$I$I$wod({E84,t~ÿ_}owle{5avF#q\>*Y#+v.YN#;c"G9nnnuNO㚋Cal$#id})¯G:sMfh>7f^v6K5[0Xdf}y7q~ TO Fl }/3 LA\9t>2OFN݃}97#[^ OGW}-;4xhoG ҿxM=oi|HV= Y̲+ǾLnX<]I$I$I,}ڮs%;7w/4F7wMM0ds+?fkm˥$0{-Atw?l~U^'ӓYw,pOuwc<۝kZ~I' !w,>v̛18en뮁xgG L[f{\8Zwe $I$I$I$Y* ;$I$I$I,?_CPܿt?ğ|S?JI$AQ/zTIyW՝ ûKSu,®ƍVc>Cre0nhm%sLO;~skgopƘȰ7!W$cecfr].e{FdLĎb۝?۸h}|QuxbAkjbf~v|LaNm-eY~s~ }$Voٯ%9} &ctk7cݷ*K{%_)߲v/C`}v.qa[_KH㑅Q*ի;A}v%?>2Y]|}܇-O0˘v߮8؏wv׉O_쓹gW] ] 4\?=yªٓѕ9/8 Moڿ662x[oKI$I$I%ly`S.M.Nϸ|}v0phn>5 ᮶OR/?=ջ*j?ē_ٜO_g^3ON]e ^yAV⻷,3_ٶ#?nh E'ͬş>=ϸWeXz'kZc$|'I%?HI׮$I$_|v'rį.~mwmyo m{mx -8=vgW$I$K>gzeħ9My6l}-滏S-)ff\܎{MdO]s09L$4I$I$I$I$IBǦˮU[K %|{gtk"j,3dZ&x1y:cWy?i2|I%_>_V$I$I$v}O,J%ᲃ Ivᙟi/U?w/fեOamu?a?`.ɲ$I$I$I$I;/de係zmkD',yMkt8{x)$qr9{Fo{ ]Ͼ uc[{c7%U OPan$I$I$I$Kn--~}YoƩ}P;Zlg^^7_qzS;֣Xl}KGGoo ^8}/nܾ ̮'o~`|TI.iCNw $I$I$}i17.pؘ%_}Xݫ>~>\AwZ$I$I$I$I$#hvK̽U4dnZ\t žAs l7,'-OOoiϫ$cwA T}ȺˮN\' ̓Ɖ+vdv1dN^C\1b갱keL}%$I$I$I$I$I$I$I$I$I$I%޻&|W YVEs pc"/y 1?N~z|qG)TI/'?ߴ=opsSk }'r/{xQݍn=thg̞'HPĖ&?oSc沪3x I$I$I$IpUwI$I$I$I$I$^U(?1%Uo^I$I$Kw9ikq1;2mqX&..t@.%XMIq4êO}?d;fN^D\` Nowg]N6F~Es\y(a~}eN@qP:4I$I$I$Iywdv:W;]&G'~`c,|LfpQ[j<-hgӕ'[q+nGپpnN;CCp =}O~̖ʤzG#饰I$I$I$K5 [M-k`:OayWUz?G,f:y6˭.I%?HI׮$I$I$I$I$I$I$I$I|w}_=yR/r>75pmϙ%x$I$cowv>we,kWvC<]%]^S^Urbv<[u,yƤ0yokeCkgh"ǵż  ?"{FI$I$I$I%]MvvZٸ[psgL߱9θKfzN۰{GoPoO*Jt=߷߃Cr1o z杳Hvʧ*b>q[VתI$I$I$_c4̳."<{ǿ]&ҏ\ _o??9> }1;uasJ?ir?[9obc;7.dzw<=]w`^̒I.iCNw $I$I$I$I$I$I$I$K?Pʗؿa{髇m|/ƯTI$I$qoCl/I$I$I$I$I$I$\?c[ֻI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_[תI$I$I$g$pI$I$I$jYj3wnϻD ?F>kp3zFj﷽#''s̻:ֽԺ^cg&xKA$IyWUzI$I$I(_MYMնڬik!.+"/y 1_ٯf>uݧۛ=<%I$I$I$I$I$I$I$I$I$I$Uq;on"\:qw練iqi$\?zI$I$I$I$I$I$I$I$G W/~#Cq?W<_^I$I/|Oj_F$I$I$I$I$I$I$^ǼԷ?w $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/*UI$I$I$I%WI?.$I$I$I%i2>ffvLggcf..v=ĹpsNػ|30.|)2I$AQ/zTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?HI׮$I$I$I$I$I$I$I$I|w}_=yR/r>75pmϙ%x$I$yz?mbI$I$I$I$I$I$K{KpI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$AQ/zTI$I$I$\?bI$I$I$I$I$_[תI$I$I$I$I$I$I$I$I$I$I$I$I$I$I.iCNw $I$I$I$I$I$I$I$K?Pʗؿa{髇m|/ƯTI$I$qoCl/I$I$I$I$I$I$\þ}]3 ᵄmiHwVw*@' (E5}bY*Wsu?NSo?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~92~}~_ja7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4S~w~g?:D ђI$I$I$IpUwI$I$I$I$I$^GO?jQݳ]mn5EύngK7(vϴ?nSn6L+xNI$I$I$I$I$I$I$I$_9|/Om^T  M\?o5zI$I$^}g=}I$I$I$I$I$I$I$I$I$I$I$I$I$I$㑛Q+?KRI$I$I$I$I$I$I$I$I$I$I$\?bI$I$I$^%4v=+'6ܞٗ&[WO(70wo=7ې?##<$I$I$I$I$I$I$I$I$KʾC}m/UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$#2U۰=fƵì}' ǑBo?#=ޫ;^5 :GZ'E5c]4ڪcy?Q$I$_/Uy> ԾI$I$I$I$I$I$I$I$I$I$I$I$I$I$IyW?ٸgnAA#`#I$I$I$I$I$I$I$I$I$I$I.VʿNw $I$I$K+f^Go-2~>E'ͬ3]ٿgXI$I$I$I$I$I$I$I$I$}ΆOP^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kǟ3KI$I%?v["sѐ%z7)XW"{IRI$I$I$I$I$I$I$I$I$I$I$I$I$I$KʿqFoDU/UI$I$I$I$I$I$I$I$I$I$I$IpUwI$I$I$Xn?ݛŋꔒI$I$I$I$I$I$I$I$IyWo e$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$y?Q$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^Ur3%g:zI$I$I$I$I$I$I$I$I$I$I$K]I$I$I$u? N_.I3N,_TI$I$I$I$I$I$I$I$KʾC}m/UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_d~.'kgW$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KʿqFoDU/UI$I$I$I$I$I$I$I$I$I$I$IpUwI$I$I$Xn?ݛŋꔒI$I$I$I$I$I$I$I$IyWo e$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?/avus75I^WgK}W(mV 'g~#f&?og3ֈ ̾ǟ3KI$I%ۿ~0 хE5䶶;%-'`y(70wo=7ې?##<$I$I$I$I$I$I$I$I$I$I$I$I$I$I$fJuRTI$I$I$I$I$I$I$I$I$I$I$+?_'pXI$I$I%9hN:]ٿgXI$I$I$I$I$I$I$I$I$}ΆOP^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kǟ3KI$I%_P?KĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$YN^I$I$I$I$I$I$I$I$I$I$I$g$pI$I$I$#CrӗK7LӋ)$I$I$I$I$I$I$I$I$i_RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy_o5zI$I$^}g=}I$I$I$I$I$I$I$I$I$I$I$I$I$I$㑛Q+?KRI$I$I$I$I$I$I$I$I$I$I$\?bI$I$I$_=}[{ 8:k9.5]=۱wKqf- =~2F8{~5UI,.iw``.7?'Iywoh 6n;9y3#^>e/ؽ Ļ0gK%#?/G_.?z?waP}pa> /4|nګȿ2p\?@AgjYhrGeG l k rژ?9&>3]cK\ElǪ%/ؽ Ļ0gK%#?/G_.?z?>YڻsܖQŨ>TowO?s_m{ⱳMFGC[6Z4"<\Iyvwpqqe u 8_/waKF^]3b%/ؽ Ļ0g^)e_jomNm]XGY1 ..M7uxWr]G-M6nogAkF}m__W.+k}Wa#ݛp\zD#f9|Z+f=P!-'?ؽ Ļ0gK%#?/G_.?z?waM6;sMh-mwlc8_A:R\wi Evg`vW8<:Wۑ쏺ˇ'TKlO_g;K}ON]\@^y4~S&Ͻt}˸>pZ= 5S%#?/G_.?z?waKF^]3b.[ߴ7Ͽџet1c^@}%}U?GqwbC -jNy-h[wvlšzcNΏ\~ᅏ:2+m#Wڞowuq3 w&t _9fO9/芩\84ؽ Ļ0gK%#?/G_.?z?waoi8pQW{CzG t믧\V߱e! VXW} {r8[ݑCÙp`d{)lmX=CASYh];xKq)}.wMqn*ǧCH>?TwaKF^]3b.s>5}'7S]A'@+)}9gNjDI$I|w_rv'ߝHA~IoO_ /_:hQk^)@_dv;T}nCK1i#j}R߶j][E6?8">˒oǻ[ _XrKRak_ o _7c-K{%)ߵw/z%0£krXOAXS7ږȧ/U2)g\-/5n1_m)47:R^{W ˳^^GƇR}J$/{I|wAfuy+y Cb|֗ ݪ̮ٗs2"4~G>_O$3|Y쪭VY4nO|yo _XrKRak_ o _7c-K{%)ߵw//`K}MGیnnmcN蔗/hշS(ˬ5Sq}0o]Yo>e'Lm.QzؒIx'{ݻ6o,{d˽@~ ?oǻ[ _XrKRak_ o _7c-K{%)ߵw/t/~,98tdՓmu>z~ĕK>ݮgU[~pck&]'#o>W.(oe]M/elsOM^c>>~{.éqN|#{%)ߵw//`~=ܿoǻ[ _XrKVϲjqv+YU^~+X@I&Չ/'f;}/;/.[U@?K7ӿژ/`>dvݟ%ccfx\+Us/};nknmftOi|~=ܿoǻ[ _XrKRak_ o _7c-K{%*klp/tz4#=6Iy3[{6?8hp?!;>}o8ѿD_X}}xLJ(yg"X -~}Ͷ Sg`?`|W7c-K{%)ߵw//`~=ܿJ>}o8ѿD_X}}xLJ(yg"X /dWuVR @"'SIfYxGf?m;fqqf[_-sgwNn3%p g\ki8Y 8o̗Nek^~U=YMn>.sH2<ļ͝h]u]x%, FkGr]rI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$y?Q$I$_4}_k1{U] ݼ;>Z\ .^|סs>ّ{fEl\GSè>:TI$I$I$I$I$I$I$I$I$I$I$I$I$Xl{+~}]d_ Lx89quVױ HPI%8}Xǿ]Tz%vyOZW$I$I$I$I$I$I$I$I$I$I$K]I$I$I$I$I$I$I$I$I$I$I$I$KFE.n82ds5I%/~&|snLI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$>gW$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$se?zгWN^9x߉f:g^I$I$I$I$I$I$I$I$I$I$I$+?_'pXI$I$I$I$I$I$I$I$I$I$I$I$ۿu}/-{xv3< t%|zK uhk]껈Ec/JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^W<_^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$]wOamo}+Frr_bdv܌Lp_c<.iB>ۻYɫњ}>6 <H#}$I$I$I$I$I$I$I$I$I$I$I.VʿNw $I$I$I$I$I$I$I$I$I$I$I$I$Ve?ؿ03#3rijO/}b}ҷ5ٗ zUώGJފjǦiU[CX M$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy_o5zI$I$}w9fa0׾d9B?fㇻ4{rv$|ǀdI$I$I$I$I$I$I$I$I$I$I$I$I$I%?D}sCHdQb@qitqLcc3^q1$|AO;nKhtl\~w/?'f_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ ivۻ& s*/ǰ<!ZI$I$I$I%WI?.$I$I$I$I$Ief9_0dqWvC̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_K;ٟqE}}nE~l. i{?ؗ*oy~aY0IJQ؜A:|}}5ߴ48q1~ ̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ym,Y7xk!s|Z$I$I$I$I$I$I$I$I$jDI$I| ԾI$I$I$I$I$I$IpyoZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^U(?1%Uo^I$I$I$K]I$I$I$I$I$AQ/zTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I%̼|_%?c{Ʋg>~w$I$I$I$I$I$I$I$I$jDI$I|DkyU&ǪZ,o~|I+餒I|4wOjFdn5Ygf89D_ggcm?dE9S [ sOwF\xI$I$I fכ,654fBOO t{m-Iva͍Q?ħ\Um8}޺qr< 8ZzBJ{}5\u=:gj/O'?$X_k;N s?h~wL}X mǹņv(^~]&lqh] rwkX5ՔBcY/k;7q˶b팢狲Zx3 ̸d-xX̢cɃuy$I$ƥ5\kihZtȟ8w$I$I$I$I$I$I$I$I$jDI$I|xdߤI/z_/?Wkaho]]bۯC=|ۇgs lG<-pk.к㑛Q+?KW^g?IՔj{MXM5hkr)I$K]I$I$I$I$I$I$I$I$I$y?Q$I$_/Uy> ԾI$I$I$I$I$I$IpyoZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^U(?1%Uo^I$I$I$K]I$I$I$I$I$AQ/zTI$I$I$I$I$Iyq߆e=FU1{unq+>n?u6:kNc`W).cڗ}ť}Ӹ\\w8;{G_^W2;[~ln;_oN_,q-WxmgԱ8_ ڽVvyة=N,a|~}HqBGٻ}=]{Xqr7?l]f>ߍ^Ma@@zTY}zж?ڶ쾥,nGsps}l +};܎v~^ 'ىWNI$I$) ;$I$I$I$I$I$I$I$I$Kǟ3KI$I%G/5eU0ݝÿAsrz=쭙׺K: iV eu<:CUI$I$I$I$I$I$IpyoZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^U(?1%Uo^I$I$I$K]I$I$I$I$I$AQ/zTI$I$I$I$I$Iy _?~G+>E_;Է8})O/#}y/# V VqۏCx?.]v/okrsۨ_ ͦg}WٗqfMˇqU.l`u|~#I$I$IpORvI$I$I$I$I$I$I$I$I$>gW$I$I$I$I$I$I$I$I$K{KpI$I$I$I$I$I$I$I$}ceXڪ{̒o=J.{_:7ŠB]_ٯ=E7[3[]fpPmUV@IXgv?yݯ#_plhK49rI$I$IcM~bcwKN=ziw sދVȦcCM$I$IyWUzI$I$I$I.VʿNw $I$I$I$I$Kʿ}/DRI$I$I$I$I$Ir?cUx%Z]Fn`Z_aG>3gŮݛ ފcX@ORchRXM?'}4aɮ淈w9IG@ﺬzlUUy9W=~.xHao?I$I%N×vj}l#uĆlk[ o>[Vwϖյf)he˞8:qpǚ_]m/{oo[^ػOd~Uq\ a^I|u>h%O\9S-6V#˯'5җwyoqZ[Z[v>>6芘rq#gW$I$I$I$I$I$I$I$I$K{KpI$I$I$I$I$I$I$I(_uXu6iss$msqYرA g^En+}p8* Μ}93k_`u~qø̃xLk`u^p{Go;:P+,wO jK9{FV >hv݃;}847[zVI$I$I7c?/U7ȯJ&9]_w]+d< 5#<~'|TeV,o)F:G^I$I$_[תI$I$I$g$pI$I$I$I$I$PbK޽U$I$I$I$I$I$[~}.F< iΩׁAzR7SIfc{=}"Ƶ󉉧xq9sA$9{cXbvFыXy5/eͷ=iK|X[3<4S ّexߊ%$ NߌdqYsZ2EdS]j{ ȂI$s D/I$eg[~g<,\yϐ澴%*5kmɷdZ.{ѝF6}[1K}5/7e{r;K{$gf'bI]:I/5{Ifsj%t]ξK&&'bA^}ceXڪ{̒Tcߺ}vٍd8 04 }9$IpORvI$I$I$I$I$I$I$I$I$>gW$I$K׶c}2/ji]\'G|֗}clD7w8s?½E$Ͽó9k6#pfnOh^_dX,%=[$I$I$J|XeܶQYܤy95QWd7`?%طU\Z-l /I$I%_>_V$I$I$I$Y* ;$I$I$I$I$I/*UI$I$I$I$I$Iq]jWfc\GXlsh<<}iڲ~C,59o8?}~?{uU[d |A*U7qmo̓4__fM]-خUGZG|8>cW\`vQtt?į5cevu~Ko\-cc&tzG}wwHAу+ˑE^n˕FmlŮqtO1F=m:I$wt5ܾI$^Wjy:Jlcd?ؔ\ˮifv4jr<×$KC}u?v{c7h^ڒK+f^Go-2~>E'ͬnËG {oYnU< c@^ϼvϸ~Qemm}Gљx^fyA>YGVfn6omĮ뮜9`;{H]|>vߙ^m><I%?HI׮$I$I$I$I$I$I$I$I$^W<_^I$I/|Oj_F$I$I$I$I$I$I$^ǼԷ?w $I$I$t # .qrW}_i;شlL7c9VCi5sKyFuWo>><]{q;Oo&Z[S^{n}7[;hisάOZ`?Kw,ʳӦ^.'@kKLΟ u^ƒI$I$I$KrOu~S7q2^~6}`xn_tAߑ3s,%8| ]RraQ{rm<1czߨ/ܻ-ƥƾ0H60q|,m'zN_ޟk橴yI$ϵr{GqzUK L4~)+3~5= Gi<מO { q]ݱ(HaXvKkf#Mh^K$I$̿awjo zq״O/Gr dWbI$Kʿ}/DRI$I$I$IpUwI$I$I$I$I$^U(?1%Uo^I$I$I$I$I$I$I$I/O~;>>65S9㸴@3O/wI$I$I% ")U-{$8`zkUU5`9P鮚kmUV1@SI%9hNAo}/ac^_6nyJٗ{op}adCr:.a #Cq?VI$) ;$I$I$I$I$I$I$I$I$Kǟ3KI$I%_P?KĒI$I$I$I$I$I$;?$I$I$_ϫ6`0D}~_s7}U}9p"./eWڱ;/ clku :-y/~[n^%3/`&Kus?zػ2_zy0 ]W1i/Uۓi$;zu}ΎOECb~bq>cc c\7whN/|XXʪsv6jzv&;/qz}QPL.$\ںz~u`9y8䒺eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W>_%؝ & t1to+U$I$I$I%mϙ%x$I$yz?mbI$I$I$I$I$I$K{KpI$I$Kڮ/ŏ.Ȥ7{uG7N?kޚㅀёoYa5u`%/ ~ ۰nvvX WW@?}oE5c]4ڪcI$I$I$;݇q,ptHidjokn큍>q {2I/zkS9T?mbI$]h_x{oj!^-OPо[wm`4;8 v'ĕf^?pS2FFnE#[wm`4;8 v'ĕI$?MRX87ڗщ$I$PbK޽U$I$I$I$+?_'pXI$I$I$I$I%_>_V$ϳRw^] }MC +;O񙋍k쟼Yg 7[g:Y&wz}ŻM9ߧA {ٟ=?h}J_[á-TI$I$I$I$I$Yi0-g{%/_+_`m'f~Kr2k"ʿralIpk4u.$I$I$I$I$}oN_+1R{uM9.7_g6qshQ_r[7aaG{23r,"O%viI٩s{^y0q?TOp^I.qbc /8,#Ucf8Q" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1}=W?ތ?7#m1W$I$I$I$y?Q$I$_/Uy> ԾI$I$I$I$I$I$IpyoZI$I$Ix]龏i-..92ؖ3|/ c~?=Y2O HwazƷڌd3ge1.l~~; ˿/wg: lG3h͂k.ҾI%?ヺ퟽?]/=]˃}Wܿ*_;Ve_Grc_yh_ oZK/K߻'oj^\I%-վcN08|`{+=ͶA sčiI%I`UgӞKZ2 "\wηU_۬ƵZ?YW $javR8\2?: ah`dez/Ȳ͗_ ꔗ5c!_;.шֿNsc' ^A#~[]#vwN[˗ ~->I$IxgTn=H7)dzpcUjwE4-q'i$I$PbK޽U$I$I$I$+?_'pXI$I$I$I$I%_>_V$gloۚFZ\;0!w`>=+@:+_4/?f{6WociM{cq@p!u_3i &W5]I8{jI$~ޟ.̗~.>GU?yh_ oZK/I1i/UgW$I$K87ڗщ$I$I$I$I$I$I.vױ?-O]I$I$I/zw{˽,7}Πr d;F6-N3+6aj{ۧG9tCv{qӥ}V;Z:݁t9}>UgH{k=уCqo uzi$I$I$I$ ~߅ 1u:'Wd}g/KsjkO(y{KIs3>*xSOxhϫ^uŮ񹦱ݵI/'z+; kapwq_`bïw?o+=xYC8}MEdS]j{ ȂOnm o 'Q}9J{B0q6=F#+?;8XxؘPᮖA$I%gйx?oY]O~.UZ#wm-Ϻ̮68Aq $I$_[תI$I$I$g$pI$I$I$I$I$PbK޽U%߿ǺqѶ$qv5D/ݦ0?|rn _koeKޚN%iN ۙ]m-$I$I$Kk,q;;m>0mÂ?Wq#?C+ /b!HK$Xe%?C2o!b_Iď7 $G؆W_#?C+ /b!HK$Xe%?C2o!b_Iď7 $G؆W_#?C+ /b!HK$Xe%?C2o!b_Iď7 $G؆W_#?C+ /b!HK$Xe%?C2o!b_Iď7 $G؆W_#?C+ /b!HK$Xe$6N3'g]VV@6dGH>Ɵ?$pI$I$I$I$I$o]KнU$I$I$I%mϙ%x$I$yz?mbI$I$I$I$I$I$K{KpI$I$Gݪ=?[Ksxl/ŷe}s0l"8^n%6W{7t썲iT'h,>.: }9h2[tq3$WyE5c]4ڪcI$I$I$K}^e:Yexu~gZ?q<~NJKF jI$_.c~e# : N\G 729ݪ݇K,k l_[bdӏCGK}3ُ̼5SvOO0] Nsۇp㷽.'~dto]_]Gxٙ!L4Gh%^^mcrMO8}K 7w{-i0߷\ķ4ff;a`\pQi vI(_uXu6iss$pp2Ɵ{K}\>Fh}JjǦiU[CX M$I$_[תI$I$I$g$pI$I$I$I$I$PbK޽U%G}}Xݻlz%UOZd2{೸d}uW?T͟n{vbZK'8DJN1;n#xhŬVR|u<ϚI$pv=%ypϹy_WRbr_Wyo_o]K/mgƶ 幮}avpBI$I$I$I$I$I$I$I$I$I$4!'o^I$I$I$I$I%_>_V$I$I$I/+m|/ƯTI$I$j?M}\}JǛ[% v ܎+Վ﬇߫ _cI$I$I$I$I$I$IpyoZI$I$^UGw n˸,#?]U;2m{xphhèȇL=g^I$I$I$I,_l;/̮~5ST-]OµgkO*=RVpG#KƋ?f{cx`}WtC4x {j}7Zm'S$K+7[ۻ^/#Џj-;߭hLaBIi mXl{~]ЖcR_$ xu?g^{oI!^-PҾI$^_ynmh/>`_A#]xl~6vk`wu[]ikC5o2O;i;kn.8qw$$֊KƟn%c~ʶ̬u?SrB݆Zֻ߽2V״~h]:I$I$PbK޽U$I$I$I$+?_'pXI$I$I$I$I%_>_V/?OvOcqd7ާgpGt^%Ox݇7c:Nˏsrlrߔsyo~c>;ȑMͱdM3ݑ>c;X̎wYs@;q08v=K#!{`II$I$I$I$I$I$I$I$I$I$I$I$I$\?zI$I$I$I$I$ZI$I$I$y?Q$I$I$I$I$I$I$I$I$\?c[ֻI$I%;&YڻGS붮q;5n>=+oMMȣU`OƗG-O؎ד~7:n~K Ih^fEXdk[]e<\^xNJ:I$I$I$I.loKhs/W7LGӯ74ͿWN`OSsxGj 7eߋX;ۭeuˠ[$I$b?hy.2 c#y8=_u/n l@c}+)܂Gr~Qb;FK28}<\!I$};X坛ggxr>䳷}9=o )Z\`֧3 /;bƣf?\@!j?=w>lKeţ~>]R'Ov7kNV}n$I$I/*UI$I$I$I%WI?.$I$I$I$I$IyWUz}ޝwovL.mENhX`N"W~漫Gmמ*_OC!U?iŏv[u?vʷF!tI1z U;_ GoveɵǏshw4SV=5Mm0@h klO_g;K}ON]\@^y4~S&?ww}7gl{c=48wn8##2[X8ݫsm\WWwKxI$I$I$I$I$I$I$I$I$I$I$I$\?zI$I$I$I$I$ZI$I$I$y?Q$I$I$I$I$I$I$I$I$\?c[ֻI$I$I$I$I$I$I$I$I$I$I$U{m֑N~9qdV񂧅񙍉^5 hk[;I$I$I$_[תI$I$I$g$pI$I$I$I$I$PbK޽Ux'ѿhwp9GHh=D7~|_dhuݸow_؇29/A$^ 93޿Ɨaܪqݏ[K}>plLtsG\ow^_onF'k1 ݟ<&vJ(o9>'\I$I$I$I$I$I$\?j>2~cdbWܤ$:W>2;n>&7َ;,mUתl<.]+6R=&qZy}~ב=:kONAQ汾c[gִ6|X%8N~3]U~M-oGI$I$I$I$\?zI$I$I$I$I$ZI$I$I$y?Q$I$^+t9]X;Udq7o8]#TmyPa\Ďq< $I$I$I$I$I$I%=kI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IyWUzI$I$I$I.VʿNw $I$I$I$I$Kʿ}/DWwO?gv^~E[opƆ/@鮚kmUV1@SI$}۸ _=;68?GXޥ×9`%4ӌ{M\MG ]=۟&Dt?fvW}W[cȸSI$I$I$I$I$I$I.sc}^; ꁏα .!x_eYX_\u&+}.NGo=go}m43vߥyį@3{vWK6IwW8'I$I$I$I$Ɵ?$pI$I$I$I$I$o]KнU$I$I$I%mϙ%x$I$yz?mbI$I$I$I$I$I$K{KpI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$AQ/zTI$I$I$\?bI$I$I$I$I$_[תI$I$I$I$I$I$I$I$I.vױ?-O^s_o;x}pG?U35Jvp]vciG8ag]]6dw $09xѤI$I$I$I$Ɵ?$pI$I$I$I$I$o]KнU$I$I$I%mϙ%x$I$yz?mbI$I$I$I$I$I$K{KpI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$AQ/zTI$I$I$\?bI$I$I$I$I$_[תI$I$I$I$I$I$I$I$I/.z*k X`?0 yT'UWwN;}׷Yc\\NrGřެV!ˎbcI$I$I$I$I$) ;$I$I$I$I$I/*_/UI$I$I$Iy_o5zI$I$^}g=}I$I$I$I$I$I$g{R$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$PbK޽U$I$I$I$+?_'pXI$I$I$I$I%_>_V$I$I$I$I$I$I$I$I$Kޕs;_dpus6?:㑛Q+?KJmi+s߲]*_y!H;?Ui$I$I$I$I$K]I$I$I$I$I$uQ/BTI$I$I$>gW$I$K87ڗщ$I$I$I$I$I$I,?bYodpq:{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕյgؾ˪@`Շi7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ}b>vM|∆]RI$I$I$I.VʿNw $I$I$I$I$K{'{_q,ʰSc8xa;; Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./@d?˽|7r*i Cܿʿ_}./,_f0}ogIs<?!]__m/{W[K o>UVwϕմ!]__m/{W[^e7~};nVM[2! } [;p4T,sY{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVվ%~v釟Nf{ĺepK"F)$I$I$I$I$IyWUzI$I$I$Kǟ3KI$I%_P?KĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$YN^I$I$I$I$I$I$I$I$I$I$I$g$pI$I$I$I$I$I$I$I$I$I$I$I$I/*= {U$I%ۑSMn0)k%lc>W:~]oyJI$I$I$I$I$I$I$I$I$I$I%_>_V$I$I$I/+m|/ƯTI$I$qoCl/I$I$I$I$I$I$I$I$I$I$I$I$I$I$^Ur3%g:zI$I$I$I$I$I$I$I$I$I$I$K]I$I$I$I$I$I$I$I$I$I$I$I$I$t72+[lhs]D4I%an3=7!Hu#tI$I$I$I$I$I$I$I$I$I$I%_>_V$I$I$I/+m|/ƯTI$I$nwϱ'u/}6u| LJO v ܎+Վ﬇߫ _cI$I$I$I$I$I$I$I$I$I$I$I$I$I$IyW?$I$I$I$I$I$I$I$I$I$I$I.VʿNw $I$I$I$I$I$I$I$I$I$I$I$I$i_RI$I$I$I$I$I$I$I$I$I$I$I$I%_>_V$I$I$I/+m|/ƯTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$YN^I$I$I$I$I$I$I$I$I$I$I$g$pI$I$I$I$I$I$I$I$I$I$I$I$I/*= {U$I$I$I$I$I$I$I$I$I$I$I$I$^U7.%Uh^I$I$I$jDI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IyW?$I$I$I$I$I$I$I$I$I$I$I.VʿNw $I$I$I$I$I$I$I$I$I$I$I$I$i_RI$I$I$I$I$I$I$I$I$I$I$I$I%_>_V$I$I$I/+m|/ƯTI$I$Wڻf#rsq[}k4A 3Wc};#Cd@I$I$I$I$I$I$I$I$I$I$I$I$I$I$^Ur3%g:zI$I$I$I$I$I$I$I$I$I$I$K]I$I$I$I$I$I$I$I$I$I$I$I$I$t72TI$I$I$I$I$I$I$I$I$I$I$I$IyWUzI$I$I$Kǟ3KI$I% [u]c=2\O2J/P?KĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$YN^I$I$I$I$I$I$I$I$I$I$I$g$pI$I$I$I$I$I$I$I$I$I$I$I$I/*= {U$I$I$I$I$I$I$I$I$I$I$I$I$^U7.%Uh^I$I$I$jDI$I| ԾI$I$I$I$I$I$I$I$I$I$I$I$I$I$IyW?$I$I$I$I$I$I$I$I$I$I$I.VʿNw $I$I$I$I$I$I$I$I$I$I$I$I$i_RI$I$I$I$I$I$I$I$I$I$I$I$I%_>_V$I$I$I/+m|/ƯTI$I$qoCl/I$I$I$I$I$I$I$I$I$I$I$I$I$I$^Ur3%g:zI$I$I$I$I$I$I$I$I$I$I$K]I$I$I$I$I$I$I$I$I$I$I$I$I$t72TI$I$I$I$I$I$I$I$I$I$I$I$IyWUzI$I$I$Kǟ3KI$I%_P?KĒI$I$I$I$I$I$I$I$I$I$I$I$I$\O콻vG`]ƴYFND /g?Q!:[.qbfZYs@V㑛Q+?Krݪv~e8upX ߵ_g`9M%ʰ:g+9Vv<݋mc:%%i$I$I$I$I$I$I$I$I$I$I$+?_'pXI$I$I$I$I$I$I$I$I$I$I$I%>;,ŮƷ#-⩮t'#z*=c}MgyƟSbbD5/*= {Ua}'z/io13>\Ol*_ve߽x5}Aѵ.qt$I$I$I$I$I$I$I$I$I$I$I$Kʿ}D RI$I$I$^W<_^I$I/|Oj_F$I$I$I$I$I$I$I$I$I$I$I$I$I$S;5s?t}IWkGwک4wL:1{>0 ]Ie]Ys Vr?OQZ< ɑt},G<I$I$I$I$I$I$I$I$I$I$I$+?_'pXI$I$I$I$I$I$I$I$I$I$I$I%GvN2n[xʬR<ǚvn[xoŰp|<ǒn]ǵ\n̻{ f{;[smo t@e Y{˜\Fq2;n>&38ȱVَ'8_bxf`1k.wssII$I$I$I$I$I$I$I$I$I$I$I$o]KнU$I$I$I%mϙ%x$I$`Lmͽo48~#9}f^w։KqᏟ^I$I$I$I$I$I$I$I$I$I$I$I$I$JVE6SumZvOskrxp6`7rI$I$I$I$I$I$I$I$I$I$I%WI?.$I$I$I$I$I$I$I$I$I$I$I$I%_B}u6#6CV>|'W~η/fw˚X0l#?oOς $I$I$I$I$I$I$I$I$I$I$I$I%gcl˚>ǚ3YH!DO][<)w/O?d?]{%rCܿ线_<)w/?O|N]Y`p;vuz2I$I$y?Q$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?s;wzgv?ۇF͉.'eoQ`iPɎp}GEstI$I$I$I$I$I$I$I$I$I$I$\?bI$I$I$I$I$I$I$I$I$I$I$I$@Y,"Ucf8|g;V_c}-7kw8>bzcQSr.ku1K__7W?}&7!k0'O@I$I$I$I$I$I$I$I$I$I$I$I$udYGoenutpM>+nu2!e;#'.H龊I$K[3|,}n=o>r^kI$I%mϙ%x$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Agcq*=Cf7'r>`q}7"ؾ72~pp O f}$I$I$I$I$I$I$I$I$I$I$IpUwI$I$I$I$I$I$I$I$I$I$I$I$I%F`t`; Ux=ӽ~䱧 vDg[Ꭻ蔒I$I$I$I$I$I$I$I$I$I$I$I$^%7>v}&a59%ÿ8ec}xZOc> )I$I$I$I$I$I$I$I$I$I$I$K]I$I$I$I$I$I$I$I$I$I$I$I$I,='yfU|!ߨmw100Ap澾-T&b]s1. U$I$I$I$I$I$I$I$I$I$I$I$I$ZI$I$I$y?Q$I$_uYu:lqs%$Ry> ԾI$I$I$I$I$I$I`}#;4q?~+_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v_v/")kZ=!}`}K?_׳&ݐlgՁUܿƸ_df: Zckś:Y GuN26??Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc?Ǘc+ww.N.ojsw"ù]I$I$I$I.VʿNw $I$I$I$I$K{1{^sadڲMsfMy #/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi ~/;oi \/Oq<<Q|>)}g9Y9Pz8p>~|.6~}͹fG 0&bla׬Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!/Xm!*>C>,| ڰ\.|I$I$I$I$I/*_/UI$^c2ƿxagn/tscEVgw\zc;;&G˯I$jDI$I|}1Ͽ?k=ߣH^q?>뛑GzV9vG9e*>]2{uǣ}=q2:~o'#v|;^י .މa9/mxճ2]cb['@ ڗ}87# bWk.)CGgW$I$K87ڗщ$I$I$I$I$I$I.vױ?-O]I$I$I$I$I$I$I$I$I$I$lWkϸ9bSe C&ǽ/ӝ뱖;&p˛/w?\8I>2Wwg'Ƿ'rwMlU< uuqg^/] ˏC8H^.ɯ__myhÖ>@svMd~8ݳG`Y|.K?ޒNOdaphi̴@L[;x_^C RI$I$I$^U(?1%Uo^I$I$I$K]I$I$I$I$I$AQ/zTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?HI׮$I$I$I$I$IyWUzI$}K/n?ݛŋꔒI$^W<_^I$I/|Oj_F$I$I$I$I$I$I$^ǼԷ?w $I$I$I$I$I$I$I$I$I$>/-M4L}I>k_ُߵʹ5<7C<`_M/ފMQZ[۩Ȳ$T0t=gLZs'o󏷔ٗȿoG0;:Evz9s_T5vÁ*-ĥ5?8tI$I$I$I$I$I$;?$I$I$I$I$I$I$I$I$I$_=~vֺ3 x~Ӱ䵤|W!Ojg ^xpg=F/og hm~˅~MˢUڻ^%Ϋa2w}ݻ m4S:ӈw}_kn6'c07ap<à9W_d;wڮݱugӋUʱ_1!KI$I$I$IyWUzI$I$I$I.VʿNw $I$I$I$I$Kʿ}/DRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$4!'o^I$I$I$I$I%_>_V$K㯷_CQ,z$vo/RI$Iy_o5zI$I$I$I$I$I$I$I$I$^ǼԷ?w $I$I$I$I$I$I$I$I$I$??c#'.YO`J\L~߅ 1mUg_}suWٔQu-k};1XnoJ[p4mk8RLJ /+/!YoΥոCE7)s^E5c]4ڪcI$I$I$AQ/zTI$I$I$\?bI$I$I$I$I$_[תI$I$I$I$I$I$I$I$I$I$I$I$I$I$I.iCNw $I$I$I$I$Kʿ}D RI$gZo]ǵ< -u֏h>cwߏ=:gͱ~QGI$jDI$I$I$I$I$I$I$I$IpyoZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^U(?1%Uo^I$I$I$K]I$I$I$I$I$AQ/zTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?HI׮$I$I$I$I$IyWUzI$I$I$Kǟ3KI$I%?m?/h9;v6 +pqtDx/ϴ C> =~2FI$I$I$I$I$I$g{R$I$I$I$I$;e787ɒz6~Kʻ%g; sVg&x<>y_Rݿqw`?kIۻ?k k@iqiq9$I$I$I$I$I$I$I$I$I$_[תI$I$I$g$pI$I$I$I$I$PbK޽U$I$I$I$Ipl>|~u\?i'~5r>i1:7 iؘԭTI$I$I%Þ;]z/8ż-[+7wy;L h;|y}_WI$JV=6]u\h(xY8Თ5ѮaC.کgSQw~E *xY8Თ5Ѯa$I$I$I%?HI׮$I$I$I$I$IyWUzI$I$I$Kǟ3KI$I% [u]c=2\O2J/P?KĒI$I$I$I$I$I$;?$I$I$I$I%}cv}K#{`{rƧڎ~daPM?K jǦiU[CX r?7^'ϳa]swl3Fe|]#خܲGέŅ܇1ti$I/'cX}-Gţ|#Ke_Grc_yh_ oZK/I1i/Uvϓ]uhZq[c՞`nI${w^II"d8>]ソ.=÷w GLlˊNݛ 6ܬ k&Euw%$n%Ï^W>U;ϵ]z987֭rKxPZuЯ{N}]׵ڲ*I$I$I$Ɵ?$pI$I$I$I$I$o]KнU$Ip#f`n͹^AG/&bllrb϶h&u-~I$Kǟ3KI$I%_P?KĒI$I$I$I$I$I$;?$I$I$I$I%g]o;^:~@w>},gv$sCѤ_a};7ׇ6iָc5 }$I$I$I$'~1}-s6>C<<I$I$I/*UI$I$I$I%WI?.$I$I$I$I$IyWUzI$I$I$I/lhnģ"{F 5M6h.'~%{:c{onO & >KT{>&gdٖc[]H sHq|X'v|Lp_UskTI$2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ aF&O~"Uc~Xk_2}=wu˨4~yI.ƿt+Ӹz˶ֹ` {'r#sO`ァoݯ)XżBDЃZ)$Gݪ=?[Ksxl/>`w߰1;issmFgp'cUۻu^,'\ԟpl8>x&ߏ%/^v&e[XqO牃~ .$I$I$Ip̊pٍGogutp.E6Z.-ǃT'1~}sZp~55ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(uOLvcMedr^I$Ayo{ͺckw@ZOwfqb$I$>gW$I$K87ڗщ$I$I$I$I$I$I.vױ?-O]I$I$I$I$Ƈ}caS_{(8gZ|[|_⿱=㡖z|m~kt+4; 2 _DY;=߫Nwڟ 5ݻ9qG )_RI$3;ϴXf#/'!&K:<~y_Rݿq/~oo\K'.=WKvĿy_Rݿq{ټ{ןpkmĢrIqW}Z\x.~:(E/?/K"/y 1_^7_D_Ab4" co /iE/?/]I$I$I$AQ/zTI$I$I$\?bI$I$I$I$I$_[תI$I$I$_n^ "q햟_%_ks8e_x+C%~w>f-mԹG>@O|kqXq3 tp+I$^O{j_^?ڗW?OO{j_^?ڗW?O.q0~^6N2g_*wo]`WedpRN}*ŗ //V\qk z'W$K˿ބM_ms^Ap~yuSF63 ;q^#e?s;Kkk itqrh8 cګl Z #I$I$I.iCNw $I$I$I$I$I$^^= lw xq-K㯷_CQ,z$vo/RI$Iy_o5zI$I$^}g=}I$I$I$I$I$I$g{R$I$I$I$I/ zK;=22odwnfsnͷHxNj@ľU{qۏCx?/{G|kv~ss^7^gk1*ݺNlXqOKU$I$I$I$I$I$I$I$I$I$_[תI$I$I$g$pI$I$I$I$I$PbK޽U$I$I$I%Jw2ʺg|?͎Sx`:pIxK/>E% jy f9Pb~^rd>ׅ'au$I$I$I/1olmaU1>&˜O{>ܧ6GFjOOf~v۪f?U4RI$Dw}컎ߌ8[fx?+eodC}\O+^c=>س}whwu0[*y8=|g_uM99mfE{=}zI$I$I$K]I$I$I$I$I$I 7g%^h\Nё$_nYsI3N,_TI$jDI$I|_V$I$I$I$Y* ;$I$I$I$I$I/*UI$I$I$I|4;!s2:gDY Oj;=v >uWͮ֏q]O?d?]{,߾kmwK_ 9+ƳչNlh$I$I$I%Gw\N2[hŬR|g`Mƾ YGx25Si٪Ъ,GH:sat}f^ˢotG gpjI$I$I$I%?HI׮$I$I$I$I$I$I$_nYsI3N,_TI$jDI$I|pC|U}؆O}ϋ'\?;zI$I$Hxx5ѾE,,3<.~;ڊ;q{ u62%|I9`c{[i -m?y|WNWx+>_h#48lwgs~oWOcG_sYf骱[Tr^sf1NՍjasI$I$I$AQ/zTI$I$I$\?bI$I$I$I$I$_[תI$I$I/z; -݆gМ:8?u:N˙.kxcHx ?> I%Wgڻ^f}Ϋ/xg20}hoSݻ/kʾkYC*.p$zh>d϶}ֻ1i%Ϸn{}b}yvh`|j]mZI$I$I$I$IxGhYnOn4>pq~`ů~dVrH䱵pvp^I/zCGo}ߐ|28$OIX3L|y .$I$I$4!'o^I$I$I$I$I$I$_}e-'_;8}RI$Kǟ3KI$I$I$I$I$I$I$I$I%=kI$I$I$I$I$I%O[כ]V"i5룿wG>Y -StSV=5Mm0@h i$I$I$I$aJujnڞ 'y:[ЪV=6]u\h+v=c୓;ӝ<y9{I$I$I$I$PbK޽U$I$I$I$+?_'pXI$I$I$I$I%_>_V$I$I$K{9;_rXlwYK9Cwbv>щqF-bc|IUw^יqsj˦Y /}_k;pu 2kf{lodI%ogUK݋[w.Pu?1G ղF\e.=IꎒI$I$I$I$>M5wsf {W[Wg Վ?5Qa>7emԸ"\z$ O/bw,TV8I7?}x]`w&pbat@3_W|N1{S,1Xw7ˍH\I$I$\?zI$I$I$I$I$I$I|9?ſq0.qul}wK O gi/q0h,4z{a$<Cf3ϗ $I$y?Q$I$I$I$I$I$I$I$I$\?c[ֻI$I$I$I$I$I$I$I$I$I%Mo?꒟)Cq§|h'G^ڼsgw\iq~Wq,m"> w! wCtKe;q{^pl72d&VI$I$I$I$PbK޽U$I$I$I$+?_'pXI$I$I$I$I%_>_V$I$I$I$I${ons̨;3"i$I$I$I$I$I$I$\N۰nȻ{r]{4|\G>eZI$I$I$4!'o^I$I$I$I$I$I$I$I$Iy_o5zI$I$}۰mkUs&7tw rԮ].Mtϧvxz9R<|{I$I$I$I$I$I$;?$I$I$I$I$I$I$I$I$I$I|w}_=v8#7VӪk{`;t33Lqp{J_W=a~ ؞~s!w $I$I$I$Kʿ}/DRI$I$I$IpUwI$I$I$I$I$^U(?1%Uo^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$) ;$I$I$I$I$I$I$I$I$Kǟ3KI$I%_P?KĒI$I$I$I$I$I$;?$I$I$I$I$I$I$I$I$I$I|lH'RU$I$I$I$I%_>_V$I$I$I$Y* ;$I$I$I$I$I/*UI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\?zI$I$I$I$I$I$IyCpqk͗Ï!ϴõKUp~KG1I$^W<_^I$I/|Oj_F$I$I$I$I$I$I$^ǼԷ?w $I$I$I$I$I$I$I$I$I$Ku@lu-^@ .+VgeBQk%|<3-2o~\FZ/鮚kmUV1@SI$I$I$I$IyWUzI$I$I$I.VʿNw $I$I$I$I$Kʿ}/DRI$I$I$I$I$I$I$YYi~ve,kUݐƹDTI$I$I$I$I$I$I$4!'o^I$I$I$I$I$I$_[cplΚl?ݛŋꔒI$^W<_^I$I/|Oj_F$I$I$I$I$I$I$_;} oʻgk ف,>Mbﰭ}#TOXU\_?m~[zY/t~g#Æ&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(sdO342S[}!koX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(}Xڋ.;mCD{zw#gO݇bհw*d{y\-M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG*?⧰_p%U~ui$I$I$I$g$pI$I$I$I$I$ۯj~}fk,#ǟE5^_b'l܏3a>O3w̮}M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG.oﶽG޾}y_e8AfЯ_o>~b?~XG 2-FWɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?i/M0&ҏK?iG%ɿ`_4d/QIoX(7 ~_asJ?icw>O{nt̾ϾUa;Ȏ@zI$I$I$I$I$I$I/DٿgXI$I%mϙ%x$I$yz?mbI$I$I$I$I$I$I$I$I$I$I$I$I$I$KʿqFoDU/N]Qqܚ ԾI$I$I$I$I$I$I$I$I$I$I$I$I$I$IyW?WVE6SumZh%O\?ğ|S?JI$I/+m|/ƯTI$I$qoCl/I$I$I$I$I$I$I$I$I$I$I$I$I$I$^Ur3%g:zI$I$I$I$I$I$I$I$I$I$I$K]I$I$I$I$I$I$I$I$I$I$I$I$I/*z;9_Zs_T?=I$I$I$I$I$I$I$I$I$I$I$I$I$I$_}e-'_;8}RI$Kǟ3KI$I%g/u{n_q{2q,#^!͗;Nv5XִuϔO$I$I$I$I$I$I$I$I$I$I$I$I$I$I$fJuRTI$I$I$I$I$I$I$I$I$I$I$+?_'pXI$I$I$I$I$I$I$I$I$I$I$I$^Uwr0%_:|澩{7LpI$I$I$I$I$I$I$I$I$I$I$I$I$I$:u?[Owfqb$I$>gW$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K^7_e9Řcb+ӄHz?րl~E3OiE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_Gsf1NՍjasI$I$I$I$I$I$I$I$I$I$I$I$KʿގFDV?OfbI$I$I$I$I$I$I$I$I$I$I$I$I$I$Ͽ[ݓ|^fy$y{Q?ė} k;}>k2+-}{ tA:ǿ$I$jDI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IM -4G$I$I$I$I$I$I$I$I$I$I$I$I%gwv-lȻ+ x.N%BIױ3O]I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kǟ3KI$I%m7n7ޮ혽wpX1 :caܠYW:OG4GObI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$}5dSe7Vjcćk鮚kmUV1@SI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iy_o5zI$I$!r.uKI^}g=}I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ejL6xY @#ۨ?oa8wvkd7u1=$I$>gW$I$K87ڗщ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,ߴg;~K5*c\"VI$I$I$I$I$I$I$I$I$I$I$I$I$I$Ku@lu-^@ -'_;8}RI$Kǟ3KI$I%_P?KĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%v?rr1){.CA k".[m.{ddoͮ1.$I$I$I$I$I$I$I$I$I$I$I$I$I$I|u>h%O\?ğ|S?JI$I/+m|/ƯTI$I$n]ǵ\n̻{ 2_Yr>YڻsܖQŨ>T>s{)sx[փy]^CWeAcC7d=K}]I// /eav"QWk~gVǐ x` Og/6nM}G/ߤ#f/v++Ƨ MO{x.0W// /eav%̾Cܿ.$ٗ{2_Yre=c{uϴ_^mq6k~L^Ixhs;Od./=V=Dpgy2_Yrf_k!_o_d=K}]I//  L,__s0.7Wѿ?~=?C?U]0\=Ko7{Gzy9Z;lipd=K}]I// /eav%̾Cܿ.$J>o 8L_D/9l>:_,n;@yooA$ogt)][-wiާH2eav%̾Cܿ.$ٗ{2_Yrf_k!_o>߶Y,`]so_ ?ůii}4^ o_4}ju]7q[U?w 0w8.G}]I// /eav%̾Cܿ.$ٗ{voӴ%'&>upw|c_j>wzu i4ŧ- ~߅ 1u:'W̟ie'bi#T1.s}]I// /eav%̾Cܿ.$ٗ{~݇6;zv':Ky%iϫ\ٗ{2_Yrf_k!_o_d=K}]Kg]{n]qˇasO_MX?h./t.8-" ~BT{u}/eZ͎'OSy{mg; V`G72_Yrf_k!_o_d=K}]I// l_l=wK1Ͳڲyj[6@辞}vN*27#G#,=xf-|AMo#a_/xv3CY^x{vc+7}]I// /eav%̾Cܿ.$ٗ{~݇6;zv':Ky%iϫ_03Ӈ=Kf ̝i^nKﳿV@d=K}]I// /eav%̾Cܿ.%cfwnݪ?\lqm7s&:l..o wf:5ߵw//`~=ܿoǻ[ _XrKRak_ o '#}VF{n>I/~~dED޹LW9~=ܿoǻ[ _XrKRak_ o _7c-K{%+?oRCqu|[)/?ƇM7/ n%ũt ak_ o _7c-K{%)ߵw//`~=ܿOGv#ӆW}1_7 oҒ_-}hzosU|dPdLn&$.{%)ߵw//`~=ܿoǻ[ _XrKW_]hͷαPxpc+]LQ%ڏ_S_oG#1o>)汿oǻ[ _XrKRak_ o _7c-K{%(}e}߳84q㽣~$e3}srr.vMo.&p_+U{]׵`\\ڲ鲇s owgbTJzKŌ g voǻ[ _XrKRak_ o _7c-K{%(_`f䲊k^u.|-/Gmog){ˌ|&a*Qo7[snKGm| K賰f4fH(7c-K{%)ߵw//`~=ܿ{58Y[cD˿ 侩]vzsƪ8.0.ca}aNuw6 ljt|ћ K賰f4fH(7c-K{%)ߵw//`~=ܿ|/_m3rYE}5|V>_O#M6q7> }c}7-7%6Y %Y3\Diu$`~=ܿoǻ[ _XrKRak_ o >/,׾`Ko/v1Sv>7GL7'Ɔ%> ~}M gX?b>Qu;yun-<pׁ!ߵw//`~=ܿoǻ[ _XrKU.~wl3dOf]n.Ovޞ88¼Qk݇Sܚ`#5Zc˚lʝ< wkoǻ[ _XrKRak_ o _7c-K{%+sQ;ev̜ϼېHu:W)/5b;|6`: 8y8\=> ~=ܿoǻ[ _XrKRak_ o _7c-K{%+?FW^2x9,o k!!{Ϯi/#`yuٕ_n;cu'7ΠLȎ[o`~=ܿoǻ[ _XrKRak_ o _7c-]_MlWv`}-='Q!%*Kwڼ6w;c5!@2L#?oǻ[ _XrKRak_ o _7c-K{%)ߵw/v_ZK^%9Msd;0~~=ܿoǻ[ _XrKRak_ o _7c-K{%+?FW^2x9,o k!!{Ϯi/#`yuٕ_n;cu'7ΠLȎ[o`~=ܿoǻ[ _XrKRak_ o d+{}m.ke _hl{)y-95Vv2k]Ů-Kǟa]=bqZצ|#{%)ߵw//`~=ܿoǻ[ _XrKWe,ůڌeprYs<`~=ܿoǻ[+KϴXi1qwomw\\3(#I$Iy_o5zI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/j~wﴷ? _jm{h]2/r}/E_wȽ.__Ek"/kWd^M_}̋ܿ_K"{5]2/r}/E_wȽ.__Ek"/kWd^M_}̋ܿ_K"{5]2/r}/E_wȽ.__Ek"/kWd^M_}̋ܿ_K"{5]2/r}/E_wȽ.__Ek"/kWd^M_}̋ܿ_K"{5]2/r}/E_wȽ.__Ek"/kWd^M_}̋ܿ_K"{5]2/r}/E_wȽ.__Ek"/kWd^M_}̋ܿ_K"{5]2/r}/E_wȽ.__Ek"/kWd^M_}̋ܿ_K"{5]2/r}/E_wȽ.__Ek"/kWd^M_}̋ܿ_K"{5]2/r}/E_wȽ.__Ek"/kWd^M_}̋ܿ_K"{5]2/r}/E_wȽ.__Ek"/kWd^M_}̋ܿ_K"{5]2/r}/E_wȽ.__Ek"/kWd^M_}̋ܿ_K"{5]2/r}/E_wȽ.__Ek"/kWd^M>Y]0{Z!kFƖ`S~FL؃Im0/>bYo۾wxrGXl3~}{?reƆ.AuE ..3λl'8qsLKk ϴYTUSa> A/ƪ>wbrXqw=;<3'"{5]2/r}/E_}[}Ƹx=;0cFs;}'1{?ھe9-mSCEǩ""~n$I$I$I$I$I$I$I$I$I$I$I$I$I$I%mϙ%x$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?WMB7 -,'O]I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$nUJ\ǰi)$I$I$I$I$I$I$I$I$I$I$I$I$I$I/+m|/ƯTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%WI?.$I$I%Ohz7"ApL=?OOo {g<<#KYmmt ofbrYq.~Q#^f_d?!W_d=T{/߾vl,<~&>Lw"FTI$}f;EǸ>ѭID/?h{_~WqDukB?ZteqnVF-.27b7}3dW\8'LA ާR\?YgOrɱa" s!Tn{ks{ֻ=bGtiv^ukXMph$I$I$};Zq]`S |U."Ucd8D4Gq?jCe_ZY:?#+ԻN}]׵ڲ*I$\&<.wHؙ .0>}pp̞&:^H9yPeqݛk?h[q,Tc8jߪ'sOpKGi]`znw1ơn ėyn㶠ߥt1h] Í~ | I$~}c1sY}(>g}6;sj 6+1/xI$O}=pru2Ykx??nOl13c֯I/ nkx-x_w`;+՘w F&磭,#جLg>ʪwO0GQo;\lvG*lw GyƧI$_o؋U8[Y{,~ScŸw]w~cw\FX28[p'j.?7;~.w<~*8l_pF/QI$I$^Uwr0%_:zI$I$I$I$I$I$I$I$I$I$I$I$I$I$Kǟ3KI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IpUwI$I$\kW؞ߛO-CS+Y}?x̳ İ@i.ⱣN@s=0..mYtC9}nn7{ϧ?z> L\>⸿? hzdcoy0^Pk?nu94:l%qp-n5ZXWu=[[d9xj񟓗^5 +.pk[:W94gz~1&?v>Qe?ؿ }j3#&G>qr]f3)vmMX=F lP2_F=nDJUv+~L⺮N]^qk/ǹ}n\MsY;!&<~4/zlUUy9W [3Q.8/}==R)\eZ; O\ җ9˲w^5ڳ=RTV7lO;wm{0v&.K+Ի_qۑ{x+I/ce۾w:2I呧_G]ܿOf6-,0:^?Qoُ%ڲ[˹T޶C?c7w+XouH/O9v<g{U~KI$Yh>Oat^ٿ ?z5_0/ʻgpfEC~;.=7cYk} koU?w/fե}mݱAfYyKE|/kZ}ۿvv;^Hǃ{TI$/WN^I$I$I$I$I$I$I$I$I$I$I$I$I$I$jDI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\?bI$I%.?b;h3gq:؟w&2y cLߵk/ngv-Fo@lO'}YWowÝ KtyuS+m~wߔƻvK^tw+g?_vCu}Z3[;Nwڏ]9so{#";?ղFK9,Ԟ@Yy/[cxZ%xn{A]cx;9r=@:snwjsZn0 ˇP[ip_e?o;XsYq$lZ ӗ{wuinutT?zo ! #Crӗ r3%g:z9w~Χ}GN_yaK1m85ŸoqvW?ܫb0>~534;+noh\+zǿw8|lHU /`;k1qHߕkď~O3p/b]zUv4?9`x~}2njqX_AG?I$I$I$??./umk+D fH}s>~kɊG_5@u3'c^|7~ 㳸1f=F"v?4:ѭ g^}=*a^>Wnn[?WGqyvosaFaxilt_O`בN=y7Vw6mF31lK8}\%ۯGz]o۲6O{˫6 TC=FxO'}7[lq~k_[M=Muvg:{}{a2]rge_f;_{m+$zM>d{Z."Ucd8D;&YڻGS붮q;5w̟)ݹUQsoci6Hϑ۬=758g6@'D.mC>}?|YWpgmh?l~*n kvmDt3u#+ߏN*ىk^xo_OFd/QKjGپv~*~].H+cvp;o o-˩LjR;t|ԯU\OeUm#ȏhoBdd˫+>ɿxw0È<]%؟f;Oue]poR`Ck)ޚ6Zgm‚>DA^}ceXڪ{߲̒3ھq\꭭ޮ6[~!I$I/*z;9_ZU$I$I$I$I$I$I$I$I$I$I$I$I$I$I%mϙ%x$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Y* ;$I$I ge,Q[<-h}`XMbL&z5,p[tOo{Um 6 jw;Qߺg+?m?mE= k oY>^{ tv5)Pe5h&Y` ?{i,,y^]߸i/>w_ͽ'$^ |r^um.$88]']}v\ loR#ҩבaoϷlZۯ:2+o 1>O1+/t]{S3OUx4z#t9hG>u?WtIjm SFߜw WV_o+bO_CPܿtYN]K>{#]Y8yN_oLTd;̷Lu~#Crӗ*OI$I$_q3?|xE}ђ@Yy/[cxZ%r?⾛s;~o\^o,pN{ig7a&WO4?s)?9Нwۯ}n_:r #?X{n.3?㶁 Z3bˋvOqsqi J_~V-Lok]p߫dx?4~̮ql9remnփ}㐖n#si~=5]*b%ߦF?g~}p98˪weF8 nDӶO=}TGY1 8}^k+&G1i;m7ҳ ~4c}L3w.Σ}Ob&t{ ^_*9No\-ۏ=ϴvʮۅeytb9.n-DL׳}vˋv ݺۛ0\c[֗cٿgػ[.Vֺp  __>6KߛgfV;\\ \S7cݷ*K{%_+w]睙;sO˽M.'E6V7qqߏ>GM$IyW$I$I$I$I$I$I$I$I$I$I$I$I$I$I/+m|/ƯTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%WI?.$I$Ix'E޾fw^\vKrOx4s#YN]w|=SjWo4Z H4WYTS6q鮚k3UU5`r"Ϳ~,iY=-cq6]poR7/9p8#7VӪm}/xwm>pe.T;/KػwNIYΚbi5.oOwOi{sYXy," O)08vVW-qo NM{"phmϐ^Wc;>Yc_oXTF-LӬ.gIok;_|'e}K,osO-?Wuw lY6vjy~^iE/?/K"/y 1_^7_D_Ab4" co v88 cګl Z #.پunsY#"87?v1ndz8c68~f;E]U͒~=I@ia /oul,kZJItc7]h݀2뭡DѦͤk5cGSI$NSڎw 77>67 ?F> &?˴0*k&Hᱟ_RԟU[G# UӫWs9gN;?SW} 0{oaqN]&WgXګ0{4{Osߵw ;>^]ǺX;: 5?ifQ]t|8c8c}>J};8U~@+iy8H֧dx"#`/_XtIUvn>5 tO@K9;>de,Ci&7 yzx?vY<^G6}Ygj{;_gÏ 熶 |}?rr]8G Q!0x}{}6g#1 s7v/vs5 @Kx`auXfa׍LZI w:o>+g|~pa~v>F=NfcCv8 wFG 1_tϓOc{{,#k":ۻq[N=o,ֱ ;<8^_o;x}pG?U35>{pSNS7&,mtadg+ݯ8c773I+KIױ3OKvױ?-O\;#>Om^ݍ{sqvqai8Yt~?g5{W}&5uחi$I$aJujTI$I$I$I$I$I$I$I$I$I$I$I$I$I$>gW$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$g$pI$I.cb_iZV{{wi,NEtkHpK۰{G8847זoO;$GfJuR?/H8b;E[nF1GqDL/f}q ?x"^nub=8E`Y]W;5wwSeᄁv9ߞ8 mog8=[f64a6:[W>vL鳊jn?=#Ûdm_5| Y\n`I9-7|M<#}7w< 6HWi{_r?h}̸͡klw(]7oi&]Y*P|R|$u;}o}׸e2KN$ ֣K?_9~Գc>Xw$7^9hNo㑛Q+?KR^ >׉]mw. ~{ɓ]nG/[':/l길:0Z߹zx?l{ ;+WӺb"z,-ݔ?ec I\?$I$I(_kh][[KKoWf߱m[uvr6@[ĕk>뭁4٠[|H;>>M}[m)1.#fru;3ߡi:Ϩy~!>;F'rwUGW\ڟf_0[1ϵn'cg1O\VK&u]MW;4"[\i!c5ݳߡk7]^훗]XvY] =/䵳ve*,ݷ'^EY-;w1 y}wR~8#ٙ?wr0%_:w?a{qp㲎o_@Rg{7o+o9vgB>{7Lp?V_o+b^s;(Ď;p2 yp09^ߺaT=:=k7^'+;?pzEz~NU3;럟 ~\i;Xxwnܱqr6?魳O)!s/pa_V3jaSK+}b`:? 6OKFW5ev_[߳?~>f;f Ʃ3@O&jw.}c/h!֮\ Hp~k5ϗK>_]]Yt s v]$<}  xWOZ^KdW>}zy^ˀtA^z-ہ^^_|lwe7q8͇bCR-3x=3tG-wǦˮUV$̒Sm}wv khd18s4'w{_u э2.wtm`YYNe8q}k\A?@l<@\oK}N,+[_>:]N?d|Gӏ?B[}5 8Zw+vױ?-OKIױ3OKvױ?-O\E>7m CkrNeuzaqtnu"ۿiw|lqasJ?ip2ʓI$^Uwr0%_:zI$I$I$I$I$I$I$I$I$I$I$I$I$I$Kǟ3KI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IpUwI$I$Xnˆy9T-^ܺѹVuuy!ž'>Rf}oXyO$S{+3-o^wg`܌k]q_lв8X`Y@wO'^dz?v16c4c<Ŵ FM̵9ӾƏdƚձS09hNo㑛Q+?Kӳs1;~3r+ơe kg\l=z7Ҏ?)?af]YVM擨+u? N\7?V=6]u\h+?h3ǧVum~N_E[}/E쫜Got)}-ǃ!:w/v]=_NaD׌?_eIvNV[aƼXrIvWg/_wL^񉕑]xŭwikN};W]];>wϵ0t׉pcvM}dZ}+q?y;նc8ˣǵ4I$I;/de係zmkD2ʓ.Um.{`4d?_zhYD#1bqGп>MV~9g,Geؘ #%tdVl\ +~[v5W?7V{KOc{tur4Wڞowuq3 w&t ^c"d3WE$f;Za>*msev(#Dos'QYv>Awe/p->{Wĭ";͗{k8]?I%o`1r)m9/k - ?\GӦ=i?=^+?{JSUᶶ'm2ȉ oK{r1d۾v{2ko^:_N4w_];8%՞7?fu f~vɦODJ-3*hr/_m?v2rihƷ<tr \2{M |{a:= lpT]VNͮ?ؓ4hKl;a}uzscnXG>xG"__lzox10McmMuyg?h?_ϳ"ldYxŗ.`gNt;۱?e:q[0?]c|h'n?l{dgtuM*uv=KvūѢ+  x`e'lzH?)vױ?-OKIױ3OKvױ?-OXs_ٜO}۱2&.F;mZ6ߝ ݳ3Iw/O>jmMvmy i߈&G+yhn5ⵯRD I$IyW$I$I$I$I$I$I$I$I$I$I$I$I$I$I/+m|/ƯTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%WI?.$I$IaGӧ.fJuRUӻ{o/w%SOxer;jç.K\iیO+j~}XY_e#ҥ<~kNs!n?=Y_j;'َœrcm {ԏ1q;fm녗p1A_o;E|X\Z."w"9>EhzΧ O c5ǗeWܻKkWN1GN=vg;ټcGj~vbu*?_e~f-k}+$i+m1~_ Wkx7l0Z:4?qFoDU/UI`}wpmK[; Gv]Q^56zT5ìG}&s;wpxU=.6C'st^qkx#%1T6?T3d:k>{Sﳽex!3$ɒOęZ+?[;n Ospݗ@gVž&2Ň?i-w+=܈>?\}ȦcCysY}xokd9, &?Xnyd{k;mlſbbGc\ƗX?hކ`;X+sqpbyƗge22_]ݷζGO !WCehwG=5K7gn{2_qAmՆ~a{qpyoZ?wH~~}ޗ=WW뜮lJCY.O#?aMO^oY;r?k~c}{=-u}\zޠTol{{sZHW\Lz-u{Tx} M;wx=Ge jks]Kdn\+9}- ]v}fl?h-wZۋq= 5[uC6IL1㮰;?$o%;?jZv2ֻ!>8Ik}m~A{y8x⎼?_RԟU^Ņ;^~n^&.]yᵙ.|\I$/WN^I$I$I$I$I$I$I$I$I$I$I$I$I$I$jDI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\?bI$I$~7bvhmn Hdri0_ f}wnKw<-ĞORT{g} ؝F"G1Jwj>2{%}x ߀p}bv>щqF-bc| L~ᅑ:2+uV6cW#?_؞sI&~TI7c?/U7ȯa$}o8?nȑ;bpĞ'qxx>%{;[盏P%n$Jնc8ˣǵp錀V9~^+Ļ7j7qɮN1ܧ%5ՏMt[j JM5[8HI$I$uōי`6U&ӿs~~&OĮW+^wYe}>,?sN&D΃@]'of6&=x2xklG@/> 4`O)8 ~hз`8]X~ Ohϑe7ٌ'W}x/=ˍ tT{g} ؝F"G1_o>w<ˍyIkCh`o|A$k~rwϵ)'g`;v#>Ϻ'sﵢ鮚kmUV1@H޳_845:c|Qp_mƚۊܣe {8N]vzsƪ8.0,?gWٌ/ R<Ob>я.8+Ua?}቏>,qy|en$hhVv7Ó[*`򝒽cUۻu^,'\ԟ}{.8.bg|rv?v'3jkkM&&7:XZzϷٿn_gpz~][>!wXxؘPᮖAvN,oޱͭT-:F*67{sHLuG15 p׵sd6`O°OiBSoq\C[=^B9@_?K W\fXKGHdK=w߰Ϸ}|q<6}ݟa{Whd=?/nޓKx](T/;r̡NEoᵞGfzk[x؟i5  kg|nӿ4eq3L=8'*lz|9L1WxϽvܻvxK0kI$/WN^I$I$I$I$I$I$I$I$I$I$I$I$I$I$jDI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\?bI$I$I$IB[Kx}oF:~3әVK1 }ϺKAqDeǬ ed/,@aw2z"LE GMisY"'4>R@-Kp;stBi$}-wmm.< .:gI$I@Zsq5wcsחN_Ͼ{+ 3FQI$I$I$ d7wlaԆ"8!ș[G@́Eu[@ZI?($UkZ.l)Yj3sSIBjǦiU[CX M$Pum}kw `0>@4IBl{kukI%BHI(YuUƵֻO` Jy68?I/p ,tD3IcVEg_=xx)I _fClc*{ hlHj j:HvdW_(t.h<$#'Z%Mb571 L~n\MsY;!&<~4IB몡V\ˌmM$/zlUUy9TI$/WN^I$I$I$I$I$I$I$I$I$I$I$I$I$I$jDI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^k/bW}?ba~wd\=WO߱tX;\5kvG/I co[6Ƈ<4#Tٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.% ~-E}w53߀t4̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_J}{xmョƇ5욎d}̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{oGϱXM=Um cP Tٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.% .E=w53߄ut}v=]ӳd[*m8|ZI / /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau/5w_twLLF}n,ǹ zvn^̒I$I$I$I$I$I$I$I$I$I$I$I$I$I$jDI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$X-u]ذ-=Ƭ̓ _/yuY0Tm-;%?b>>;ݎ?iO{%_)߲v/C`~=oǻoU !XmJRad? W _7cݷ*K{%_)߲v/C`~=oǻoU !XmJRad? W _7cݷ*K{%_)߲v/C`~=oǻoU !XmJRad? W _7cݷ*K{%_)߲v/C`~=oǻoU !XmJRad? W _7cݷ*K{%_)߲v/C`~=oǻoU !XmJRad? W _7cݷ*K{%_)߲v/C`~=oǻoU !XmJRad? W _7cݷ*K{%_)߲v/C`~=oǻoU !XmJRad? W _7cݷ*K{%_)߲v/C`~=oǻoU !XmJRad? W _7cݷ*K{%_)߲v/C`~=oǻoU !XmJRad? W _7cݷ*K{%_)߲v/C`~=oǻoU !XmJRad? W _7cݷ*K{%_)߲v/C`~=oǻoU !XmJRad? W _7cݷ*K{%_)߲v/C`~=oǻoU !XmJRad? W _7cݷ*K{%_)߲v/C`~=oǻoU !XmJRad? W _7cݷ*[$I$I$I$I$I$I$I$I$I$I$I$I$I$I/+m|/ƯTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$>gP endstream endobj 234 0 obj 202505 endobj 233 0 obj << /Type /XObject /Subtype /Image /Name /Im61 /Width 1882 /Height 995 /BitsPerComponent 8 /ColorSpace /DeviceCMYK /Decode [ 0 1 0 1 0 1 0 1 ] /Filter /DCTDecode /Length 202505 >> stream JFIFAdobed     "#()%$%%!'+,,-/4443.4444444444 ####44,,444444444444444444444444444444444444444444444    [!1AQa"q2B#R3br$4CS%DT5cs& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjz  S!1AQaq"2BR#3br$CS4csDT%5& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjzZ?^I$I$I$I$I$I$I$I$I$I+dwB)^2, c:RI%[}ُͩ PiגI$qы14TjoYX?@Ή$I%_"۾wz$KԻoڟ1/ڞ˂FYʢMy$x$K?`ݙ9v8;mwI$~nU8nᕱ$^כ{-Noq§[oMwXg$\bx==imeXᮢz?I$7?>ʺD&[$^i$^پvd?ڜQ=7-sWx$IsxT47}Yp [I$=ϴf籶[H ]I%i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kǟ3K$WOv0ܽQ$$I$I$I$I$I$I$I$I$I$I$Ke'ITIpwyoqZI$tIvh>7^;#?Iq $/{M}?u?xkU ~0I$ʇ8݂/I/'I$I$>-G$^7'MX)$V2I/3ï>`g턒Iy]VOrM{?,\I$_mğf+ $^\I/U_o?~#=Y-k$^/(~L\|4rI%)]v^-xI% $KD巼02G^=co_I$7jwbC;k[X'gGI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$y?K~cLIyRI$I$I$I$I$I$I$I$I$I$I$_RԟUI$ ;?wKI$I$I$Ouv(ǧ.;I%O I%ˤI$K/)|-ZI/>ؼv~I$Y $VDIr=}ϳw4O[GI$tY| -$\JI$y~.e$Y, I%O5?{$KRI%?4tRrI$6k~< $K?ru^ʫʿNI$~W\I$ 6?biqp0.e\l7䵀p `QϢI%$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kǟ3K$WOv0ܽQ$$I$I$I$I$I$I$I$I$I$I$Ke'ITIpwyoqZI$tI$Ii]x`u$K>g'uT sW~sG_$^PI$I$I/]m?ِ>~I$tb_͹#Id$KOX.;'}یϙ%$\y|NpuI/+_/K ,I$I/~/ÏL?Ig Əې?>|+yjI$f'uĒIyJI$GI$ =rkCǀI$}yI%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$jI/U?3/TI%I$I$I$I$I$I$I$I$I$I$I$IRU$\7[VI.$W{?k]ʌ I.N]wwkӸ|I/4I$l={vq0Z?H0?ȒI,dI$I{Ov;#_ $?mm} xa I.>U[K֎Ky_u^>n,'$K̿{=pV8?+I$?k~Sa3$K˒I%ًk (1r7&IxE012{9BI$;k7sh$^I/?v#;p>y];khI/>W;r} I{?$_9I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I&sRI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$II:I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$m$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Lq$II$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w I$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Q/ВI)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kǟ3K$WOv0ܽQ$$I$I$I$I$I$I$I$I$I$Jm'-e:ͥ $og^}ʯ̼?4Cy%$\÷'ڟw|_NDzRq-"ZI%掀GI$Xc{K\ǿd0}A7\I$O_;#I%_;#I/>_n7M_[I$$I$Jgyc[dc $k>N݊>\VlD4Ig/yv>6&=hGXI,O߸m!521t)I$3E]Zz8q2;I%$K{_쫾Y-K$\c Voڱ~ c-x{ %$[ g+};뵭<P$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I #I$I:I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$HIE$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$$II$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I!dꢒI)SI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JI$e :HI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$$HBI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$@$GII$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$>gRIz؟aɟ߹zI/*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$џcootI|I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$$HBI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$UIXII$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JJHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$y?K~cLIyRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$C{$K4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$,$DgI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$!$GII$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$gRIz؟aɟ߹zI/*I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$џcootI|I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$$HBI$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$UH$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$II$?$H$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$F)$?IM$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$LHXI#$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$HYBI$ߤ$II$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ ڒ #I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kǟ3K$WOv0ܽQ$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kϱ77}rI$sI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$BI$F}!$NI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I GI$RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$HI$qH$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$II$Oa$SI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?)$)$H"I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$GВI"7 $tI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IIE$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%mϙ%xԒ^';g^KʒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%g?$_9I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I!d} $#>I'I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$yr + "I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$GI$$2I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$i$_@I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JI$H$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$GҒI"7 $tI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IW8jH$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kǟ3K$WOv0ܽQ$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kϱ77}rI$sI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$BI$F}!$NI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I gIE$I$I$I$I$I$