%PDF-1.4 PI4 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 45 /G2D 46 /G2E 47 /G2F 48 /G30 49 /G31 50 /G32 51 /G33 52 /G34 53 /G35 54 /G36 55 /G37 56 /G38 57 /G39 58 /G3A 59 /G3B 60 /G3C 61 /G3D 62 /G3E 63 /G3F 64 /G40 65 /G41 66 /G42 67 /G43 68 /G44 69 /G45 70 /G46 71 /G47 72 /G48 73 /G49 74 /G4A 75 /G4B 76 /G4C 77 /G4D 78 /G4E 79 /G4F 80 /G50 81 /G51 82 /G52 83 /G53 84 /G54 85 /G55 86 /G56 87 /G57 88 /G58 89 /G59 90 /G5A 91 /G5B 92 /G5C 93 /G5D 94 /G5E 95 /G5F 96 /G60 97 /G61 98 /G62 99 /G63 100 /G64 101 /G65 102 /G66 103 /G67 104 /G68 105 /G69 106 /G6A 107 /G6B 108 /G6C 109 /G6D 110 /G6E 111 /G6F 112 /G70 113 /G71 114 /G72 115 /G73 116 /G74 117 /G75 118 /G76 119 /G77 120 /G78 121 /G79 122 /G7A ] >> endobj 7 0 obj 9898 endobj 6 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 9898 >> stream xz |['{Pfi(-P񒄭"g{Ȳ,ɲ,-w$k]lˊ8/([YZN{*:3])ڙ{3ĉso;;|.D !-k?S~wJX_hܵUG]l(~^"Rnq%kR +Bz~K~]?ky_Fj~unF݆#B+DhB t?B"!9B!'ڌVډP B5!Ԃu!G!BV D#!FhBaJ!E(BfGh?B:qE4B/ B":Bo!6B!!B?Ec~oBП7$!EHF!%Hv]dW"UHv-]d_C1W+++*+*++VWX-_|+W<,_Ny]ryyR^^%/_)/_%/_-/P^F^|ay#;w+V+JyEbbbAyyC+W%\!,WV++UʕUk++W>"S^uj\^U!WUɫVʫVɫV˫WW=$Z+zX^|wW,\)_Jr|%ƛn-֭;U+W{{<桵?"tcܸiS[n{zohlڦhWv:m[cE2F8/eW6,,( ²lDb,!KR,#d㲜lB6)eӲllF6+deCò#cgedN˞ {QKe^&u7eo~$m;weޗ} PG~&cc١.LQv)]dC肵Etyt]t_@ă!r"5! QGP]|- ]rd ] /K7K2.@0t ]~]@Ww"+Е嵨 $*gt ] tjtееW6nD_m@_ͣ6/DoCק 7kC_g?A7^n@73ot[niEߴomFވn]nmE FۖסۿnoC}ztt9A;OXjcbsŜvIv:!rw&`-J)Z~(袺;`wY3 iF9'Q^Icc7a%ぎ1SG>xi~}؈+H#a9m:fk:j1I -D ,]v5(:L ,S]0B7R5FqJ(=;pG%J|*¯ M}q*2Q{09 <RWXKd2ab!zx$Чz[> YND!f;ПPޕxJ+^[[Ǟ6@'f Cm!B c{-KS{ oT NҐbHn^1W'9fXrBTeHl^zCbL}϶ujWjcx*=cT4@ܚk;ElKr?ޒD.O y?Y=œ/21FuY[wɥ:&b!n+5i-Bc!=C1C^1e$: a3C[ZzD4MĽR6i<[6= v} <{+iCi*$[ZIx:S}2C!E E0+uVYjx)J ;oK ? 1!_΀ƣ堉Qk̠6&=MM\^UBdׄX9ۄu#2}YcBOޖ655,lgm65g:==*BOHjdZ$3T;$z#-R[  NAdj2zU!FK-N/G.GEKjq R5Rz{ROv?{kY٪$]ajO ;}5JQnPm嶾'uޚ]uty )D^%M hokA|uNwt'mgiে =-'c1HGs<yD;H%KV b}1+3| 3Ž/ EoN<;$UOK"n_gS0ˍH? dF@Zw{s u̲ħ@ͿxϧYq TCZ{liE En )963@:;aךzZXhe pM009.瞄?3H"(pzW6L4g`f.~{6g[J,CH{?yv%`Hr2"6( x\ 3l 9`ǚVXN3lAeAb`+4!p(65l$>b`7`W> ̆Zjw#k`"Qp: &%mLaIiuD(>dӭqp} h= [zhx2z =l xɥJ溪x;nGI3k' ^O[BUa`BѰB>gѼ k}\l`(BĜk,~e1^owMw [&L#nF6sF G9xB|NDF!^B m0dl)ٮ3:࠯B[ijHK?{EYZI*"MFNƓ1'ZQOdPx$m7Ԫ[6cXO.-k0Tp[qM(ʄzQ9RL%f…/IRhňc]vB)JI :?AH4pŶ$+| 57 *퉁fæ]AcV`RaixV x޺)i݉Zx#Z^hվ,Yw Bd4aM:c&khͤNtTV%\h_ 1n&"um>]-5\c؊9+)k()L% C+ŜҞM8]ӫm8hYð)H;L%F 1{`ܝJ]JN/n&m !ѳP6(] K|I%bNu7) geBD)] ^Έ)?隴{j*`zz ]=FQi]k#vL0 (<ظvh󽶒n T*gzm>߫Z aB'$9w S"8aM aN1p;^(`T.r:-wכg,J3L$ҐH <2G h$:Y5*F5ҡ U_֪` K1ᘒY6M7ɥh`.7tp; [ *Ыj غ*ci^p‚mښB6rxn}ZXokI,ֆx "S3D^1g<<[0LsNgq0:M>x0+,Ȁ#<獄y3֘F !CJ]/J*F-+KWRxqX«J27 Eq/vݸ,Xd}vCnϐ!=u>deŷxK&҂rẇ Xu76ḯe5&P: kͣ;`q)f!;觤 yc)ܕ.BNx3|v;)^'n!r3~qDD683 DR\EH[ /c՜jاj! *1d-mntivE!h,NnG +_1\,&㐋'R1yRl /~n0Od!¡got8(k"8֛Р76I5$S -Ph[J՗%!0GnI#jmzuݽz t4qece/{iQJ%-%ÇC0 Y3ItwXt`X0@ },% ūt/&CsawFcHQ& 2Ͱh啐oۀ~U S+ۂu@9z:ಁFsNz>}ԑpx1 FS; l}"uz/,¯gI=LTЭiCJxw#KR ]$vɠCWu;R9) x=K\qO TRg0[` 7 ,AC zs'sش{302/𰟞2 jv7S:h,ۤ$uMSf2Xг}^k!gȑ067lj<@dMb8 5(Za7-lQê†Kс`ҝ &F^l$ *ԓh a)fS#Ͱ3@\ƆSijŃ]o|J ۟kO>ήfgxx5o[=4|L^n3=B8sPV58Ln; [S¾ pQϾ'p'~pl:>`vXmMfx_Fِ V_pbCG<觝 qdN؜vsK(pď])֕,z9v/Rq˖HXC~u#c#h< /xYJzv':=v7Zw'̻to'8'빼wh?w'~%nV4A}I3%RHdR&R\UsJ`mj}75V%yHd|"~}z:Z# 3&:;ML=puq5uLX κ^UZӮmڤb`'ە;CtobOv2c1F)WndMmکj7@wm9ؑC;g1~_l\xy" ɮ(ha K kBR- ;m̘1ؓz[ЪQQZoI]$$'# ¤pdY U4jhs(maQney۝m&In)ԑꆔ.g>nfdRbD0ƒa:bDKJq,^wl^QE~waw݅x`߻qǘv--j,zK&ѡشma31;C+KۦF|) Yݐ34Lr@"hb$ ͋\ͳO!k? "?g@'AAn6eP!JL-G"boP..fn/}@I⍂e9$q뤰I׊kbzRj tΩ"qЎLf4ӟg' 2qH%GAO~Ǿ]& X2 dk clmׁBglcjքԄ߶EFS LȮ|-kO9Jb̒|0fu8X41+d_CVU*aEBj/}ppLRhu.潆4,r{BcȦ)G;3]NX04-34#W=bZP̀j1VC btZ٧q+ڴ2C-bT)o;?J56Z.*%ZV2ḌGiH!3YTKX:OHFa2Ό ֘ {EalVMaz`98HR_TCxxT; p"^&Ml YMKz2)q'1_GO ;/!..ePCJ_g21L̴bL/D}I~E |a0PjuԿ/KA-XàFӫR5Wq#IҾTTcFjl?ۧ@WGx<~7x'߰'Ł N?8|6V-Y"1 cB>*,*$m/~A IO\!2iN5Dma*JctitA,boQ6DX9XWE'?4jʈՆ>L[h9nGժT밴1CU?Ò ^=")0P:Wc]_>Ƀ'?aG08a=i6s&LxWc0A߿d83|Ti bwp)[Nh$ 8@l/E'0tY% endstream endobj 5 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXT#2BFzBookMaker1DlFont1 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 6 0 R >> endobj 3 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXT#2BFzBookMaker1DlFont1 /FirstChar 33 /LastChar 122 /Widths [ 500 500 1000 500 500 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 500 1000 1000 1000 1000 1000 1000 1000 1000 500 1000 500 1000 1000 1000 1000 500 500 1000 500 500 1000 1000 1000 1000 1000 1000 500 1000 1000 1000 500 1000 1000 500 500 1000 500 1000 1000 500 1000 1000 1000 999 999 499 1000 1000 500 999 999 999 999 1000 1000 1000 1000 1000 1000 1000 999 999 1000 999 500 999 499 999 1000 1000 999 999 ] /Encoding 4 0 R /FontDescriptor 5 0 R >> endobj 9 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 45 /G2D 46 /G2E 47 /G2F 48 /G30 49 /G31 50 /G32 51 /G33 52 /G34 53 /G35 54 /G36 55 /G37 56 /G38 57 /G39 58 /G3A 59 /G3B 60 /G3C 61 /G3D 62 /G3E 63 /G3F 64 /G40 65 /G41 66 /G42 67 /G43 68 /G44 69 /G45 70 /G46 71 /G47 72 /G48 73 /G49 74 /G4A 75 /G4B 76 /G4C 77 /G4D 78 /G4E 79 /G4F 80 /G50 81 /G51 82 /G52 83 /G53 84 /G54 85 /G55 86 /G56 87 /G57 88 /G58 89 /G59 90 /G5A 91 /G5B 92 /G5C 93 /G5D 94 /G5E 95 /G5F 96 /G60 ] >> endobj 12 0 obj 8693 endobj 11 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 8693 >> stream xyyf ə-Ѳ Dۢ] 85MdRiHf2ICG;!hWO1"w1wNԅR7!i# O}W}fxK)|n(A1bO:vhJ!myRW{GF2eL=n2Qo4m`.kEa%ݐtJ޹* F RKl)ÁP@˂ LA~ g6Z'Eʹ@Yޠ5f1)pJ/ޠ;`B"SJ ?D P‹OQqQW7@M{|UfZ(^jNhIh&N$LҴ0`R F,@|\JV!ڬЉׂy'Ht3ЏQ㻔\\<ב0;l5N&aOY{ޜ>b; Ow3>: +#0tMT)kd t9YK^g!;ٿL+ K8ޘ'mN~u4$ӀsL. bB ZT?AI3$h-A2挒O1? o\ 4KriN,sthɓbe! ;B]Ww+e>Ql,B}tU?:4db2DDV&Mv*y5yI< z")M_nwl8l)FyK>ϛ`|[|vu=hf1C=Ym͜7C˃'u͊,SZ 4Ы@8OApǭJ/?#>Yx%ۭRe0Jx{_11u-#mm=Ѡ?->3 $"yJ"![(UT-V kv#''3>lo ,yG__9"r c(eioROQ,{+A(sz2?c'a #,Mh'6/F2!(0넍8q/MM{֘mM}AC;) \Ϩd&S ԛ7z B_ ޗy\om%^fäomB4)~$*8 ^(x*4 \  x)8+A{=Nlm|ֈdOLk`X>ՓmH^͵yp6B6 p si{)fD5t/Y]tq Sx2-"Fj~\SiuP]fZ|`I4Æ=c )co!<ǭ@o5rbyNk68 hO݄]>tHs Ua)E7d`W"d "..DK +Vq)@p 6#"}tl0tڃp3I{@Ͷ/]0 EPBڹz3D7Hؐt k zYf2O9 gGN=8fFb= 4*Ogag*DŽ}ȇW4/tM>ߤ¿=+*8j2Y[m(<(,Iނy$R JZ1 ۠BkX׀l?ꇈ)pdo[)* x01 V$tmY4f&]P2g'M:p&1p׸ '(9C+%riRb15P0ef8D٭`<MB_owgZ4sWlgGadhHx["b8ϝ&L6 p,51_XZL+v-EQȶYD"㣇GtcNu8p2Ӓi]d4D\y/]쾑-O'*QM ( F}G&a0anS|/iůlR~[^-kY(_"BY5LcE4 IHےfcY#<3-+גޖ^[ xuf DZ^W^U:еhH;9N-TYQ!RMCnH?׸Y/Y`i3y%akH*#̘s*l;p@Nl8ɔqy>)e$ bi0 ͂19Έ퀿z= .3ÃwfCV%KT1<GIweé'J|imzahXt{퓗7kz~,L}I W3@kƝ!κWΟ_>+nkRfW )W|W4E!!B>gjyj/_z5 @ -΂[+xTgN-%dB: /13ʙMO1 +*9&l4?>d$ЋtbdXtIb D,Q(5I!XE_U?&OW:`)%d $^K]fviOoMMuJ>6-j.4i!!r>錿B/Cuʥ**Kb \LWa$:遤^B񺈙(ws~Da7N$o1kS^;dKjP?$1)^ Y1U"̊񸇘1ߌ f[E1byMm1ג%VSyٹP%$0eKxp ¾]گ1 79/+jFV)Tj OT;XqBٞ5`uNu}6=tlM#4w'v؝;ȺK.:8JFA"#^NW,za޻BsK7V].4GKАja: 5Frty| Ʀ SIQ-lM}Qs}||u9M|FFO{cyD~˜LVlԫjl- ѕ2 r-P7 <ψOom ;8q6^{FVf𷲞HA_ԋ/tDS7`L /H_W^<)ARM-?!NP[)^$$OXk͵R- Ӻ#L&׃ju% (} u GgbL0a,Q9}k@ UsvF듡 N$K!`UjW*-(5"wh#T`#)kMƣ$)pق` 026֋!}{™ve)l pϦHeY2C{"駷5Z1z bXk/OQ"Xm-K?mE5 C_/׬jmv)ʊ){-zMy1ٜ?GGI{R JLHk sRW6>&q[Sff}JUnZErlr =$o#T?B▲g+BgM uԱCImrκ9or)gm}Œ4+7$:KoXGwbb- L[Л]K _cw&nHa%4e2q'IbI%3b<_Cy+i! zs;Y1G܈kK*̜uL-yc0j%Ks%B#d=qba?>_ɂ;Ke^oɧˌJ&˶U)nT9XUVq1jr/t=#]_,m)4'!5f endstream endobj 10 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXX#2BFzBookMaker5DlFont5 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 11 0 R >> endobj 8 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXX#2BFzBookMaker5DlFont5 /FirstChar 33 /LastChar 96 /Widths [ 1000 1000 1000 1000 1000 1000 1000 500 500 1000 1000 1000 1000 1000 1000 1000 1000 500 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 499 999 499 499 499 499 1000 1000 500 1000 1000 1000 1000 500 999 1000 1000 1000 1000 1000 1000 500 500 1000 500 500 1000 500 500 500 1000 1000 1000 1000 1000 ] /Encoding 9 0 R /FontDescriptor 10 0 R >> endobj 14 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 45 /G2D 46 /G2E ] >> endobj 17 0 obj 1445 endobj 16 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 1445 >> stream xmSYpEI=VrJ܃( Re8AbDHD*\&dw&P>TH œ>!j%X$,yfgF@HGH@hZņ뷗.d*mh-[ uWK)צ!HЊwgv>L0(5њD $jza:JmĊ"-&DŠtPā`jHr!dp\4GFLw\ʌ8wL J83`#T\řJ<ˎ2eGkuThP6r .n(@GR]v{q| ۂGװrػk6\'%NۆYӨAm4qǖ?r|]i3iJ_&ڱ6E/NFj ,87}^=lhp,ܤ_#?spϟV@Shg# ӡtBh66ļYZ O =O,K0M3fH5c5&nB>{Ym'hF]muf(#t'|H2D?*tjB7=#޸h #C=`^+YwX4TM/y:6IZv*ky">#9}Q:,VV#"=F]F]YrMdYh/H]6VƯ:Ȯ^cpLdshBN&"V/:qa 4.қtf72' = endstream endobj 15 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXB#2BFzBookMaker9DlFont9 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 16 0 R >> endobj 13 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXB#2BFzBookMaker9DlFont9 /FirstChar 33 /LastChar 46 /Widths [ 999 999 1000 1000 999 999 999 999 1000 1000 999 1000 1000 1000 ] /Encoding 14 0 R /FontDescriptor 15 0 R >> endobj 19 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 48 /G30 56 /G38 67 /G43 68 /G44 94 /G5E 95 /G5F 106 /G6A 123 /G7B 137 /G89 139 /G8B 140 /G8C 142 /G8E 149 /G95 150 /G96 155 /G9B 164 /GA4 165 /GA5 209 /GD1 210 /GD2 225 /GE1 226 /GE2 229 /GE5 ] >> endobj 22 0 obj 8915 endobj 21 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 8915 >> stream xmz |TչNZb-`m@DW 9< '< 8!&3;ܙdIBH0 b|c6U{ZOmIOfk};EC)凒"IS7.߲lS}Opf//zxsy_Hw e?CQX2Vo℉dibX񷍷"׀/3~*M>%I$I4EI I_4IJP%\2%i$u$$mIʕ%i$푤BI*RI/I$F3deLPfÙi3d-L[,s̹3͜7/3=#3̇d>4swY \4sɼ%d.O̘q=˩>c}Ϟlg V_] IQRR)5řJRR)o/şHSS)M)pJsJ$%bJ,%5-XJ{J4e8K?lh$FϐF"KcI8["ݺDI4*m}L\&ݑ't54a44G4Si2ioD`TE.! ]) >hW]6ƁAүQ_As>6MQ@6 qϿx=SM._:N|-*l:Fk-',Fvd>jnWUUT .Px ~xECѪ@4ZD"j]W|]rRasjz:Qo>Գfs65:>/G aٽ_Ql 't/5ޠ)6VY~cudqg{c[+}g5fĶwm)zS-*?\kV_l^9rP ~`ˊis}Mυde #OT|hMDW aW-zHFX>UUPY*"gt%s}|`!7kb}l l{[ '^uBGU՛kЁ5O+PupGu{ ,WVb>O 6D*sj `42P-WuS^*:S1O^wXTU1AZ[ۻD-`f׎'[[m>zeQODE|q0jIR;GJwĂr(v;.42Zsuajݝ3>̰N]AY6=/h$ :E7Zv*VPN۲ rP(i :kU| P4a 0jK6 "c(iGd7AЦ0V`&l &<}%K60d3w<'AXXip;5qb# `Z*7֊\̠}fY׭ȦrNTSF}9l2_Nr9/fNQVf(ǥ#,Td(ž"<69ߝPUX,W_6uKNxV?($utE2Ϧ"焠1xu v ޑDOl"3($oDp7# U5Gsz^ waNl UCg|w_?eQ\ڡ$zu=tmG=`I36K KfGnWjjl0N0X1 5z65 i+j &z`F*_'o({T9\xNU Zm$ݹH+]@lzzW7Û-(wy עWlvlFKM:#+1>}[}+?@6#ƼQS;:.yW֬ OҋY_/>s bf-:DU=ǜbm۳d1"'O2 'r۹8\˃< P|X̾pI,ڪ=F಩v]p3X 4 ȼ68lS5fh#tƒԭ=M:" RT ' dK/ɖ!(eA.ršЯ!v?| ^ }Gd':Cv1,]N:3c A B9oQA}F?bLaw4xCve4Gڽ}F-| h2޷#x&6v?{/9̳WG5 ISkh!NzEV]홓;3:mOCjǬ`hU W;lNQ5mʍJ09l‹HW˩n#F t8 p xܜj4N=K[]A'mn:wkKRk MQA UwCYgNwF/ TzP]7P}qԫ^jM&X"6@ɆcT/"]PF֠`?8lZܧey$k9M؎:LBG҃ Ua+s3id/uBy< (7 T/'%xR>Yh4gM9l2b $5D"琍Ե JZ@'Jq3?o䋠wt'ƙ൜OB$~wXY\|l%ԧlr0g17VD#zfʺ' YkUAmV%FW'KpZ=lo ;&yw 󟘉wOj7r޲T5\p܅Zѧ6CUP~OXߖy7mB?3G/0]Gdyن0e6("Ӥ_:$H~s <8=w6DP͗L#Y5AX~`u0VPoZAlM܄%RG,j!Ҿa4WA"~JSP'G_1<)&xN.|ca1S͋ iÞB1wAA:9d#pWP{M16`RقOǷS}Njz)<77 ;e;k\Nf컡;-ҥzlJTLJ*,q\ V13n38MSߝGX&Uebj$s-s]fD]'JsjN6|KWa"pwƻ_Vw+P% },`Y=Arp25jv5zmw7ERQ_R#+L% ZQD?<8N4%lza5l|TҚ'mlZAA;ΧS-K[GzsG$mW4 mtE(mkhMg+HhΰE?QŽ/%B,3pWhU|ޖnU+7Rk*tQ|,/X dwz`O!;O\=h:.ژvx[m=W0-Zi. 7*jd+ m'W<_6͢3cʓʀqNCwjL&y2 d4r0gF6[y.<\SvGRʉ'ժ%|Mx/'VQ/s($$m i-"~.r3W $:$ɨ$eEuihi`|N>HxUqpwQFQ(2(f9+M_}c"{sCXS@ ^Pb'ΜeM0 d9deI- P aM;Zm 7k@=/}h&Ǘo\FPKov(oݾ1Ճӆ>L5WH-{HujH5"P HuΦ :y.o=2_ɅqF}P퐏Y]~Ll{pTK &`S!,+tI eEʩ?C=oQ+ >׉+*KK {ɚR /!` uߥY+:GGP6|^zj{Ny"D#Jr35}pIff\qɅ;ZHy`8N275ؠ ={XRo5{smڒGΣ`눥~sTb[zJSrkaٕ6tYL\s( |:]p?BZQwPѲ5'!{Y/!Ν`3,x[lqPZ2ҎIiő@`ܱ},dtrn] j^|AݓtIK؞ dߒzlŸ;<<[Ey9?OBFY?ˏʕJalc|T3Hɪ78qeOFQMIaR)%?kUٖZ!2Y| icmWJ,6=[' l޷E –xiM#ITDb,.K[GRj\;=P*; :{ٖ)4o>JAB48Ksav:Vq;&1b|xWˊ.~jUx>;vxChc{`nxE8-o&X.ݭA"׿ xr&_v)6Ð e>5b*w_wMV(qO~HW)u\iһA* ׆:VK-n bKՕ串=I3)9GP Gwׁh. Nd~aziҠ+0:HÕ;,+BvQ`Cq{}!CԽڠ>LLRJoT1iLP~WEsqQ#{Wk&n)||iܠMwusYa/6{vc ֊P*ըZ!4D+(mj(A:l1uy<7o5%: j6ֲz5 kݧFP-$=x-Lc {V Jt N틥sթl _S'9"۰ehK!+lӟ#fӌĭԦ7#(״KI %˄AADOU, ֈ.wC vACܑO7UuTVבp U~;Gkρ1K{}/nˣYxR*hPڏ>jQEԌU\w;v(Ci_&s?erkb֋h$ts=`3طN^ ?/ ZߵuX:A`M%&'f7A$_c[ٳ&û:1NpyzH}GO: +lo{Oen+[-5^gQKySH&)V H u6̭E+Qv7f{smmՠbKUc9nx7ysM02׋$#i++wpfFC[ :醳u/Kb>xH?y{JԾ1?,o"/'ۦ򓁿3)u&n9A+ɑg~LHӡ9dsv}RjōO2r莄L&Ӗ}oI(}#rNZ"6!cm,#"^~ WР7Avr mt4ȿ=׳lB7~,/{tad#i:TLb.8r Hϰ/ NÔ s~E~Zc&ZG6t͉Ͻov0Y;6EiD+t$F2u㮯@rT _>2Vl (Z&`$+CgRI%jx1~kYz+6@Yv^o 6yCCw:YiXjg/=/͖BDQƊCEzR3$2.e= t&Y|"><ذ~ƂR)Pϗ8BbC,BNѼAa},GWPLEE#b a3Wi9"3^b?gc*'[@U:>j!X/Os<\Ǯ0|e; ;9 ~wQ%tUA^?z }PƌR+i^ (>](@ !>Oɛa:*8DB_^"?M+[^ G N5bޜ?ỲZ6wW.+_;Ï(JoI+)IڻJ>?U09k`r՝2?K[VNʉ%r<@(ENP-vmgc%Uգnx_ʸ ]V#`6'eBUS.84zFLjXpԥ=j~)o#(.Gy.s avDٳm/yS,i{;j3pæ\kY[xfLV./p;ťym*P/񊼙's_-uV&jf zZs=9"ME9Mm6S> endobj 18 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXG#2BFzBookMaker0DlFont00536871247 /FirstChar 33 /LastChar 229 /Widths [ 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 0 0 0 1000 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 1000 1000 0 1000 0 0 0 0 0 0 1000 1000 0 0 0 0 1000 0 0 0 0 0 0 0 0 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 0 0 1000 ] /Encoding 19 0 R /FontDescriptor 20 0 R >> endobj 24 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 45 /G2D 46 /G2E 47 /G2F 48 /G30 49 /G31 50 /G32 51 /G33 52 /G34 53 /G35 54 /G36 55 /G37 56 /G38 57 /G39 58 /G3A 59 /G3B 60 /G3C 61 /G3D 62 /G3E 63 /G3F 64 /G40 65 /G41 66 /G42 67 /G43 122 /G7A 156 /G9C 157 /G9D 158 /G9E ] >> endobj 27 0 obj 11373 endobj 26 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 11373 >> stream xu{ XWnwd j2f4ƌ$: #|> @DlAmaMlhhll Dh4MLLgb2|3p6hswgMU{k&|K ś^۰l۾'nqEq_9s7NWa1O?@~`)17)v)!aR"OÏφN<_/qǎ]A ɂ <'A B WᧂP B ,UZ Q!C vA!yP VA(A/J1Iq7').!)&K[()IqK^O?;)>.)>>)~NR|BRKI/'M0)~QRkI$ſ4gVҜIs'0ikI'["<>iӟ+s˦R "M,5X`Z*:hq4'E0^i.Up|*h.5P/% pKW0S`;׌ű8h]n,o*?q|ZfsbI; ERޢpRj  a}݁'D*e;m#!F@ F!GYX̗S#iv((JtL%jvlRolL_3oV}bmH-R59l oyeSEJ h1ek3!>X]~KT/+Y*kƂR Tr^N:X,E;l\|eL[\)XQ`ca촄Z(lk)$t 2Ddi٦C"d䊿o>{f-O]FDe;JV_)rZg>HA A–tQ-?chT*?#Ts^!*./Cu9k&t_u5>P];cuf?U$fA$ݿm޺)>}OlXc?[0š}v;vMEj(q2[]8lwxOc$wW. PEk(J}:B-3CrQBn#&#pk-hO^աXӑVHV篝h!ͤ0_Ym:Ok]qT|`dOc/Z -(Ye@cXLX;hޱ CL ;%7lǘ`C nzfxnWrg;1vm硵0 ؏@p&}1>ٍAӠ;2m[;}M{ |UP x܇T ׻U 잜A`9AԔ! v:̆ޢ NZߌɪ,"Wf`Y>6[pGBcSÈJ+^uFMJ]%94.Uw/r.Pz9IMSnX(SU_U"fS^ =PφF<Ͽ0y"H;ȋw/pS4 :[$|HMA:Ȋ۵V `_ف]eoÌЁ@OyyAW̍d_?~"ۏ̎SRL_f|ᓵ5SZAp(5 _Tז8 PаQYFqL0 {t KC}᪆jh.k Fq,v: <#(lE0JEePqVGZtD x|~  T9*ȸma\I8-kOpVFq+;с{>@V>&qJB1h?5)O1E9cSt7ڰ:s>IpKABD9Vʴr(=,M XؔYX):(AW=Yj(1 iߑ"NOn<5ԑҔ l h,Dkbspb[Faڎ>.ڭm'H{r+%@6U:3w.)^]D6q\At'b]2}eI2Yg_4osa>6SM2HYm>sIM;)J7MκhB֩ꤌ.C("0<^pᙾT_6ja7rWvc;4~#u;AS <N+SҌt(^Z6bU/zkN&րWO+aAC}wϋ]C,'NE_ nW$[.2k&hO2pڡtWMz V>j5zOE - '[rI]zK2G'wEڨy@T<;5L WWm̆ 6^.+ØĢ.W!E9v9+a+Rb1NwC ]y#޿ֺ9ydrZqjh-ܪ6$0BhW I馰aZA39 -s%{[:u h7/+1udxVw}QX%#|΋'Ddη:S% L8e xs}_&Rj8\UGŞ-̦pTpLaV噌=& ~;ʩ MkmFFvhK`ClCӟS*QHk)oy:=*cw.^­;0B =.ipc8 & w{`|`WLi7hD;;]R&${--07QFv-5ȉlM;Qﴆz33J<|+MKqգ^OR؂l‚Qܲ[#o+"]SٞΠ|AM2&ޚ~z/gw)#tHB:3krCirEFoo tLaτW>9F;ͮ2,UP E2B.d$97%8sc]oqbd+=µv>}R8fk5E::Yאzrh 5|](8F23R!a2\_g&<C$qH9yWkT7ZeM%+űTrUMeL}v[Y~Q6pyLJwyz5 \p7g^ pX%Hy@?CNXugs9:|w*Enhצ@O^^—6!4f= nj~qGIfcvr)|@h&`kWF'CHE:#7Djt>Q%Ef1fx, {?9kxĮ٦;]`U~0,3y*sAR4*W-ŐvF~LN[1b+pQHmie>j6M,!ZB5=#fIzx%2Tub5, Ž BmA~3M9_aGɧ5h+i30WCl-C3=3uy#!G4搱oF\4׃ )OŔyTg@{=/f(aw ed+m!TX+JyayAoi,tVSU2cfh( TҲ[% 4CB1\P~Ϊ@S] aR>K4햂8#A i3p]{i3'RH$b@]ܴ쿖1Q4&k 3<ı'G$6=Z0<`)/(ŌCPRy-ű`b+X ɃAu TWq8}=تC>ōV=VGgx4vΥ\hn #Qy9::Cf-T Q#.Yً|B/jL&gxy cwN~!Mo_262^ض2oi`d=]rc<]x"LR5U8quAVL,{j&+ʀHi+ UIɦ~x) }!`k=,cK/{7:W$b.O!Fh, ҋ+Qx#$'#݈u9AE;' ٦57f!ńT!rޛ%(_^~@hWpxZ'Lzru%*cX')4pJQ]Vn^t}d*_T0ΌWI;) 2tl U3fُ cKYAaNB_|d+2ޖ@7v~ nN7n]r!B76UbpԻu]V@] ѺzAEi9Ed)|21j$Q," iRaUdat9,-۔n~,!}Srݰa2v2GsL7:~@9 E2SY~$7; /V-JkJRc\ Ǯw,vuN{V/ENXei< Z2ʆ`A)\[֬^j`i^|L_w/_j5wQuVJR];y&D*u,2kQA$Ci9"ҶZpGi pX 6Pu$G| 5j77R() r$="W*Z$.o յ尦WvPHWly-@nlʄ4Oa|p/+7LŽ;3~qUhNidQY}<3pثOq 0zA+ﺇ,_9b.Ec$|&^~MZ7ZCUYf}ad)+??{mv49VW^J̯DzEw̒3(dPRGD1Eg-k;ko$UfU6J[j#DE4B2B!W+f^FhjlȦs<.pU(|)dx吒收r-=<3MX)ŰFȾlRN(\%$_Ң]>D (H\m^"2P g<(-}*Ne-& -rK'IvTvWEڌ 4Z)ŧW˰ZcF◈(6֛w:-| S޲|ėO(j&i65[. y+O8 /DWK ;J(<G𱢋`"p{ ˹98RE%d Q \_0vDK28֎FJh.}Iu4(Yw$vlpam6 wSF˷S:&-kv.b2 MғZrF;HƓbEi3°H;盕SK8-V39%O~2} y]eGtERcGocM5[&$B_}gW@[-l{ޝjjY|<܍#O0s %bWP߿L~8:RffsE6CKc#lhb +1w䝰t•>SBTL럤e˳$T橆uTE\_ДTFHØ&e5 nݐ߉_k ,YT$ҙGUZ-0,T6*z>HB_߁fKӶik 5r*/8_8 -CZވu) /j.;e-B~_A;rkφi?I] yhW^Y᪮Jvx|57|W:x. K /MG ךԆ-WxTd9Hn@i_~pHj'pf+ ѽ.]mna/cZj-@OK!Z;IǐBHG<|,u&g!;xZ#.H^ Ͻo^?F2{.Zo7ܪ|-YӬku8)eJbͰenkgP5b3sMa$-)~œNb䰥f#ۙ9/4,Sg(P_:C_vNjbO=ws/KJXeK9[/s&RKкuHQ=Ͻyo<:]+>~W~79ZUyK]A(M)I/E RfzſmhEu pųeI0j5wEaQ= q7Xm֚;6o9 4|kcKѭK_fcHf .]qc:<;H 'FK-=:b4(~2Dڡ5PъRKUD%8v/DU,tP kvn8:'-J<^yhiHiuNFf0/ϠIb4/mwzTӅ͕e5_*؏l(MYѪ2x9"M7eLCeʇ}]LJRc9tz6=vn$-Y\ GJ69r5zPKOm<W!cz4:! 1A~WHEЦ) gsy?{Qk]ShP}=S^ݽ;lvE^Osqf\u,|pSlnIDGhdߚgc"Hc"i~f$Cw:=!ay:ܲBG{ނSmHFx^88 'Etn'6F֨ޘN|GtciHn'7d2a˳Vl9+784WoLA𑳴+j_nx):m--MɮTMn!T w"ilUشw`OaVSgQJ"s-ynUv~eBݱ3~2gVwo_w#q_GR,\tƠ cp|D< [ST4DwԯRaMVˆHZiP/SNiOhǣE"RbJQ?YGoR-Ş2j23=Fg_X\Wt 1yx1~ɞ2&N6_]Nb?b0xtmJP=|;&[Srنg"F.\105=(dpyQ*mx{MPYWV'_hTrq*rq70O"=jh(oڈWOtyУW $&Yh 6 m$sT#ѵW_~qݔBxn~g0*ȕ_7dhluajGo"of+l,a61MANmQ4-*aMq7=UWQ_]d{?sMdߙ/?poϔO^6yo-/q|* .߯"$#'\-G;ʣϓso7!iX]-Kzov|ݼ 2ߋN9|/; cl+|?q P/]}=Fz9"S)Y(U*IuЩQ&+M[WO8Nz[h*c|Vb)4<> endobj 23 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXI#2BFzBookMaker2DlFont20536871248 /FirstChar 33 /LastChar 158 /Widths [ 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 1000 ] /Encoding 24 0 R /FontDescriptor 25 0 R >> endobj 29 0 obj << /Type /Encoding /Differences [ 33 /G21 ] >> endobj 32 0 obj 192 endobj 31 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 192 >> stream xcd`af`df``d`P urvrMN-2vq+160560742)!C,S7ӏK> endobj 28 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXJ#2BFzBookMaker3DlFont30536871249 /FirstChar 33 /LastChar 33 /Widths [ 500 ] /Encoding 29 0 R /FontDescriptor 30 0 R >> endobj 34 0 obj << /Type /Encoding /Differences [ 52 /G34 57 /G39 60 /G3C 120 /G78 165 /GA5 171 /GAB 217 /GD9 ] >> endobj 37 0 obj 2241 endobj 36 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 2241 >> stream xmU{pT+s>)JfCI1J F4, q$lqsrݻٛnv]A^XiSGmbAs;}߱IgIYdś˶^lMM Ohx‚2ƽE+\PO }2sɵeBޒy޹\w壼9R7D`$I-{9Ksn] IwHR$K=t$-|+W)heUˊEf@#Ӈ'%[ںmMi7e/+(^/Enͥ:05Cɖ}>w@;1i)0~=dQlѩ oK7G<2>CB8 IX%6¯g#wUx&t47Ii#'? 5 }7 ^-N Shvg$(V5$o~7j\ @5zTڣshւQ*|I*{hƨ T Y:FORx9<;vzо! ^$GhGhh3L,Ѓ*.='r8iG`B(dd _$Jʐ('pAkG¿Ba\*[Vd(d&G'0!mӂTaX'ը q:tF|wb߫aQj-v0Nق=m=Ȑ\ ,kIb&x>D! ?H4%`oE(f$<ցsW"|h'`!v%77ż_C[(sA8veT+,xo6 kjя0+!G<^!Ԁ)鮔uЃ Ggb(We/7Q^3I`7ք/%@oAl_fd^_ fU89; GNp;`ϪoaP@[vUvs[ӽgm Sӏ:4uYfs!Vwӏ zH/iN" CU|p !] YeK7~#s+ ]z╳ -jayISEp g7 =Qsp`^JKaz]4!=-z6GG_l} .@>HMpxF2ƌgg@4 `ō)m~ ~|e-k-ݭ||ƹ~ ׶}?IA|dx>z!>@׭7nJ6YN ;:|s86>ASTEa(40'KpO@DoeE h! >אh~X7{bz *]h_; FV;x8[8`oI &膖"7 siQr mB#'PU-CeuS#97ޙ2pMg:v;pqP^(Xܵ6%d 19PDo9;h!G)xeZO j?5 }Ǟ]Г$`$QSS;1 `Nڝº2r\2oALMd&tL ʰTPy\$ - ƛzuԼpEdHtOni^CUxn9TŞ,Gc}|k ШDd7b8{Ҷ0̓GC p}2IG̪߮Ço#|!h_ t3V`D)-h{wCo'JSǀ-#݅ ',8pw[$u0J#,-faӋX(a3۱#D\~1B>+ kf ̰>_AOכ5ɭ()v K.l!auXEjCn'X$BmUt{ )|w xia8]HZW(=a;9:7 4JLCzkP >)dA:8GBPmChW &j endstream endobj 35 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXK#2BFzBookMaker10DlFont100536871250 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 36 0 R >> endobj 33 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXK#2BFzBookMaker10DlFont100536871250 /FirstChar 52 /LastChar 217 /Widths [ 1000 0 0 0 0 1000 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 ] /Encoding 34 0 R /FontDescriptor 35 0 R >> endobj 39 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 45 /G2D ] >> endobj 42 0 obj 803 endobj 41 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 803 >> stream xmRYLQCm{hL\@EQFD1EbqKN[ZuN FJjCĄE7$~Fqƪ1Ƽ[y(J@:\~luM;{Mu-7l)ZL&O/*4hr5f(H @? ~n~4p)|#lj<9vH"1fgf|$p@!@Z)MKkiZKhii]hZ\ʎW\UzPP^G) PA)+4P: 'rInF@{MƄ[($ s ׺.d.h,,kC"6 AUUoG3Nr)Â:cU}ߡNYUҲJ55NUd~L2u4Bӳ,R]nծAU:-סg_xoġ՘~TԂ$Mq ύxa1/&1rw~77S-i}btx ?{'5d^~ύ:GCIcGvcnag#o3ASEvrx3F E DdElY#&rv'kE!Lm!#Y~L-̷J&RHw_~Ra>~8-w!tEP;]n.vXH?xsfUf? D1Idu~IvŌ0a3̽~}''^`sz K~Eh endstream endobj 40 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXL#2BFzBookMaker4DlFont40536871251 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 41 0 R >> endobj 38 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXL#2BFzBookMaker4DlFont40536871251 /FirstChar 33 /LastChar 45 /Widths [ 500 500 500 500 500 500 500 0 0 0 0 0 500 ] /Encoding 39 0 R /FontDescriptor 40 0 R >> endobj 44 0 obj << /Type /Encoding /Differences [ 119 /G77 148 /G94 174 /GAE ] >> endobj 47 0 obj 1195 endobj 46 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 1195 >> stream xmlSU_NdaBR : pㇺ`[(cC' d;sv+ mP8%`$Ƙyg-8?s>{ g+?XX[k~IIie%leK^y2sH~Nv~n(?䣢֊QS\ſ6gsw ;Op<+j򪕥UkOr1d_3$& ׍T ߁!ucCBS n:Ϋm]uoNORX\IAΫ@z5C6vaz/Af^W"ɋ#i?A> endobj 43 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXM#2BFzBookMaker14DlFont140536871252 /FirstChar 119 /LastChar 174 /Widths [ 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 ] /Encoding 44 0 R /FontDescriptor 45 0 R >> endobj 49 0 obj << /Type /Encoding /Differences [ 163 /GA3 168 /GA8 185 /GB9 186 /GBA 189 /GBD 190 /GBE 195 /GC3 196 /GC4 197 /GC5 220 /GDC 228 /GE4 243 /GF3 ] >> endobj 52 0 obj 3270 endobj 51 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 3270 >> stream xmW{tיFnh’=hyذq mp3!p ?%˖41YX!0[5I $8 psnOfܫ7ܹ~~LIi o7ڼOͫS}WU|#;{Anγ07Eɟ ədL̘2H45d=(JܿfGtӍ˴?[_ 0K0O B ,_79+-[*?ouʜWZzQ=#:xf4v?}#Lnd3Mb0{A!F¤0iM09*d|#Lk~~⊙;COm">xzԨz\d_ %2!6)!PT"!dNuV}g&?/+_gYg];cKTyWMWS UGHY:qYJޝeO*q_vJ$ЫLV}=Ks O^  TK'n֧\f/OROуdT!abrUt#g踁_m\Fe1@$Hګo*:VrB*HKZGK0ʻkeH6N`ynT 1e>xWB|XT:?};"F*))!|9z:@ywR^~$BUțӠh!5.b=#`^x<.\@nz>šց'q[ݷ$W] ?>f rא](,>4\K'3D>.;EZR 5yLPzPyXRP, +Z[PWl-T_,&3gFML %S?2'D1[5m Ʌ=s\;YU m08;R=F^fRT!uDA'D>BïNn|$ONYv93ԫeW Wk";X8J5Х`R>{2'ƠN93՜3N0"Ҟ*rշϊ?FW%+5+=ˢr 5v݈U#x[.g*}Ň'5\ꅴ5Րyߤ^m"|+S$bC"iY6N]AE#$'Dq:UBQDtfM65a-p.q,DbNI/WEw#AODJ/dbp?hk@"dkO<S Bs(ҽjgMa=YҴ1a%*Q/J:)HQq(J5@ePu(Y q"ûW(̝">Cd_^CKca:>_GgPqyqzyu5 t^g^9t_Yʇ!>wT@SoBrɶdYoG7jU!uh"gv)ٌ cvx $f~BsߙDS=kmZrx" 궴0nֆ7p į&'aE^écd;aU&x̳snKvj X MD;0+}ʵonC`#cdsGk#MN{*)DEʟRZY蔵qŸ,O{ƈfvv8;DW'£p2H(}0+mz Lj cN`UpՓUVp6n!9nccm'YZ=#}P^t]eO1L_?a)#m@Q{;!_HCcOP`G;j9 o.GcjűA:DxI*Kdjx5xd}>|è /(~G/ƚ_A7>gްUr LKE4/Շ=|FMO6Z ̿TOl`=N֧QF]\2NUfؖ};VX=,J;\Ŕs\8`5jяS]J0wKK-.Wi(j^_n] ھME~[{-=呴Ѿ]:QَIrSE~xb}-vR}(?XH@5Y2; zHuCUm₭@UzEG&1 {phT\4 f#f!ՒScQCA .τiE, endstream endobj 50 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXN#2BFzBookMaker11DlFont110536871253 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 51 0 R >> endobj 48 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXN#2BFzBookMaker11DlFont110536871253 /FirstChar 163 /LastChar 243 /Widths [ 1000 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 0 0 1000 1000 0 0 0 0 1000 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 ] /Encoding 49 0 R /FontDescriptor 50 0 R >> endobj 54 0 obj << /Type /Encoding /Differences [ 121 /G79 149 /G95 160 /GA0 165 /GA5 ] >> endobj 57 0 obj 1404 endobj 56 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 1404 >> stream xmSkLWw櫡RMĨ`kE[ 1j+XŠ" "]2; d%BR VZmcM]$]O33d&| "# ׷pefڼ5k0Su*\c(ړ ^pQR;~O NÂ3qTxrT+*GhvĢ \쓗jqܥKڤ&Vɜ=rtWIkkWį]e8 ;$=c*l.*቏ȆZ.bcE zOG $nox\ 6|ltG So QM&"im9 \5̺3bh׉Uu f\JuKyW #}'0f~[F |6Jx8r.47j*T]ƊjbP-Rޞ=yPzyHZъQ#x&jY>ѕB9y򖀭6[lb Hrvޡ홈VK&[&'DViBc,c(VAuc((x ƴ9*5zS\o?,@A&EZ0m:MF4^dxEX:'fT$2~Zï8ː_jmjW@:!T'>eݣa1ٽ-"-P'ORf#`}:6]zȗѨtz "3H$;Xg~"ŘVC{(>\@v7~;`[YĴA('q,eKȁ.ϖv QDm(jګ`ux: 駼&w kfҮPR #^/2 n}5hő7Aq;6"2㉕RoF7U3.X*ʚlUw}: [ Jޭ;`G<K(BcrVdZb @jf*i@P?:[]x!|PK(4u-衊tw:{6򗉍A䀒x EtRz êH6M2n[K+ƻ&0AиaʶVȧ[je 6-2 =H%LUCiItsvNG\Q{<$ۜ xU;5f3:^pxGQ::*gu*n:q:Lh+v@0FᇉB,ʢ& endstream endobj 55 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXO#2BFzBookMaker12DlFont120536871254 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 56 0 R >> endobj 53 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXO#2BFzBookMaker12DlFont120536871254 /FirstChar 121 /LastChar 165 /Widths [ 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 1000 ] /Encoding 54 0 R /FontDescriptor 55 0 R >> endobj 59 0 obj << /Type /Encoding /Differences [ 214 /GD6 ] >> endobj 62 0 obj 583 endobj 61 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 583 >> stream xm_HQދ moFeъ zJK0i@" 5u~[? .6L!-zAz?{跬Ϲ&ڂL-:r:wB,uz|Ѿح1sy~E?Nef,`0{r)f 1v!^v4c}O3*F2m4  i"8`3V @c2EJlQ^hLQ.4ɻEνx@b$'tV!!֒"SCRd tQT!,i2F/=:! LDoTEQKiʇp]@nr=$/hvMtKx92 Q53/AU yY7R$ .gEȤkS#*3s ܊ Ɓ[6)ѓIӊ\*̪" ?T[jhC+[c2TʌL" B 텥*\2, + EE1lB"Šɂql'U K(n endstream endobj 60 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXP#2BFzBookMaker18DlFont180536871255 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 61 0 R >> endobj 58 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXP#2BFzBookMaker18DlFont180536871255 /FirstChar 214 /LastChar 214 /Widths [ 1000 ] /Encoding 59 0 R /FontDescriptor 60 0 R >> endobj 64 0 obj << /Type /Encoding /Differences [ 87 /G57 120 /G78 121 /G79 122 /G7A 123 /G7B 124 /G7C 125 /G7D 126 /G7E 127 /G7F 128 /G80 129 /G81 130 /G82 131 /G83 132 /G84 133 /G85 134 /G86 ] >> endobj 67 0 obj 5845 endobj 66 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 5845 >> stream xY xTՙ(sgQV+(VP D"0I&I'w~͙7;d20a41UxZՇ]ֶv۽t3IV dr|ޟۂml6M[n{?z]]]Vyq+\Uz/ޘ- wede^xyd}UZd}glK{\ž/} ]?sag,>o}b}f[flj}fͶf[ill߶پk)\]d-Y}JV-Y`J()^^RΒJWlWomqzڽ>C¶R- @+ bF ^U(Nk`+mmWk;+[lwlۮmE}l_|Ӷ8D>6W[k#FHDZ#Diit@ gu*ZhaJs!SZxz#r@|HV\-n"gNOD74ˆћPRGjS z#!9A|4idapuf}WOV^J5;8#  Qdp:&b, D`] 5EYq0A a@A) k&ӑؑQtF_c 1zD3BB N]W߳n X>QWDx?>I ϙFٷgp8Zt6ci7}+L&1 X0MG6QH;":O Sg!:~*'0ݗsԮI:i1M&z؀tU2?h8^{F_Snz>B蒑XorFxՙ"kO_{xZ͝*e[W I\ i$K&4Os4|N<Wc-Yx3䨆sqfˇ!Dp#9;sV1o)ri@c_s,KRoO8Zӻ3[a]u<}-nI |oi ɀl |r6րuSAS1(6IL$*v XGݹFDT4h$}ѬgIuX~a~xljd;]TB1HΜ<=Um) @h᣷(Ȭ_:9#Od=n mpVq# ^||lV@(^!kBg;Y1[ ,AH$Š{Joup0h7gnCX( w@yJyBeiFtp- nw4hWZut^Կh헚cUVn؆LuϽoOqjSY\cˠ^F %(H[o¹{^|tF}K"ŰsǣgohX;]~yx#c$>.OÞhݻ%gfK0ۤDnD`""OL+ ^at)14e{H2#GAìڽMAwsCK8Z:ΪqF GcDSl Oϊ甭0t닛ow1E BDž|(4+LX阝4';P diWZOW  MSg4tU7jk"Gҍ/}^t<*ЂxM87E5FӬPܷRaST$xyj`_;RqwUE#;]-4PӰ<<C]?+9Oo-].WoPDfV͗>9"~ݴl I7"TU IعYm8G ײDfn6/67t 1F:"ГnQ>h'{Od]3'={nVK0cڀŒp^l !2暀 5H" +A'e (^S Mb&c#7yv rx i!JuĚđOwU9J;nHOt70" &'&"@AYBYGT8U|k3Vq*%Vf^/E/ k|z="$k7)Stx~߲~] vTirV4dL}ocbB SDBs˥@ Jč@gO(C:]_d-~=OKR3`cF,(9G]ߕn@d"%5D1&fʡBg'm#Y9j4@̺~A]f vK501tGa!BDl!UР6d4X<1 ;uv|pk집3htqtg6ͷNC ˨ZYrPӛs#S?c y5tIjv067ֆ1E)#ڞ-b#Nr0}g^۱vwOBn+me)2/G: 9[#d2F&3#\^?ڑ;\Dd@vr*AJɝ2.ܟq nMD$ uU-nsː;@7y7$o@@>䉪iq$!"4n5"?&vj)",Eҡ˒;\Iڵռuiu#L }YOŌgS|›D4ڮɆ‰&cIm<-sR7ODP B aRs)W9An 2Vm iш-WIVE9(o x@ --H!D)F߶OX ,Q<:AI O=:GPeDŽ+ma?$ DN!`k=% 48FE/vt ˠIFy׽b]{2k1 o2d]H$lϙܛڑ;#R^}V!0Dl%<[ueZ0 UdENJVdxK~ I_:IЦ[ :C.-b@ fKȲe1?b-bђ?r`!tUG& v汯ۗ򋘁nN~e!kg;T~.GcۇNCq%eTQG#GD,Ѣ֓*EfE2pۋunm uG. ,A8/AtVdgyѸ,Chڗ-cN2)pVIb]3r@x=2k9S+U1P0d0xNnWguڊ|rZﹳmM@𸑮ӌV83Zh> 3- >/b/0]*jB%5Uzj(#BS`g׾.}u*-t}.HeH=xzB4ʵM ^Q ҂h%›vK8u]±k0?>R"s3S; =4UCrB\Vew%/,`=ntbLt SMt͌jXɝfΠ4G썩:]G!҈fK7Ȣ._ =u%gldVNG:ȱOWtڌlJ͸9d ٘(O2Rpw(ŐGR94sی[3s}9zZהd gPDPf7\棋8 IRƜ э(aDς7gգ;S@4psd\hYNѰʬqU2_wԡu}H"> endobj 63 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXQ#2BFzBookMaker6DlFont60536871256 /FirstChar 87 /LastChar 134 /Widths [ 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 ] /Encoding 64 0 R /FontDescriptor 65 0 R >> endobj 69 0 obj << /Type /Encoding /Differences [ 35 /G23 ] >> endobj 72 0 obj 231 endobj 71 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 231 >> stream xcd`af`df``d`PurvrMN-24sq+14305607425)!C,S7ӏK> endobj 68 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXR#2BFzBookMaker16DlFont160536871257 /FirstChar 35 /LastChar 35 /Widths [ 500 ] /Encoding 69 0 R /FontDescriptor 70 0 R >> endobj 74 0 obj << /Type /Encoding /Differences [ 36 /G24 41 /G29 42 /G2A 43 /G2B 44 /G2C 45 /G2D 46 /G2E 47 /G2F 48 /G30 49 /G31 50 /G32 51 /G33 54 /G36 55 /G37 56 /G38 61 /G3D 63 /G3F 65 /G41 66 /G42 71 /G47 89 /G59 90 /G5A 91 /G5B 94 /G5E 95 /G5F 96 /G60 97 /G61 98 /G62 99 /G63 100 /G64 101 /G65 102 /G66 104 /G68 109 /G6D 112 /G70 116 /G74 117 /G75 118 /G76 122 /G7A 129 /G81 130 /G82 136 /G88 139 /G8B 145 /G91 147 /G93 149 /G95 156 /G9C 173 /GAD 182 /GB6 185 /GB9 191 /GBF 200 /GC8 206 /GCE 209 /GD1 213 /GD5 218 /GDA 219 /GDB 222 /GDE 230 /GE6 231 /GE7 232 /GE8 237 /GED 255 /GFF ] >> endobj 77 0 obj 23672 endobj 76 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 23672 >> stream xl|Օ>,]B!iBM dCBRNqb[QQd˖ef44iXŎ؉1q 44Bii [^>nUyse[J!F{ssU\i S0wm}<{k74ǻ:_bU߷lŪk/xb|W?Enԕotȍބvm~2̧7? 77']- %_~ad% |a1 Y01ya a603 ,|af;41Nie 0 fne~ 0La8Fba1Lat1dQc 30 Sf# sa^d saN390?d1̛ ~eu,{Dze:=Xαq9/s,_Xұ~U9?}.s|~NJ+qXXαqʥ9V.s\X]++W9V>:_GsZXʱj,wc+=xluu+w[Xy=ߺYz߲+_G:=|]-m"kH[?{LP kXZIh5&U1j25fƪkj 5Ś5555j&kjהk^9R3S3[sX\͋55/Y9QsTͿԜy敚35֜9WZ2kOafnhf>~1g>W W'3_G]Ǚoc-澇es3+?O2άd=Fxz֠# ʐvDN(9rsu J8/%@X䆢<%m6m|rdo]zo߈~mw}y>B/?H|REWq%8{<%$hmXGB?^50q /U #oڢ{L )9+'TxE;$%}.m@C4Gi MrPz HĹĸ*1t} zK0XM66bhNaŃ\$i,_2OW`;-I :pbXWR{M~Wus1{X};GfbGr1oX{-nPS+=fn(nuZN"{5`q-e@@S_KMcWtKc W3/^ Ԕ\2ɫf^ \RS)i^ɾuCI75Z+]u+w(:$Q]ӭOSX#L[ Co)ע@u F#ʥ8T&OW0ÙH ;L.`훻R;iMO©SG' y|v/q鲳oGVh{9b O) Vhy#ױLkmj|b7ζL.e'dz䊯ڷz8b`>k^vy}AEY( cz7SG4|0I2"/ђ}wJ#%eX2Gk5 GE1OuDɺ ^⸞9.SuǛ^\DC6Ho_nhb a*vI Y\&p%xDžȾ0b~޺i}7.^`'t[+H/$Υ$/qw';5خE"e&X^ȻJ`'ݫ %tPMݕ"[d1o++U+~<ۢaF()SiR$pc;i$d]8!Uvv_mJ|Q;CҒ L@u^ wl!\<[V@-R3Y `1>džX \Ta=|,&7!K'nsT_+ɀf? _$}î8lAX<2O&"P6Ǵ)JSHdCQgգ 1b%2ɞ(rN[I (SEVH JѸ@l~_mk`ퟭ+?LJc>X3ř#`Y4]7ۜZ!B˩F0AB7h"||u km{;]FY.E 9ljQR&B<=U uFHA/?O^"ہb rB3b2ZǺ ǥJH)<ڛ.4ؒ><;|sƺb.o$)($;*<g0ycփ_ceUxf7kZsQRA8Pr7E6a uq%嶂`ZQ2?keSBI60\Z?fhȇ ŒT" Og ˿i'< 4HJap p(WkftsȇiW9րC6FQw;^+HJ)2X7xxʮC1b񄀄Gļ.Cw.N1a|1nHHc$O`=ط:?Ɣ rßqRG]G6dxR PIͫ'9N`\ֵʩ;/H]4\ER:r6/!'2ݩS/3$+؁ݍ{73\w]Vol߿hA0}V8/Ad1 [ xھn7|bT2?i:| C%&5B8ue >uEh f4𤻈+Ҳ+a{]G~1k"1Լ4o8-YX^ }THU뚁*NÅFyˇH= @:I7 t˻Kߓ YҤ _N!5 ѓh޶Fٖ#TERbӽFWy|:踚H3+]Ő^_ X Üg.aYNf*2 Rb\ve |A\K+O3]z _l|ߞO}!#n,µ3e@NKV'1$`D`@PJK ;bMﺲB|:OɖOoU0$YL5 ^2 t$6iVce|Vkp*{EVq-74l9la`JBMh0WD"{8kz"iB'nŏ|>s'za˓붮hi1u*)p< 8뇳 f\艷rξ0w|p~\4Fu$3# 2԰@~/D(nj8< Rꞃμ3]yA\GZoҸE~֐s127ށAǽ0>vR.4qܘؗAR$eeO12>7łľGqt x79գbEXMGY0>r]SȦ5߯BCtWգc{% >~,[|V8^tmPk<%杺W,C~$ ȮrJjKwFS\﬇f1E @WhћcQ/aaSq3§#2rSQg [$C`ᨳ rk &E9E '!g[LXQ;9rZΔ!`yFf8g)yO//g,(Z*CSѺa_@f)} ٤oFBKѷ5Rp;yխ޶pc#(T eb,Ll?4WI <)p<荇1іc/m::~h@z9lc17|:3 ŴEѢzwE;" 89+ LSK^&Ho\!go>0sK"J.{+Ѿ%Mӡ{%JUdOvɍ;Դ Ox(F|lisy |Pޕ"Osb6haxOZ['V 19,bz".C(aW(?X#n=onr"lIpMTòxTYb)1M8՝q5cRikwEv2<]ANmGeO6] IZ}⡨Jw]S4#ʑ}=f+CRpaD)D`я$7-DVts8)IfE<DZ(2Y\'מmEqSEkܰ+%uB@v0)LCR['bȸi'O&`Ȓt|:J zy$?*Vk"Kȁ_h%~ftV?#+ocx(>]HR#cJ5*Wr+ ϥc?-;}1O۟Ae?kХ T|8r N pF*#}wdt YPhm77@!a!%Fi/߈mvdu}',p5qО f{NwpλMe9rxusRP~ZH-68*j|D@oms!E2 ҩyN|Re?am I^[q^~: &%Ғ1`30>y0I_Y{z[~S©!;>26J@75ֈ{_㠾=C2Pb 筣7~뛷? =APE0|ס4+VzL=ݟo,:g~wP-'y~dCPHGaKzpЬ1 I%F;r}E:%ҁjUuCe\eQykสCfTTq9xzXY+|HȇR Jœl G+`o|re{=l/.ޥfty2VN>RexՂ[3UZsz˜Q89Vc͊odxb F.p/y~NeT~-2LK/b3BPw W94Bjfn']H~Tn$O2g}<$Qe$|bZwmSh)\9[2Pz8S@t+O,n@℠_[ ]OЙ]'٫t)Q$)G`VM΢P"Y&^N4baUA`#ch:nl;ʧu͓A(INVWJ? nC}YiOcK;(RA]t7oxVGb1}g\`i,[ϔM0jrf>>lАڄ-2gvZ\F51MJP]?UaA=DJy YWAZ<֮ zN?# rhp%i:w/`i#F,0Gb " sw5òAS *ddxvrY:33%Q?S!on"(R4f(۷h(""чlA>n_!zd+sCx_3oI]1euzZw #  #WvPq`xd';^+: p芃_#1QY,%% ڞ^RcW;?Aks9Z*ich}뻷Êptјv]kVSZbϟ^tv[1A%U>{…v,Q9?Z!>E,}$cB"vJ{)أ?CjPpN*SrGuŜ"*QP;{/3,. g MɌ:u}g!aֲAXmnS+\0&$Cෳ+uP7- џoʶjcg 8> Y0brw=-k*t+c_?V\aZ}.$^40dȷT'}k#&:F`锗(LwHd8;]%`d?N摵֎ǃlիMiT˃_0e!/֑BP;XzE*_*'ӤT$iΕO5#*Y9=,X;ݩ`:ztp \0%?|03վ1,ָdܜN :8|\Gј95ds|5ĖlFN{,%"ˈe y%Y [v*_]"hOoISڙ1ѤTq~ 2˹.݋@$U{n=wKׁwxxIuj4<[R 9'ՎG"`4%\-%H(J^Ϲ mLr_k#oi h`R[ e:?K+csP^FWk*Xݘrn/J c&ؖ1*~ɇY8:V#s,u,A'&Gel} Bgrt8*1Y%'5 ŀFlc&MFT|yԚ)OM'#Dxn,R GX p zAɮoƲZ .Yvg0nӛ6xw6u]DxjW&L/}N{iև0M^Iea-vҪˌycN􌭲}{y|ϠnrQs<- jdo EIc΄\OzMP9^}@c t~\_T"hjhp8]OP:EНoJUS E}Kg^V' X f0,8h)~/$WY숊9~6?kd*|eWRo nt\dB8g4ak&kUS쉮)(@owu_k+ϽϢd{Aut9D gT03!a/|X 3=a"Af 4C* mq{,WV8dyŹB O w[Y_$/c~3N2f{C@ehV0N%#Z 2+779 ;t%P ~+)nDŻ>Lx2pj!/i8mZ%CF36Mh7}oZ4L0 ]M*VSN\be@*߫aW0YlCELt<_5UE+71 =91Cu#S5}H4X$B״~Fs~7SMΰtUC?VN@uĹft{%Ii= A.vM Zv#7:Kx!&c:^5O3GF쇇% H}^:bf̢\fLS:-vDVDW'b$Qm})W*7O֪|&k= qAyx,.]a+ۿrϝ&>x9Z0!k"#1o1#:@؟Z Ŷs9U sπiC?&D)" Lve\3Ձugj y:jIvxDOohmt8E]SiGY@908+Rhf@cʘQOM\#Q MPt*?¬d%Vmj?iksdbByj13I2(|:|}L^jc7ۧ[.^_WgIY=ku_"8u^WRWuGuZU}XҞk|sTP\,wt\lա.^ .8f^ 4eřWw'ȁZ~y(>]{WKD#AtDqH,^ 1܉Md9z/nZ\gsܔ2AzFmG_Q=w0Ny=%߁p6SE%H2xhAPX*Of/QT43tl6^V"2 uJM?_×:|Pؗh kuUzpMo }bP-W\_rWo] Gʳ6%lwWvMF۹tNb-T̾eE"[1Ts &즻'9Ą  srl6{/q/rOģK[+5ߎ.T?- XSbWVr"Fh9b7jw`FAؤe^6X[Ц[٢5?9=aERn\'/<9Ѧg.#GSStl*pQɼFˀ?~fJ+Ջ7$RS~ɕľ8y*{#! Q fȋ$h*GPi4Jxb( 7+cr!TFBLoe׬^ }>JZ0bWUBɗs+}ĞQCt[ܘSB2o[?MP {D?xKݏ|+ 㥕In}}+%_3q% ._[ C,((Ю%"& 3ko'$֮R7Q=V_Dcq1u5sTF~_"|ܰkMC4Pʠa)B ~ѧ@u%}: *exEU;BYh'@#]%<>k*_m|-n mzϦNo."ec`7ʴ/uR;ND[XU%I%4! Hy4* yjY[&D:d +*h͔[Yh W{ɷh{ ?NL/$ k0ZԞ ƭWd4y Z;QeʹiEd|$?Y>z!MVdWs[~~a0rDGYu }$F o|W~S:}&T9, [8wT]ZJhZZE\FۡL9|>v<>h'GK(Hm@[3K:Շw[%U+"'DW=ϟHA( hBimVd{ړU\v`bk߀p>`)4i:a~ѺEE`-"#longi, kJ X1AM{IrNI(3ղ͏1h5a?Awٺ!A$0?Q>91?~j`2Trs($ JL6šFc3}0˛؎i;{%H Řew ڦ5[S #)-J@ _*'V~~C:h5&-/kWf3& 1rDr7L;N8@j A [0ޞcShPH[4eфpUT~acGՍI|v[Tnw4?qx΂L8dt,std̂\6E*ra1; 7ț“ѹwC\̏th3eW{ (b(Z&Vo`~{t8[xBnni*:KbsrXJ:: ~H&PN^*SnuXA,VF]i֪z̾e = pސ3Nkn*|%ȁ@'?+ɻ"&SCItRPܐIPdVxoiG 4 aFMyZ p|Wr2XGRP<R.鑬ӂgX{~.:3F2~#J$!J7ip%{KFiMZ&VC]Fw~6߉QT2P'c0bjJ .LW~Ӟ<9DL(I$UQ_ɪAz.B'|PDvֱ8sԧ}=;gXd\x4( PXUg08}H3^{u.dњ$$I0\o n3G/~w_.2fGV ]kdWKr?n]L䕗݀Ȼ׾I j"@_`iʾC\ U;]=Ve2J/ce|ngoh@./nUͮ` N&R/ Bl{gTtX9tW5yC9e-&AW+UБX>Π^PC:10x"CRBq#[1r8oO.+CdI@#*~z ($(Hvwh-֜?Jǵ)+7*azIX\ Ɵ!F.a.@|9.Af- >{P[@X~]HC[작#zEU|;Q_괣gLbX儜o [Y}Jx+k dz_Պoaa%u!Aر¥HYh?Y(oxӿ-]CҁGHo:O}q[{N&[?߸rz+RbiʤJi!$@cłvX` |D-YQXV1Iv:ܴI7=gA/}0MT ,,G t 7c2j֪}ƾD;[Ap'< $ĜTOpZԔy[V45ad<'뎆( f~+ϼ~]c >> K~i0rٕ5dm)Ve/hٛ^8Z>+՗5bҽEj`Ϸww| GFLIZTA=I`Q[*,~*@qoh40n0K>V.VHb btXbICu/p`WyȱLX Bi.?{: Vf.#x|$IKm]Z 5/q33m/~Y1<0"Gُ_6*C0'$yiFևiS|}*d+|)kcja{5le1O\\=-RŒ$<HdD)͛0NGr>H32O1` GN& .0S2^ 75_?pS.C0ԧ( #yOYNR_ yDAɸD@3/70J ;aQ)8}BE?i?wَY{!BEOWUxaAx歇I=-/hykÌuK|ۿu Lġ)N0\¸C2x* IK4e. ̿6}qz ^njR>{BGa"cpǽ 2ܲKR~}1Ss. FYM> WWg j7?ƒpM3l u˥>b}8! ']A('RA<-^Rr)9 p_@%8%水زπ`~ -uy% r`Yu:G&Ҽ|.fB+Gy<]iMyM1a<`\GanxM9EH6 ߣMɛAϏXYH^ՠ f,.=;1-|W>ޭnHhU \NkĄht ǥb h>U{&?d;>q"HɶH%5i;z^vByz@ LY+w%g^' f_ FjJ\I;Qo8<]r`H*ͼC8q3 9lu[w^M[i65\]^8Ed6u;3L? *#Hi\ v8ӯG/M_:CdShTg1e;h! YhXy0k_j^ԸZٰqHy {$1uBCMu &m{+)D6E.TCg# fb+ .¬骸.WHStAe%c= FX2$fgȔ8/-(,aF1f}aߴ &梎)_2.|-:Moq7C+ƊCSӀ-Naâ}tDzKS/ B:rR_IHf#H <lPrY,BTF4SWc>֓z@rtpVd0|twq*,mԓg +,ϗI .~7@-oV0pфR^ڻ*X&6\+ڙ &k cBKk7ɑC{-{X{rqƨYbSL!KWְZ íh}ф!PlkXeG{yh4N5NK*ZNA 5D_j!W H\FkdHXd]u7?^ AH^{O½Y|,s6ڷaJt:Z^tдՙ_4 }.5tdeǔso!S^O"$=9Gra)Jl%¨/*"s -a}@r dŽF1QfiMpպ.˗ oTAG1BaY]-l 2FIo-Qpr _C%Iӈ*thSAD9,mAQDw Ж_mLCtX.mg#Wf6g>ST "OzJq4+%"NMgaۻw/[AP/-TU5(Xw4;HZ:qq<m63#;ZDc>f8l~J\'/]іC|!ayH^>FMḾ ZM-*2TWsjqҤm_=BɜQ-7AZm;$BNY1'ZNWql ~|J%שgӈpjgf.Li $P>WoNfdsXoUM+b̛3A,:s -ES7jfHF3F~JI*@jx+{tO;Ja!lERYbylE o&OGN> ?+*y$GkC4[izҧf 3{:aڋ2ط[|@PO_8c&_P@~k|>HK/n_^c8fzR{A|&t.^C"D ǵfHȱ%!Pc:b_9?SnI]X/QO6+u ڞǐM@V.at:0=1ڿM;ejс X_ αo6<|K':Yꥐ)<'ۯ_c6L?U_@yͽ9XS}D<"-Q}CߟuwMaݻ7^zc/9ٍAJzڥ-:;>c@9#M=縫8N< =0j"7lJ)y*ߧ8D ᔌb¿[얍AocaP91qB|;Cכ܈SY{A OppaHv}?{FM*CwVT#1ʵ>ReAm䎑rKM;kOU!A M|c.7JZ UL/1h[ ݬ wnKb1`bU9@ Jg*y8~8- c#Ҳ1֍)6U33G~xl E!j%UV?ؒF|rf0HJ^+ LMKk[AYuL*dO앴MGUD̑{]s?^Qލ_[~k4{_:H~rk˴絧DzDZ, KT5k媻UOt^7DGh*&&rʒP) /%as ,ֻdֹ*D?T5 ^ x0u/L̀/ôhfH$w]4qRv$er "` D Lkj5`{d$>wC$úclc Y̪:1ͣ-zJ+ednlapKON H u*6, <.VW5h6ւc}n|y{*1F:֫ƈI w3E?OՕ b!zzLS =2/LS\r/XwK1jI#Ӕ g](XlK@Gk$"* /+ȣ:&{Rzn1ESMxULa'#+듯мrUzE]f.F/9E%Wc M颎HM,Y!u es-.h, {ɘ,$@ x`ߛˍbyjbYrEoE=N6>HqʼnA$OqrgPfǑɌ } ֭WiZ>`읆%>[21CdNC•bMU< 8]T."PJIyou?v쾥#c]./Q/R$^0 d5[0Ok'&ku̺FC74}i!8 =VS.~W>{Yd~xJ{Gm_1V ?EFBi$\ڤڏ@YIn ٱij6v鷄OOV~,թq թǶ3`d6IMT'e |߽fxn~R"PKi$o%%[N O4kCawWdU7 f]Yk%Of)kV[ft:N=c^A4ࢺΨ0W,IS|6ZP)L{M-CM}š%ї}^j+0Jv1A/O$ux5rxXI % ߴr{HVX"yzSG5ܦEKF%\OF+h=?Yd"W{w£ws:UKG*]Yofik=VdCiHIv/0@uM#/ o9UMzLI1ı1K@~pH!d&"HAK9kԃv2ۆ{yO-##KM" FS_>2| Gp\<9{* + _֗ʎTyb<I“׃P+ּ|վr7PƘ$ 7M]Q 3Ȕ*Y !tW7!$Gmu&[b\t-Bԡsbz \>ZvJoDkz0 endstream endobj 75 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXS#2BFzBookMaker7DlFont70536871258 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 76 0 R >> endobj 73 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXS#2BFzBookMaker7DlFont70536871258 /FirstChar 36 /LastChar 255 /Widths [ 1000 0 0 0 0 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 0 0 1000 1000 1000 0 0 0 0 1000 0 1000 0 1000 1000 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 1000 0 0 1000 1000 1000 1000 1000 1000 1000 1000 1000 0 1000 0 0 0 0 1000 0 0 1000 0 0 0 1000 1000 1000 0 0 0 1000 0 0 0 0 0 0 1000 1000 0 0 0 0 0 1000 0 0 1000 0 0 0 0 0 1000 0 1000 0 1000 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 1000 0 0 1000 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 1000 0 0 1000 0 0 0 1000 0 0 0 0 1000 1000 0 0 1000 0 0 0 0 0 0 0 1000 1000 1000 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 ] /Encoding 74 0 R /FontDescriptor 75 0 R >> endobj 79 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 ] >> endobj 82 0 obj 692 endobj 81 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 692 >> stream xm_HSQҡ)P+&g"XQ S\]t۽(mJRI[A5!}޲8/zsq8?~Ru8ˍ׬W/U66-]}Ö&`9SWkkpkxAlL1挩Q_VQa0.nV"~=?ȁ6sbrekl> endobj 78 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXT#2BFzBookMaker8DlFont80536871259 /FirstChar 33 /LastChar 39 /Widths [ 500 500 500 500 500 500 500 ] /Encoding 79 0 R /FontDescriptor 80 0 R >> endobj 84 0 obj << /Type /Encoding /Differences [ 39 /G27 42 /G2A 43 /G2B 46 /G2E 56 /G38 57 /G39 58 /G3A 66 /G42 67 /G43 91 /G5B 96 /G60 103 /G67 105 /G69 108 /G6C 109 /G6D 115 /G73 126 /G7E 149 /G95 160 /GA0 171 /GAB 179 /GB3 184 /GB8 189 /GBD 197 /GC5 210 /GD2 211 /GD3 212 /GD4 229 /GE5 233 /GE9 234 /GEA 235 /GEB 236 /GEC 237 /GED 238 /GEE 239 /GEF 240 /GF0 241 /GF1 242 /GF2 243 /GF3 244 /GF4 245 /GF5 246 /GF6 247 /GF7 248 /GF8 249 /GF9 250 /GFA 251 /GFB 252 /GFC 253 /GFD 254 /GFE 255 /GFF ] >> endobj 87 0 obj 23158 endobj 86 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 23158 >> stream xl{`/.wqsyvۖGiY\4!Gc+񑳎L;V齎L:>k_㚷t8'#r;owq|ocͷkw;9!㑍o(:6|qcK?mplcǽW:vbwK֧Ɋ~ R->4g =2\d%gȎa+oxmg2e=AxcAvPY @a6voCO ;A(ϕfy?lzArRV >KaY'BXH$TҜO%,%s2ûws`(?9uŠzB.6Þ` {ր0#Y0(t`7J Ɨ@'5uQ+o$xO~yQRP*J%uч.ɬ_#U))%2fS (\0̃O"(jI˂VJc6Rc2 Yr4jw))TZHr>vV\VV)u4)^k/uktȀapipTq|c#dDN ^gw7wx"^ps2;IwO,j,kBS<"?s?~*=SA_ J.&X9Nwf^-Dx j"`d;B"&)Uւ}|/A)*(asb99J@LLLY5bP*z2j6CSi&uPM@m7#Dy\aϒz dzH;;X~8̓KM}I9kp䛘v6j? 7<t$K%B50F,`w(o%"BM(Mƛ*MvA\̜]:)@"A<+ә mwt7WdTB k7 W0wB H~9?"@r)CyBS83Q.PMf \  cx tB-QL JP9"p&*g,g;uQz~c5ˠ(FT=H >rT|}M!@j1:a#Er:; :IICI:[VbQOH5eZ3A2~X"WuD,gnM [ȣdveP42_&gg% a ,PV$(? l_xς/<̢a'J(߈Rg&l.y%&#p o]^L/fmh7Hj oc <tcr_Gc:O_n讴Ň>#\d+]Ufd9An(r<aq/AALu'ۿjYBvDQ! W\0(咔Xt'y:U3è41uk<$ Z.a>BX 1DOZ2*na c "O~]}birM[@ۆƊAiXGFH5NÕ+L~ ExySxfuϢ<w1YްȚd :Y+r~Tgw.p SwZ=2~Sք6:0V,)/`Vx2~ӫ"/m|< HZov3MK2=,)6ZCr2P,%ڟSg_+ /4zr/I*g_wcC*$Pr[3( ê*ǥ37O4 6>Gɳ""J"9ND#Jq)b +<(_DF4]zBa s[DDrC+"T\, qjP6ʂqFn|b klǛ9>IVd_'v*c)ˀc2 ĸ#+L/R9%P_`+/,h3l/un>J#MdJ+No6+\wXG>Of efOv|%r̀b2GuӤnOrT/'5@|gd7 ?vX۸GTjNFLcs#,2OPDegm^>JJp5ٝR@m7>Q3((CAJpw53JF)m};(Su?b㈃JE};:pcadsMԪS:t !yIR=ik']wDF@Q&4VA^;d2! *~8b:Tx ,ހ;aviϱ B.:oѫhu6 gv(d^<iz(f4'Gp> CSD y"5͂BBW-ͼz}j j#v5߼>ZCV>pY[S ,wW.@hHK5i>9pB v;^3 Co+sl#//!}LԤ4Wgُ?AnXU0⏅1}U?bT' #<35Zc ;ҡjj2oN߬7uWN*T8"M g;(K/ )H W!I\i"ףvӟf lÓ3;A X^ni{Қp {ƣ3!"!}<; JP+jF /!kU@vʢ|OBJi Jy8cBnGmW yaO1=W10Whf;Q|Z/m=ЛL͛'иq#g( mlc\5K|@t$>.F@Z40;cN_@LT*4fs&P`tE-T&\ Zݿkb@:̪à??=VPЇڐGl֜c{ ?=Β Nظ71pLMPYPh?an\I#da0FڟSwAiܘzKF?WL=c˲- ?=yLm,<"h*> Bg<6C29pZQ% t:륓f c5!5BLX|gh9we!yYNi7xt~%%Rw.CZHG,\鼊 CShkC[UxM% ~.FHxqY3YZ2j Wa! gr_c|e <ĕV4Mb_  "I}Ni*b_?D6n@AOB DF*Dя9UB\ZHhjH[GJ!ɹꐲEQ_0h˞͘$}03.t(m7l|.֏ER130??]p\O$Hzj\܎.݅(I8UprH&:= 964`h0?sZ;K.`LӒ #;˛w[=2ˇgxG˂blؿ0g>+ 웆܀N)nD1MjP/73נP/=T|ՆOpok Nz~6{l@ӜxS0kʨNW&qoqvh&(Oxk>:WIW@4>2LP 3]#3W>a|*} WEf uEe )8*Z4?XAsD xGO5q썽 )M5 -3ˆ},hюyV_jr| Gm|u%*cŁftXCP}hq'}tBW<7 dE4!yv 87OR<b t Ff̈́ѿRgK/hH65V$5JFj  h=(hvh؉L^ 'hSJ⇀9[*/eepKfݼ/0#ApaM:|4b)3:z㣳f7=n0[yƥj-}|3;lgsl[s9 ?2w# :=P}S-鼲)>}= PJ0f+{ԝ%i,zb9EHC@C1Tp=`v3h_$iEA@'r h]Z H/JxU:uHaT©:1ƄνC9J'px]ؾ* lVL&~62^[v8$"}iݸqjbE4>|*´ڧN 9D܀1U=mїQ25"i0pgk/گP]~mj쫢_A3OX,Y_j8ěi+* $N'G(m=>=mYGΩ.cY'`0TjpA@; 1}%\fŴS iA[IԿHZPw6w]< cYY/h43-4m莕w;LHHa*o75ߟt@)N2Fxb 7GZ ~OVAVQ/5'tCuOZG4%u.e"sI n{&X(!=ۑ@b?J+^Nu|ZXBrRGpv>I˴W |0U\il@Rz 44&/cB~SQnA ,sN2z.kV \9 (gy+~Ã{k߽c# جk|M^:BeN;g1}hR]O>~&DIe΀ }_hE$pGy2@(iÓ=~oip0VbIY\]&B߿v`)^JG#KB  >/i-Wv[pdfSRs46<6a[vx݀V*|9u6o:`n`7C}R"amڛ/A uH$~_?4 naƌJџa9V"qA C/{C(R鬉QJ`*SFU4^EjYPܤC*I'#G4Y!I"i*f5.e=&c=#r=lzzr,' g^oݾnoPNׇ̤_Ko *~P&Аuyo^,QM+-Bvhn,MUeި!")L嶆+*E' h'XZ5Aɝp2S&qFs8dUbciCi| vۑ.!Ͼe`4<$=*R%J GEc] hRsNWS$Mިg .}٢3˰"ݧ>/.= V1c4VQmVFPz 噗Ѫig/HX:vL?z{ౘxJT9LL"{SG{$U([skc0٪z۰a0pͺ#-B֒Te)/+2TF#r!:A0RJ) T"4 0򑱄'޸>{Ʌ({L!T3H[DG@du^o.dyֈj,|{vַs˖mCG~ \B{mx3($Q"ʰ k ҾP\2NMHICTύY8;kjZQytcz8Q=o5LyC3{5`?\cH@q`1(0YfURҊV7G|s Yl,h OCx^K jqiNI j,pk`F;_i$'mvobk`dS^LdpN~>3DPYp[:WJ9V_} `2DuݚgJ(NzP/--+Y5I5 +$*F2ڪ<\4Yт?r-u{{!.3Jl#Hui2F}ХmɟS0<VRV&g(Shu]M09:4/s,ΑT@j~ټ'GAf"Y: TRt]f!JddTMOѾ8@<7Gv5@+1IM,tL0*$ z Cv;ݭIf[hM%npYUHFʡ! {yLUs6nc,$THW[Gwo4b,|L_AQzTw+?׵^!P5$tc0+OźT =g2 4%h9h+P-&*ν] w}wL8;<93quvU"EiO .x@: QeA'㒇@7iJM~99wL&[-KP,]l5_@cTq5ζyͻ߻rX@A85FpOqkp:]{{g 1-䶣D W4Z=SyrCH5лH$FU6<%M}<-2lj|/;+³<#-Q9BY!cZ Kڛ>AҖe`e<%ou!aCqҿ茪q4(gW}l,N_ YP6͞E=yUb-&h$!bKn@C!3[<. FwU9t ñ ƧW,ZB-G䠸8 |VAU-ɴ7թR,9agJS՗UԙՄ e[nTIT<56c NF;nvw?^J͢ը R&GѴ_*frk^/ pF;>/Q!FݞtXB7fϾO?J܄9Z-if|֛[iP 2Elońg«GQڍӐG Sq8H( :ȗ|XNpjN.󿾊|72A`'h+-Sσ4/4kj$ӗ*Y!Ve /&|yuE=Ti8%7Bڜ]_i6SƸ] Gw}c☚jO ޷e31wE}bȖl2c[tmH hS wo$׫>Ozf9:dFt<*M#e&Fz)GbiXbģ 6.+ d!\>fJ1tӫl713;rJj:x>W1?7òW:$ 9=RC1 X>'+޸Jv<(+wCT@7d=#ЊR}(̔6Z:\ؿ4ڟj@(aʐn֡|PZ(Ԣ$0: ~2$o/qCZ:@PQ+ifjrqfˀkmƣAw$; H,V\ >vxC]pQ6@|+׸Ըzp f^~wu,&DgVÛU"oKWOS~fWƏ @z$dln]-ۉ\=N G%EܡUhh)bz# X Jp?n:36a@똾=>[(.Nm1!J~s.aD=_D Z5YA 6pg:A.cS e Tl+w$v>sf:]/&[>~bB{0ƲTjB>Y€&ض{jN+I2$%)ઉ2:oH"&vX?)l6DU_^1SzNC=mhXLa?c 'h5[h"$*{n( =VƗ=O!_ut? [}  0HQb>t%}3PtfvxZE D'yc~Π 5(M-t R7+߿/ \ݣ~ V]" 7P0399޲.JN% ;5 1*~V|3W߇, }y5}7h tpx']KCѧ2Ikh^^GE ,@riĸ'@OR"Eœa߽y5h_I9z;)]exd(=L Mfq(RiL*0?ugp c {} ~tEדs LΟ&M4Wȷ:F-aě9'^.5Vl6wġJ2ւha$ U?8 0t"02, Cӧ#Gvgah&qtzo WE8 ӆӜ 8 aS3פI.iJ"b6]CX_B)J1\/' mݭ^&L)ttڃCfGңe=$! }K6ܼe՚!N)19xcƇ`bc;4/Y vjBNFmp ٯA@ $BmN )zY`R?(a ScTs^tћn\Yݻ%2xk}%+`U$TO"1B@!sA&?AvDUWZ{'l<𘌗(P[ '˿Ν'bkr,Y!WyzOKTNU2*6=L 6:4!&QslR_qze֕g餟:IXr%L5(zؠZb-^)):X(OfM\q_Қ#ӔqNi{fH&8ʖӭ'ÑRztB 7B` Oy2+Bɚ2JP[`ҜTݕ"ɹN#D8?a̤ހ 1q et?e~)gK RuS2w mJ1'W ( :KM{YIRU.%P[e+CS_cQ3|*lt &ȷ ɷ-^E5I!!ZLy'H !7 !&"2sUgHxLr_uOQH (3ؑ;؏awq"8du Qxp:_F;N[l:mrYi *2wWnS;X9z70ҽ7_fcL 母Y[qڙ2иwE*0,=\_uTB?X*y;a !UWyz#ǟɋ'bѦiSwY TT7sy4JwI;~TƵw524Zj3 6bP/W@7 P1GJL-V ~}DǑtxh'D9ZJT0Z ",>3,||W().|t~O`'GQM35 -EBVNJ;X6 19ORP*h,g4y6T!cRD Tk zU50X剟'x̼lLsN,-,Hđ}-w{xCT_U+Jb͖=u =tG:XPg Ƭ!'Qv19' D6# K6>\S"$3R;0H>EJ Yp1 K>z4N\ЋtrAӈf ʂ6J (FXAb"ڏO/+ÅA Ғ!OAC˂^6cn.zXY?0-0) HRTo ͉Ds52Qƪ NIh9@LN 0d_B\bsCh3E+@zQ:L3AR/NgJZŎ "dG_4&Th>IE0fxR|y6|Si>ǿ6rB) BQ;|sG"ʌ <^hD;t`^+% طv$KX*ѥ`x@`5~]9sUx믿ٍr&^d'-R{X|'y;PZi\C%ҧ]酥sC].>C /:-D;L3 V/0*9*W%/{S@4 ˆrJq|H ܮrU}eslRm8!cy.Aa7nF%ÎN8wI&'X U}r$ ʏ&` 5x:ŋbd\&})nd8Xb [|QK3'{X* y׀x|vI~t?Hhزq>k̦)IRjzTY9&ϒAsI DA;%Euĭ61bL'gW,sZi)),G="! ¹ܝFRt gp4 edFu O {@=( pAI] "¸bxU6;[zz= IY]r4 ~ʎ{CdDĞ!\z\j` 8SEUMNRW1&0-(V>Ӝ1mЄGkL-٣cE`dPΨʾwo'AnP؅PLw& ¥<͐scVF-$dxbloji1FXK]O^V7]3zpfk {$}ٔW!TaqLfKC?N@!Q6le1"3^+ _=Zisa/Z ~.zظXKL<?c26=G$&Sxy7Nouu:"rh wQseޕx"+CQJ/{Ce /4<9[R#EbZ!Xn!xrQqҍe2^\ A'2DmS ]?c|/ť0¸p8 ϻnЄ mKrp]&\ӕxHpLzK|BunW=h߂xE1%=D``C/kVR5;!AJ4G.6L^1n@); QO1!+`]/ *_iJ)+Wv&1wŷRZuM L_bmt:\6}M䪠gSH7ܑ^1j^rI;~::Q=5 N=^6ǕPc$@i+ l5ιe6,ɯp_ɣ0v{@{Psxp 3osRo/<}JxCDL2l\֏m)o2uVa@l%₻87JW,ijah/q`-k%T9[M:D\>t>>ڥ_7t3J47ܙ)P궟Ǩ*e2ŚO갢_pyw?{' 4$7@2yxj?D\_*s ފ_MRGdPhȹ| Q3B$0@jX"ʡ}}Ql7a_2 C۔3{KQXh/» ž3#/pPw0Nn?e$D4Qhb\)[A $BxYD2 8c"Z:٥FǮ' "ɝ1_}yrFCZ+ͺT_?ݬ)(pxγ%]yT5Cڳؗ<#X><8GG_Eץu%|x\ ~I!Mb?D>Dib!y9`ۏ޽'F7=0@ d( ŒR)7FUxB?vrWCӇ݁M+$֘Is;:D)% y5߸rmPHAN-dC[E3WCF㖄'6? T*k3sƒa[x)(F ;BS+!B#A! wZ\,cL+,O-O%$ UB(]L6Wn_8oj@MI1x`\EMo4;xvd(n_X"Ws&"qj %^:Spy=1&dPtS+! d * XP  oɴM'L=xC6}.T[Hz2 񃪮ʞӠ9U\jTʇ3}\ۂt7{GRbg" _jZf^=9}[vķ%! K*R# ,Al_BX O$bZϡiS;c;XM?RG/Q6mG{Ơ[PN:l-1e$lǷ׽ЮfՎ/!*vsN/--l3F-sr#X8u+bkyhP'N%9GRPlesޟ8$6P8?b䓝)1f~|囿>(LNGr*|~Hz}{ @e!l%`ȷ]pxr{!p Eq od<Cg.=)ȏ"I^0I!!賞q<9On_iQƚc (4Nxx.rlxP5Y)jn &\/2TX?|Ɣ{FjP^xiK W T@:b%wXW ;LG+?W ]a)77k}Qoptx5!`GuF}O¹mzV㤣X%<ή/u(.-CXJ P0 c2D_z!r d6 7%pY}ՄW't222 kxo;mV·@ӑ0pK76MQh7."TB?ń!nC}?SͩS5dׄۨQ?c? ɴ*Z RrfO1 /e{?J`Y~1θ *\`;ZsCZTKu]}Zrv& sƑ~ju]ɶ&?C :Z<7;4EwiǞ8_ƲÀwJ x\mfʭ\rɯ YJmm_x,"Y8F~'?߾[eIe?ݙFbQന9RȀb(ċQP4w^3x߲O1TFOnyj@s#elل IY k(K4mw*N|6s?) U5ܥ>Wj0v:\Ir'VQrC-ZbKh~"-#$bF0 a F! FPQ5Mm6m(́<3ޟ\ikHUR&RP ^~5<\q$5'6bܶ~(43b*[GE)q9}B rw<y/$I#ɲ [ŵ?MA\Hv8#U*Na6*s9)pZh\JE'WukrOj߉:O pI(>ZIU(ݢR*CQSKйE|dhUmI[Yj]J'He}3QF*:_l.dZ;ML܏4K#v7jYzXPvS)~I&'(}8L⸿w[cW A]c8]viM܍IqjԦOil`uQ1m02P?4&s1ZFg4W X;4o6~0 G7C#(YzI_;T. dOnq%$(7c9[nN4-un A9@5Ҩ$k\h^MNgrJSyٹZ*oiųdAT9"zo]+l>?m)/P|bQ\8[^V K^mA܌:Jҹ)6ȝ?zPw"1K }>~6Ajpn 'g6>%a`D^ʑh폦vMJ]PYh)c-u} 7<0@"Ӻ.|=iZI}n|$kܹi}4P8曵8y^֒.T&d>k'x$ k)*-r#qI%5_1}kM6TQGM[.^ %T6F7oni'̋eXgF~$dgD+!dU+A  y1Yd UJZ=>D \Zf&gB5d. Y,R1>QP!Hp#4C$( (Mg&s Y!!(KT}!iYA@LOcȖCc\MHd٢,{*nP*a<]N=a,ez0wbpkŇ3`6HOFƊ2y5~u%_ΫjRl:A+\;@ii@eL4j\Vc6^n;\+7ldTAJ0H$[+n}?l1F" / [ȎJ$2u5Q{qɳeM놃nƦ{QPHXx!PwSv>ع8AB=QCwK}/NW,AǠ!40crʯ6IK3s< *YCiOAk`#aOp\pr3#+}K>27}!}=gh䤮C-xo}ZwcG^؊!I= M~]:A2zǛ=Ehq{bpW dz2H;x׽ww`U Me^=62_PlryX-),FZSų_E ^0&wTb%?/u?N#1192@`%ңI*ЛQφ)ӷ6 5޿",TǦ2eFrxW YlvJ>1POҨΞ3נ+zxeXT]rJ{->#E9PC/wowVa1f1%dVuX74,iF ؂\}OZl/ccmqUKd!c/h^!1o$7àxX j-[K e/G!L]#]UD$ MvQp)= endstream endobj 85 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXU#2BFzBookMaker13DlFont130536871260 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 86 0 R >> endobj 83 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXU#2BFzBookMaker13DlFont130536871260 /FirstChar 39 /LastChar 255 /Widths [ 1000 0 0 1000 1000 0 0 1000 0 0 0 0 0 0 0 0 0 1000 1000 1000 0 0 0 0 0 0 0 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 1000 0 0 0 0 0 0 1000 0 1000 0 0 1000 1000 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 1000 0 0 0 0 1000 0 0 0 0 1000 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 ] /Encoding 84 0 R /FontDescriptor 85 0 R >> endobj 89 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 ] >> endobj 92 0 obj 3684 endobj 91 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 3684 >> stream xmW}pez ?rBZzq.@.#s.4$Ql$9e}WZv^$KQ8|8\&!G@(ВLatGL^z[lW.,Zl{5O=yOu6tmm]\? x6ۅ[.| ,Z[t%[d:z-cŗEol_|-Wސ3ۢom[mm6]62mvvͶ_{ۊse{V=`{CmCk]䮥w/=֒ha--rҒlQ[m7+S!Fl ٽٮc[xvvαk;p~qMݱ~ۊ4N'acئ*uP#ŧl=h5֝KpUg+>l,Aq"m( 2x~5왡3#`~a<<ֺV5/d2'I/ c< }Nsp6 8yDzH!1lҢ>RWN?tD ĺxA#΁҄tcPYjTW9=KMdϯE_KBW?L?cи^kaw/D1:aYF?(1q๹_x1*XLanovs_fXCͷ'RbEa|#*6k}ElB.if?IQQ8Av KmY,YiJvgC=YySi\ y+eS$Qd"muq3<:[|(Ǽ%r0m_֏eXAyZɖT+}FGt|1*!O(J̠*zШ0g',b1:dh4*8}ƒTVG|.PsbgWBy.XF^[DI:; %~d/Zubbmܦ4`Yio5Q瓬~ohބ=@..o5zrmKP't|FqTn>"hÅ{i^Eg* |H@y aH 6ݝxdXv<3<}.\?XK47ANa@1$ؿbRn}T'ꕐ~P7m%f<|:HF *Ϙ&A[tE?ʪ9$Ipe5E/9Ϯǔ?] |QwHhVG$e>ku MebR02w#䍅hm;"$xRQe؛=HT^ vnu.]j*PxBl]fu?O%QxpAaI Sz£ӹν2 Xa3Ku^ fV(v: (+AȪ~a LY`Lx :|R'zb^I`؝`Lm`|7 "j,#Kba-[Wm]{` gEaV<7K}hjH3F Лkl=:ެ]#fBGqXWMuS𥟆pW:Wz*7pacn,/=:/\cI@~'qZJdelI!nqw4($3K>+6}C'/BdGń"t3֟Gj/ZGLT3l<`nHuK/rdhrN!3)`z8BM \}A9MVrJxP*"c8CDqLӚ -s/ ӪDⶒ! 3rгțY:16Ir#ʿf!ڐjHJL 7[wb'niúe];l]IreQυfO?<)|-@\Z0yTSK{6֌=6u$khF&&F:zTJ%ȫX:`6%,\7q)&KD=wpF>PWLtg\ĽV7sKs,eo,l= ȿ!3^0TJB̄S tX 󮘋4zD|EN,bPjQb1er330䗓'57iڋ9BozzMLFZqr=74>rz*}@ʒW'c5:#al<;`f45zDO rlCkhѹ瘟 ; #c:rNe[?\(tn:- O~k_VtLdR$*YD" gyFB /cnEwiDnTHNbah b) kN>xX,CY5Rjҷu_JSngu^]8NJx᯿<ݸy~OQ/F)ĉ?r?^I"gy`]p"RyMD=|(rI$dNc &)G쨓eH! ۅY YV y]HpIZTgm:S/HË}t@k#<rO8 p%l4ef]Yn4o6$mfJ*7}|F$F12r?.m20$;;JA^nk%șPei &9d'!4h|q;we:9A5NDМ/*.=S9EhO1n^m-[m!*ҵ gO~}c` qcI-y)"SAҸElFǨhrX}[`u~4.Y'hL'maēl'ȿ2>kT>#C*%8"%<rmgZsu J0Q]}Q֯9ÄNRwޑ8t^o]YTjX[uvv$_UQn亲8\)ϖ`$ >,j\+ alYߋǡTc(vS cqJF]ufLHk,1 pֺQZy w7z4엾ʖ6eQS\uN~}&.MsfzWRQlWR#> endobj 88 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXV#2BFzBookMaker22DlFont220536871261 /FirstChar 33 /LastChar 41 /Widths [ 1000 1000 1000 1000 1000 1000 1000 1000 1000 ] /Encoding 89 0 R /FontDescriptor 90 0 R >> endobj 93 0 obj << /Type /ExtGState /SM 0.015625 /OP false /op false /OPM 1 >> endobj 95 0 obj 1693 endobj 94 0 obj << /Type /XObject /Subtype /Image /Name /Im1 /Width 236 /Height 236 /BitsPerComponent 8 /ColorSpace /DeviceGray /Decode [ 0 1 ] /Filter /DCTDecode /Length 1693 >> stream JFIFC     "#()%$%%!'+,,-/4443.4444444444   [!1AQa"q2B#R3br$4CS%DT5cs& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjz ?I$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֮$I$I$I$I$I$I$Ip33I$I$I$I$I$I$I$\?;jI$I$I$I$I$I$I$3?;NZI$I$I$I$I$I$I%֥_E/)ăEK$._ w5R"H?]MAkH_E/)ăEK$._ w5R"H?]MAkH_E/)ăEK$._ w5R"H?]MAkH_E/)ăEK$._ w5Vowoz<3C endstream endobj 2 0 obj << /ProcSet [ /PDF /Text /ImageB ] /Font << /F5 3 0 R /F9 8 0 R /F13 13 0 R /F296 18 0 R /F297 23 0 R /F298 28 0 R /F299 33 0 R /F300 38 0 R /F301 43 0 R /F302 48 0 R /F303 53 0 R /F304 58 0 R /F305 63 0 R /F306 68 0 R /F307 73 0 R /F308 78 0 R /F309 83 0 R /F310 88 0 R >> /ExtGState << /GS1 93 0 R >> /XObject << /Im1 94 0 R >> >> endobj 97 0 obj 8924 endobj 96 0 obj << /Length 8924 /Filter [ /FlateDecode ] >> stream x]mGU Kw=BR*mm XBQ@$ hE4$JBB&L@$ D|B[{Y3s4t|^f55~I7gbcbw;N.8xClw]潛ws7ls-:=v$?NMamn<}:&ncU'Fln\=yMxŻ:pWZhJstRڿng@YtZqIOrsʲF:[Sv#QTwi)[3zT/7Vt=3`lJpf25!c-#Nދ`,kL2ЀNY.T vrkhn:s+mO7JEg{m,?e ^RX;5necUbh:v% A%uNX-)Ga+.B~uroTڗZesmT]/%"h } ;ΎjS5s\:;sT='σ/Ux0ۂF.NwK Yi1cK(уi.h^?M'Q[ŴiL ʥ7R`LcA*m% %pICdrBN0Dzᔊw|i9?ϥI]~[FP#"4D3% ^ҩ긑f>Dž4A2.el)U>Uɺqc{ɒπncsw8yҞ#Jтw'>xls'OL7͡zuLf?=oy72ؔwd,a12P/\t\(O5aW޲^:;OA ~f(E\X`ߛ}_'#`BrE;dt7fE~w zdѐ@t-}0m xH %7*]obBh ^U( aE;z$gIo4/N,qMozŨ.zZ}lӻc!a5UeL""Z!__xυ~%`RI]/֌z%DSvfl.lSڇW[yLj?I\D!7 jޫ^8ij^C9(bht7IwLe^>X|W&c9]MGx7L6gp_]Qx`yb1 /A9{?Ipia!adBB h8HU$p]5NEƼ]voBH3_^c]pqֻ@R-Bn3pgJ^}yMڛ¬+LVk3Kv޽(p Q_+9:,(Y "@LлNpct#_&絭q SH`ϦE"{ Btf=Axdu*>!hgJH['VW<)oDC@YH9- \rMD rTݯ0B#-5\:|ۃf`G-.*/XD; 29!lvX[69& #N55,"`zK jȸT0c$4ՠTRßTo7PqZy[,Y0v.Oƫ{rHsGP\8'7:MnK(9-,nӹwVF` `s`9Cҝt%"7]6\ydax3zګf0mo6We̗!L$d3"-זƒ` K^vVzG*8Eje FAԆ9k;J<+ׁzLK .֩ȋV<>0ÙeVƞ<쇚vTaT{X `ۆ6xm)t:Di2Eee[awgB1p+l<__{e(eUeF\THo [~S90-L OIt,cH~2*9u(ģMJ)``ɘƱM9܇c0c'cIƢi~}Q/m!3/u}?9<G|(ֽ0{Z0K)Qc}4BFGNDig_pxH RMQyy+xaM/g9/RPB;a“:OZRKpӤL1;⡥JfW3pgxwY"hiWXZl*;3_ & /V&BR &|@ŒTx DaBM DdKy\f P /)RiR2>hy%P3vH]:_P) ̏ZUU+z%'z~H{{_7/{ >_bNݾ5$YoBf^PT\em1d>8j٬C\)%A5 iBKj57&+ȍ!C8=ߕ;S.?]b,@mTG∇pC`lk_cK ;dL}M+9_l߳:5$Z.t@g'_6\矄Y\Mi^`C-f*2b \wfsM$hiJz5c]bw]H9h:v ƺ6oTVMz"Xve!&y:hԬb|>"p>.;]X2[p7!S{trXm^%3{zd Fz#WtQqS=aQ`m5У|0OɕMˏB7ʅagӯV0I>,CNʺw >Gb܄̓nrs#l8cp޼9g NK|D$ƴ$Ğvۃ%5hJ=dؠ>p[tX5ɇvA v[YHiazHq9=zXD'-<.;Bs !_yηf1]CԂ7svݽThzK ѡ[H7jDʻ@ fZNd232YZ -HĐ0&)˻B{ Rц̮pg4:DӑHzͨ:%8O2%MT,LdGةL;x,^;m$hȠΪ"b!=E'EW xz4>e3Wu羫 m}Ϥ"C`2: g8Z֋ރ&Ǎ)Ԃ `Jí@,;p}ޞ-9᩷d?{;17! Kj?p|*k&r (P\pAy?G"\}?~$%Ri1qыM;ebSHiT$T)NJQݘ^iX4;9<΁>^cmDhm썛/%d6YcODa+IP̄zp~{D\A `'ùB60whη,Kc22_seև,U`(k`=b{BMyu9tJI_HxsmEZwп'pbM2P>eB?ENܷأ-֝qZX`YOjd wĒآAV&^*`iڼ*:NYkA;?yn9z4Dn!EIhѭ]_ Vgh_H2os;Ya>fw|mVXZ|V0{Y0 ߢY|ŖȘbnU+&{GwEɷ %1|C-ZֳM d0z޲+BrYoQ/ѫnp6L ň寵t## rI0.{= ZYJ\j c83I=? ɖ5І-|*kv,(Th֐KyZst߄vn\Z"28|k ̿;rN4% NjG/0?ȁ Ho<5T[-dts6PaA5e/GZ+757ɧn:aͳP#{4b09>g{Jf,7;_x^ƾh73 6SW"`E1e< QxIfi9efassI$*,O6lm$,\cu>͢_Lk6OZY|aW[/4% h6T +L M>~sۚӍĎ&9fr4/8#l,<\zo>poj]|*Wd&|;#d)=b:VЛW8 M>@Tc*N]אMݲAO 3ӠS;؝Xl[[L"똒P\zy_6uG|/4/ĖmJɔ`;4,{FDIwEw⭮d[OMšè*LjS^YAA%|][Q0`:ze:X.UFiqJk_z>mzWҷ/&PZ«LL8T6t_WF P)7z*ިx@S(hlEQ".s0Og,|do=CcLg[*6Q0TSvEOJ—'J@мi@YOQ\^IlW#G9hP9юIaz* dە5. $W OZ NJ5q[!&Uge>0R=+Ss`]qN d PB \H)5vBU΋.Yڂi" .J9K]>]sZ,>긃dIDžvT m۰זiz5ǁVtQ[`[أcWEW-l{$PP%l'8#+V|G)šCN$Yɑ"sc+0- w&2AVqhFYh讍cD YՎތt}oK֧X/nN#™P\qȾdoHODe$k-m+rtS5uX ͆x!E 9l.qJZIJnxRT|PĸupRh2W6EQȕz֜H*,jޕ?u Igivfmn"12}01 iq-G[tZڪx-ka]pO cnn+9ByA %FJ'%M!ʒ,kGD=@~\tG$4*9jֆ6QS74PJE54(Tl&bF/ӏ=R4ﰅנJ Dŗ+=LjΦR_̙͌tmaSpޑt%A!ǖ5sYb\p缜 /4=S CJ C991wFkX<.g0}6+:ɆGHJR|3pe@@Egb#3M 1t9t^rs_awZDvC\nk w\;ȮtJ#4#.Mϰeo)w4.hB|GHWc&b >uK (8(ZB{Xk7rlК-/˦Ț++<+嬐F7;Ԯ-P ٛA fTXyk{XGKMd[qۭtƩ4V(uUzGcם3J[*Uyt \◬ےӷ/ ߖU@N:_Y}ţ!gɒNMK^aqQ(2ẁފ, [>SLg^~wop,^Rd Ǿmn/¿!=R ^e샗w ݗ1.wLztc/:N4G` ><4vƾ-_=[FY@*tʺ2q43]mϼnS)ۘ!&-l(s7`z[$mA>m6Vo?yw6yѢ <78|=[=ä}lx'Ғ85+She0xJ?Wu =^BevxMm P%66\ ͢2T@ HenR$g؝X7Lw\Uz<ӟ,i< )XhnIb4iɿ\ջU7[s0K/cww_^Q+¯T^sB'aK~ { 7G_P=[%l>ptWBȘDZ']7M!rs̅ikaPRo^#70wWr{tZ-Mgձ9ʸ@uρ^1"T w\XI!o PB8\F_{C3X* y=l4@ͻdlnvSEdŻ2#R#* ^ ŹD-G6=c ~"^hr1~y>td[—XI/}Ruj,w'COe؎ήseg9'rs_J|H/23 eis'w%і^Wv..I鱭fkG£uLًh{wV`e\n>iF7Yuc> endstream endobj 1 0 obj << /Type /Page /MediaBox [ 0 0 501.333 763.151 ] /Parent 98 0 R /Resources 2 0 R /Contents [ 96 0 R ] /Rotate 360 >> endobj 102 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 ] >> endobj 105 0 obj 1078 endobj 104 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 1078 >> stream xmRkL\EܣAM#Vk4&FTG"T-t]Xޙ\^{˕BRqRAZDM_1Kffw7'_JIFdLe{׬5͵c-ǭJǑn22hjq;5y,5r2DYb*d n؋<=2 e z`_v?c#!#).)9Rba+2Mġ':425I)h@EˡOa6q7gD=Oڡ,1QۨSg΁16̓#^ot `o;Ia *A.Y#b K"]ܠH)"h(ZFj'3x`vL`IИOu&n*R-@B&<3Qh-gH}l =U!8Lr]Llͮ:pչ ZhOt^A$RT2I")x%q~ z>ONݾZbtȂDPd%8A5?~v| [?9aV,"Ay3VpOK7thg9++.v5~3pww.Ί׹UQ<+g^`}7tmOn(eiyB޶c}E[}mow{kow\T<!@zX[N{i{0:@<fQ I#@| En_/[xz|0$W@R|.6p ̨F'܊!u ut:luPx6}. Fd"-DPCȻ endstream endobj 103 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXO#2BFzBookMaker15DlFont15 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 104 0 R >> endobj 101 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXO#2BFzBookMaker15DlFont15 /FirstChar 33 /LastChar 38 /Widths [ 1000 499 999 999 999 999 ] /Encoding 102 0 R /FontDescriptor 103 0 R >> endobj 107 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 56 /G38 58 /G3A 59 /G3B 62 /G3E 63 /G3F 64 /G40 65 /G41 66 /G42 67 /G43 68 /G44 70 /G46 71 /G47 72 /G48 73 /G49 75 /G4B 76 /G4C 81 /G51 83 /G53 91 /G5B 98 /G62 101 /G65 102 /G66 106 /G6A 109 /G6D 111 /G6F 113 /G71 116 /G74 128 /G80 131 /G83 132 /G84 138 /G8A 139 /G8B 140 /G8C 142 /G8E 143 /G8F 149 /G95 150 /G96 151 /G97 152 /G98 153 /G99 154 /G9A 157 /G9D 159 /G9F 160 /GA0 161 /GA1 162 /GA2 163 /GA3 164 /GA4 165 /GA5 166 /GA6 167 /GA7 168 /GA8 171 /GAB 172 /GAC 173 /GAD 175 /GAF 177 /GB1 183 /GB7 184 /GB8 186 /GBA 188 /GBC 189 /GBD 192 /GC0 195 /GC3 197 /GC5 198 /GC6 199 /GC7 201 /GC9 202 /GCA 203 /GCB 204 /GCC 206 /GCE 208 /GD0 209 /GD1 210 /GD2 214 /GD6 215 /GD7 216 /GD8 217 /GD9 218 /GDA 222 /GDE 224 /GE0 225 /GE1 226 /GE2 227 /GE3 228 /GE4 232 /GE8 233 /GE9 234 /GEA 249 /GF9 251 /GFB ] >> endobj 110 0 obj 24515 endobj 109 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 24515 >> stream xl |U6^TǠ(,!6[ !! t)TtM! B$e10#긼8~V[9qtwrZ5oMg_=7//;9#{ r^9aB &N:iKzz;z>N={aÆkGo8m=<)A.}=qsܯ9_q8n4Ǎq]?}~1I?o~DIyS%MϛOOOOOOJ'M'ѿ<]\6|bc>츄/4k^_hk7l޲}~Uu8]nh FZG[uyw.{\aG?|/r}:I_',:ΦjuN:Υs<:^5QԅttaA]Dפ;kֵ뢺#VQ1]]wRס{CwJש{SwZץ{KwFyݻtt>]]]]}}cu'nTsu_n}Z'7ouϺt6*?;A͜''s92{w{`5nȧ܃FrqϹsr{no6sßFF|=7j>2)-qOQ3;gWq~ύ7r_Mh&n&)\nnn.!a^|9y{i+7KnΧ\ܼye\Ľ<{kn~&7;n[x7-?oL▎p+r+SUsǭ̥.*.M5ssoqm7e]rfqN./\܎J.8I}&EQ_zD/ W`o{XK6oHzGZ|2.^6"KHrgUb3}G9̹Kgû/ߕC>U7GWx0(UgwWtNŅ׷);laZ*Ykr=sz{$*J f bB9|`J@ tHwxSy'j `.-,j>pqON$Y@թ ~t?H悵' /&]`͖uB {Bɨ=̐U֚삚*fvk1|7\8, >'ث*$S`DPCn lpv.ߎ Ǽ7q/{#<]h&ì6 SIP,4ßħ ]Oǐ &]B$ CPغl+6׮\]y.w`gYOXa{S1>%fs;[IMnb m!ґ#GP!#FӛQ:IxWrKr.5܀6 TYVbRv 6 ޝr#ʢb%B whd+{YvԧDa2q"O} ^}>H㦋4]8'|κ0BƋi D4m~"n6{'"Ig/f/}^"]qiKO M|Isnt1^ ɰگe|5]ZC2OjT>h{)xT\"¤MֺgߗGG/7]W]6R!?==Fo1B&'AG\9~ tGŞ;zHBsx7ͯF((I]'CXtF굁VViTK[l:zXv45@ٰ ؕ#ŧkٞ6EK6Y>}^ZWjґQz4q7"J} ZAE>$|viÂNŔ1itL-"v}j^CGP>Ką)V -]&PD:$<+x{5g'yzN>X ؾV#:tXo(ػ/։ *H %l@SR].U/됹`m& 6C堔gϾ҅$ۙWxr;^n0BɮFt!vxK;xzuye2bض=8hMfxW*AިrKpSdlc;WWa6-oXւ ̛>ϡv(hMkOꄞ]G#d0azSyr?vӖ(T5%roߦ=@UMѩL)κTOY)2{ h̑Vt~t_f` UƴDz!D'<10hU116[*psM@DxL?Tm3%_d̟x#&2A+|fJ Sڽ/k]<-1WJGx)6e3!L ^ɛנ9띴ϖ@0zг:T9?\ 0Ӛhb@g(SצKsbcyL8a;khg=m#·qs? _lg\ԇNP=:$+;B55UUhӂVG泺-Q8& dLp]t_^@rp78fy7ѯ*Oe]BG%FRk=Ձa{q3Q5֣Gc`jXr\e1mg9xu%>#B$*GC\XՀa:}q4#3b`!m $6oΦΡP3c)^=yqD26vo kO2b3na>ȷ{À^g/a0͐J> *s*+`Ā;Ph~r6JP%pZ,͆PM2a[FGģCkxVA D!hܜԜY~;; ?{$⺎E8M=|h[6gx}ߴC%\pxAT:2-PgD^ۮڽh ۡ"H|;#O e#O>7qG_c}ȅ33@eFx~$Unɽфų -őFsP[EE藃E깛H_2FXE]דx3?Kscdk<ΰD򦄀 Z*ۍPXk fG~~hqIGKRzRICM"cgeC2"i>{I3Qy &quHA݊+3|r#.ֈooZC1ϒEa8?@4JpJ =IQl y%Erдv0K6Q;jdP21XmY{_8~g%%/Ҝnia4(uePko\9Q&]dD )a+\>sO7GsʢGíˤ9te2Balʟr,᏾/EcW -*=+{-+ozĴ^Jzr՟0oc3.:1>@9n30<ǽ-BC%#[~N>(G+^lZt9﯒_T nİ|'@xDQ~4 ̲g}ςw/Y=VWVE!1/ݔ[ cDSfCSѾ:͍{E\>=th,Vx}]5^/eX+yL;f: ~ ]&apHXEaxM"Y0ślN6U& <*̙7.H Ӝ:Q>.)OIf+e̫f@eu[@K\^m/6<)sE|Yn\ZWVrUڭn@ZTځ:Q V+ESj1XX)9A.EB,B- K0dw]Oġɨ]DфO#c6'+9ҤmR13??݂DG?,Bߞ>~N Î#oG>"7Y=9JD9|&. 1|׊+.Z@'R0(;Bdn'3u>)nXK""H:-b!!IuufA#c^Ozp;%_*T,ޑ)ƚl՝aԨ&u\pV|N(@h~0X}Yfr^! "IͰF:x6;z6xT= #s"0s҇gZIr,mKS/һ/]Mu ERkf RD{h\(IQ,_kjA쬾Tå ޼,C})P.&]WY /Ȱ0 Y+$R"ygN {X>j,sl[Cz? ,?\eKA$l7Z+"Jq|dq`]TBx3I`ռ3żũ2Tj}#͘됎2%d1ZaK[dU&IF Iqu1aHpK ' #{ppp2A9t ;N82t j6wBo}CA=azf3%b^ԘqtdE}9Mkߵ{0^);]/`V?Ч:¾vu H?310 gCz"ԫ]U"5'm"@jDI)-.~&Rrֵ?esx 36[-b;=$"9 iD{Ly#+ڙ ŋ,&_˞KVcŠ96kPW oO61O},aLY0Y^ XUWT6Z0Tdf죣4Fw &LPGYHI͂f%P 6x3 &OWŰQ9LdOleTOA\ڜk΀&1;/^c8~+|Gf=/3CN`ZaeɤTp櫎?@u Zvz*XUd4PR]LHjkbҺ$cKfQug|]fU:&̲"H`\׺@D21S"}MG}bme} B-uJ-~{ V 8}l9':-)(|IWmJ㑜-V\p1IBh;  еZD~RA ̑"Y ;_݁V΋ǞX_ޤ[vm)HfKrT{YqH᝴Ο %~ȹ}ybEheZdBX>m z_gx..b&x]&pcZf\~ζK;8Zfsgjʁ9G EFa(w4"XWxfAϡ_>)!bp`{})l+s+RYm6I`oe1*L0FǺt OgT%{k(0j(7mZثZ C`o$Fw;~)Ijsd3o:|lsXdGEnz ,)#.g$Eqr_ڜ+nf򆦇Kgxgt'[lBW ukHƒgϐp>}ex>rUV۱ռ":h +KvVAEj:";,(I.:#Mip΍돎+g܎u@s^Xe>U:n\!7+3K7\@ |G@2gO .S/Z̒ck$P2:T c9r5[kY͊AȠ'ӡ/!,]/!P7Ln,etJ=J(쉬$HzK ^Ubt<@b"yTr3̛X]0Tz a:%Z^(J6{-+.Vy|@r>"LkW\/Cs }7cd8VFD$*;RE*~F˸U;NP0_=!Q@_u_?3Re).@W$17V[+\G>b,)˟r=J:^ @+2kz7j˗ۀҙD8-Dz5BHõJ )mo@G wiD㴇q![I>؆i]z SGSdMƏא#b8*LO]jI-98.jwh|@֊g#t6BdiW0M6y:JqBF%Zi&/Vj:1(5HSn 3y c$'4qY#ĪDa=5T@%A,Y8oC^]($+)h0VFr/kz) axXwx Nž œ68=6DSHUqU=ѥZS/; Nc,,^?IU^|VA?].969N!P|nt{0z*P7lhs"j]["`<8ƅj}uL2ڂ6(1a>%4Wm]TKkPA;b jjNÍ{^oY*6EǒI CUK0.2jR">b !|dJ~U\a٧ Z`4e)5ݳYeɉC3Pܙ~*蔝qԡ}y$o25T~+J`z/Ӵ}tq/YYRR)A] Ya0OK~NAVu ֽJ~G&I % My N;xdl%`K3*k Uow&@1tDy D #nG_6166}HpB3cc !,Z)]`9]Vo{!lXК޾5$el\c7*ՀˊhS]*bKgo0TW^EbF,1?K8@0V'\~*jOF3h̢;&'?FiA)eڨ5tBڟ7~3nFɚ.8>eMuQc%c/u;DMg/Oett:f$v'_$BAQxT]l֢3ϣz%v-'^{hƦdԬ=c=>y bm`b W˻,̼G+;ʰJy r߬D ʅe)hRhx yM pu B?ߘ8zyI|G>js'7M^ >A{CInuK%v%. /`` qVD.xAIAdk\߄n9[ E"1K4~@&2ŊN5#葸*X֡́ PJUa6Tَ@>8?gXD{-xP$?m60TUPY(x+SC^OٮA`AwY;gމZEv$5Jy8ð1a%ZtܙH;.&*m4$]<Γ_Ǒ"9:]2S{sdd4S}hwbe*Bl%69quP:z@1OqZyfYd6[?G+wUi4VXˍ(bi.?HdSsg}լY_ YF4h+բ[gh`msH19'Ѝ⌍ T}xWog v; jEE.VTE0?-:k׼G"c@zD2|y-O$a:f$_H>6,Ȼk3P,3Hˉtp"+t? t05Xy{uܹ0!r !4Γ{)[UDmoH,?s|E3_ZS{|ۃT6h19e>YWRch[P63czR<,V6,͐ITdx0n/Y$DF (uaT:r'HDRnhYl=wFU $iZ@W+YdY|)ZܰHfdW5ukΐ{,1)*W,?F Ⱦov߰ te|ktPwղGC;;PU0ِ!>Ƴ@ OVls/7&q0NL*I_~ ,yh\6@:Hu:6 (ָaS^CjCt_xx=`ZiF 67ɼ hdȊHmvֻ,} Mm_Փ جo2FGNN0yuJ7ARjU\TKKB[NJ&GzQ:)2B>}|5}t *|_dnήO@Pѳ{b؟@J]f3B]`d4258+mdԯu8uJy /|1HAvo*lFf-T4S0uJ]3}2~5 cG2)`+ŀoܡJdWC @/{o8^tH=9U*\;[-dbگQ:EJ_ KW9,6p.g]دEfkRm<++ `0֘9]!U7+@,N.H88$OxUH(mK\!7x1*5:A`t ]hgW5nM!wb!9fk,'$] 7 \qSK`WAk>ƿ+=# (gz-]ߌ< _o*~ k *H'i:}4= 6f$Tj2@6N(dXEșj'z~۷?=g4P*^$ [r%lV+ uȅp/MuFootZj\00jרH=_ݕ!jbB&t~dr2O-˻홌ɖjBBKY@Gsۂiq ~N(<=Y ?yQ)Fi N7-4@Rn!+F@ DBtZ')&|ͳ0 TF;vJH+ZM[xotv-1-K~%etUbY;WoSAbQ~r(1TՠE}y׽% Ep㑐lZ-E ]>їepc 5N>Eo!:wiD+g_ _ jh1/b c֞U;ѫdY;8\e-fD1zUծXlʔr?(*qiXb2Du&P]bA]ԚcAi<\kT`5J7kXJD6Hۥ њ{KULl` L+Rچa沩K&$odyRBf"aTsFfK;vX@6ZL G 1nEB ciOJ~c;;FV81g0wj$;pb'o[`yAzW靓1[6EO5u^3h"<Mǎv[2`*̾l_c%v! ߺ)%Tk/3Z[923HN4o )uw9j͠jr]*[X*aڜEhcyv*2Pa22l+vv"}%mC6$*bHVzG p>bjИ] OP!(Z]iGZ3]G zټxt 4KS߆Ch9U 憥^yd vZ RbD8M3`EvR$UUTaOM5# |v+|Ma^()*jż lvN טMN7^;oD:ʯ,w>BN#Fy3\>}=^"v8a>0$ۭ}`rB}s,gi9x&HvO 󼫚a\b )5;PYniQgwOC3.-uEOJPRLEIW1ѥN[;yx=;?7kNX^,Ahvl10z¼K<踊?sxT}f֋-'ѕ)B*Du̾!׷L&J_}_{nG.6F|CǓ`K k[h%)IMjrX#~CHͤR -fWvi9dz/RY?"Lp ҺE9:<s12{'gQ=M>FSAOc]20H^_;{)TwPqb!Őϩ={o`w>i:F9C-ILDp5T_ vϏjYhc3`{>ND;0^3Y_RM]n1~b6r)T7-T\}@ujRߴ"֧FR10ٹGAζ=6T7W|xQ[wHVF[X~aA'4ZIk9&OdJ"/!D{@ ¶ΐ& 9ܽP]DQ2ha ֽ:anmůT$"(,(pr3;4S no,r!_1W{لMR-vݥ9}%Tr:F\&,ڤEW7؄> i{=uf}a3Ϧ5DY?-ұEf)=;#>Y]^$JU\GZgg3 !6jOjʯ吥0}&)Vk [V3_6#KXs]M{|lPӵ\œIΔ" lEOU2bo;m?)޹>>=f}@3E}oV?~揻zc&?Tb@BK.08=Svm+|&׳#V8LX A*Z+ehϱBM)-ǐуJuH@^dƓn+3ăH(⸚5#A |\@Pv0]wiz^c2z)aWlF-tVt1&GTvFij+&n"ϙ(Qi4eB@^MDe[Ȣ/^0eo?kI}TR-DvkD=g ٩`v:8'\fM.Ɋ 'H%MWd1yvnJ6M0˕R[1ݣ GmCtE"l lzn|;P^cӛZ OtxŖdiFrcˋFG?{@"9m5vU/ 9ʞWLe%sSPf2YǽЭSce9|.ɏtol#wJ_nrO"@vLfrMlKW@fj#(ǝ% AeOǏjċd1n>c5?O-a[䭌#q^(sG'sk?.!=~s;)HL`k=vXGIr${ô]yֶT(#W74=7N;0L{%FL/K!X4S9r3Hu]v>;6\*Fl!6ETb˥regϙlDgFnI<a%Eu: CٓHF̈́#lGDE; ƙϸT:u*NF07>9A4~)Z ѹ"9%X0h DD+}5`G=Ԇߩ4(}_,_F/E(Dُ>3Dי߂lU ˕.|F`b#F.(83}Zg1~by%;arY%1%O{G_}̺oQdյ7Ueks;`"2*Z P5K4%mimH&iSJi< "uƫqfump>;{m)b!4rF)*/6SrcIҟF' i*jO ثOq=[WS}y~*mljs{zf5U<[ν1oy⊀%tw&vG"Y?ߜ~DT8/K.<64 #խk).5(woVLn6]x .Y(TJ{vb9*KݪC]`cOAeSssv(!&Sc3u A hyR<+ TL̶t@mS]fxX:;Z7Ƽd-by?WE/K&t1b)7 $?SH1A9&pa ڝ~.uۤ)g[Q1Ի1o.cZֳyl賃ϽupE~!JS/3WUԙ{{ulSk0wH vb4ќPvjJ\ZB- t%z͈4WBUT" >ok+}mj/vDt t!Da'!d9Rrl|9tš2Mvcd4BΠz.qI|V`d_C;8~ۖO)ax`  9t%WRAAѻ8eWA(eVz7I_4zFҭ9A$By?amhyj$4㒪aDVvzEPx&'#ӻPN!kgkg;\3_s^HD6v"[*k~"@'F]I*.ĺAQI$v^cl o\ZmlSmǙ!E]ͤL WҚWjԆ:qj5!`j%sC|aߓ;0v bL_w` 1 |He!b&x%F֪[#|Ca7f @Ӱ) mST;o7yABR-W0C$έ@Q[rƈy v^N ?E3=JK̭_+z;φ5r#@(s䅞C+F_~=VJn%@,ͳd'3ʟWH;\7xڴV /T5j#[b~Ts`{[;т.$}TU[+wKRaȻ'fmߖcyV1x-]RA[Y{V42nݘx_K>{5}źL:.mkqs>ֲ'IDFϊſ(ZzWyx\6k$~C |=~KBd9~YG&j?Bjڨ!kja9сhpin=K_85gu{`kfr} $W.dz]nUZXeGcoއpF [f> qJ6+ijCAyx>"  |*GvW,Y3-]WC(eL=Q^]IxLxuToкJy> 3qR~'ҥ4-N`kxoϓЅyD)4gCȼ9[Iԙu4diF@[?}ƛVu$ PSG4|H $W:Gߝ&!zO"ObRSza/'c>l#Ik'WЏҕ˂' I׼cBoՖ4E:K_q{o eM:<= ZJW-pm}<+Zf賝P> (̜} 8ΐFh+[/S1Ӟ8훟~nMև(/†9M3KPoJl VDsN\S:N׊  nnP8~.|̼[MyA*Ԣ'|\f8eW܎D# f9K=+;ܻE(nsw&ȕFY,IA ?9x\4eolȜA8ɤ'8.rs3jBؙ=$!>;o@T3O O#P,۝ (j2AS`KR>N^1jgbp<1C@ f<= S@'qzt!kɩ0M%SEmmbP*g!,JJ*ny䎊WXes Iڢ>{皪 Pؿi_Q‰͐?+*-$.}!ZC hP_v0((>Pl0a 8r^7 oIyȽb>YFg>LoF w}12jDZB-qq(NoԽ[ "vԱ{3${f۲xV\ sV%3(2Tk깼q~LJ3HǠ]:".`n63erPZQZQ"IPLӂiܦ׍}[DB+Qn?+Re%Y)%s b$+V_Ao B~~jԵoRzzdZ: }>;l1]^S=72A>tq-sR2wVl)dQ2e1 )E*s'..,<@ע:̀~yFw3z­j +4Iv9mI-\ IZ%V<΂rHzĔb\Iq:DylH腍M u,Jq{oLKT[ET~zzP@ E 3R3^,F^rA6a0UlH_' km-_|O< N[-2Keynڣ(aQ ?s fZU}x[؏/RKBr`wvX`yڂ  )Mf0['v*t1 nZ,x?]^X<'gijꪌ`j:TWA_RDIjXV,56=.[{!} X7ەccR8q~ MwʖZ k;<ϒm^P/S8&F'iB|5PƏrd/k,lhc0A}a<%2G&~y94KU`G~k2IÒɮ8C5D S޽ إForHy)n~$>}X>w|"˼ܿܿl£@U^ԑB67.G+T</cu y.QjΛU`hCXlID,YuyZ ި/ QGK흯m{Yj&q0YD2 *FZ  ,5ql愡дeNe9rjߣv< qd+u җ9([^IN6GLv&9Uę2/dt&:GEblozzmq1 F]7sN JT>iz^?bQx>k Ϥm^ S3/`Gȼ@%9A Kd_:h՟zhdl^wF,M]L6D/w{aG\-G֒*ŽF& f/MתՕ筸*g"d^Vj (ZNt>Z=0 WVȉ;xol"-nZHH)akmt/iXk!Ly D4']‚B&h_m+o~FEoD%SN@/-d*烬d#k /l:Pԥ=kEδӼOb0Pb\mLȦLQY`&/:ہo6WU{+=hrdbRQq̫v]>\Nӵ%ub~*./3/"Y *읊<6_/A*AנdltTqVc q*@}7a?:l0(:`%`G3H؂n1LM bf`DGK#f3y7-_EcJ>BۛlfO+W F$9p{襈s2{9]5?|<S"J^z;Cy/COiHYSea/]q> endobj 106 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXW#2BFzBookMaker0DlFont00536871262 /FirstChar 33 /LastChar 251 /Widths [ 1000 1000 0 0 0 1000 1000 1000 1000 1000 1000 1000 0 0 0 0 0 0 0 0 0 0 0 999 0 999 999 0 0 999 999 999 999 999 999 999 0 999 999 999 999 0 999 999 0 0 0 0 999 0 999 0 0 0 0 0 0 0 999 0 0 0 0 0 0 999 0 0 999 999 0 0 0 999 0 0 999 0 999 0 999 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 0 0 999 999 0 0 0 0 0 999 999 999 0 999 999 0 0 0 0 0 999 999 999 999 999 999 0 0 999 0 999 999 999 999 999 999 999 999 999 999 0 0 999 999 999 0 999 0 999 0 0 0 0 0 999 999 0 999 0 999 999 0 0 999 0 0 999 0 999 999 999 0 999 999 999 999 0 999 0 999 999 999 0 0 0 999 999 999 999 999 0 0 0 999 0 999 999 999 999 999 0 0 0 999 999 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 999 ] /Encoding 107 0 R /FontDescriptor 108 0 R >> endobj 112 0 obj << /Type /Encoding /Differences [ 33 /G21 36 /G24 48 /G30 57 /G39 58 /G3A 60 /G3C 62 /G3E 66 /G42 72 /G48 82 /G52 91 /G5B 92 /G5C 95 /G5F 96 /G60 97 /G61 101 /G65 106 /G6A 107 /G6B 108 /G6C 109 /G6D 112 /G70 115 /G73 117 /G75 120 /G78 121 /G79 123 /G7B 128 /G80 129 /G81 134 /G86 136 /G88 143 /G8F 145 /G91 150 /G96 151 /G97 154 /G9A 155 /G9B 159 /G9F 161 /GA1 165 /GA5 166 /GA6 178 /GB2 179 /GB3 181 /GB5 182 /GB6 183 /GB7 188 /GBC 191 /GBF 199 /GC7 200 /GC8 203 /GCB 208 /GD0 209 /GD1 210 /GD2 211 /GD3 212 /GD4 215 /GD7 217 /GD9 218 /GDA 219 /GDB 228 /GE4 231 /GE7 239 /GEF 247 /GF7 248 /GF8 255 /GFF ] >> endobj 115 0 obj 19293 endobj 114 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 19293 >> stream xl @T?|H= ŝxaz9MWGeco<0?g')ya2 "d 3a3BIa aV2j*Y0 a63 0 0feR)g*fc110Vq0Lø02&0Ga2L't1L7Üas & 0Ed+ sae sw5/Լ4[3kf<ͬŚYK5R5_N$IZIZIZ3C3gfNfb͜%9K5si̝;O3w&y&y&y&9Y\3ofͼy5h-,YYTޢk n[ Bc Qͩa;\~A6+O AM~vMνj~^my,u]ZƿtM_8 n{vI @}UGD#x71iA#x2^9޾b߰D?y X1٨Jɏ+_nCQQzL1l?=L\b=n~{ 'HÎVC5q&`YCV?t l͜k1*=f:$؛D; O_xh0A_WcDfr9|ԚGWBZe3drcR/Bt ZlV X65QIFx M(f x"Y$yHliI\ o!pF#ĭk~.#p67 3r0qk:ĵba0Y9;I$\vXIY6o/{.M/(KANo)K%P& 8l+޸P&3{kVUPn= ه`G.gٙ7X:̚ȦFHc3t8. N05B547Czȯ^.LA-t' ,kUkR ,NGr:JZ1 jl8])+6v vt#p`ij4X[c*d#/fcߦ4YtUŠ-ѕi]lb9d}Bs48NtH7KGA8>^H2 FwpbWd'rd"y-ʜ$rpk]Q˱=]=TIYxXO,)礋ҿKD\^{7xwvE :&*u8uHl4sOldurӑ?ZdN0?[fBoll坦 hr`bsF2q%2D;;P&a[[|0Yڶ# bdVN逯x%حtNYH=3Vp }pa o4^__SzErNtb8ڂo#BCA)gfD'Ue4Xd3O|bR}HN MoYI,I1v?H O推d0&/FVLQ ^]c6qB^q5/#:<-eHfQ~U Us7Y b-K U&Zbh4 DMMpµC~+ T6Kmo?p~j+kPZq BR|WV6~vv=c{[rZEy`4pJׁƢ-%(`2,5 uu*0̍4; yJ7謒ܛґ\MeG%jluĢ8Gr"iViU΀s6#]N*047kYܪ=na=i-O;)_vE٘h0]EG㹥R;ho脢XN8~'3RgWVu]ь8J$>Dp^‘VOf<@ҝr܀Τ* !\s6\g"K,YF-5+n4%%73%he?=]f xkoE(D Q!u$9RKA A>yZ/CH_MM-^p:QPoaA2I-+2+K=vdb#1ɷ yeA{+#toAAeUyV%ђV,ƈ[jC$p#ϐ2D$_))Kd>e‹ȒV.-ȓ7(R^۵`hS2rz=Ӿ%lebSpNdgAqY%c2E[UCMr.i.u|[#/@~ko)*;ɲznփĩC?%{bg}G[&斕h8.4p׸ʂK_i_F-Uǚ+ xq^)84Xf+DG;!r $ P8Ǩ47\(2OgC.j=ʔ7>~ϭV~.?t)8Ln!fiu`)ᣒ/8QFٰ5ƬUEYt Sxƫ*Ү=`=#Aj%S6E"Bv'7eyr%تYg}ʸ}_}fZl{zM4K>N*Ol3a-K8{\ލ@asF-KĨ9ُXiK0P:ABFK;R^9gZ`ꝙi`]WK^Кpd[U2Rv"? 2k!CV ;ⷸPQ'1udL\<ĹY%Dr-VI xhącj' r?hFOJ3S)Xg/vi&8՟SIWoaeKًc-?!78FoW\Ӻۄhިm* ,֍w\7d`W:A) t2UN %֘ZH|މQ1zz+n8k9J"y'UX=c m0& {c6)Wmء"3zqoeG &;:X @t=[j^7Mw; b0λîNP? *xdF]9D%VNF̎ߚ_HHȴM(/ӷ\j!G6.A+chBGgU:DMQwv^OPWOhha'8Z{`0˜N0%Mv ճ;XUe]й àN(+lcv7[Q"fW, %Rބ?Ck,zE\&kOIґ3G2aHZ6X-o~GyūJl첌4 \$bW@d09u1]̆F  0.d\Ct{:N_]Z Wϝ1ܿ57>ugDqJ-~_t>h 7E|X]|Eb78r$ >T.Ts!퉹ZAQh֦~fQ괊 u^~NŐ1{pDM pbO]M z8WW8~^+џM1B|r;y>dӲr{H2Ow#/^ne,؆,^ᡦ ʣœNЭoc*˞dk$CV{]qAx*)̶:z]7d|rp<1k"L!"t9vT䔽(O%"9l kY2VSm+0kҘ暧A#9Es\.uiჃ}Pqa,,Ļ9kI"J d!(9%s}INIф)))Hi(0`4w._gzBJM1j((gY3hqU>y->LFEsvx՝NǙ tuտ,H.[444Rc(@L 8+F3)ft1M66g'$I[t(p >H _\;pBdGBhc-P;oznLڹnIw5{QqV7J'U0vEl/DGh ! .̒iU3IUd> Ѧb)")k8@2Yֆ"%+9q>Yѿ$h@V;:jJ`G;~f)G8< , :-;<*SDbXS;*λt" .6ŭX<&1vH Z0AH^KrLb~ i+jmE7/${iU][` z,bM-A'{J<$"9y!Qd]2GfEc[} 6D6LwO&8rRX7،tv&gu`[% K`;yӘn݈/^ФU{`L]- =nQ <:Ah9tȑ,~NYaPw],^ʹyT[W8?/Qu?a%[ RwKNL3 ujS7g Zl=\KYpIijPg_A i־s*H ϚQ j&Or )\ n'idd^mp+)jD+t[NA^0n ʹB6|h}͚C$[S 8,9HL&)rwv- VJi+@媭%+C:ɟ' িz_E%+wgN{.AϧʳСk~ #OӔI$񉤅'ؘIFՓP)&(^l2rUsn8S]154<>'װdgջ* Zu2Wo aO-?*BaVayJ!e^Wwh~ހ)4Ŵ}L%?J u}Mva-k# /&ۧjd/^}}B<|g*ϟp&/?|ޟj;4Y@&YS0׳*\㸲yIOCZx559L,C&VH iw{%r~ qp Yߒ wYLcّASmrۣepRBWfs[E4kT!A!zAS9LBA_ Z^f"W"v#^Zje!L4QݮʎR6P"i_)7QRa VӽwU*{w4%j}K2YC$!͖[` ,X7xe .zc:yOѠ>Mj__Mq=+XY(V΁|ր%f.GlAήCM7:Efb@hA@ ;x}\+"侷zZ ا`Fc<_'nW>;`8 )ӴѼVq1*z٨L;ugɩ*i9?~@gv =)AXL;}$O劺K"qmZu!,wt.Fc&/㝽fC-[}D ;?d7Y`FEm:֣ aL{@IT^C<奇 {}#w;YuWԗz*j׽j(-w,䧢,E-)JUթu@yFy[Ǹd“I.iv_$SHV"m㎈UFS,^bdmBYJ^nٕۖ-o(pD!2$zd+hVפ>pv]Qqz8zfTAנ>F"q!y@]7b.\lEO N;gϮ f!;^AϓǮJjgBV_OeSG6;FDjv\LL'S)Wz 7e/Q|ƞFk[=6vӉJ#DQ#xjе;Vn^WRGPөxB)E$+m=%Qrw ZѲF2@H$|- A*z܅|sJ}}Ckk;=q`Ju%2$6Qsŗܭ6Zb?-#̻f8M <1wPr rZ]A&\_Ke "a&HfҚL~t|g}Q[CżWfQW4<ֻǞw]]5 d#\ZXSFw7[ׂPT#]AsOg`T=XCP8 (V. YjQ^;ds"'kGBawSlG&#,Day{ό $t2U.G\Y`]]O3)׀4}BPHk|Qq5v8 Lg"ЦՑq&g90/;c쬼>yW DpCBNe)xC4Ҋkn'K늲 !؍+P#FejB* nOߚ%q<^S @zu7XPއ{+yx~*Zۻ45lhr!Ʊ|6' *u)(*UPܺx{ˮю#r/핢KgyXXNCʕ$ *5 NshV?7yNɩʸ7k~q5U[}0]z[NeR+]"~PMl1ۂֱreI +h"pݖEe%瓃5".@q `7 %M:1w>#*a$s R`6Z_Q#bUiMQns/VEllI`/4^% 9`e >H +<4a[X B?`w~O'biנo0 t#kP~ӂ'F(کNlEx2[QMr,lsz taS THއ Fp]l1v!;Qv U|Q,ϓMH(F>%fkG/H:V&LF-AרLbKv4&vQ֌=GZ1^&A󣳯8\( aPƽcݴaQ+`~E;#/f,"5[J=t@{$ }T-~0^= jhuvv9r)^[UD= D塓V;8H ly\- (3=aod񤹊qIemC|$-QߗvvV%5*[=r"?x}l0 m(nis3wcfQE-0̮ὀn:0+HB zOe^TT[<C%d06SJݢtzB$P H@WMi.V ), A{D^sn4.uR!=2J+i7جutDx|Xksul: y _2y^ċRS"gj/*8[dHzm~\(-kKmJZO!ί9쏁 3Q|+tRAsZ $%0~^{J f `uVmvo^-ګS/y#g$e AY+Ɩ o1߮U/S67Pe֛පddjdOH#hɽX80(.OX?IKȾhM'Tv =VWQ1Eg ^C\G\.1N%N2몊iPrE<~X:ՖTD?'~{A"m0}Yֳ/ V'.t]|CӅ=3N} W74<"O`8k??>,1p(> vJ3Ls2!dm^%<9{T?AC{ V󧀂.^TF4*Dio1mbz%Z ?k4xxZ>i)KnB4f(VI] %"Es}e`:(TBUL۶ 瀤6Cm{P*PkX]Vr~W {*0Z5GGj@F{ $Fi%ᆣ3TPeݤڤZW &FH;ENtA/3C\،GŻ$(ZhZZl&QG+,:lL*Sū; h)Vu?g|CwsI q9Ľx URVZDQݖȭY`R,0lMJK|OEIټ!U{Q#-G/ⱐ|1ūZ2d6J[̫X'z)P_||v:!,|g,ÙP b${aզY?55WxS 惦'SѣSvgbhcaN+PnKC/&)Og-(zP`=֓z::Wha;Y)q\l9&:T>gYw;oWM * &ɧսŮuEAQ8A+{%yt_X['m. +^%S`P6;= n4|6a Jh9ԇ_qz@ ~.Wv2 [tմ4[.]C== El^jA P5wi0 `h92.zhW Թo$fNmmyέމ1nMܕŎΣ:-E&糸ŧYwYQh; €>{PeD ;-*&F[8pn~P1VUgZ+D㿖#>EKLT#ŗl0(ࢵ3ۆR־i jY3y<#Wa)@aM;CMAi6 ȶ8[]Y|o+ፉx+^PN< ҩY[@&wD $v4J['eV^k@?l(w0W ><_}dzQ-e7sVc)qƬY3(OONJQ/p=YNR bG.}j֭SR]qݸjEN;:jA`_N(Pn'la=JaEWL+Qv;^ h_(\~zj`t(̤ u"ӰW~rjLyM9~3fG1yubRjȂ);U'tXZ֌6G@dr/@/| Hu ?YKHwYt]!zvt41#N7i7[F}!.}MU`jk6v9sC5w7͠ fh]:)U旅1`,~ySBuj/Ňl:w$E9%^(uDD>c \Vú60ٝPc`@IFC#8܀h+⢲N$VtfۺiA2V owlro$&Á(sjJo%c86 -E)F2(BKh8*Z<|T J^JS!`dhĚ.岗tgw+xχBr׽>pPo5 1{Z (r \\H71rFҦ;@5ԘTiIi[e "$svbw*}6t?Q-h{"8F1?;`q؛c%)3xbB Wӏ=ʩQT|DlqyTAnOL15GEWDi_zd' Ơ!#"{]>4UyWcM1BWX~=nQDlK[PHWO6Qq2 3ٳn9̘-r9:0&"Ƕ׀T"{ݮ}o>(#%eGis ] /N԰~mke[)Hϊºf,%?̠UĮ_~ʀPAs5s<`+ O?XRvQ7 hʒZ/‹ϑa.xګt"|(=b0{~w|WkP M8}l֒Ʃ"LrKݕairQ;i?o!n]Y{ ZœPdP\kҚ+?az&7lQzn\mjXD&bE(V/[dc}QgēZ.@ Sr$>uhl.P@O,OwiiA UW߃FKg|VKtSh U[Rn舺~Wԧ\cIJ"w;⢟̻v/-pXHԉƊT֙jQ$S=mLJɻdWd"LOWx{1+ke=3".zrb oeF'U]ң;v_Ȼ3t`U.?qm^g-Bk)(mء֩cqMnCK r+310I B|o\ؘb$:ۅ|k x7v1:\hTU9WWZ+zԅWZKLbXv.b %ͳS{.6-i;j4oz=t*l Βoe΋v!/`l"*spgK'`셞@J7W !t3~ߐ z9OLv崩ŝjw~pՈ$CKcd(ڹn OI${l؍2ysTKPRբΞ@f0 ݹςj$(]?hv1OUК֥v\M9A؛pZ1.4 _4"''˜S1S7Gh-'Pj0ɣ< A%ˢ7nY>Jye6br?Ri.#@xۻeOq2G^ c2\y>\ǧ\as1/:*Ĕ!gr@vp6FnCT[BDs Pw`l&T =Vo G"lHH(YAX"o!Ro!KT<{K*k2ٌ;Žyꋺ2ClT9tZ+C,vXIІvDֶ}xBT}eM=fZ[~ba2Xr1ϻ 3d: 5od,2JV;z\esѻs:^A[ɺ2o<ҡfk,qkU媺q%UZ a#vלikc_&w b;CBiaijcpD/JF\ bDB2F` ݺm]u[˥-vmv Mf0*1~䌜w-16}yؕraڀr[k}{z.H$uN߁DMz'1-4=1^@!S-'`2@hH?>!<, U`RtR 9VJۍ7ߓ)1-f@TJuX5-81~$MWɞ ma*|-{>!)>d9 ~ I{ymYOd(BhCY CC;i5J;O@~>W.|MP *[e ffhwv}SЮ亂m0: 7tl>k_C :\1t8vf-ɒജY??ŏ`a}7=X'(0PtQ1ٮ'Ϡeh-L FM*[R֪uh:hKƝ rOELff1n,Ɇ ǭ| 3ϖ%"ĕD@je`yoCGr#'MP?8|\rtXK?„jJNMKaU쳋O}8:O]/l趼)?ϓu9DCoq1%zHAbdu'tZJgBzlNoWϕx i"#o/<$bKߠ/>*eTKGVt;ad$<}Ǻ,h©IJtnU۷ ?&fRG7e"] fݒ u}ut2]80_u=/AH>=q͒4ئazp7+5 t?_*SwV6"{V,ضIe7{U + ENJA#Tirʑ`?>!<]Vj$4,G%qT8=%RL,bxyb略fTLq i"<|>g~dw|o~qEa9J'}D{`2.I/"HW{U&m 2{Ko*ۘe;a;k&d#s?>u` tݤ0+XJ+V|E0hsСi# ! ml6c=*}0}HP :vHD _.5H6P#?>6{7 cGqE<ϩ{lW8/O LbEVS߶sW<6p7Y0Q*x< diL:H/;}Î4\kfJ8h)B@P.g tN:gd|%awh7naϭea4 \zj* &d.Io/.Q7V6;):SdHF1,~ٗfтsHtѣJ}rvKw%galE`d,U؝ +Oȶ>lmtLG!C endstream endobj 113 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXX#2BFzBookMaker10DlFont100536871263 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 114 0 R >> endobj 111 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXX#2BFzBookMaker10DlFont100536871263 /FirstChar 33 /LastChar 255 /Widths [ 999 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 999 999 0 999 0 999 0 0 0 999 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 999 999 0 0 999 999 999 0 0 0 999 0 0 0 0 999 999 999 999 0 0 999 0 0 999 0 999 0 0 999 999 0 999 0 0 0 0 999 999 0 0 0 0 999 0 999 0 0 0 0 0 0 999 0 999 0 0 0 0 999 999 0 0 999 999 0 0 0 999 0 999 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 0 999 999 0 999 999 999 0 0 0 0 999 0 0 999 0 0 0 0 0 0 0 999 999 0 0 999 0 0 0 0 999 999 999 999 999 0 0 999 0 999 999 999 0 0 0 0 0 0 0 0 999 0 0 999 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 999 999 0 0 0 0 0 0 999 ] /Encoding 112 0 R /FontDescriptor 113 0 R >> endobj 117 0 obj << /Type /Encoding /Differences [ 40 /G28 50 /G32 72 /G48 76 /G4C 88 /G58 95 /G5F 97 /G61 125 /G7D 157 /G9D 161 /GA1 168 /GA8 169 /GA9 214 /GD6 215 /GD7 216 /GD8 217 /GD9 218 /GDA 219 /GDB 220 /GDC 221 /GDD 222 /GDE 223 /GDF 224 /GE0 225 /GE1 226 /GE2 227 /GE3 228 /GE4 229 /GE5 230 /GE6 231 /GE7 232 /GE8 233 /GE9 234 /GEA 235 /GEB 236 /GEC 237 /GED 238 /GEE 239 /GEF 240 /GF0 241 /GF1 242 /GF2 243 /GF3 ] >> endobj 120 0 obj 12780 endobj 119 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 12780 >> stream xm{ \Te<\[kԶknfXb~Ħb&$"N80̙9saqpQ IKM\Mz|uڞ{{p>_u] K87yY_9y**6mziYe+ʫHx|'>6}0iG9\ɏs??V"~s9l(7,29^qs7(Mi8n=q9[eq^"+q9n Uq\ 99n'5s$s%ylFL3霌9sOy"+gfVܩ9sg̝5='뉜9Y9Yrɚ=5'sdgdO~"'{FN̜9rɞ3?=gԜ㸇zl¢~O>şׯoJvi4GLsi4-͓MiPZkZ8-֖֞M{%-'-֑7-֙jZWھizrnX7|? NNr#2[qq?{6ܨLοq)= {s_]Í?qM&-&M3H-Hh.kJnZ>]܌fn!nSGf A' nҧÎMuo".*m_U o(E_ynA(*h.@u/[^ʂf?tTa$<XN+B,=TwvAhӁ2K,Iv?6YYsn୾UQ(vXP-aCK .AXU[͝  L@/+j @QբFA (^|+&%S_\%\UΤ# p_2?+yщs@FNE:?}[K|~y$jtCa36p龝4JP &pX^~,'^^RVVfF2A!gR ɇuz0itT|' eH }+ V趷sx@'q @J9XDk3S^C&YzGؼz͋lBcwGV'^X9!TP:'W@zʚa ֢]R% BB$ Ibr.㏨<+̛BGΤ^ϓ9}dVr'H󬏚jB<|Bxl2i%nw@UUN&áNq ;[|P \5ۡwYnnݳ_'Qv9? DX*!M10FEdeӬ ^]Z,(KS}Z<* inC ,uSDI;l@:b$vIO]pJLG7VB¦`N>h#m!$9c~8&O!9.tBU$]'&' $KkZoK{hw,4lڱA_ &c]c ])`nA\hB)Ҝ`]Cp2lMs>t  d%3M]~&SvLM6 迅K> ې<.D[rnqѮNk@d5iRP :OSj=Y_/%wȠ8%Yʣ+Ao[N-;rj*(vJe$V^. 8vOK{U߃r@&ա/)jt5$®~[ٚfodKO-4b<WVIi׃ML+IiD )d:H]ߴ_;R/"!6-8<(k0ظ 5-Ry[H "J BFV83 sDIr80.okpcj)bR(9uw\*dBJ k4 '2JyDne .~pvs#PBgQRL$xu95eI)/U׼ kp7;eݝ0}q?kRl1ZL刺2qQrDgE>@ "]p%' AwCaocpM~0mº2_vΐ_Yftw":^Gs.'KV8թ *96@?5htOk+!#H&Xi6 plBc㮀5%f\Tq])>1l,.W.?~A#0TƟWg>z4$ÂrKI) &1T,ؤml!2D5z|5XAT0avdۅq($bF*l$K/;xi~Z1hw*Z7#\!+0;/, |{맯yD8EG~;Y x 2t$:>L$r+o߂$vHp:I#얅`GІ,>4An[6H /|L 3 Pbr.[C̠'Ҍa} B?5@#@y:(I_ޔAv{/_󗳸MFd/&[9+u |pN*}OQ -@{WG1Js?*{t ³OGw@ɉi j1]7N;pPO8_B e]GV \ r";ث>{VDb¸*f0$.i_ܰI= D7Ǽ|tk813^ };"?L>&g̤V] 3:@3% MF% dNʹ8CD'П>(.7o&G{CAZam4?T,B3?v?&̢|K@7΅c=Mק{$`%x)?GP*8?taF뵪Qdad7q ;L& 狄}|3}B7/h~CJ+ôh@.6v 6|Y x(Zn_ǺDH])BD5ppLt),-t/CQGD OFe| )ʢ#<9kmڀejݥ,v=w[_=<&M=JX0ֻ]G҉։W#?bcbk/vVA06C`[\*d%x)Jp|pE$%1 [} S:'!*NIy֖Z&.v43\"Y:4*9K4+TIJuU}i=\ԺSHtB \z}0]3a-O$-|wkNBgՂŤh#*=Ђ^ àxֶeU'6-f-۷7d~^hĥ)TB (Rl,AwkR_?l*^ɕttfGƋbAJeDSnjjCcٌn<.M=ik%Ssg@Ÿ:}?|9f;6:6 v2 KU'ɊB( k!7m%*Xb*.\DUߕCw?|=~.-ևj[j,c|9n<ĩ` ٍdح .{v@mߌ>y/DK[aIzpo /yXK /?Am}{4jKR pY60Tq Fh(1X-F5Ęt\ CP(ve@U |IMHNfš8'?X|fД1RvJp_e+vdҵbLA|Wڽk'*iW, !W7CL~(`!$s[WX I'gպE"]`$Ja2e0U[7ofUgyxKG~<k[=̽tTxz&xb! R3~55u605udRϿk誶Nz\{["{ NT䰣m4 5`+2 0SOGJbȇӃ8Yi*J>^Ơ6?b0;)dkk:$<\ SC{X Vs*Vɜz}<@!iW4-WzRm1D*#D(l xHJ]ҷ" fކ^n] jAn5w,룰Rdau3uZQtK=[ e+P{ |!{>2ߤ*AK%}[#lITzC폮7A\Q5(+B/EOQNF>b'J*pq{xܖo{chͶ :r7mc54sdW?x<&:[zXugB :2]j^ aKDm !{_"^F3

cw)90pW\_ZY uK)8Oְ`X|2Xy9q7[aL DWXϲaHADWŹW|491xq',1$'L8Ɠ8v"9 Pp9nI3YN$N>sޠA-zq̊aYVx\VzưY ݋>ZzAcW!bXs!0 Ʌ@=e2#U =dt尷5"22jYv`}@ƱZr=s_  6"eSRdCUnFu|RVvJ5P!l2[mqzP O$Qv!,Γhi2ذVr"1G}|сqGRꊗ? O<,A#f]O|rIGXJzp2}xa$s2Gc JB"!HXGKD,T,+rX= Œ|&LyDOFvZg%5~;t{w9 }pk \g0'^; ^yiS^YLfI\%cJ&c73ڮ>Pi0%'=K#+gfpڜ J"6o0X'HtD'1V<]q uE)*%2[B&~oi HDMERe>&!3c*.S&zCtYBhb~.&| 5B8xShm$3 !:M&n KMmVe>P&}fVa^5燔Bρ?iZY`zrr pmo Y;byqzHe/i%#֊RA+Dz.Y#|)ZSNoe'ɭl(u**?p ,D!@ |dվUBCaDd/9/UQ ?>$Ҙrri6 |ڜ PRDYQ-k-I+m0 Q&5@֦|0L1 O=EUV,:ZX^1!Pa8OP=?BG,Ssl'ӻ]&@ E diS>0&G;\5_'t!I-rIXߊHӔݶWTEn&&b(7WY/XX2U*Evz9$Inߏ>I%w3Gr k@iQF c26Ϟ@"~&(J;7Sۊ[tLi h6&&P'H&[L٦b kK$.&gmTJUz%2);K|NwVu@W]W:`/ u4}z2EZ^9)4f:BguٮuR$Ԉ,b'lq(LX:OE;P'z쬹R_ 60MNYvVNRa2 vM ˵0˶6\ΘE+a&HCʀP$} bИj&Z6X)#<#7dlԦ7^o(ff dÚzEIn&ou8dTG[Bi!dz՞%_vihlIwqN:jZ5y[nvARLV}d?dtR\CFeN* JoR._TY=QX`c`u B<訍pQYd;I|Yq$Er755Vd; 1!SHpt b.:qĞL,9VXW]"$]ݩ1zU[ Kѡ4ZYvNE^i8UVMbi H;v6)4O^ݩ7okOE L&T TFV,8W -/emhvZfS*Z7jd }RG4MpE 1ږS-/\tZ X&7|6y8;zP*],rw@M OJEubЁWps C&6ekpՠ)Lh\~;'>uo[ {en$[xS '{Eg7ꇄrL .!DU%fŊ ח%ᱥġj9 1ߢٌ XnHŪ/g6RbCHng{SŘ+SɊS{x]TYѠ/c#A\BnowGBck`a  `!I~(5X^:)yp 7,Kb ~J^hEuUr&_z @L "+De֥YWDΑ^ӯґdT&:[S]cT+m*] .q(5dl yU[*51 Ƥ݇"(xb83t̐}N\ȧKY|489,h^՗TRyH y~wu:J=Ŧ|d4F4K;Hoiqq4RfjBBp'jI55w_a,"D2%h}/c8%e6H7X"}5y㙙,A҉p,h$68U d.[6F3 RB:*]D(+Ag?^ ;D69TX&^)<H?֑łqloVNe&a-g e<#joihGkRݍV@ #BOGMNgS'׀Lه'T~u>?w`}>UbL~P pkEB:3^=câܟxYj 4alh{$F45-HSe Yq7;:!$S?Ű扌A%y kj*bAqgSOg K#k=+0Px:/a1ŜQcHRutr)V9__(+a›U>o2Ӡ|d2Ιxz9E [W*yPlI|{o;(,{SهZbأw[b.2N@4v0u-bk!9췱ӆS;It쉷S;$ endstream endobj 118 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXY#2BFzBookMaker18DlFont180536871264 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 119 0 R >> endobj 116 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXY#2BFzBookMaker18DlFont180536871264 /FirstChar 40 /LastChar 243 /Widths [ 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 999 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 999 0 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 999 ] /Encoding 117 0 R /FontDescriptor 118 0 R >> endobj 122 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 45 /G2D ] >> endobj 125 0 obj 1112 endobj 124 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 1112 >> stream xmSoLe85-:c12,plXJ X{b^K{}ۻ^Ph7Vd_yK/fxGb~@(G@hmo}ضeSzM7[[/pA$$]eX_&/O+V:)Tx3=|#W:Ph(@2P@5#@5Pof_{UD L0!D"J1/uƳ Bhʶ2QC\%wwknRIdav&= ˱++`.b&4n 3PrhTedp =H;i7$YRXtc:QN[+7tRk}fZc8+oY}g:ηv|ɿ'!s2FX60c!Ebp[~W, ?֮a!?EobTkLz+W.>`i >Y(ɂEb1Z2Òi郥xfИӣ8अ>Yin rsӛ˝`ʞ ,>q'S0M aʷÙئ/Z`9m]]0lq`-iWtR|zW`j8?d8W>o<9=Q+NX̏|]zH-#<<6RH0.|X;HiL#j"++x9-I+r1^cEq1]cې5~1/E$^&> endobj 121 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXZ#2BFzBookMaker4DlFont40536871265 /FirstChar 33 /LastChar 45 /Widths [ 499 499 499 499 499 499 499 499 499 499 0 0 499 ] /Encoding 122 0 R /FontDescriptor 123 0 R >> endobj 127 0 obj << /Type /Encoding /Differences [ 41 /G29 42 /G2A 43 /G2B 45 /G2D 46 /G2E 51 /G33 54 /G36 57 /G39 62 /G3E 71 /G47 72 /G48 83 /G53 84 /G54 85 /G55 86 /G56 90 /G5A 91 /G5B 97 /G61 101 /G65 102 /G66 113 /G71 116 /G74 120 /G78 136 /G88 148 /G94 158 /G9E 169 /GA9 179 /GB3 185 /GB9 186 /GBA 199 /GC7 207 /GCF 208 /GD0 215 /GD7 217 /GD9 219 /GDB 220 /GDC 222 /GDE 223 /GDF 226 /GE2 233 /GE9 235 /GEB 243 /GF3 246 /GF6 ] >> endobj 130 0 obj 13318 endobj 129 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 13318 >> stream xm{{`SUrY*#|7 `0Q,RZ(!%mZҦ 'Ӽ&M--P,VQz}J?.49=^'Mvv /V_;oܧ_RQQM[L4]œ&M:eZ&O6̾ }=z~GGF#ߏ|LyewO;f_~@a! # <.ca <- $AxN0Kg)L#iuiJ#͙JsyԴ4o/͟H i iƴhZ,)-H;L;֜֒v$5-hZ*XZ{ii'^O& .^t5°fA E焟\~Z.f6r\V Z+~P) Ex&@HXF-`*|PEv{w_dD~#닅r;}c~ 觬O=fJԟ>ч p9Ϯm@XtJ_\*) $bO!%/˜%,fJ/gad}N)Z(UEZ$@[–E/.cR1y ^:BG JFĽUR7Ŝ%"Z'Ƀa!j;B?Ů5VA1+U;KdaZ+Y.vD&=mYF#27ϓFQkoL(eȘc;8טJS@L!"{8G2/99% U, M孭&CUS4Ȯ*[b? jH_j]/c=>L,ZKUþJ `.nup&<@x_0wY;n2 aee@ܤT@M{ #Qz)`LOe*jo"j9JVX`U]NūoLPIl4A[j"2v_VJ.a<=KA(ҩ40?:yxwG׶XU\@Q5P7Kƥ Ա%2/ -&@%͢:V$Lp*+OqrP?X_Q؈҄gQ&;t:-u]&߯8W@m1z$/>|C <܏ٶQINU\tE|m%2Q0|.x6Lj lr6z UKJzGlJB1 ;+[&c-9&\dy6nR^9iq[PC|uTO/l s" tGz_.}ԑh ~=Cc Yh׿7܃״/i`"%ٯd,.{зydXcX_ %[*`@rZ=<&|-./&74Ơ5K ;J-ܭ#-)B_8R9϶THUa^Oo&͈?/ZPz 9q3C"l-ۜ" 6alTFx$_>wo MGfمv7x\NήҽM ]cڭK!Cߪ9ґ&!bo{ )(.-Tջ,ӱdZA!7a '~~閊t&vsr\. SSyW=>R/_C`c#j'[swOc݉t7vɳED3t`j=P5;Tm"!.'p@,[lU,I+ˎs2 {CY.b*ԍק\w?Ex Is)Ga0]_"=x7G0;],Uܵ:p􋖿+\ jv3`ou ~S+}ے+LHdTC $ t9\DSjE;cy2,\M-P͍rݞ߲) `E q s,M`![^¤L1֬t`*JjW^Xyw%BIWPCo}o5N)қOrsE6A cz%5o!1.ƕ(w?I1 U~5mK7R,!բKƜKY/$-?%2kv݃V]SuGd{9=2u υ_7h&uTaAPjXg1Lj W`ֹ X~HdaKgU{};zt;*a?i$Rբ.s+ýDحri`Z/β9 sH'П\+W>Zr#Y(޿9W >{LB7CA$) 6%0v'¦[{* 9`^_M6xy߁Dn5? Tc} [$9dm0F&gehIqy4#4'nr$۾?H,7'a[ɹVD'2n,^lR1C{"E`sB7kC^@=9 l`Ά! D<('e,FBb_4{w-Ldމ@Mh:}&unC\Zxck9I5a5oM5  !c}Tnf y;B \wiEFMB`t4s.=$'٨thC@g_-`<ق&<5Y6Z ,gO[^#zib^(<˻~s$$6>o׿C/qo_K(lI3?'^⃎ao+S$@:47sr6)s3@dSoY˸FDFK;ӑ;V^v>:M .w6 O 8Z{ c0гH.ޒn$Gp&7N{f'x[m?]}\`V"KiD7:%k¿^\Xu26iP͢NH9q/6b@Q1k.,k&"E|k)X3o,L6>SS1{AwmClSl1?tM,SkVP^ΑZpk;%\=ŗf:J7+h;Z,Bܽ! Sqȵnˣh^D5=_sm0CAE"r$6ё qLt; d>3FO;V-mDm,ȋNg)q~=fSTUa~'ټ$fkM,leC]S# ]^ sހ7$;jmTۤȗ>˫&e{FGA獍ɜ]Jc||+Ա[E(b)ROC޵ىޖ9TWkKKvC5Z.uh~SZ"=(YՈrs^"3,&hn7k8 dSQCe*Q>(Q6q䉅F`TJ>LKuSie҆M}+MX7 :b1II0Fsi3oW֐y`YzlM'쿎]gvZђYk<9m]7M%G /qs h6go]s!}Cx#^#p§wî-0*sdžUE`0pCkqow/qΗn]Ep8۷ {]UEC{-зzRWOI)wR-Foiuz?3W\Dnd t%$.$J>v֒9ZlcHQF^|UX3{lڵ"b%X5!up.EΥΆEJߩ7nZ#Mh|ZUoUw@u@_wt:::d򯬅Z2C:~2p Ӹ9r37i&9~(T!D)%2=%dΛ0P<c|6BXi??D,) [Q]{Ң_ys)x<5nR HI>[X3ձh|f1Tn i%)GnVcIٯۿ3̽*jJL%xu*OQVSliq\ ״VK'3klIB"E ͐۹/]:KؾPV`1(UX!`)&k`LlMOn-/0\hD=dmSӨJ56^9Eԛ$Dԋ`JJ+7]Fm B&Æk?mH$䴙KrojY9xi ^v(E)O%_,@19S~5͆րd>C'PN)]%6AxJsqAn3L7![+ڬ|L\>"O TrY)gU~S@%:NґvL?Y]fR0=v`,l _ykW%Kf+Kǁݑ3y[?~yW?(Yl1=o Ka-bU)@dAβo0it'xs,fYBMZrl6i K,h]N*0m^U6qc4|ԥc={K*KG 24onOKv4T7`*aؤ*\P)wYW"Ȩ+J7 v 7_kÎ5 ,O%oGpDw?حV &`,Ha^&yvm)S&,k!j60GO }#R̶W5Li {Z2cEj71%5a,$TJY"CF$$+qGڄ‡V"r .w$}TR5lq|/mtwxo-(g =7脪Ha[vf|L/gب1ഈ!h͏-uSX^ M-> ]Y7P- ¼=YYnK~?v0'UNӏǡ}xdHQ6ˁ2,jI!~ȹwB/V%qlk:-7)dmS^n,WfJSO>14 H?K~9 𡅨 P,ݏɶ~KOf7Jsŷ"cf}#=o xbwE뱚.^/0C8R@Wi6Rև0{1K?pHSLJ# I6EyŪ k-?HElR6l&qQs˞B@#1mH(7r[:΍-MonKt;^luGpE U1|ákzN"R}MSj j*t<\q1Wo&@$TJ8MA N]Dw6mM E Y@jᓑPÁ@wJO} _b[fcyVbȟ. pq̨)SSFATLR {fſ+pxݹg{\-FrV[]*|{z<@FQH31_՚Ĕ!^#\qh*픶mTk"ˣ cXv^ 7-,o[{[϶BuOK*5XRQ,ɝ"\xP:(P\s])OB\btBlIN9<;vsAaSNC"z_1<GdF呲F&}MV/ûr{Ȳ恑b# .-iԭ;}%"tY:>K%j1(F2hfO7|-Ő)T.ִ[3K쓹䭱c~`Jyq,ZZ w:裹 ~'Sx"8>2u# N!ds{b-c;zcֿ<}Yo6zq'Tnym㜵 {=~M3_7|"Π2Yڈ0VCx<([cď>>j}>+\腁ռ]Д N#ҒƄG+CEt]2 .2V[Ģ)gn#k !FVDL-%B^_c޿v#2y&Nz #jS1AјIH6UOPR}3YeMD<>I9G /z_A$u<|]#avr_| 3I-DOOCnD} ɛf||ge>Ա>mrrx'' 3װeUlD;^o6Ok@ ڝ8x "y 0_٭+Ùh kL nRiعds,Hdoi~)zhq(G;7`V7AHBXw97(v{7Ʌ,6=el@6l3UeqLٳ@E4ˏ)gt} Ls>[mfMǼOj_wmѳ~j5>έ$zwDO-q$?p{ȏ?G pN1QU"Nni`A1 v1^6֌͜ S}#݋YZ~[FD`Kg{g #?!UrCW ,V e\A+zjngPyN QHKmr;@dyAi6;XN.O|s>vN ,R;?'_ц7 C-݃2b qRuHnF-DmЎXH%1kc)A?+nDjB:F‚F\ww}5XPr|w@d/\Z7z Rg۾jA 8f }z4F9` *|AU htNU>4~=!)ձ|\Ysh%e`γ-8QƧѥvކ(#8//1OS,4[j K+᪬a-GR˼"?WX~?nTo ހ̶h>GrߪoGu\\mM#;.)' fO(<#i|cw ,F+xGLQk|UWҽ>N?oQdK4W)3H WkYn>Ǿ##}.>"|u˕هCX̟)B \B BK[¶ ߮ ;|}b%~{ܽ7/~OT61n_[&wƶZqvM'ܐԈuvˑÈK;tKȐ+"JtŁǥ"*~-L>=Eƌ^9y >zBrG Vp[/9,qD3eVR7D&aͮ6 oloAKH5qD雁:6?-;O[!iOwcO8>E_ԫm>'^z98,NA@H endstream endobj 128 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXA#2BFzBookMaker11DlFont110536871266 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 129 0 R >> endobj 126 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXA#2BFzBookMaker11DlFont110536871266 /FirstChar 41 /LastChar 246 /Widths [ 999 999 999 0 999 999 0 0 0 0 999 0 0 999 0 0 999 0 0 0 0 999 0 0 0 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 999 999 999 999 0 0 0 999 999 0 0 0 0 0 999 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 999 0 0 999 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 999 999 0 0 0 0 0 0 999 0 999 0 999 999 0 999 999 0 0 999 0 0 0 0 0 0 999 0 999 0 0 0 0 0 0 0 999 0 0 999 ] /Encoding 127 0 R /FontDescriptor 128 0 R >> endobj 132 0 obj << /Type /Encoding /Differences [ 47 /G2F 68 /G44 77 /G4D 78 /G4E 79 /G4F 87 /G57 89 /G59 93 /G5D 97 /G61 103 /G67 105 /G69 106 /G6A 107 /G6B 108 /G6C 110 /G6E 111 /G6F 121 /G79 132 /G84 138 /G8A 143 /G8F 149 /G95 161 /GA1 172 /GAC 178 /GB2 179 /GB3 190 /GBE 195 /GC3 227 /GE3 ] >> endobj 135 0 obj 8557 endobj 134 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 8557 >> stream xmz}\TUP{?mnneiZYRhY>ʚO ((̃yrg 3OHZKiemoV}8}Π?~;w=|>u&n&NyzR>`܂M_ 8) /MKwn_:sq%wot~?>q2^'x ?[ 9M\##Î{XyDyTy\yRh4j4k4TfF3Shi4 45%8+fFJIhh44L&Kh{qnTI t u 3t uuӦM6W7mnZnĩ9 99ts_}I77I7%]K 4%mmfvܼ@ב3o'퉳q8W\}Ĺ!=elF`aǒX 3t>Y&+{ɖ-dHm[H {m1ܩdYv8mvN,k j֚ͤijMgO/x#!8>3tT2D+"6-6E@N罝KVtY$6"X.2])55`,-ΐ ]zCJ VaUQ`|H6W=\8vDJ+@@GYp[^05"}D+ ?̯F4a+|Kbw.鉇2UهzZT aKa]/cJ.8ZCy! -cBcAcBRdv5`Xw' rpJ-7ɓ f#Q*z<{$4{4B'urxe) .6w.բr[uX*2ߊ\aZ꾴^zv-C ]P,P d(5V̶TR`1 ƴYP^VkpBp^G TU{a1z{^F 8@q?n 'Z vv`!\кHB&z=8 *ݺ  S؎# tiXEggLمӹ?FwʊÛrЃ[~Rpo!2$k9,PꎿFF?3[gX\B k`ְD6!:llC܃oL^PDŽ}>; 2VEuXu#-]堪mv-[R2nf) e! {i=/epӿ _ iGL@o { Tw"lN[fZN>8 4Ym: Te/WAጳ SKb?n٠˵_ l rLwg`i4iußDCvz]t97U\]uS;R.׸,p^,Ga6LÒ59݅iY{s|^e8ukӒgd=_ ._DTx$iؓ,r->j{9E`CUaCSޔ(ohQFSE;;\q6^5$1=~ r5;-g ldD< C &8+oYAw3NlNY*8uZ]`T"![_f P;;}2` ~6dUyK;|yeJXuյ_BS22>[Q!#0JU7) 2h"%\v%W@dFQFCǣJSP2/ Ys8_bC"Pb5߷2yFװUM`х>&W8ϿLVTN# ]d_ȓq@Sek6(2tՀO!i:NK嶜)ߥGDۅd$\5cU b:{$%à[\k!oCoꬍӴy\ ۏv!1ߍt$YV<.zG,o٘vV8=V2呭a45UPSY[Jnw|uK1osyX) ;dݍĊψ -[HWo$c&:p`.꣏V"\`wѻfi б_rro\e_L; BLFғ AQrb`a;#7=8%^C絬TdSx#,,+:I{'[ 4{hJ 3~(} z6vjKBvNG9'0ޱ0 hT (5ҀCdv~ <9^)H}{NOʍ?I/K0%|Ե7{]# B;[LVD @w{C-wTп!xh5VQ_g)"t)> +YlK]teU[9}4HV:&cs\ cysk]yn/fINv/(iTzVbXkC9'y:wNH~me*uk[Ňbm~soӟ]caNŜBg<2AsI{&R02϶'O zSF$Rlp]op"ͽ+cP͝<+/ҟ`XAF8 tg9#Cv_끋'N]^E%|\o][UgCey4[rɰh|Qi{TOhl>{MTPp2=n$#_?߄h{ߍw{EllgtbӖ [W\SJP7ÅaQH\Cؚ9Ǐ}7躿}OJaw6O~z s&w C裷-U$/(NA=XS[xP+ ^&lHWtt}lG\g]g}^Ajii}o;s'1#̗C~(y=E }[E y:Pu Ƽ9 `c9: Y&zc%ףV0q19B\gA~tZK5^ݰ2k3x_/&_x@UF,-VT*7JKª&cn|`0TBV( yDCDcڬ346P»[OvEu@1G'he TA5TKog&GL`7:@θEwB3s>#÷l##%k.m!-ȾWD/ΚX(H;ϣ 9XT%!b{ݖ(M g@(U [ xWD5K:Z=J X}ކ G皳)?d6!'ButZ31^ĚwKcf{hkuSsZZ/Zư08R P]VDZM4{L&Eq|֊#{|3k#%г{{W5ܬj&,PGO2~=ob`pi9}]v'$KhB-ˎM*[ikc +n=gB!}()Q WAuoDwNT6)`>NX Me'lYHF,b>ǧk9\[*0ОE;g; !I3dztch'>mu7=t`dlAm ԽR PWw{B`ilcMIP Պ ߍfc*^֋ (ˮޅQDԮ0"h9"\.3`/?^#"cUcޘSED舵'벓yn +}{dLBkC}MBW:,; j`]ɛ VALH6.o1wM%^cdC*Eci@B{cd}:;/^QP#גvbw'q<1jSѻ8t] +_8v6?7鏯@R54Vnb͡{7_y0<#O)'Q񓯾=Z1kS)荫eT7 r,6N#P7oEwp48 +;ퟍgTtCn9F{V^e<;Z [ m/.p8!?ׇv%ZZ0Φk_wږl4BeIm G+ 4N(I۶*&yb]L%C%ЙV0Bk֓snItHQ&#ݏOWmqF@v[> endobj 131 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXB#2BFzBookMaker12DlFont120536871267 /FirstChar 47 /LastChar 227 /Widths [ 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 999 999 999 0 0 0 0 0 0 0 999 0 999 0 0 0 999 0 0 0 999 0 0 0 0 0 999 0 999 999 999 999 0 999 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 999 0 0 0 0 999 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 ] /Encoding 132 0 R /FontDescriptor 133 0 R >> endobj 137 0 obj << /Type /Encoding /Differences [ 63 /G3F 69 /G45 80 /G50 92 /G5C 93 /G5D 100 /G64 184 /GB8 201 /GC9 220 /GDC 234 /GEA 237 /GED 238 /GEE ] >> endobj 140 0 obj 3656 endobj 139 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 3656 >> stream xmWkTWS;ɝ1Čh|1!l!>F mCUuwQ۶E11Y.GGaFLɝɝIYkr`uO|{$ML$?ߔƊ+f]# 䟪 Nps{]8WdOuQdcGjP 8,K)Anw=b }W,ݱt2pP*? QDk!?Nf͆nƯr{R{!sS%lJH"}T|>*ʡpx[RC,x4Co'# owYMMlUVuo8(PEt3.FV> ϰ_i#!eˣVUBx7<55n1 ֊ c(|bBdW+Q.>ľ$4A\#aGR}&<}鷘3{L3J_8ϼHd3U1{13u/E6n7nNv۲x>v(_>;roPHF@ :AZP y)׋,O@!@ݘi O_ϰf.ݾd[l.ؽحG3mf ǡvr_ :k xMo+Vtd57 H%<{$jіNU8Z b; :Exxl+I$HQzF2KoWj VU+ZV Ǿ[ $  g}S1v;vq,=C|0]veZYА XqǺ>P~/cŀz]s;'rm'CzYSbnl@v&7jUQ0 /? Oi~}i( p oZ2,gjjzmlV4 *v*uJhц2tg2H%e(~D/Տ7Y﯂-xEd[3uen@o׫ ڀK$b0J\=]F`¦09&Z_^ҡC 8M\}8E>:Z@nS3~.tֲFbX?ڥ՗y+U&.aiO9R7Lӡ7lH<ǛC׌@(:: riGޘrwZ xę=϶) .It=z3 O򃪲&`"Vr=M2t)R(ΙlL?c h!t͋R;6snŴG V913kD)71ȾGKPWN[XVZnar ^G)Ens)\MEyխ}s ƄV_y Ҽ`HLPiX41/QӥuC_eдLEQA]f=z}S'bmzS52D.& "ndw/S7lq:v Z ͆C#] `/j"M܀w<~p+WͲ=<;;4n#ޓz5ɑn(WO}[n?P~CZejzhvG"=51*U`P%nUaJOWM{0dž/#ŷ@%,m;hLn^D7ӮP bIGuqteAzπbUЮ͈?ŭSs&9]*O"P'*3vm:u4 m49->;/0xk;&܋1k`x tBOܑ+q^6oi*{+b[dV}#^pz-t,2wHs0W(iN?Ʀ/1fҘUVs/:Э כ> endobj 136 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXC#2BFzBookMaker14DlFont140536871268 /FirstChar 63 /LastChar 238 /Widths [ 999 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 999 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 999 999 ] /Encoding 137 0 R /FontDescriptor 138 0 R >> endobj 142 0 obj << /Type /Encoding /Differences [ 72 /G48 73 /G49 76 /G4C 77 /G4D ] >> endobj 145 0 obj 1584 endobj 144 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 1584 >> stream xmalS_H޻)-mW P24B-H$EHiH"cǘ$yqs$5 72BKD‚:UK֭PZZ:kߦ޹zs˒rlIʒ,޼x#q:\WltZ6Ƃ_Z%RziV };7;Eb-˓H{9$O2SO(H$-$I,)PPd łSjYu" :$?B @Αr.HJ>6jAbU/i9…}0M]sh֞hR$z!6sBSgN0"ٽ#cVN# ^ Iv>u\rrz6]J&گnG_OJ0bf˄unŸle[ca19:L'\/L_Mk*x DY) /R" {?A^Fa [B7Aw›O>!iCh[pz=5aDFCL)l9L;ClWpc-[QZ/ɂVn:3do F>,]cVI@s>.ؤ#VB!/&ZYHh}lA/SZLсp +Cf:5*nlv BoاyDkL^QUtxiqVJ34W9AsQg F'=js&q8RCXdz BqB0NI_Ft<&.!SFRO %I5){=Av8@fB qf?M D?^ޗ3敮(ĻNއ,1z1<*GEAc Yo{D*QOڰm-h|{)0F.G\ ĐQ`J #РYEv^hF6!ب6f-p^ e`LLU` 7|[{F-՘ 2#@)Յ<`T?{ݲƁQLe*Gnv[`~e8ľa-rz/׍U_vU^T ڊLEXAOnh%2;ҔoOg~ 'MJP5xM3gE!=L"4)Rc)^[#bK0; M^Ka> endobj 141 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXD#2BFzBookMaker2DlFont20536871269 /FirstChar 72 /LastChar 77 /Widths [ 999 999 0 0 999 999 ] /Encoding 142 0 R /FontDescriptor 143 0 R >> endobj 147 0 obj << /Type /Encoding /Differences [ 61 /G3D 62 /G3E ] >> endobj 150 0 obj 813 endobj 149 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 813 >> stream xmRohSWima`06킫º,*-N VW[_l41g\l& %I)}PDٗ}*_o}sp~8f'FRoښ?^׿jm8P{_ԯYV׾m tU?rVSW[笝O>.I\!Vw{'Dz8TRxZ<[% ِ"$Y\H)W'~gJ>Knc3Nڽ\p3o5VEbᗾ@FS46G+R?MA?s"Οfd^@cc2Ow:ce$9ܡs9MMf-04]GIoJR<<T  ND8fp0 8$^RuǩAoQUɾnALhmw3,IXiS ZPCqGYFq/c_x0} ![v{ $ܮ~hxJcA̱y|r%Wh>"XQ8;k%A3jt- jH }Gi: endstream endobj 148 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXE#2BFzBookMaker19DlFont190536871270 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 149 0 R >> endobj 146 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXE#2BFzBookMaker19DlFont190536871270 /FirstChar 61 /LastChar 62 /Widths [ 999 999 ] /Encoding 147 0 R /FontDescriptor 148 0 R >> endobj 100 0 obj << /ProcSet [ /PDF /Text ] /Font << /F5 3 0 R /F9 8 0 R /F13 13 0 R /F128 101 0 R /F311 106 0 R /F312 111 0 R /F313 116 0 R /F314 121 0 R /F315 126 0 R /F316 131 0 R /F317 136 0 R /F318 141 0 R /F319 146 0 R >> /ExtGState << /GS1 93 0 R >> >> endobj 152 0 obj 10676 endobj 151 0 obj << /Length 10676 /Filter [ /FlateDecode ] >> stream x}oG]_h-ꚵ沦E6ֈzh{v۴ZSb5rQCTl%!n,h(,xz ά>wzVO}}5<|mƣHbyJܩ73ן-855G?tUH]g׿2,(ȃT?6G~JXe2̋G׿_o;%qhOڶ;hYJ#`]g4h>x[gճn/A9X-~Tsx{hQ(e2Q}aTVM"~+upgi$Ag~d?)ZĭTb;&1U ~N%za642n%muxpd XtZ%'N9_XGzqRw{æ~N,G+)ar4Eδb+zvJ,T݈yM7@4q^Ϻ@6w0tV/N WiN6?|A,$}3efU["&_ݙN';m {*qf$|VᖂQ4q#5ċ;qCA-e=h@YXm&5OfpoaF;Ak3;rVEFs=Yɺ1Y=&1ۅZ|0řKPڝB.6jM ;LS3wTmHtmm=>33QfTFv}֔nږQjfAȳg~:"fg4$LS~L?=qգ g VOrnűfY>6+)i=?q~Z%u̘])S=Pl֕S#f0`~>̒<< fd4.̷AI٥YLhm0әmYa6RMgDnY,edM'kHжvim/!ߚ\ c[m:^ۤu^r&jk.] : FTucj٪$سPd?S*R6m[ Pg^2clrvr+117]ڑCc-JWOS=nIZs(zt2eƵWL> PΉ4\:wΖIo;.+#C-g[.bn@ۛѼMlmhânzC(*2Rfi9d(fnN`Rv4XI4]*rif0ٹ7GT?M&FBt1ojPiTR@݈9C-\-(a >Hm.@(2L³lbAz:w/DWS%y:HIdẕ4_trZՎ!f4%R9)4rC\\kʈ| ϣE̻MF6l_Cܕvj\KoݷcZn讕e+܋ɛ[%vbforH8)W= ij`f># O5o(іSq2s?Ah&erc3e%/6JFOՋ@HV<$R&YCfA1:_BPi:η9EG @R)g?jGfͺ`|^߁1fN 9W@^J)aTQ3IY33֙|zǘ^j"-1 LCWj/s_P,0֖^?~?\tyT@`^'_LpƏu'j[)ͦ$br1iS@t{jpG1"PSۦAFtXwAEh PӭZ>HcbdRX(ͮr2zj@T4L2yԫ땟v{(*rfEv( <3@92s)*xJu~sc 7H$|@RGm??ܙ0otƯ2^4reҌznN5js#&vwl ɝTY5Qz&tWGiʣ)h'3LXD}}EI )J0tѢMEJb.,bZ^w묗Y>6bf϶`#@"G^*;m$uj̮Bԩ1 A=oQ(裬S/$G!稞fA}\-$j"23IE֐Cid|}wu:w[.{w_qݽ^2ѽUԘῢ֚۽EP}/|2lr7x][OB^@OB^yk1 c6[.8W3uPq#H #K5_MiNF;I q_](̎P&9v㡲6*3P؀X]S 7'5U1Z̖ v}-o7$,IrGE ֘\9ԁZPnY3ܡf앫"\C$<(H כZ+ ?=:o2bAWǺiˢёcb2k6@D*}My^ gD%Z?2e t|j.;8~4sa\ݞ3#bQv]Li14ns6X)>uNp7Hn#sĹp !A_Bk6kK?90b*l>ӡ9U{}9؟fQ3lO !&xm'mI6U/AÇU.;`9"c!1mz1}ezJA j:.4b])UOYG_,RԞd?•[sr7Jy13ӠRhU5?V$|dQ__Scb-.K!͖9Ύa^ja~|m]bED%M|]r|f8(`X#Aڴ=a¹ٰEлXHvԴi{jKKN2brBw9/}<?!7-uQćގ,[0w)673p#xQ SpbREI~jj}9ĀŸfRARZ~s(՜:^:DJW"υ8֛R#!lj;C%eSK4d!!5$ ![o /xi/9m!@R.J OVÑ!zDU*NsPB[|d6`֤\ni'IfW&o$C:@V?­uGzK);/. GHD;iOB>!f}xowQ RI=h˛n:bmvX~իQ d?{BH;I˩쟷'ǁ&92i|b&Ggb;.KVˏN"r@R24"\z$_Kאr͡|Y.kI,y/˜Tb)fcV]i!ps(m7CľR7Q,MԘw2S^ NEd.trK^L fag YC:Env?J*XR%N'ä ( gKd񈠬 -+M:*m P QET|OR Wt Tp_vHС^;TΪA{z(\XU4Jݘ,Q:RcĄ't#s{N/ְCTObvstKaBsĺz:VIde9i%9.NZWjDZoŸT'KQ}jgT4-<̇JӲ\pTc܏oմAh%e0OiFˈ^m St^6C, weZ0M?H|DZA WFP1m2@P|UGUJ.N 5@Я3sWz ]- w4 K6Nj>rN>r`e!(pL #v.^E9HTH'#oT;w*mYmI1N/A);!hCvU[:'}zes~Z^Ѧy ns1J+jfn{zOEX b[ʪ/Y7!IZ8_%l_o!-a'>J',cŨ;%4½!nscVGN1(=϶l+qt~㨓ס~q&?{иFX Κ|jK̡V1zCV= J5%DZR?L^۩掠4;^a7Dn,eBAάL9% |e:Yד 2h*{1Fm9 BL*;1B raU*?SP ]s#L^6sR9sbr1'~ g:@U7)4Y[&PGT P^.nPUv?>X \ Adփm6rjU@xEpUV)/¹ E7)#(b䌁|Ab0j1>C Iӣh@oTD҉h_Ԗ17RsWx2}gDҴJAӢƴ)۠d.l ,0FpD}:Zrr0R%9ABRt`1!&!ɽ`uͩ((9-;KԾe`/L XEA`0R$!(EZJR$!(`!Qc1raCTVz>AqUDeĎTT{~|vHtqH|<>CH s0gq.Og?RxU{W"J=W^RWR@7>sIC!z# A&'ʅg;[YI>_ :߂_DP*FPje!hH+?Hsbt<'R߻RZ3 z:?a\Լ, (ULɩ(6&{N}+ (|GP/}I~zz F lB"]PN..{BAl d(Hz"(t5"9,lSIF ~҅=Yzv\d.2Vv:^* \n_j(VG!{ } *:`mӏUC16޺l'19qLh`gSȷi}3$b +fr}O::{[ '|;Cϡ==I6LLPOxӰ&1xǩ_X/TOAs|dӤ'z|gvvO}~ F=u?>%$sn kG@ЙQɄЧ} esg#tۑE3?9!D@!QjӦZ\sYcR7O\MUTz5(>jga_2>FrvK U6g̡ U0C@<J( 0%ͦƼZ%˦N%ɦFYPc֤:8SPOٙv929S}$0hje1`j8~/bWi3Q.N-\T}]L>=sl?p)qt)넋#(t;Gܩ[b SY endstream endobj 99 0 obj << /Type /Page /MediaBox [ 0 0 501.333 763.151 ] /Parent 98 0 R /Resources 100 0 R /Contents [ 151 0 R ] /Rotate 360 /Dur 0 >> endobj 156 0 obj << /Type /Encoding /Differences [ 33 /G21 35 /G23 40 /G28 42 /G2A 48 /G30 56 /G38 58 /G3A 59 /G3B 64 /G40 66 /G42 72 /G48 74 /G4A 75 /G4B 76 /G4C 83 /G53 91 /G5B 92 /G5C 98 /G62 101 /G65 102 /G66 106 /G6A 109 /G6D 111 /G6F 116 /G74 121 /G79 128 /G80 139 /G8B 140 /G8C 149 /G95 150 /G96 151 /G97 152 /G98 153 /G99 159 /G9F 160 /GA0 161 /GA1 164 /GA4 165 /GA5 166 /GA6 171 /GAB 172 /GAC 173 /GAD 179 /GB3 184 /GB8 188 /GBC 195 /GC3 198 /GC6 199 /GC7 201 /GC9 202 /GCA 203 /GCB 206 /GCE 208 /GD0 209 /GD1 210 /GD2 214 /GD6 215 /GD7 218 /GDA 220 /GDC 225 /GE1 226 /GE2 234 /GEA ] >> endobj 159 0 obj 15605 endobj 158 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 15605 >> stream xm |T?~cZbZ"KAPQ EbhX!0$„,L2Knl7g2 C  (HЖֶڷw?Z3>{sC7\8.Ƭ^nW}ee[vL\XJqQĉSMq'ǹi'| Ƀ?<8Hz?R_ |PI{`#?f҈?=l㸟r9?q9n,Ǎ8q7fq7rp2[qqܯ8n-es\ǽq[8n+p\8vqqg8#Y8l8y9.qq9.qm#wNp);qg8]8C0v$)ӵiLN1_;uvdکSmm|miiӴi-N{ET3'jN_1M;E33^Λ7I;ov^v4y jOΟ@`v4 fh.]]8Qpvdiڅ/j.\͘͘@r/=gΚ;ђ>-on{Zjp=^_(ܲ?vP}|nν?V&5i4[=͑LS\i4O7͗O 5ӚBiᴖHZ4mZ,@Z<5`Z[Z{ڡDᴎ#iG:ӎOJ;֝v2TZOizI;nٴsi諾O~EnNPa'wA{As  ~8GAA7ç/$si og3a3pO|{77F7n7/OqOƝ枙=7a3{I7i(7K˽[n'ܬ=K:nne7g7--{e@zU$?黡Ģg_:pMo6Mo3X%hV s@ƧWD=M(.l% $ؿ:GLx\Jg]ş?sҙy(9wHMMH)Lӣxv]loS_-HRmmeT  R)D  tHw:y^sK *v@Tײ$Ivp] ~u>D[5O\"O "?÷YJ&r'{WWZ nmL킎|c$mMq'7@ZVݷۛkpEX{՘$g2X${l1]QDIv8 x]N~owpG[a(^a 3}R?{~ 晻kaf4L@t_vbY-VB>$D-- "D2& lu6A9 {%HZTLIkO#y8L2R*^m`2G psm&KѹE]nPe*/8w6jzv9,ίw "Y,o^W DMҐB,lf 7"*ЩtBs&3 5d@_)F&y7,keS[r8Vn Aݾ=<dPBeKpxuJm1Z}KwDnо?IDn/ 8*a7LLqSug`HTm<<`CMY 녱/qV^Us-~:BDy|".YY6hk?5"!q nK֐K|^ygnk^ud1kԬxO}'4o Hf\'y#c f#֗pkrE$IJ3wW_pT)]xyvg1;[MpU`l1Kw*@6+v<.Łp064NCAX52&%"/qaϦO,"&OG ^U6a>$3$Y_N}b`n `}#GnH*Mt_){w!pkvLѮV򏿑2w ]GĚ(솽5)1z7䮃s>) %06]`Оo}ýjjt;>yyh%>7Bȷt$޹G@g# ;^;q |\ L9f!wsleV%+[q>݉Ix:%_џ?U : Z<`z\0חIP#$XmP.}vN`'tD:DNEqCP8B۔,Y˹, [g7t@4q{qDtډeW쭮!`Q5ZqUs6tveEOgS `܇VN wAtBnj ^̻R Dt[A.sV-]ks:*%G)Y\ BdPr̀z}a<*Ugݾ F>ei[H鋧w݁dy5%v)-}&(i0 G80RE"57<#Xm~@Hү2͎nry 6. }WY6(@.u1-/Ǥt)LK%%udCٜK֭u'%%R"^c㙻|"r[Ġ2{8 40SV^wyJqUQ{ՅFUG]@5Utp }E {#ܽd<й40$0Hoʻ8.Lwpz˟1f ŧ9zܪ. ")z)/ழWZ /as5{3M^]Jh$a^/ b,+qk\!%@ zG4ۋVBlnIѣ3g޺ sA&:f,XheT,de'_J{Ys;|xH=dDHFVzWIc(UV7<#lN%[&qm CBquSE#Ly-dYVCvĤ>9G^kS4h2Q~_Uc]IDTݧ?vŲ^ 7xV N.3e~f M[]9fstpbq_#CG]_t6zߓH~N]mMkk,/  vkkDM lO\ S`ڤ$⽵ז} :g`fΥq &Qr}mH .M"$ɥ+f L3AAI>Dȷp7 t+y%"̮;`jM~k\ {=t扐4]XEdHX$?ZNK@b3I&GRp * rgcXo2w1:,^S)u[^1X~,l@7ߓ O^/nMi8pKMN4hkY [1ҺƋ;U:}5BD`\wUR ݍeՂ<tA GL <u7R͇6%rtB-d  (A^`̴5@ n^)έxȒ כ[G6{/]7_/> I(Ioi4m:0 nܱUPHV_C%u,=U m)w|pBD BlSZ\^/ԑCwm.%f4R"(&7 {<.2ՠcGt4K].^թ\ /ҙV2R-hlP1v (Tv{}ʗ]8+?LlFd;ߎl䊀t)|@׋_Itp;B8KR,̰. SU>4cķYY gx^-+TJ`T͂OL|? _@p+jFfJ;2<{]Eҹ\2tu؏;@I8v l|mA_صRޓo]^/ 퉷v3[WQ{.YjLoDp~[sJpϋ֏{ّM|/b=^"|<$sW5Դ ?6RYm+AWw'm:!jYq*K ,`n.\^)ͬClUJsay0e*O\*|7izZ t hc d<I YA,UoMVe̬٨/BR">_zɘ@l{PcS W.!&H7[xIz.gRD/d9C\g$a 'ѡI/}߮Jm\-%Wʖh .)Vs7H &zI-cw?jSO%*ň Dxt"1k%z _UŢ^%tek?;e'w8Af({mV5`x꽏0C$,ZvrrA;V񫂠9Ak[dTFgٿ`Ϲ3XʋbTT3ZJ3napS/nge3<$i`3Ͽ}Ht7PL8ItD]~H/v+}.W*:ڞ&WGjU0Kwl!}XgkbͩxG5@ _'<+՗?T_D5K {얏,@'m3a>zc/Fk"DT't\:tĢ緾Ɉ!E4x-ոYF|*`={tE^R$;$F 3Lm A ܾ;6$Th꽵u (vZ.#5CIY91MH-0[|N|,Z`Rv\+ܾE@&W61@D@)X~u>; AdPn>Q3#Q$]/Q>Si#:/1Q?hs"1ꚝ ab{) zaVs@a]aƄ<lT TzmAd"ʛ$lP Q_Nnwɝ"# ?6Un7"|f0[+!6F8 x'ώ7abU-bp*d*k &2\w64S@j[ݩ?v~Q_ 7۬Lp0hWsfebbН qYT]X(HJҨ4|> C{Y`3O!H5YPoWjSCJrPB(%]Lis G:Vc2ߦ죫JCqt$ɸ|x#8}~?,2BzDJXm@.Y6VA7oCX+{Vf,aT@݌ V ]!N6\~UYj_1y;߃ؾI0y uJLG{^k3//3: +YX.rtb0s25{w=w\ByɅ.x96~o CAn?]/\JUR!oI~7+zYgvhِQVpknZn C~k?|vJ3} | l |:HbrfDGQ-=zGd:Yj%a!lejq6\q(ͪV "s|d MoN߀ZBǪ .AǍYx< }C|G-vq/x~W@:|>A+5,)|9L'2kS;SVHمJlN-c< ׋߮aF,VޮL,5[N2df+\҅ Oj3W9VezAߙubJ$+DUEϓ?jh}^}̈u6ﰼ{ԽV-2Q݅Ƶp%}0ډ w[Z|h>;bz`ONo!($|@NO @> H6L*;ә]Vz @ NՁ5:%-V^ů[R?Cr;,5lFN܋3򹥧?ûTR+mP6-\䉢%bF1flA B(eaSpVY;s; w;*;kn9EQ Cts?֠nBj@r۷/btA=qrM> J~e{ϵgd|RG2@4U@8+opr9,uu}ȩ)+ PhDq\ faBAd{S[}; [+@Zِg⮿_= iI,_ H+ٮCҾ^ǺnnUoyV-z~+8e A_N6C/^& r77I]1ϽLdikȱ\'BZ'#nz5tDʗX[kM-gnC8v YYCB??t~hL({.:ɐ/ܘ*Rc FoF0{ߘold"&{H~:BWۍm^{,ŞBO~`dJ_Q"N`R6?YN z+96!N>'Qc43Y'ɉiȃ߯"i0@f3d;!,SXu,NK.H&w_ade*,b]nd4D7(:Q\ |09Â;{].M2&ućݷ (M0/6n~&̉җ|Z76󮘷=p ] ]>w!`/I!]Y@C2Xu1_d[.gkDyIgbY RT Am@Y:, R), 2TMP}s}7րg?EF-'[TΏ<?-djVK}"LxWW #@4*;|Mm7o Z$pljPN\ۀyVU~bJItw$8vw_@I# P0BAd#=e%69f''?ʱ.LAKTm/wCG7܈&"1dnifyr Re?]ðy!]~w2b12r i >};Z8PTRT-XH i<: AOe==ERyƵo /CoֱyEmJeYӯ]i5uC u H{-ם>+r>9hH\ -QasLqC of# ǬUq*jMh`q`g@jO/G]*,>+Q ꈶA%b-.0yTn> ypQ/eRu{q̙/LCeT/~~O1jwNH6ndӯdMefwTgSc r-ot }C?F<F,Z[ :68BrRv֨wmd$uXM6 j&º)dY _QhEj-(1&_XX>y}+s:v ]9n[}:\yT Ojiu ӨT8}%^qeCz[.ŜL"n)ӥy1Btx}w~1RE^V[FZS@#x,BUn(G jfOڱ(&\V\JC[W໑&&{r^aZgNw5u,V^SaQ<ٿTxSꧼT]ߵ &}k ;\p7+T!ΥCx'DSGªFFYt$:d4(H~|?x<G}Ze~OBR| aS;. */VI1%#O,k\X \rl2myfs=G\OhfraekVc?9:&|.5?| u``n/b~/P100'ȟ-<3 Br,M븙`xK<}rć4βÛrepg8w@6 oҟB|]e>L,8KE1eDG=gȳ!d ]- \< B:!wb{W]Ց=&B,FW5;!/Ia^ö&#nMy2GpyAL?KrXE7m5+ ѭ8*S3Y%LVOGqeSh>Z-ע.$I\>ܛˢi"J-w/~.yVʚ&F1b5߳OL蔫 l %Kh,S["pG9tHi ]?d(!yYWfa RdDQZ[Ρף@|tjr/9U9"[ػ#oF\WRCsr}, `G)*Z$}bj5^zÝHMl_%TޱfK) -Pw*x)Q:Qo&uofwjw[n8ۤ߹AhB8t0jZ>z%wBfR'UBj8ۿJ}^{iI;袅t,X4x H|p򗽅p 2sϨnі. lϩNm;DjZʢc׌Xj]^{>XHekKKPE2‰W oe6oIp 7܃xghӨiuKJM^tM2xSZnnxw.BL+n;;W_NL'NCWX{i kpdX9Fʈ*>7蓬66] t^ Svut0 qG?0IY#p7я"GU8U$L+6F4TT'Lz'_"VR#D)ZXԏF1Ҿc-iI.2Ez1DciB+?ht6]GEd*G12}زP D}V\}>M1N+оiI+AEͬ\G1hVY=?:t>y*XJChtkKc.IIV#H\ë;~!wo63`x\oBVE;&(#v"X064|133f, :[v)g>xC35z{S[NbrQT>ZATTkC+Z^ Mm^'6Zdm(*}@Aesn4FұqLHn?Wbn[Lqdk˯RR2FNPIw5dw`l%5V{HNJ3 &NWoA EG t*Htb:$?mި?fprL]Ey} Vg_ձZVol~~\x;@mWj.o2$x7OZE)iOn+j?`n.K'M=el✍RQ:)x:Bˮ> g1 C d S3>f*telo+'π#yEC$uY j-j_3YX:ZȿL:f6oOϹ^"2,eA]``Z~!%ѢcpIUBe;a2L`nwa~лG'.cm].3>_J$2-6ʭ#$> V Ӄ}1Jb=fʎN؞A}N.żnv"l@iEYGg X}Y,3fܙۖ6Ӭ[f},و0ul!w3ONxmR?Pz_yuq0Z5ՓHQ{`r57C~& ?rzzj-  6Yg`j#8oJa!mRsk Y BeG na,]0'e6}^R4FNcWwyPu+\TSҳu{!@b~PLGf͂/>!iO [1zB'%PKWΒ J7}?8:n9qR?x+.(kCUQ_APCMu5Ax|aFf9) A vB`uݤو'Fޟ./|8#*dĩRߪƌe5ISB\(R&S[~>Ɏ Yg ,j.0{e Bd%u~0ۥG0Y.;JHM !x֩^͏Nf`c( N_&+/m^ͣX#qU}6q~_rOj=nBYN[ Psv|֒֜@Lxժyop9S8945ySFr?;> endobj 155 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXF#2BFzBookMaker0DlFont00536871271 /FirstChar 33 /LastChar 234 /Widths [ 1000 0 1000 0 0 0 0 1000 0 999 0 0 0 0 0 1000 0 0 0 0 0 0 0 1000 0 1000 999 0 0 0 0 999 0 999 0 0 0 0 0 999 0 999 999 999 0 0 0 0 0 0 999 0 0 0 0 0 0 0 1000 1000 0 0 0 0 0 999 0 0 999 999 0 0 0 999 0 0 999 0 999 0 0 0 0 999 0 0 0 0 999 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 1000 1000 999 1000 999 0 0 0 0 0 999 999 999 0 0 1000 1000 1000 0 0 0 0 999 999 999 0 0 0 0 0 999 0 0 0 0 999 0 0 0 999 0 0 0 0 0 0 1000 0 0 999 999 0 999 1000 999 0 0 999 0 999 1000 1000 0 0 0 999 999 0 0 999 0 999 0 0 0 0 999 1000 0 0 0 0 0 0 0 999 ] /Encoding 156 0 R /FontDescriptor 157 0 R >> endobj 161 0 obj << /Type /Encoding /Differences [ 36 /G24 52 /G34 55 /G37 57 /G39 60 /G3C 62 /G3E 66 /G42 82 /G52 91 /G5B 96 /G60 97 /G61 100 /G64 101 /G65 107 /G6B 109 /G6D 111 /G6F 115 /G73 120 /G78 121 /G79 123 /G7B 124 /G7C 125 /G7D 128 /G80 134 /G86 136 /G88 141 /G8D 145 /G91 151 /G97 156 /G9C 165 /GA5 171 /GAB 180 /GB4 181 /GB5 190 /GBE 200 /GC8 203 /GCB 208 /GD0 217 /GD9 219 /GDB 235 /GEB 239 /GEF 254 /GFE 255 /GFF ] >> endobj 164 0 obj 11803 endobj 163 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 11803 >> stream xm{ XWnubU$'Ƙ&1b/=>" DDP$(HleUWwQM7E7ݶ`E3:nj&$'OK2Ldfvs69h^EwZ&nحV3q[ ---^_ʫ&/ytێI'M>}o}i.)-ҝ${签;IwGG΍N]y!g?Lނ?ҏ=34qrh{q=q8n*M8.fs<{rbǭl[qk9e+-s\9Up\p\&spq ǹ9|_+dM5gM5e^̬֔knִY&eM5--k^ϚB)YӳȚ>7k'fOJOJ5cR֌Y3eI˚37kԬiYs3g͛5bYfe Y/dfzt~>wo--UU]S[osn_[H_7>8SI21&2&cL-&5L~S)` L2M)jk:M])a:`142pOϹ[ [p&pn7Ǹ;įBnwsj5t137{{nnK1s>=z{ nܓø'pONrp|=$;!e$6mV|k||H9@9q /;V 0Z#O~+~[ !Vh~0kKu 3TJD Bos/XKN:׵հ[Ymт^PUKQ౳|[:(Iv ֆu P rD띃 !I@y1GZJ~{WMv)s.tYD#$C 'P*||)XZV i:7(Hs*haɠ_ I1 INZG O*L,!/V:AZ--<]Z\ !)noH $هxƈs|#x'C$ . j1O >^"vaUg\7|k1sAq%<}OeA $75u攀Ff$(^O i(#n>5c>hnn=ݽy tM3(<(n_]up/֥Q`/B%|@ )Q)ƴpKP?x'bDk~H OʯZɣQqrW=Cni]2!Y*`h /푔Q>կC^jyCzC%tF78vB:|}r$yF,Ir)];•~d*tkφ:䄾mZQHf UjּF.mtnlU)d&Hɐ 7_qj;Ce[8Fw5=|A Ə_\--bAS1$$'7×Ba%(AmclŁ.ٵT(JUϟi,¨}3AXMG-̤#@s{oWA+_=]s@+ :]A7Ggw_D.h+UJ,~1po ኽ%]\mKABcc]W7ZVdʂWa7Gt5N$ 1mJ*x8YsCphvåaرL׊4 ٢GyJ~0MWafXZ-_ 6||4)L.FݣlRk]?) xzՔA8oE:R;1p%.,f{ETm,Xt!h7.\1A|+Rh [kނC3EˑS A'jEj!* ~}. "Yλͫ9V(vDa˓f6@mUCu|g=*~#3e|;ݻfuKM4*U:\8} jq~prԙLnjwe*b%1 +cŋ6gLMwTPmR/J,2PM VlOiGAnw`<_[/5gծϏf!ybS һBuhsgvf䚩U,:6* >O)9G#P'8,]qCCBkTma\ŶLCOEO:ΓXZϟ_X]EUHݝ}`5_E Z UYC%Zκ?1@*MDvNw]]D[QK*KgWϜ;5FƨndB'u.|R#6+K;ܸvgSGqu*(zS}!:js[YwF4jtHBT1quU-F 655` V460 .HT 蒺5WNjt#9p!qaD ;D|{#Z+>$E8O36Sg)[ZA钊thH[7mf:x Y$0AzV9&%C$gdM )&mG7w+5MՆU;;QX"g31r#Y =hG-gEBP.킘p^t~3Gn\-eU#o \b& )EtDZp#  x}W|:ߩA(e Zڐ'eoi^+f ;m*=hYi .O֘"O{(K2ʊ>*ZWDYOZ8d@m"Bhx@zY^2(83k|r @ߴ1B c`jAr[K©w{Y_/ MhJ8kHo ?Zvq&vFBs9f6ħn jǿL%LY,!9$ȾڅœOɏfI֧?1YZXoE$#c%[=!R.AFlp]ٸҍ}ǎ!U>BMU֑}3΂l!(`fҺCcжD^2ẎD:sg 66[K`!d= ܎Kz_H=E+KZ::s&m.Jzv\2թ %-?+ =4Nσcy -UVAHp;o_V /πJ\"%>oa^ܝx":h~P~uTPno\eKL]Kގ%@B,FkP۰73 HNnzY HSbV{m4UkVT-+k]Jv0 jk,Pg;fۙ?\|]2TqswAJ1D[b&3p y;d }_ej20 n!{; WwuODi䓩L}]x~4b.<& Fi"ndNd/|syQnd *,8;ӝ!&UĜN1yB(;=ȗ5hzCSUͺٛ9by0 -3SHƇHb3|X fS(K]>|T$Ve(vnv࿱{ 8qd">:$u I\q!y+d7rfݩ!䓋-3+qk.M?ǰ?HiHbyntɘqQX-UYPy >zyG': `l,6I%QGX6!w$7Q508/Q.qa 5Y`(+ ctx_YS 'eU&wӟyP?:]~qed<`8i)@e8K\]ROt`^Q1v6G:]2c5S@'Ct̒<$Ft_xTPڻ'@'_>'*@Pa-V]Cʭ[#N|$YwuSCQVpT7Xd"_~=Dq8 GBsx\B4 o+@-Xϓa?Yp&j͊SzU;l cw;DۦGqDtj0jTCPp0O>f C~qpQtۄ!e(apPeECCWE ZueՆګ6q6&H[6@EƆrGQYd53ah:DۂC<"yoG'SET :J| Tu\$cFZ2Tkd7O*bg]W p]RA:/i[ۈL?ʫ,E^'KI @w i '&8*N:ڹ z>N/4TPt<  ׾kk+/p8ez@~H)(~=85]vBAZm=z7ʈ5OPt5.ilj"%oH՜zFn$wm&ICF΀)Mk4nT#A:&@xT:g|敘 y?s-GvUpKvˬzLٮ iyB" ]sVAluw9aAʹ]B|(`6RΟF} 3p6!yGp]4] 8c9ʓEscNαh ѫ.t~L>%ZiTJL/=+eHZ&4q# %K; Z%^} {f\2[=?vZMst,xo~~{{ɄMOCc:կ>-7j9Ȧ6Xev%֝A~ Q(;#vrHuunT( 6AtͲg~Cu j CuPtr7%Q80T+d6#烜e Dg;7B{q(ٶJYf9Y[ A\6Ioљ 3ݱ9034*8p>]0Nǧ!?!ܘԊڲ␼UR}}aЋf#uW`W~Kgj#7cyd";l2㼝~/"~NX/&͋'[nGbPy(C3 bPӂ n|>Of1!uׅ[y&stQʧU{ ;Ǒ qg#\%00Oa,!@n4٘N.Ğg\r iSǡg <,CP|^v=nc՚ zcG{a0x,;r@J lJ_E6 Iًy2]21Zݔ~+ vS D2MR5V '3n ڍ"I M?8͞t7ZjV16 eFZE,kejQ!Wd>U5ʼnʃ뺀P#"&^"0M' >9%Rwے)MȜL:6 \uO_+=y*\aKZ.K<>^8y>Bqj 7R"h(!- ۄL h|`9?ݚ1%SuBjYQ;(O b7W{GDŽpŀ"T\e⤿ho0<>m_ҪRri ;3ӥ"E!>]t*&ty3lX3hy!ʼnNpd|C{7ݖқY8I:n |=9A_$08}"fUH3f$)Tu~C+$xʼcQLoAWd܌Ev7"D4 qs |t#{M]+@ucְ[ondc*Yٽ!@EtP$x6H_Ayu>BsW.Of0Ryu8 Qqݠ,>IG ob7teNTT742FTo:% !&Wq,3FJnNZP sɬrE=#u> VA;F&л%+28J;ltl+F[v My1IQt}S0:1Њ0Κ!ҷE)T,YtBC=K[Zs3NWkxg@PثPa{k,e+lQ >S.eO>WUcn4\L6XH T0 ~U2!I^u#ٳOu'=CD`@l; tiRK|kPߴZ^J)aVفx8.Y/^Wuhj7+2,ZЍ1ZSMT-|5ؠ`6}:,osTӜpHnڎAxMLtqKjS15ܰ1|D kFPo!GoH(JR jĀʅf#B/ZO:XRk*ʫ,VGoKyY0:t\Hrx:5:U4hU7Gv^wsADy^RUVz=7Gž%(=.I94#.q#џ@!ɱ3s Ȱw?-eJN4Zz |Ct 3' MuBhMae; tA!%=z^בB!o34Z/=({(IΊpQk.xZ,^ m胆+E1HFi MrzWJj2Iujͭ|4{3%ĿU~b ʜ5Rϓu TA_JPngB -V| ӢN+Y-M6 ~YTFN$J2N0Qcm o}t!3bpɯXJ!X:&ZAzsR- X`]DJFIz~>d<] T>$Au8Q;|1b2  [0+kg1i&/6Rݜ;KTzgϼ}*Vt̅ ^J+M'/'h0~M|tgl{hK6xz;-'-IԄ9# Xt^2ny.{>Fu&T5e_,oU [#Br/%ɿ W>}%`$I`^}\׼s3 ѱ5ܻeݥ Fq]wvӍq=ڡݬrI`^ >6TExsBTa5a_J33?QC&=A_ݩ.hְU* H91{wU0{yܺ4ŎpvZ:d%;n31bG 1!g^a'1H,Ma8nz)Jף'|ceC!Aya~//O$''_!lע$ORuPL m0b$GTbu;VRJM)Ѷh4ew6ݎߓIT녀_R dƞl̂1YDI9C 3$ŦX/`44gEZi" Zա2g8QpdtIƂ<>;S2â3|'`mj/&rw;OYv3˻к媥gۅ.9wR#<6VT27W" 4BBg>؛C Eߥ١Q*4RC-~dkaaUc43CsS_>1mV6[?N)P/qw.`ɳ!7o" `"zW[u"Iykqԧy{gAę7vahۣY +U^rm SzՂ6D:2nHAHv 2>'>%aMRۗՊy5bswr/җAʟxg@:76kKUE6߫{+H5ʋe.Bm@Z/ 1敖7JKap;utWx>NBy:_ɸwrN7>#t ĵoŀp'F}SJnq)U9Duɟ v_}(uLq#9vRi;. (B+Ț?,Z!1|^L6ݷ" VQa貲ߙ:DEMR^IND:~2HgRara'%ͯȨyvU̚1kc,&^,[˚/r/`(^=$&0puȓႋzyvK"/} Ꮆ=ߢfTVdM+ZkR:6&I@ Ʊ4 ٗ2\ ^/՝[&J&N^kCLnv;GJ8wQ+|EmHybo[pkkd(y!Hbseߗ2y3rgۍì X[/?_9VLLNp] h(a9x W:n=uy{r$1m靋Y:r"\Jŏ4̍m93o~s r1QxzI-W.XM$9Gn jauňj#f2V K2fۼ*3Tf ITAC-U$):7jKJ6Wo}kjTx5@ gYE^$O`Go~,.ݹfRrLRUA71! ҇syrU5q%~}.Y :Z̈́X19 t-L䉎`;&`0H2 %`!ݯ1YVvArU7`_6_Y9+KUmt i$Ujm)c޲@^F~qLH ŨWqyBWh+i[f&H90'%c:}g@mBqhHmT$UHVaVߏ_ t;QlU+}c3IXà>fЕ"nA:+5IρBRgrqrcz4z/>VOV؍ d>B2_]F5~ VPa *,"۟ ]X/ވ]+˲W7PiT0hLmU!00ʍ*h}jQqujz[#FOy>ɭj^ QrUld_#?3vڦl롎pK?F/KTvԪmmaO#Y W7~fN$Ebu>LDI h4ZlL' t0L]C._bwS(_7֚{ endstream endobj 162 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXG#2BFzBookMaker10DlFont100536871272 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 163 0 R >> endobj 160 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXG#2BFzBookMaker10DlFont100536871272 /FirstChar 36 /LastChar 255 /Widths [ 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 1000 0 1000 0 0 1000 0 1000 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 999 0 0 0 0 999 999 0 0 999 999 0 0 0 0 0 999 0 999 0 999 0 0 0 1000 0 0 0 0 1000 1000 0 999 999 999 0 0 999 0 0 0 0 0 999 0 999 0 0 0 0 1000 0 0 0 999 0 0 0 0 0 999 0 0 0 0 999 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 1000 999 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 999 0 0 999 0 0 0 0 999 0 0 0 0 0 0 0 0 1000 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 999 ] /Encoding 161 0 R /FontDescriptor 162 0 R >> endobj 166 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 ] >> endobj 169 0 obj 823 endobj 168 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 823 >> stream xm_LSW6*61,Q/_6ѩ1E6v)ttC{\KX4`b65=k'b\>sw~aR |loW'orνZw CuP\7T]Eo*$:u*:jkˡf6txJV+P5B*(ۖj|==KzI6ꎟ}q-u 1A&Ĉ0er41*VC,!ڄ8xrBDird*8$ (HzMtrEw/b){JaCwnԊ&-94oh  ݶi6C׋ʝUQ_QH[bNNδx7у(H̀s;v%5,9:YbS׳~|>g׳8M RU% ߘz>?hzߔdzs)$,2f̘23pv; ꜻ,Ѳj8arK(`H'Q#22z&1k@/O>.P)2?{"ʏI7LAEmΈ3(^}Ł?Ǹ#%xIuӔv;FB313Jfbv>s0tɍPeH%&R(_ɯH4 \T~6pH~ZS6{hP!D?` endstream endobj 167 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXH#2BFzBookMaker4DlFont40536871273 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 168 0 R >> endobj 165 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXH#2BFzBookMaker4DlFont40536871273 /FirstChar 33 /LastChar 40 /Widths [ 500 499 499 499 499 500 499 499 ] /Encoding 166 0 R /FontDescriptor 167 0 R >> endobj 171 0 obj << /Type /Encoding /Differences [ 37 /G25 61 /G3D 78 /G4E 79 /G4F 80 /G50 87 /G57 93 /G5D 94 /G5E 97 /G61 121 /G79 128 /G80 142 /G8E 149 /G95 160 /GA0 161 /GA1 172 /GAC 190 /GBE ] >> endobj 174 0 obj 4750 endobj 173 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 4750 >> stream xmX{X̛jLTؘDlKF/h0`bTdQXAu`/;;^˺H bZIBkM<'z1ymoqys}wy7|M?I}jԿkЋN>0fbf6ag9Ie a~0 a^d ;k~ZւY 3J(+myVZfYgJZt^Ԭ/f-df侔isAtw=$LIb-IJ'9䤖$g+ɝI&'2E}2eP c c*%L̏e fy-”ՍOjnOn٪L 6tvT޿;uhhmt+uXa|@n__\Gz[Qp A~aÿ/޽99t~ ds7_6=6!RlY҆<18ivcmn:6A'Y9 c?Q;&"H {sB_V ?QnV`,6~V<Z[v 2>K~SL~\aDZTuUV 7BNK`r#lyx %(@pb] m!Sq6<߀wϳiijM[ AWXooN[ ~gTlSÛ``ϩn'8"N۵_҃b=z%2t19GY< 諷ݹ.W0Qix=. 8 5ǶdZ/D)z _g;1 \ck;*DB,vqWEZo\:-6,BhWt8'O@k bCx:K>/J9:oCQVR'@g'>F=u]kQJW *:Σq=;ج"#-fIL`r;4tYU9@>a I (F~ȚP{cgKW巖;`n Y-@E/ټzZHljmj̔JSYI;\]IH=v/ЇէK/= !Y

w? 4\1D܈ҧ?P{jW֙OM)dRHqwƧ%}L%"wjoD[0PEɶ&7NM98y(B~nPxh^!Dq[˒IubZ^"N&GjKOMy%S O~xkkhv:Z: usAAGnDb\H:Edd!jl>Zުlد2\o29BbA(-mgi7|o/\v{ʪ7P(h0V[(z^QY28%$P:R  ddU6Ʀr2B΃aJ pc>{"J<[rEȂ$:q7l*/u}t&o x=A.{yyWUY<lv'qMJUAlpg0 5ٌV#2q"̮'?!39RwT!e#nŬylg>L'vS.- TRij k8\ڸh+EN:-HeJNTJ+z:Q0ә%`)XlE yozx[PuMUb6%Qgۿ*?,xڝ^٨YVkUǫp t[{T&|m\e]XEeA1(  W6PEY+ҔxTzH^~NA*A-CCnhɵUञE5;c3Bót]݀[4V9zk[BCRsNSzÓKJ@cZUYZ ]1S^)*RHt=6,`rN9 &$NLDܭ=g,%IQ{6P+Kr2mB&5Κgm(rd4r՞+oc6τaljMjDʭFdJkPZ=RT"!Yw%AgL Y0vM676X~JdHz:_ϖ7hG{-8Ղ |;h HF5H oZL~x7_kZڏLP%wv\HnS @dwxep;vzc[ylІplJ0U(i}!/iڟ6{]fV [Hr-XnΨ?s8IC*bSr{R@5Ioxes}ch)~!NX](Q B#|N=,#li!wC婏RC8I.âO Poafhd\HYF&Pg3G'?;:r;u bOdo'5R7hTDdR *Qh8tSqu9H2HluO۵*̼QZ[]W9STv#vvYږLO9Vo#{U*:ԩ~н~LJB)?!9#Vrk`%fRf Wo i{͵^l Rxny&1ˌ_0dNJ)4p'A0jmLP4I\!PgWة:^Jh2AWg}ӽ@I\pj/9oW2 6Z-{eO8C;~(mr?u)!sBvyTwUtF2׽*e_BF[2#7Au6D,VELIw*XC$ ZM0^TC#řN_dId2]]ӹa ~o"mр }ƒ".75a Q4Z)=i³U`7TQOb,):\,^wl·2? Gtq[pT&剈B݂pW hi dR{#3aDdOw#ށ}Mؼ:#ߣ!ʽ/6jʽ=fU!7$9[:du Â.ZE\lWj?`K.RW_FE\UHV]Xyذ"HN)D  endstream endobj 172 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXI#2BFzBookMaker12DlFont120536871274 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 173 0 R >> endobj 170 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXI#2BFzBookMaker12DlFont120536871274 /FirstChar 37 /LastChar 190 /Widths [ 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 1000 0 0 0 0 0 0 999 0 0 0 0 0 999 999 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 ] /Encoding 171 0 R /FontDescriptor 172 0 R >> endobj 176 0 obj << /Type /Encoding /Differences [ 38 /G26 51 /G33 54 /G36 56 /G38 57 /G39 62 /G3E 71 /G47 75 /G4B 84 /G54 96 /G60 99 /G63 143 /G8F 148 /G94 179 /GB3 185 /GB9 186 /GBA 199 /GC7 207 /GCF 215 /GD7 217 /GD9 220 /GDC 222 /GDE 223 /GDF 227 /GE3 228 /GE4 233 /GE9 234 /GEA 243 /GF3 246 /GF6 ] >> endobj 179 0 obj 8624 endobj 178 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 8624 >> stream xmz xUoE9Uf eLX'@"!1&&4!MzTw;$$4`a@!̸::3Ό$ﱤTW/:Eqr //O/ٷpenW'O^TxwMM6c)ӧxz/GSCy#!$ѩIۯ#%g+?7?`Ll0fF # a<"O ³0Y0K|AxQ2Ax W%ka l,A,' >[iiiisFzOO~aӧ=>--}ƒϧ/LK_83}$}E3hq%?xfKҗL sW۲tKW?_R))J=őLqSԔ-œM4S)-)zJkJ0%NDSRڄha wd wS / Gg {}!<0Rx𓻅oyL}ck~ar!/&4~5t`&;<9|M5k6["3P՞{dq7 βdIf2{GNJ.r3򒾩4U6z;kBAKlU@3h!ːݞbt+a6b;vM *9laOTk^sb5 )hS'O>],}PꍂOmqTxβPrb(-)2L>VP͞ >zjkQ0Bs.,^0!X6+$*._3S}A4s$TSEU|lXEXmaom1,U`(̘ ^ tnkQ%zf 140 6vBAc{D55wo bkVɀrŋIL6G­lzWjp_Ğ({,t)XI8_\^m)fm6t%>K$T*{DJ&}IV-",,z}taNua]5T,f[ҵ-4YxpiƳ#0`~Wv6|b7ڍr\P+رv:k΂@z ~x!ye6Vu_YW^-YD"J9M rk3\ۡ.2Nt8d;XXں`[$J\ZA* P#dˠ[jTd: dYQNh_Z~" 5ФeJdO`A`^w&3Md{ΝxY3l/17T N Ka+.2͐"j}X?{j//0.OEp9quZI0 RUeRfuP3`MkuSvLElW$'ʮ(;LT+AU=~⑖1Z.j5PQRe#n sCpX(_O:hN'w?^&ge/$O&*.{ h{*C``n+"o[q[@Xo")\PY[ ڽ`)4Yj6pV:J!y%hƲY^K?[eWa&Z<;,=m@' x[ٱ{{ -L`lķdpp${ǫstW9d Z%*N{|j؎im28uK֭!`XY4t{< }&n=_fY.=M+UIS>ujsbA@}HHEQ8[U$`3tX\BsD&J {^i:ŖU;PX?2&=?eJP[o~=pkh`aC8`K*61M |&Y.R<)5 :VӅw6Kd9֘Rr~DDϊ/y9RSeqH|;d2@'yt[4-fAE$sv d 1i7iz*%"ǂ$ePY31M}"UԖrc~[xK[LJ\ݥj=lbU_;f  E>uȠvM,`T`48˒<i{0xFrD%kp$gl"'vUdƬfEv(.'ĢG#}Q`W$r~hLGRsa)#ߒaΗD^ˮl'IH•OssxwS`K{qTÔl`⺱>d[4G\v.D="BPKwYv:4>U&[bZ >/Q]tH n#pÄRM ."S1[ a\_KO+o^ڊgkyU߅Ϟ&]lDb Y5|@l<|1j*O5 H.{:-`?c<./E:,8hyCAbGMHب=vzTp. 3*8x+U]@{ `0׉2-i9 ,:8&قq!m}wy],oه4Qp.]<V;Ʋ|C5s[4S]JzQuJ[ftC{;XrG ^qE.|~_mt 04)&Uv[bQV.!" =R1~z_X`F9_.$ ke/8eܩI~NrZchmVI ـE*&`#`t6b{ak x}?-GΠM ~(yi/`vcL[rCG>8M>ߏu d N,= v>PO7EeҕdTe-l(e )^mڄR-ZzrW(N o*y4+P& #^wGMvg^l5PWQT֎Mˡ=gYΪM`1۪֕@ˠ)#{`x2EZsEAͧ yyM%(_J~[`0t?o:Mg#!"= \6uȄ`aK5JHfꂲHQknbh`G猏]-RvW^F:7;L(ˆch.n=Xi( oΰ5aOf_ ~ }Sc8:%7sbT0t6Ml}CұpyV2Kg^g t˂a5y\Fzt.T.x)BUDUV~Î ;GE{pS5<kbi(~tH=!+1yFOW-_WP0J}Sdj 4kM^ wF~|/}T.3`c?=Wpyѫs^o $Tۇ^տё*=oSZ&۝SUFWTY<%CٕzI>V#9A ;=͠PG7S4=U-P6)ꇍ=sE1>ӹ+ Q݀21\>:#dy%j(lۊ:!_>lYdW[ LiR+G T<}?s<~g3/PteIv ܗ>]qf%hu.Qp =M|;Uf!ӳPc& :pZ\:] iȹ9u۟~_, > IP/'%(D?SJ=ii26ado.Qu08kE}DFFpgrWI;=tZCTXJtg4|pSt{| mVa<ӿڶ@]A]=T ;z3NG]U 6ρ55/31@ >:X8_]_aVO&ˢUlܒ͛6A>J yLa5A P5s2/j[u8^㱦X}&bt&7oZJlPit2rG \0~4PxYdSI?D3UB׼fs$}"/ڠ)"*_㤣ZW^'~38q fnjP!j{ iQC6G?hW8N}DEvmek'ݑ=ebX_>D<;B5m.@?c5Vn6S$D\6r >Jߡ|6 ղq VA=aUqZ;[/ĝCMrJ+mXP{ݯn llQ픡GŪzF/P5p;noW\(%6 pXȭs<}: BY(ݕHV}1ow&Jϋ/? U ?-Vs@$yⷡcm*&F6!;.>wcX/j97*E3Nt^˧^KJ> qə32"e"HNLyLK4$IH5t4I%m9j14*y1@SW;/B/|t N5trE}yM?l6ni ]=-s\"ceYd#Bű@DL޽ eA7Q7*RZSG]\m6rLN[E_oj5P`?_/{?95,PSt9**1P2tˎIg+(Jf}NQ0;Z}zS.qǶbب. a\}rX:?΁γ/|U:,fCal^ Rܩ[ϒxB6'l^=zݡkƿ[7zJQKufS}rЦULy|U{Uᾂ||z1/ȜH%֌ JD[nSeUzbPdwf?ľ SII+SKA16hw7՜SlKWz

Xy˭jw?z:UF*U&ZpqJQG8ͼ-*bOY`Idȗ:vYM&~nPQCD[Eco2zMa?_ĖC@h1|L: +xVUbi:yrU8;>iM.]{v|"CE1LNy8;: BЯEk);oDb4f@ǖ8>c6Lߛd?:kHHR_ϵ1DrkLF;jE)Tgb}Y(n3퐧wD. #;ġH^FҳK$5͢º3gLzME{p%nߚ(0ِGzC n*͘%rGbfmzhU?LCPs .yr"W;{].  IL[8'=46k v䈻˷b7й+xGeWbxÕ /s=.-59(#H+Km_ְ#6T1VhِR>:@([,hV|L'pJv[aX%:lc+.>;XԖn@uM2#1i;JF=_ hP<29rя%Nd Rq+UUF`V7"#R~K5+aKլprIuyMQװYss{9|Txm{!R8*U׵)؈d3]WϽ&^?d=Y&;=+B '7}ܴdҰ/X*҄D\(LIWǢyYێfuD~.u_kGBYlC8|ns{Uà ,ӣ*^lH%֌"6΂g{(.6w SbN]X|SDS,Г8ЇUc  3Sy3"$W].ԽXفfjva,,IڏQ0J6\_ٙ\gc!>tFz!?@77=fUj1{񅓤Fv5! %ݜJ'Vr*kM`)YrPQWXYeIѹ5.eAcǚÞV0pa'A,{d35X$tH1緥B۠~ |+M U^E٤OvcK.*HNG;]QL޼B-^dnΠHgAhq7IؙaFj{ؗd_J>}h;EvľݡG;p;1Dz48WdVJ}SRTFqpU84TZ*T"%ZŝD-o3Ah[m3nv֌9Rч?J.qFB!kn _Qӂ IH$,D()#U"}@|~}4։FI3njI@AeϫS6{eM>6*/r3B䀐IQ 5n!o5I<.FRd|O/ZDzTG?1v9*zy vrR/dw".[GA,}&j7khHfG' endstream endobj 177 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXJ#2BFzBookMaker11DlFont110536871275 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 178 0 R >> endobj 175 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXJ#2BFzBookMaker11DlFont110536871275 /FirstChar 38 /LastChar 246 /Widths [ 999 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 999 0 999 999 0 0 0 0 999 0 0 0 0 0 0 0 0 999 0 0 0 999 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 999 1000 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 999 0 1000 0 0 999 0 999 1000 0 0 0 999 1000 0 0 0 0 999 1000 0 0 0 0 0 0 0 0 1000 0 0 999 ] /Encoding 176 0 R /FontDescriptor 177 0 R >> endobj 181 0 obj << /Type /Encoding /Differences [ 44 /G2C 50 /G32 53 /G35 63 /G3F 72 /G48 83 /G53 108 /G6C 109 /G6D 137 /G89 161 /GA1 168 /GA8 169 /GA9 214 /GD6 218 /GDA 219 /GDB 222 /GDE 226 /GE2 227 /GE3 229 /GE5 234 /GEA 235 /GEB 236 /GEC 237 /GED 238 /GEE 239 /GEF 240 /GF0 241 /GF1 244 /GF4 245 /GF5 246 /GF6 247 /GF7 248 /GF8 249 /GF9 250 /GFA 251 /GFB 252 /GFC 253 /GFD 254 /GFE ] >> endobj 184 0 obj 11994 endobj 183 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 11994 >> stream xm{{`Tյ e:X"P<P*< BHH'33d&3!HDBAGV|>zm=֞{|sr朽^~) )?A[>y KJ 3r 6{qђ=fO5OOSC? L?4L9,GWF1wyCx8#% :l(6{Io /  0Yi0S0O "AX"KaJZAX'EAvZ}ɧ/o_~GB%PbNXSl)-őLqS<)_?)%ҜL S")DSIiKMHL~1h~􆷅~0@. dA&O#Oq0p-nMuL髂e"g_?Aƒqa%al:N᱿ r_4M) ׅigo 3f Og(wOxW';%"~(K{g˂zؾ\D=)k](.?+qBNd:Uի]X=bIUN8[AbSN%},Pu6Cuy(a=:E'e䳩2s̷'bG4m0 K轭 \-i j>>\*hVʤ9lT(귅W6]S.;$41[]!6ظU. bntKo9AGԫ j hdHl @;?E-J5pCt>ZI1)cyZl1$QTM{3*50*uh2XxJKK÷̿J鹁8s3ӘnTבoɇ "#⁋R|@ [->Pr;( u&&:DC2v}&ߕ<pF? {\(Qi )>A̔jqďTaf{txUHDИ<@t[u%ސX&nn-≰~1D-A 7> ְ #&wݬhqxkHuRbOj{:NB3pMd $}ɏ'V6 ]N"I1wMy޹<sH58쳀[b~6o5vg{@}[۹jjn? ~.o{} D: 3גER19e%fy zy0ʪJ8n.cS[L#fi%п >ziIؤL Bthk3h;? MId7 SFYʽ 56=^h _5\B1oHoOwK ,C懭Кc0u=AtCBU7K^ؼ2Ezl{jkM {VTTdE3YjE%aWm%H0.˳ uo%F\EPGBzG1j@XR\JJRcD=R0QY ԓD^C,?ЕGl]~Y+RKUnX`jDvrMgKd)iz#Ȇ '&Ow5C9 jzB9 hbsfFR/u[k)3Cڌ8L1Tuo˦ޤ'"0xD$B ؈#,w<,l+phU.| ^3{c;漱8}(J&j o3jk6{AtlTZԜe3Kl\B,[Z- &C0pnJ1Q5do>tBPT@NQ[]Q](5F^KY ׀5RiogaIQFn}?J:'-&de:>dÈ}Smy-ƃ]&}g޾x*"1+@:Z/0W*ElʓZgp6 * 65wAfjui.pZD.mGd35Z#U1(fNLj!Iٲ/TT;SzH_SqAlq0 {ivJty-+;#a-:"ݍe ؆`^qE6u{o0g.Y&,c"ґ[*:&}vT&e;3{Z$xݧb'#8`'#t/cLLW>S Vt=Yo#\0j?pvڴ`6w(GC/s&Eu'Ύ>$y@ϊZ'zOY; y\8/FU,UUCoQf#8. 'iCuVDՐ!@ĭ5䬪Zj^_S[SSeN1ʦH9vZOa; 3t8N$:y|j|@ǓV2ITK}\_ &X!ftFm7A8K Z\8|;6$^Tc"IV'k]%&^*& /l(:X ~ =}Q_cq95 Vz٠+NfR(hFtm|J;7Frv{LU Rˆ]{ku6 %rl̜I/GHa "Xz$KOj%15)p nL'QߤPuͥQq׻em S6!r=aO:"6~g3i#''ť]pwml5"MA(ݱ =$SFQ|<(l0PM;Culgͱ8ݝƤ@ɻ~{*aZh yW+35 4!8 61-Z_u󮩘G֑ug6m8VB.I kn:X(1=e 5K,.:-'L)KusvY/hH,a19*,?y~6uȏ7pQ0jU!h,zJ]Y񇘵z\\ )lt7P"zxJӫӶ*UTJxK-I2?K;ON  &Iښn~ݞ2\0ִBeq?pZLP 3~B]\6Ȟ_w3ɉk2IRLaEC18҅[VʚK0߮ \:oܤJtl(2c鍠~,B yjNur05H+wsa]hrgqNtf8)Jo A|Q -`mFXL7V3@6ņ*tg`x Q6nG'Ǘ%KKS{/b8hj7ci E:~ˆZr*'\j=yU'jlO62~.husoB#)tĻCh3ПHV2mr1R9%4/l";P%9 eKpD<މp7Ud3Kn^ά#v_ -m.s z9nȺBbpFO\,M^tvjYkUVd'/v0MKF04AӯTwsB R,FЋ$ͱm)FBo: VRuld ]A=l`s`RBרtf ujV@j$#@+̃}GMr@`׍?SY*(xZEw%W;i:{@bNw+i/=Įxq߿tؿ& 'u]Rw='j9Rm݉}7m'n2A11Y\d (;Zc#Q .GD?Hk !3JJ-TPPo4Pe5z͇BNǔ00V*/eJ湳aD®֝ZSAu: ʫFug ? :tDr\ȫYuzګBYx[Krq,+ ʅgmƉѿJ4UB%(pk_ib: |ur|!M`?E˅. 9 k|: ўdzo/]cO]g#y89k]c{ w9KV.)~^6R`o%)Rr23Jߡ^?VonN$lvr&N^VieL7V6aJX0=hŋ(uJ1I2_hcC|Cēm)b0Mk]ϳq,{\Djj )/q|`o%fk~KQEtDpS ][qnqA_ B_Fs&*ȌO- &o1o$t*zjȣ1eopWˎP?J[wJL9\X߫@g>o^135ԊLQPE~+ŚEX?-=(˸~ny$jQlYWUc$V 9*rmeS&BfOъܴ-tɱCdcU=ygDl)›'75ݪA^f8eߡЍ"Cb|!GuȲUyOjYrWK$GQe#- àV#QݻGB)å6i^EEn R{x#x+nWD~Ŧy/E|B-^.>džrθ`ٷt8)jnּQ{'^,F<^'{,2[088Sj^⽷Z3Ǜą|ખvS,`eR1s!|@g@ 2_f\ԹAbeK Z=2SVB]('(LQOn 1a:μpýSɊW/d4 uL P*P{܊5+YxOT/A C|5R:6Se-:#xs'8ֱlM]VAܔI$'Sq/&=Ynp{nLi8$*y;>aIF֯@=l+y`e*7$[hh݀< $nw); kчYarZoY%QdߛxF4)p|;:%Iy y'%8sة+ewq΍q=fA][3r}yse;٦ރ6 'd'{/x?Y>(wŪ8xTW!N^wM|\*^·zMW}վ< hV5{Jsc?9 g$iscD,Zw )[g$-˳5FQ)uڿ-kKbƁj|E?,DN, J\WAVБ؇P;O]x,a)1Q._$C:X\jߥC~ UZMF.-wU9ȏVO]$j  5GiV4Y^AW79ggހ ꋪҹ0W4m"h>M 8: jw84');`:=7|ʟqE{TO8-<܏w1}AZQܗjeEokA|Tmz c6 `)]+bC/aCز,mK̇]C.bZQ[B7*X]ڿ i^OG.mf+r4`-Ul|p{;D>?*7g(Y8OJYBbM¶M Y&#}P{d鐺?%a.`p8Ld;HEb@UUoÞY`/Q>/EAUZ@+qV{x:jOöO: :Zږ۞Ց_;>ƶga vY24 J)fIgEs80<{yTT֙a_2K#/:G;`>c ȪiFU q4B;l?|>f'千3D[{gk!+9po_w$+YX*^4LU^/o(LZʧw@|1q!ݏؿ*6@iGPg VB􂌒|RnD)W5SbCoDoi'!AߒV8 Řu\U:wh[A-rzv[z ΂s 01i ǿē:3N ]@ |0VR+ 4^N{Նt<>LN6"ld&IlΓ ->[-ٖ߱ݩm">+xUeڗ+J?P^!OVKˍ3 Eў˞dY,Z?4?+yka+}!`zlz"+SS 2/c4IAtA͍ -|D.81&'Wh+|R_Adm+(u84em,+Wξq?;m)*nbj''=C}21أUo-dUQCMeL\Yn=,"JHI{QٯT*LP~h=so[ 񟒞> endobj 180 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXK#2BFzBookMaker18DlFont180536871276 /FirstChar 44 /LastChar 254 /Widths [ 1000 0 0 0 0 0 999 0 0 1000 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 999 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 999 999 0 0 1000 0 0 0 999 1000 0 999 0 0 0 0 1000 999 1000 1000 1000 999 999 999 0 0 999 999 1000 1000 999 999 999 1000 1000 1000 999 ] /Encoding 181 0 R /FontDescriptor 182 0 R >> endobj 186 0 obj << /Type /Encoding /Differences [ 91 /G5B 92 /G5C 93 /G5D 119 /G77 184 /GB8 210 /GD2 219 /GDB 220 /GDC 225 /GE1 234 /GEA ] >> endobj 189 0 obj 2961 endobj 188 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 2961 >> stream xmV{tי;_9bCݔlӐlH 5pll #[_1I2,EcJbBN&4ͦ$v)W;oόf7w>3I0M pSe>ʚW_vE}]S {~~aA܂^yܔy!PV`nEy63o&ʛ,̜v!38~m~4MyG0C @f ӂ0G7ŒyKK-+W\RPPxnIҒe%K/_rŶo}L]&b6&1yM>ߤ ?H#FG 8G RV09">BO+]3[w#155; 5'T s9v*@d\K oKBGM8] Zj)YFtE( QQuT5 *v ȸp{DW%<,ހ@xBlq;e&iC}5HAh'hPA(JZqʼn{]Sjo`g辀@۸J0Z.S}K lu>pJvRSɋ@$qcmow슒0d/zD꣍c";ϊ`449߸5^=lk=v."y4T].#"ŵpΊ#Xf2h.Qz'oX`nn`4z6u$ 7pFw $ܰڻt'i]#F?8|VE7jډr/7}~@/^""7Gv7kvmៀyCR)HGކ̓3c6$1m3~QrPR]糀aiREi.vZ>͛v\=rA=ڙ{Kz-{nݿƷb[%f3;/ymo] 9tL@ΐA$⃨lM'1ys`t;]! ukx]4Is W2q:*5Z>i9F]WTyEs)U|no2V˩[bzyeh: 2qy'5Owh./?f`1vk aX1.14S̍ snu3DVp3XRӦ*#+9|VJS:87{ p7ɻ>PӐ&Y_#{b3 V3p]"Ǽ~}!0^mh t+3SɆhoVdy%N jIؗܕ,K]B+{|P8 EZpg]Ͱ;M)ƫii~6`vx8vM[1th7nG1{1faG^rz5ov@Kw$"P~t]ju2u3<^诘EDv'&-nz ~G1Z Q̶(O\ߍΪ(awQFq@x#y-b/c'Y5)D'q$>_g%+]V\T_ lY$ |Z /gWlCk;%Ca/]($h2AĦgW\}*} d=UgO,=#!]]X7Ĕh@ኘ/֓+hˍg_Qٴ[; Kgʹ"^t7eFx3?́{ğNv ho4- 2+z_.g>w-tv_w{O3xB>_//7q:vY Ѽ7]7:?c:ECX\Gy-!ק_(3 S/~3 q<7 e-{޼/>db#>DIaT̚qR0|I'W):c^5>N4:tD7}6]ͦʍ }·7xw\Os-ÃGU=^.h444kԷ/n9.bkm{NU灮?L,֌i7 =a帹b+4Dk,)0KTAmcIG4j;u`SXMZ>ِ}j7t=&,V4@vl mBH`2Dwcmܱ]Yy.TUNc`I%[gZU҆:с; z[/2nno[~r@}}UrNpB?iμ%'PwpMU`%%z {|h*#^#>IxS^/kأy/#K>жC)RMٜ } 9a#\P,k`Tqڬ-3 zx  <qٍm Zt:.'\fEpTs5@LcZ$ڏdP9?7uh]ef5"[iؙ pjlaSSPA 痁h_ߧ}ZtT kl͙GWP}#>lʾ;NpmZI|]zT."Ju<!Dy endstream endobj 187 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXL#2BFzBookMaker14DlFont140536871277 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 188 0 R >> endobj 185 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXL#2BFzBookMaker14DlFont140536871277 /FirstChar 91 /LastChar 234 /Widths [ 999 999 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 999 999 0 0 0 0 999 0 0 0 0 0 0 0 0 999 ] /Encoding 186 0 R /FontDescriptor 187 0 R >> endobj 191 0 obj << /Type /Encoding /Differences [ 38 /G26 39 /G27 76 /G4C 77 /G4D 81 /G51 83 /G53 108 /G6C 134 /G86 136 /G88 145 /G91 146 /G92 180 /GB4 212 /GD4 232 /GE8 249 /GF9 ] >> endobj 194 0 obj 4656 endobj 193 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 4656 >> stream x}X}Ty1d6Qшb?H𳈢"Ȋ ɲ02YX/W%" 6Ik[NimҞ9}}fM=,,̾{66q1Ķ5;VoOxv[Bmߡk_/~>q-^č?3:c/fL1gלsqs!/˔&({Jt呂A//}Ba;cxĵPb( aߧ}t }02qs7KHid냦[AB,'srAi\~b (Է՝kXuE(F SxYzjo&*:}{8l[-V X2z46j^w.]Wژ}NM+u/l AC7q9|T7'+BS{ `O0uz8R'PEH+esS!p,T>crEϾgςiZGQ|f`+r)'6Kπs퇚1h)c_s};{8y#9 lz22 :ߘ/9(t<1YtB2m D"NP34&e ДR0|մIa|B}9O+nM,wL[׬ov& HVrl;}.PhuW6t]з7&|@[jn?h| 9,ɂyCh_F+RHS6f?FoьH i|Al(+qU[&gA>W݌On@}6 yI\ 6HuBPn)a"AxI~9O ~(|BQ꛹؝!L#_E!@Εi!ZK չ =S&$riz^sҷ<1j= D7 w(O۫VPXHbhTUj0`%nа[5,{J~D|z+g`ß}ߡqEUn0G@,<컕z㾝gޏ VۭRua:K[ */*2G-60℆gx}Z/BP;ʟ7S-YΔr$ d93+jB E-T_ClQ ڧ4" Y]6Ɏ&qYJNQgM9H%4z9'_02o!+Y%[dJ%K>'w8/:bӍw]YJ3}g9{jKa;+ܕc?8,N؟_Zu=vc|bʞ2`[!=ԐM7,3#ͧZCVa}7깇9m{tvްWt܌HҜۂM_Q&y4)fUI%#vzF꒰^-bfyFSHPZԈs {xvK.lۄj3"Wu4?oP3Ϊjq4r5K! Y%dGI)=TmQF1^hߑoR4HwI4&g QMm||"SWG(ޑ.l L^ C+I2Sxhwxa$ݵIZ1ȝ5-࿰^.P r\NQ_&Q7W04Xn\܃a1Z)VO_SVЅI2hR?TXk9dL"wETFEPzMbS(':DW3Eƃik@пOPe ;i|-\kx;a^ /o֡I7' m[<_5 5)-%iY3*A*<2Lk} \t+r̵3dCN )H3 mˇH^s~ i7|{sC<^8 m'Z[/_=߭݉V=l7kAo˺@U_zWMCaV'370MI)-pЏ4qk𫚪 `3_gf@pϗG+MF1Vжzl5!^cP(jn nvD@磋e/~oi`8y}F0:=@Wç׃8сIgT8?* lw(%2-2_`q$nWr)szEWEY9L6w) Ә`x~OJ3JX3N59Ը#`snZB[acJۡ9pz5Tò$K3+R͘%$GvXD~&3ŝF A׶9 ^(FRҥ-ZtN8JdOC(e{s;Ȧ֐ ]D>@ Z BL>Q{rZյoR i7P6c/aÝ7vLZaGM_Ê!9*Tc8fkp?4fLz%qdv) 7$ Kv ~`pu6rwjJCXF~3L3p̦Y":6C>opɦ&x0(D[ ݂ҧ?*XDxT`>@Ӫ YD티BQAz*,bv%j 528,EmFն$ϣU|Ap{jeU3{3,(OiJ!՛*Qdi+^o S-W*` +ЧRj~ zbmњH -lUAZKUC;\;%z@Fo5*Z=fO 7fepTi' Cykp፶ g~'HxRfô1!}$I~S]ƄD_"W=w5Tr m4J֋ тԑh]y%ՆY1ar15%]YNM[V%JUX-C#pk`ڻ4pvEnj,GqFI'=#F*q@~10;ǵ_ڃ{aш67:H$y`|tf6:KOjm063U`^,i7syl~??rckstR?\]گC0IN1RhGV&C oZg{a29_s|7Qr'p9qgƨrQDW<_ cf!@I`:bژ·;NgG%֙ݖ lE(`%[xLvH$abLGc7 a= Zl?Ǯ˽Yz,>rZM(G%PU)F%h(UM1ĹeO􂾎E ,v;k\+nwc< ~Jp endstream endobj 192 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXM#2BFzBookMaker2DlFont20536871278 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 193 0 R >> endobj 190 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXM#2BFzBookMaker2DlFont20536871278 /FirstChar 38 /LastChar 249 /Widths [ 1000 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 999 0 0 0 1000 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 1000 0 0 0 0 0 0 0 0 1000 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 ] /Encoding 191 0 R /FontDescriptor 192 0 R >> endobj 196 0 obj << /Type /Encoding /Differences [ 41 /G29 45 /G2D 63 /G3F 64 /G40 65 /G41 66 /G42 67 /G43 68 /G44 69 /G45 70 /G46 71 /G47 72 /G48 73 /G49 74 /G4A 75 /G4B 76 /G4C 77 /G4D 78 /G4E 79 /G4F ] >> endobj 199 0 obj 5932 endobj 198 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 5932 >> stream xmY{|սUOE|ڋP k@B+`0A²!q yLNfv6ll kx4DhѦZVZ?vBOz{g?. ٝs~"Y,AyFʺk JKmsm_>/xqiIyO̚9{3F&XFi77CNJפĉ ߽܇ι|N󅻚m¸7w ܋Â0Iɂ <" tAH9 $ B ,łDէ)3&>8=5qFjYS&MM8?5qAjĔE8ӞI`aʢũiK>l/KZ,Ex-gi&4[K%d#scOBS˜zAF[npmn*ܱVKC ?-YeNIZ`RzR t'uRZ>,A+E +:-BJujP_NMĹBd?#Ԧn^m~+eLZUEUoi] #AjE3D٨dS( &T_EUR}]AKLݸ`:K"bCnpv˪0%Y*\Z`>LIarY2 vm愑d4:.Mϧ)?<ygvǞ+|wl_`$'ݙ MeP _CY%Fk :NA )FëS E-!0=~^ؕ۱>>ʻp [| Q'YCtz03nd{Rìߓr*3Op -gl`缛*fa=xA>#7ל9r#5B $jZDQ7:6uM:TC }=b9m˵mg5Ѝ=u[5;vT@SGCuSuu= ˑ8rvy6:-׼P4`m3o1r$t5a"ʋwW&J4"wqP.N\^_I7I c4 ${{90|XwypV/3U[+HeP*FK.oq[#-cu|N4:짝`'vShVLe)lW,$RrTwRko"bZ8|D>̇ ZLa (|GٲnYp=H;x2Ðհ=^ľo(`t{X뢰{3JMeKyFUB[hujI m|I)pI*zƒCTJi=^[xȪS F/adY&#oI%djlBBC,i`M+?;a>pM"QwE*AՌ`;wоv$(BNzY;CLu]^j6ɳ!>N3vūf8\z=w|&q(`vG.\~]6Yq FS k Q^T&FԨڋ, e3G;*Ve_7Xň-6}M6<8$nP>$~Kkt:k I7jT /$,jK1Em'MbʫPUKvW)wɼ=NJ*vsEsAmփC/zWaZi  xmJ 8w'8_\Yr1M@ƠϏ 0("|2  C8,~ ;Pd=:J=I,a$*gz//0lRǞJcwqOAlg׎6ӿ g\|a&\:/ =w2~H=f+KAhm|{`0#Vl㆘vv9˙Jzi hT 1,*ߊll.;C;rP;v&ɫ܅\]g$ 7TrA|7_Cvh>-}o1o$_ظg]~>y_Q=OJ6RvM\!=ߟ]s-b?Z0ͱZ4yZJ ]DlnAc?y2/hz*^xְ O>xB|=> lbGvAuiMs!s‰/΂9.ż/| ־Gl|YN?#@uhumTpUHk W¤6yE_#SI?k=>r N!RLFP=I5uD3xC kyp;Tv*Հ o[@ȿOy|ݸl))NJ`;9Y9y!n h&Iyj fQF .>bCa׈ بG,U7pʖ/%M Ox=9+Ѡ7`\nTf/oe3xb q;21.6(Ç? #MijR^!uJ?Ndvt1_VbIK`Ih{о-|xd-ZQ+z(.ZK+0zCNOE*a=K\"%Ȩ̛>"}hK]$UBJ|j/pt$^J^ߙ%Sn^ϫ>H¯P/`3IEnO,ZlkUn&M͂%Y鐙 {fo%BWָ:wӿ7;7ּB3^z2g!d,]Uv Uh髑syF \}̈́9?2s6,m`^{C3ǀg'PQG`-G?ƀgGLaMހuZ,(U;ݢZ1\%ްLL=jas%Թb[h!$Qt 6Ț:6{Sj>3 ,kEsFЖt{p>n۸;%P(A\Ja;1dBxP=Ÿ 99ɡy Eڍ:M^lCCu昣9̧RnZ.4ͳiV|3+ ݨ+ܾ@pA;e*AVI= pC# 6# t P(= mD&K0%op*=`#p SgBM.uanP-pUuXm(Lr]MBuP@seȃ/'<x "%S$7tU\wQچ:;?L Π+c =-FgAm*B9'|$Ńkv6i2FY=P9ؐ TviGZ_>GL-GFD%zI{1ӈݻkvuPY*/ 5cf8\ B>S!_ Hk)LG)A[nUҤ)F>Ճjtm vcN-һNE~Uk+z=`*tM:~O 9%|߄_wD^葮C$Z(0Ne?V>R# ϲJ7(ꃕcZ,[Vv*Г$ƚn&,4%4Gupߡ.\:q{@'ӳaйʓ_l5|@aR3ӓq$[mYn]Fe9f*1Zѵ#\ l!L:}NH{kfF6:% B$£&aVSOFr@oC=`ЉVϓ w;.dSC-{b=ys3*/1%_٫@\w1{adDO<6BZX#- vB&c_MXJF~,a~+*MI?ݧq;^\w WvQ.Dw'qH%hئA-NdgHq2GD n~j뻰.Ha7N*!W;;mْ眯,ݎ&MeqS*h P// -!,Iʜ髙*eatWDsdہZF7^B:ɤ+`7u$_/P $7ի2`.b9xpmZFsu WXLE;Gh ?M0J9}YYdAjz)}1 Ӗ+nT]h9^t8̎Nds|.^X@U7={(&\Rq0#E Up-QEK+Ĵ7dwZ⇆4ox8.|i, viq凅*~֬}ٟٔQ5ot&/Ȋng]Me,zr͆7%4vIK=EX]憡 Z>F?iq)U;[d J' lރH6R}shi̹ː bz/X$j1{݈[6aO$4y.ԴUT•Ko'0h$jf)g6gj}tBxO i&rx9rxžrw@ uǎެ~͉]f2|i$Կ9b#SOt3?pbxE&D0mЗ8Rdb= endstream endobj 197 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXN#2BFzBookMaker19DlFont190536871279 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 198 0 R >> endobj 195 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXN#2BFzBookMaker19DlFont190536871279 /FirstChar 41 /LastChar 79 /Widths [ 1000 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 1000 1000 1000 1000 1000 1000 1000 999 999 999 1000 1000 1000 1000 1000 1000 ] /Encoding 196 0 R /FontDescriptor 197 0 R >> endobj 201 0 obj 293088 endobj 200 0 obj << /Type /XObject /Subtype /Image /Name /Im12 /Width 1838 /Height 2193 /BitsPerComponent 8 /ColorSpace /DeviceGray /Decode [ 0 1 ] /Filter /DCTDecode /Length 293088 >> stream JFIFC     "#()%$%%!'+,,-/4443.4444444444   [!1AQa"q2B#R3br$4CS%DT5cs& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjz .?I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%$hߴg3kY.7Ҹo*$I$I$I$I$C7D7wMȇK'2_ߡ~M9ӡnT%uS9}ARwh /x.N]ϧclczed;ָcY;f_"Uռ\vgu家+g;Oij;V_Kr#7vDds i ܬET;Z!:I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%~}2>/ wZYZAW8z#|/ѿA_+⎞"W?G wO߮Fw^ɘRI$I$I$I$,yo -m鰻3&*k8?<~J|/OyҷOoW>=/Ijs\r?[8ؾ8xiߋS};?A=}\^0)j=o'+}`o?"Wxoo6U^2<V'}ew}_+U.;KjI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%n^ڜ[@ko^Z_d9Ǐmw]mOy.!\͌W' vSOYmۜy[t$I$I$I&y?uxk .r3~wJ- mTr!Opz>l>ύ,s]Kkglgo-Z4v :j kG-J+!I$I$I$*U\q?%Ig]/~cw]G!;gkqdY*v۲$x*=7xXB7u~].6$5wUHUJ/s݃#) ܫ>}W2_u|D}$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/ǸLbm\?٬?j}>7{xx_d,`xv2ZqC&|_q~bvSgf?lާ8 sòLk9pa{_g?vx9q&ӎ1>wݻS?(yV+,c|I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/دpp#~:j+5#O+}Pn3?Gaw AT[?9ޅvR&?"gs~z}OpDobgLI$I$xöw~=W۹cۿ%>g"z>6=Z? iu86юmh1I$I$I$I$I$I$I$I$ITxˠ1;Y,ǾiUٜ:}J =Էl;U,d V^_~>// үv+_eC%$h!Uq;qmeo]_~2^u?%ҤI$I$I$I$I$I$I$I$I$I$I$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^Y~f $kWW -}'+a$I$I%]ӾwJ]lˬ_O.݇[e*I$I$I$I$I$I$I$I$I$I$uc;bhCa{u0P]X8~8xv$kz/6k>Q3+3cZ=6hUq>ʽ[s?it~7xx:G(Zc/oy]?Y].lk.ho7zonRK̞%i$I$I$I$I$I$I$I$I$I$I$ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c>퓃e$ \79u~wLI$I${sW~UX}sz"ɟYxkz?WHG"$I$I$I$I$I$I$I$I$C7D̏UnW p?}wVs%LJ?n]H ʓy>O,-'x88}_~>E88?em$K?IGAה3}/g]29Jͮ=?zݧcy-?|l%6G rXwh l  ~"|\[Xw]:I$I$I$I$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%=K3+{_y<<\:H^I foq_?aud?㻉I$I$Ix7OwO]gfS2˘k~s<s~=NrxxG>+R> ~WG #$I$I$I$I$I$I$I$I dz[g m. ?oz[w/V?֮gOW??|ͲpqFO/|Yz~pF|gڿ%owA}Wz|\:GwϾ|7 0t?u$?{qoKbay3*dž\sO쬫o޿Gry^;㘎o7/JͰ[g~?U\Żx{%޵ui$I$I$I$I$I$I$I$I$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?w[ {JqgW?+a$I$IQ̳ցvwM2'u]?WQۭ9dzL|= W{֙<;S;8 <<u&v.(euJD|V>7/wg7]϶͟GWW,4N7+љ2[' K6Ov /k֞?g|԰;&w}$u.Ýȳ#,9<.dh._l,_]%̟*һe~WiGM%kޡM׳ kColT__ qۀ\Kw_]Mk}֧h=ݱuϱk=~?gp >m?W ?8!he<N,d#/Ͻ}~89D⹮vn5t2#eݛ`{Cq=.lѿ\wЗz?%@R! I$I$I$I$I$I$I$I$I$I$m/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Yh>apӇLN"IW`##'+e$I$Irj-@|u+oh{9ʼ:Uʛ.aK *3^vZ,Omo Пf{lc][tz-:b샗lK?iWݷSV^Oig RjX?-ʏ~Icftle}[Us~VXdgiiѝߜ9oZ;6d?&d6>&ۯWVe6gSQ\ݽpw,~U>_/xtqY]0Nqng||t~gj k;~;g¦UUL F^<ى@YO,Q"+~P$byljﱵʳ$< x'|>|[ot}omN:#K20Y^3kp 䲯Qh nv*3i6hgxϮAsޛ^^6O;|5'7Qs> 6f&[8[I$I$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%+XlV/QI$sÌ\7矰_l$I$I/$vi1*35e_kk뇒$/Q]KwvpO=Ǽdz|-~/ixe0z\ʛSzI$\g۲8I=O,o>Ki,Cide}^狱 +e{9{i k{wq=*<@u Ae~οh#3 oO*?(v_JFl}cN.ohw+DoW7Bm蹿gȻav[ym>bZ޿Pki#T;ڌ Wp?mצ! esu<*-2)>w4p}NX}eFksK}%{n?ロ8=9Vx`׺ʢMq+/r;}smplta{۲}csO|o1Ac$tI$CwW@YO,U$?W)-?3jm3)cdo3ڿu2[-|9^g3f_o>2|_=v+;]}̻uuĆsم__o_gqꪻmw~`m{߰Gt^il~om}RqG/2KXY?UQrjů]w_]vjywV zK3pqXes GI$I$I$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$`W.ßhȽI$U;>_pjȿ}'[)$I$Kvwݾⷃ?~ =Q[]U0=_h#}*.\G9sw?_q~Hn}>_ϗ;)?p?誖]Et4/iox?\ST-pKKZMEvsht}C?v?ϋq$L%ؾʾ;EZ6 N.} cEj}e|k0پhWY.Gae gm]O?js~^҉?YzI$I$Cx W@YO,U$7?d=/xܿW?ؽJ8' }aY?Onj\w}et}߃wG{?q~lǚc;jg|?})W{ec?L:b}||;Kp}~ov?Ưvz ȻG|+|Nx Je'яV}{?>kt*q I$I$I$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$`W.1:x~E $UF_.wq?[)$I$KK|W}/?oacˀK?u?c{=/zq?.}=69ϣb<8.O27 i2겞֘hȆC/Y<\FW~}44WOۯG!ʿ}׸+*ɿ`8Z7#.͆Bj;nE0`=B~ߴx^x#´f&/w_;?Vَ;57!\->kg؏o/vYf5<6:.}M | hTe^.J_͟{O;*?ڞs%rgJop7?W}Ke@;:w?i{Օ7Iῴ_Tm+xJ`q޼*G/v״veޭx@ |L}"| ٬ow1=`w:OSq\j[{ euC#%[I$I$1 ?势Sc|$s[m- \?zݭ}#Ƃ?jc/{nK~g4?C[n^?.>5ϐ}N+\+5xƷ (?_R}f8-!y?~,^gUW4V׽N`kn;-77x]证g"}]cz5|<-x_DI$I$I$I$I$I$I$I$m/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Y p?$H97ĮG.wq?[)$I$YmtT~BgO/x[#Nt;X\|[vqzs^lwk&[EjϵvK[$grL eݙc\Q?qot&C8}_VY$cb< E-<;p*e ;rEջnWWasp~OϲwNe8 Rwb;?mt6v/i=4tMuFBhLASIbiټ? ~ݱLjDVɢp{޵{vvWwgq_.?^?tI$Ix?X5;/v7{I,f>-}p4G#zofu?xzٟ>O~#WU9?h7½1%ʛ/7]b\}??=6YuP=ax`dzGzd?ڰ1]˵`Y~E\2$\ڬl  n~E7>.1S =؏ _N矐1`o 7\/nv`zS˅^g[UY /A5/;v[k;֯ o;;Oz{#ƿI$I$K'W;j_b̫{kwJ\ө?Oi=UL/sp5{iM$I$^<,*dNݍ^K3Sb]8^aOm osH:EcZY w7qe u[SZwؒU{ĺ9Wva H9M9q=sHk~\N^cRBLO#&eu}A/CMBwk;f3 }pil9s{w9( ;o'fXز'[_c?ͼWW"{Wf7uǢ׷8+m$I$I$I$I$I$I$I$IagVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?? gRI%[CW ]g/I$I%w}o^O۩msھ5Xjrf%dϻ#6 rJvr~xˇɊۋڌzzW[Wi[ 7_.?w^I$?^5izGoa;Ƭߵ9rXޅ>SqUַe<~]>K}^[vLGcz/;}ï3WnI$I$~9?/  ;j'jM֯x߳XyԵ?i=UO,s}5{\ISI$I$j ?势Sc|$n7ݏ]u3vY5kk1AoR+Sjvz};=Rm{qnN^ϴ?k;l]%3,O2[&? .~1?@#ˋF3׿.}᭕/wk;nmvĖ5ӣ?h 4|>׏F;X>]ﲽVEv\\"> .fӗ>ǏH"/Wpv k8?F G[}q_h˫#4 >wpǻ%7dK.}} z| dbs3⎒I$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%޸C1| ԒI$p4윾K!O~VI$I$L +?ǭ?d=;7wb%}8p֯e8ZsXYSZO|>_C~_is ^S;~go$I$fb[Bg.vF[>/[O8xNZ/`G. SH#ȏ||R[ѽU6 VV}o}o{[c_($p_RՋKTI$I%Gx_-?p֭Otn޵{V~vzkxlG_1~\ɏkc5{:I$I$Cw+, }Ӳ67{~^Mkjlļl}9_S'yG{wۻ4ThZva|nsl(c&??Ņο^Y:pgobW+;}õ85ha^~=!L}'yi[*el3zy_gWGk<<\m@vXt,&=:g ?mB<;obcɍykW{e6V8 0 ڲluVPmcZ+f~+C;;\x7+f>7xLq1uݫڸ0adDVB6u5b+ǵgkm?wzvdO !)%yM$q|JI$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%ap3ȽE$U;>_pj}'[ $I$ 86;*{yOǮXi[9=&D;_3ᇏZi$I/4P8v?x}űݏO^[} ҇Y1 6}߅OR\~q?Ń6;^/}0I$I$Z8e~ mJ{%޵{6(?;^w5*s>i=Ul/sp5{ZASI$I$?k1 ??e)v=2O/]K>RUZXI* ܿO<מ}8y/Fgqk@v+$I$I$I$I$I$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?Z3$JqgW_l$I$IgwY{|~a2OӋg^!!}~_<W7y^}ALRQgLjV{.sM^@g~dYxi&MsO+1>׮{]@+*_c1]S_E$I$I$>֞G߅oO[GbƯ`1k?V??M_iW:j*I$I$c^/gjy"W\(em^>wj1{I]I$߿w[>î6='u8k?Y~}Vg7lgjΉ;V[]ܷo MWپM]Êq/cfa uK;j/^aoǾC+L ۷~wQ˳@~.- i?㗡b1iRI$um0J. g>xxtQ?4]9?f3jWYbdUVq=ڜno'/T0 =)<Q$I$I%O~}iogj{|WKyҭ?#ƹ߾9׮sc>wοW5$I$^k/R=>U=ߌ2p6ϨÿR치ݣfұ y|sŻY d5{u}K-}]Wstbo6I$I$I$I$I$I$IagVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?? -~Ei$cq~ ƶC?|^9<"r;*{gfWs KYe;"e?"i@3ѿ7'*GνKcAd M6ձ*!;;_dh~?mI/~ۼNQz?a ZSkr9Y?.[/˹&|I$w g=/In?u#5f_ ñ#+!aC/KzxCa=lWrlI$I$Xx{Q'xgxw?Nר?kZ_0߉52ONW$I$^!;},*}8;aJB[ۮኮאvc1 ʩeUH۩s<x]&Gݱ]jI$뢇1mn>vUVMYJYݎ}WP xϲ.oȻׅnAKco]s`|7.3j>_tI$I`]Տ5YBb <A]4ᖘb~EI$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$~^I!0YKy㎆Q;?/?,~E+UڌLǽIay@;r;ャkag?m[wr- n0\6 xacP\x>+V%y_kr@_핯f%e$gkO~2w2^wWKb"uJcwoOx'I$\vQk9}/<'/\=Xnk OoW\z+we{XW[~S^- 7U78qWFI$I$X8P'xgho#jeag'z+oƵMgx-Ǫa9׮kdӦ{ I$I$^!;,*bb3ec }f7m$pz dC.έ`/XT}K%f,E{\ݧ}SMu5$Js~%_6t?5a3=zqGvL<^\ߴw{ ?ścnӗ$I$U;NoEޮ ;1^k➈$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%OpO)5}#oI%_;c^c1}_8Ww;1a `w\7,zќߧ DϿb)˥<-v}k{=_t;TqvM~w|]-Y}r\e79zOCDn'1ԴX&}Jף]ƶ~Z:5n}Qq)zXvxptD,ߴn9_w>-%_aGˤI$^k/E_85}O8rx?/ibՏDDKs{\Ҟ|7v'KN3~`V[E5p-vGɜQ/ k~'t ~su'@8ū8bWI$I$Ic=/ {֮W_)1z3@ziz7/ -sٟpM^)DI$I$eWZ֧z~N+[}3Ь>F7ڸ=FDyG%U]:̓]=)l>ڀh׉ _?N-In;Z%W⊏LG@$Pq6]cjsskfs`mB1{,[ pq|yJٻ-GkgÛ@_ q9ngs݆ͥ/+Nml{}M՗?C7/rȰtL1i$I$̌^u؋t}_ޕwzVI$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iq{].?c]2I$wYOj0^*qp̮o7dx)>۲fi\wWaV=;}lKfc⯤I$?jjm\>x}olVObq.s?xq~uݗΗ]KI|ٙʯ~E`͋W|I$I*]Wg1Ǐh ;'8?6#]*=?lGw$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%w; mK[ss7Y7}S[e%W;WOgI^ڭׇm_e5ĖI$I$I$I,~/j]P^G0;rqзY;tPnMŶ8g]nRKĞ%(5W|2^֎Xhn#'Ďn׋F_7!TU~ECk=a]ڲF x| ?K{=. 絢N+3gw cdTlOE߳;7G߶_x=# O[|( ozW:Ś?|g^܇oxamĤz7lc0k+TN/ҪɾhSWhs_i<{cdF@ʱ0;ad]c]G+vqok?J?us~c-OG'ݳedzw.; ~?_λxk}4a_<_F}^Z#g$I$I,>e#/닾?WE+ ~ a8ޯ9V=gJoUۋ}s\3˸_ޚ($I$H[@k*=`_}}}p~񇉏o9O9{NyǾ~ ߪ|nsVCaͭ~wo-k?/7|換^K|둉gU誼wqV [`w,g[W5XMǫ1e@ר}cGl?3½Q%eq=Ο~E`͋W|I$Wsۧ5#.?3Zo 忴*cm;Cr~vٲO?|}6?lI$I$I$I$I$I$m/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$=ڪg.?/'-яe!i zڧ8A>Q{uXwX= %O;eŮr1-xk2+{F#I$I$KauC?eH_z٫jo g%4 v%n58|'h⼗;D`evnr#NvmgpέKinGgY E!Tuy*x=}ߺ7;gm>iwlWDZi[YX,ܚ`s[Twxs?myn۟1̥{j=[X֒ÝI ӻiM8k%~NgPwcm0{fP?/12>ԴXw_e3{=_z&`it?jW&?J?!Xa;OLyPޅ{ZʜG@|{_r+crLue0 h}DzOO SWRI$I$Oگ+߅7j?QFn(3jyp?gqO,@_?O:j $I%!Tt핷53q3׍ |CeU:DUc)s@贻p8͌ .?ΪIx2/6~R_Zg,4qmogqaw*˦ǾZׂ\H+_۩}c^+orH,O99g2*}8k^ >UY 28܇ؽDZbxɇk^Coo79{zKh~w|*wNGE|cG x/U_m>7_pw'3֕x )k< 2[]{d{6F&#_Ka|M0Wk~FS]KMf\^ݙUSxg._O߫#z^.^pܹ)vi$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Cȹr }V_x+o;{$~]h;q;&V'p罅Ot$I$I$໕N=+qg;^7yǵϮȟ>KoyVMX.g>#ol88n~ڱ{_ /kڿ_V%{W SoڌcӻU;r?3渞e Ec}da~M_kȺC˪˳sUib߱-z?b;M?=yx9_@]>ӑ_6Is8{[}?/1uoI$I%q}/ |ϸɿWG+.ЧxSyө?Oi=Ul/sp5{YM$/n;8q#V{+1K_Ӡ~pqjmϫU*p.]wOYeou@R2\ԏwj8OW޾ӽ2Ɯ+רNץ-"),g<$G&R_ς{.xz,gqsWRX]SXA`w|O1Jr]sx.g]?ay>O[ ivo _+nRa]uo v`ϫo 3>vr?iq?i0jY<DI$<[KtYyLϋ|43g۞!W}y=Y07Cr0;M5~[} zu~_C.Oq³82Ȟz2n,p22 CfYׯUO} yw_ϯfS{v",; mf+UOs?K"ϳivYs?7, [x?1p>o"?6u5og2*lf}K}]8S1^( ²>{yߓ7ovw~_s|$ڗZmT~2U.3K4FCvh-.eX'xԽ w)B%fy=ʟ~E`͋;jK5}=WensnηX=܊2FUGYͷ~oV+wYm8:y9;ڮ2utM0QY⯱wϴn+2&x˰\^ņ|ws͟ Ibh٬Ɵ>Xp[ 5EI$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I!e?Ź<,qwf$^p':)WY>q7˵I(mu Eyܞ.Wto9u  N=~S I$I$I$^7lw+Cښ"I$I$V-is~EmG?7e?7ӷv=-jɻQYÜ1*Y^2,qXOvSgyoh{M|vﶕcXkl~۾]n'q{x9]~q~w V~Q/_Wx81uDwoܮ}leo0w;dO?x}?o]:}OgqpI$I$~T/`0|{"cSb#D~E_#o,ݛdvjwqi|jkgpcD~33[+.oyW":[gOʠ_{=G;{ܮ[?1D]> c=ӭKN~M\8Mp]'a{L2<2wW]-/UᏍS}߼O!^;bw+Gsyy-w7#WHousc'ok;,VN{ 7k8=gKob2ي,?8ڼu}˫UKx8[Q`\Wf/ܩ](q/@)G~ODL}h0KWJܟqYs1n5gpa5?d_~ې驼r8½ks>Ls[K^1{;Y nVڮK{|mKٰ}8W_ݻo\Vwfx2Oz6An/q'^{xߑe6Z2k_A̓mWxPoQXk㻗+Ue$I$I$I$I$I$IagVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^?Opgдr ^qrq.<_ޕ=oWo -$ qmn#__֩?[XuCEm#5[I$I$I$^??ͮB-P=.ܯߴrKoߴ]J_=w.]i\Ai[`eȫ|M^!1~]l->ljjd~3maF~ڷkl_g!?W"cZ4 䳻5, ;^Gށwy#ȷ#{_y^>yyzji#_$j $}|?kT??]!֯$7ߵگ%&w5 EMDwZ1;?ql};&bz-2ܰeGmj_`j?~Gz\>/jv+X̹iixUaZ_e3p-5w<,xX/6@U>M6Y`cbOK]1+i4V:\/oOe$?#?~w:YI$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.#_3+ӎ;Oϳr8㏃\?>kI.c踿9~5WEg_cqvkz4p$I$I$ Nh_h{><9Wgt~Շz^ OkOħę>J08%c*uewqf/"?};~Gbx/]gl{]> I$?ڞ{2}__B|ໟo,7=IZ}|{Lg-I$IxpW2Mp^G^C%1RAݾ<1X~nǍz\~Z&\OUk=85n޿|85ǧ>{s剌y.$I$I%?/ ~?ɿWG+l?~Nשw-9ޯ8KgY⇸~:.5lMu\zq>jI$͕}{gӅbU'Ӱ;%J>{/xcҟ.Wix|z]7o1;-n/w+)$I!_O^i/h2/PI$?_}ʣ Ǿz]""?m/ǯ8"|<.JJd?{Kٕ2|%/Hez Z1&9-Ss(;"g\qQi{ .ϵfd_.˵JqUsWʹܫ'-\!}'!Ua3 {X\ pvoy.eJ?c~ne٘^RY=dF/lj/?f>NWOxʷ:7L^`w5ONI$I$Id2^0Z=ZOVƻD?5fˌG=7DLnio?V?~>_o"g+~Wڞn_Og- s}|37w{,!o-3/=K&#[T8J"I$I$I$w+tLm~{W$J^EF ˿&?W_ >ocyaRζhEkWwV6]ܳ>Q}uґU?f._߭_ݣgrMw0?.{_ $w&6{\$_u8Տڪ,2I$I$I$I$I$I$m/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I) aܺȮǟN~^Sx"_.:;k؏uʳ\.8UWIvJ"3p;mcdW}en~7 \{ζ>~sW~J/AvvL;&|S??mQ?h{Ԇq,<\{쬛{n{e8;b:waYk1{F{xS{ri/?4o02EL۝l'\'J7ZܳE~w[U{p3;NȔf N=q*f=*shTʶP~mE{8Z P$O_RU`t]a]wOl4a%<~c/iBI$I$" S+,dzrh{Our_Mn\WotvL^݆ dO5;J݃dNMoh_2?"W{aognŵ[,>+ 6/K"'YU}î:RZ+f\LlX+>Z| 癋P({Wg.C_cXŧ}j5ޔ_1?eA_O av O_I$I$Ib}g^G]G Jw^O??l$~/?+m$;~MV[ 'GuB1;Rgrwaycr?9ې;oq9w5&~9E& j*o!TXe$I$+2q0^EoFo uTeUu17o5XVwoq;uw #,kmc I$3##~/=Iھ8zzpYG?HºV|¹p32Z|[o`dqVDIJ. 5Rs] RWO~-}+T ʳ}}o޲٬2ZE}>'}A`jˢ@!xx\`}_C=g;/Qs,5\cϐj;]]\Rb?ez'=;(_@#]2wl|V\&<0sIG#CKh`?m #: w=irv^ёG_クb}?YuUi_jDǒG_]6ykS9ooڈ#GgcOtCZG`r\G>vE .۝*fQ>_ҠǔϯM kBӐ*CV ג*z C'7v̹ײp~{m9t {\`ຄI$I$I$I%}4P~gd_~K416|5%e7> /'%V_ ZXs1u]}^_Td1v.|q+$I$I,GxWۡ?r?֮VW ӿb1~Evֿ0x}&wq?[ $I$wn.\/|ijb6HsK}/76sXpZTIa}:q kr?p_pGn]opCeDw }Ye嬟*鱭o`Ͽ}/c`wq&11BwqJI% ^%1>e1O/-a$-v`qo.N]Me9^Ʒ yttgkr2{x{pY}ZWM~dwY2o:`>K7.B/yIS6ۖXf]}:Zk/+콾[-<|1I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/0eai2_pyV} g\4wuV g;f&-xyc %yjo.t/zlp-=C~xv\:;m8X(+fWk2~s0,{}". x-ߴbR5f߶7 hgeGs=[2=Y\+}&kYyϊBNy, q13I݇ UGoͿ~?vT?'hݑf9e1um$~Ctjo7a65m&}htj'tO)6Ϣ {wZmzUmݛ|7*f'SoUm3[;o iX l [1Ke$I$I$I$I%y wcZ|<Opx.]jJuǨ96uuo#},0mrms#ӧ.q1z8z%f#2xvGi$I$I$>.?^q֮XV/Nr?"oPgټc:/%_l$I$Kk씑?[ŧ w]i䳻ux{I.{?_pᮟtMo{, SW+/į8}C_χ/ZZo:sV_aMbo itTdف醞?ZxVoh=]y|TXOQ tI%>` 2,G+(q-#{{6+9gvĮ3S/;/guo\wr#Xnx(->+#6ߵʡlkJE<gqfS ]_Gwb{7~]I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I% :/.eL/`QW6ʱ)Ӈ5z6xyigga̬r,#ח`_*=i~x]=}̏;NjsRn6|jo ?FދUw}e0 }zx]cG]M Ť{:0xǾGq50[:](&v}IkV&.~C(\v^f]yk2,k|{~S/}u:[ݻwxAuˢvf\gՋMopVhw9^Q tI#(cӰI$I$Xk㽗߷ɟWC- ]W/:?Le{ɟߕI$I.WcІz6+8zǗ+}314uwNamؘ}+dz޷c8 흧[[٩+LazB#jZ߀RI%f1MןVF!,OxW$I%x}qojr?xk >lǯ!8hq+үoٛ)`h"8G/ W[K} Y+=wpQ4_WvKm=-sr* ;oyp>wڻb5^22M-=x9č1ښ"I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$N2MU҃mY˼MwOb{oG仾1cb>?T>2>߅]}\kGo2?'g52OK̟w3XGcȟO+9J]w+xrIUo[og;͜8o_?ge#luk8YٝXU¶ꭡt9+K|gm[~}fSg~V~{o]H,+aITI$ŧB{c{mL+IB綺i=<^F]}=Fe'P<eme?o`lLzi5Gbllv֯fI$I$Ic}1s/K/ rGg'v?{k?#/75f/%_l$I$K,s5!znp^O B]%պ`kU:I$I.KzV-ǡx^js?I^XI.gad1Gc;?qgti8xg{j?nu;~h> ~Vcr%ʵ\gSbw|{8&yh.MdžHXuv~eci8=nϱio-/Qsuޕsi | 0ЦI$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$s_|βpqF|+W6\/aQvqzNQ'_Gas_?U->1Sj^޿EX?f8?_{o_V~E{پ~ϯG5$I$ajoo#Yf{D~4?$].V??ş -sI}f߽pEG q8ICwx[oo0'_EWi{̟oH)jp# RL|quU{e?r_u{}jZDUq}v+;7VecsG9 ;$*-#Acu>jUy$KOtǹM%n7o>O8^#4;7_[ԜVxc޺;`WྂI$I$Is+_c{<|>֯sEz|]fez/x9S/1z+¹T~%rxlLe{/I$I%}2o޹r8GkaZ.?;vޮ,}hI$~?\6v\e?W 7߳gx">3丢>ܣW]gogO3r؇z~.SoGxxG9 ş}v~OZGeu-I$I$I$I$I$I$I$m/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Y3'_:Kϴ̆zl'-سrYEudqֆG#*w ?u U?f{%`sk?vn^.Im0ZǸ.gcs+?kۋ@j߈Ijd5Thw0WT7@*lYֻ7_uY_k~32?~h،{e1?ݻ4h>кfJI$I$hUlEV?f{#v@߳v;ROJN!u-8z?G#?z-?lYd-??Ecca<#uyj wڎW\Lc?i\ab6xF}V^?Wog_ jY'>~ޫw3[ICYXűqqGS[G_eW;9ٮtOj_?;OmebwW'f:~x6κI Yۙzl?۾!28Q~}4*̘%kNVW.ܹ:/TI%1RkYd:ξU~WiS(c,.?;Y&ӷ/^c 50@.㙏;{בQn{35+~x%޻v_Wmsg]K;M18W1ݿ|/{=no)-߿lAshw<2|=?V']2Z,oÁ_wO}W} =vmXl7G;+E.^g8㵍C /%_l$I$K'%5݂#5k)QǨPI>kgvUw;HO I$I%Sacfpz^YAUC!uen`qTI$G969W}]Eo߶~ncn,հj۰fE< 68lfMnwSۗ#/O>__b>{Yf7'߮5$I$I$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ip2s'OQ>vLǍ}uZ9Én'MQ(z;6Z%R {sĤX[#LbK?i /vÁOʠޡj > v=enwU_f#ۭia7G[/ެq~ATVV7%J"-^m=>q]hwV13q[;]}_SO(}#u^Z}Dqvwaw g+[jGvkQFf##"fa8rj'1K I& bTu0B 8ta~7Qwbnf)Hv>%>nULkNgbw8;f?,GtNC[ W;Db_=&w.=Gy.>7?zGd}nS8rb{p395a's+6^?pǽO v? FUww. ƖS2k~UV4ix2o񍑉kk.k'Hudȱ΅Qۉ~NgѭYe~[$.Zũq,sBVf-·3!H [?gv]A:>kInOsǐcz.Wq`g 9/~g꘎'j%yhaa >aOD9^|x8ka[9#kv<{mmo).{xmؽ#E>Ju}wC6cwۼ}vwkԴPMu|\7'n﫻Zn,f/s2Ҙ?Gm͟^=ґڭ4Z|B_[]B+``OoO??f /%_lI$K7Co+f7';nWj!?خqϢ$M j黧~O|jl=*;LVI$߶ٞg$].oBjI$_rKdg/c 2p66&v3 eٸqXC2/"xbe!׼[Qa#Q+'lfSjFt8cQ-"r J,}C'oϵ;s3lR=cw\SZwA$I(s;^E.d>C}ϸ]n>K]!8g^>]\u7"8OZ!ܨh]Kݣ"s7xt_a>W ƾ>2;jw/=vU]O.<@p\wk$9t߾fl{sѓϗ>'nɣ%Qjkx}.gQq!zOC϶v~^+AeOڜʲ{mylF~ WתXo}O¡,܄^+mQ^=w=ʮ%֖9ߝ?\Cix?׳Iw-/{6#*uĶy9?Pgmt 7cN]/a]Z/.<}/h-4|9ΕIB4X?Wϳ/%?+e$I$U;3 aNמ}·V:fc?\dKni YovOvq.>) |WьcQRI$}}),8wgtb~FjI$ulͭ$Wx|^×?}~zӏzI$I$I$I$I$I$I$I$m/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$kw=?|n]#?gO+{wgsI]_g;Xȴx,#9tсW;]M~%.l5ǚ鲾vP[NO>":|-uA:DePwaWYù9Tlx;hWl4O?jne}ͱIVC2fOcK& 6P7e?iWbm_C[K?#n~#nO._ܼG'n ~v^o[K/v|_O#:OT)˰\-;MgևkM1:k;#ufE}.Quݱm[-2;>._ocUK{Y9Ժ8l0WlI$,lO'7} v1@TI%_pl3j(.w[O_wɡޣZ2u޲{X;$Ic}_? :]PEac]^Ej[y?J_l ?emI$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Is*[=-V]8~}}<^+;S^McCZ'C/Z8nk6S}Qȯ?-iv67?uƪqT(_BS@ڿR=5g߁R1j??tl{+k#mk_pc pan]7t/dώKۺOteo03syȰg7z~*)2U Q8x_B~V8'~g񩪅6mX,#CO63tWPn>; 27sLjWn3Ǭ~hTqꭼP>J(͓SI*lsv<ſtYdf{3 8jrRI$'}")7W},soρ]ks;K1,kphVȰ?Vw'q?Ⲛr|zobc^]ub1tߊ>v;g{T 9/=6qA3>+sXnu9%8u ȿTl̵6q1]#XN=dG6m5g~:-8V}ǧ̓yGϢ&GWxv|J.pv²H?Ga;a"O@v|*6.#e齱}I$I$I$J6^c9?㱍C #%^C;I$I%}氹ߣǙ\[[u\G7,_Eub{?ho|zUMY{Sv[UĒI%l{=.3`{g-̛,; Ľ;FWd^ВI$>k3K.KE=s3WP1ֆ輷w ݳ9V^<<+kvր}&}<#[>SJߴL VkaM$.,L❏%onؑ]kwپĿ¼v3}@rVg}_x!p`oWOmɡUWmi-ܬodUk!pmtv%0K^Ƹ(XyXOr-AzKf?Uzðf> 2i;m_蹱qYb/uDG.끑uwqDGĮ;3a~bi˥^qx}[xxhƥ}vxBZV{vFeŔ3.د+K>xY*8 ļž]]mv滴z}=f>b2)Vq7#$I$I$I$<c Ҽkdӑ{#`Xgm$I$I,u\tcx+;gbq/|y_|_ξ+IBkQ6_y.2w< 9r3s{bj>k;SY^S{I$d߳ydylW/Y_j{n*>%h1ܻ^xjm>6} /aI$I$I$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kq͞*.Wۏ}~^,>N>?G==9_;j?دrM8=MpkI$I$I$I$I%M>|_/O .hOzޗቖ4v[`~8諧VO?]oVrZrqɟ]gqECOgc-'ؾ./o=?x#_7/Oᘍ,?w/]qp+}~cя n c|԰'+3?~=/V}ww/_v~?ݖ}/RYB?Q;~g?II\'au>-$Z{{q\WM)mdoI$I$8©<7ӝO4_ƅ޽ \Bc_,vc??[$.w¼~cw_/oIH~WR?oG^ #_dmu&9t $I$J.t/%oA흛~o]}OOb"VFqg1*w7BƻrcU7=/- ?vm}z?rGEqyd;6qLqzWoۭ㸈բJt?N95k; ~1y]g ocpe; 8yx_^ڰ?{n'zk#BI$I$I$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$wl}H\=YL{Y}|&뗞lgOL8gKI$I$I$I$I$I$Q}lw7W3!-/ӵ.[ݛa]3N2X? f"/,kl/ƮW{V eVp;=Vc<]漛8ӖֳC~Rcv qKN5cWbzwW.bLurַw+?!w_#z_Z{/~1o}3;oe9xb87 ']7GmKb~~1_Kc4[){Joaܳrnz jr}*?b;fj{8o.9v5\[Onox%?Kiskא2[?i_~}HwoGѳs}VW fH{?nw_=pYKn>3-?W_jc2tlCwfL7^뛒}?@WyWZ4\58Xw.e`}&pjxaQ{3zXO }*Nw}?I߶ƆCA:I/-7utzW1诬 ZB>wo~ٱqlcLj2gu?_šoߵzUWKaI$I$I$I$I$I$I$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$X5-i{& y}9Vg[knGpz|\y.ӵ7)^]8{iEm)[Km8ߴM! yaYg?xO@_j}^8YkUi8_Sdgk6].gܻuYKlq_Y'A$I$I$I$Ixp;S;O~O\GZ?xཹ4ō5i'm<װ@Iy?ێ?Qw/kw:,/ \;Kf=!|Jϳ ϳ]vP߰,OLEY?:c\¦ߵv;^O󶬼Lm-nMWYh94г ua=[?2>͞Z xS;Ac\䟼bӝۭ/ .^?qpG#ګp;⾗)_}C<7<ls~u\K:.7|Z&^'q{ŔRߥdqyddgk}\gO4m'{OEyYvmXٖ<loݺ,eLo.q9z>{/VK. W{xUR~-1-_Gep~p+ASUf2{~A?NN;z*Jی?a>cUlǍ uc)V]1:whבf6C%6O]ٜ^ ѩk?}\OfU#_IdJUۙ/v6p˪]`T2s.w?5;FUͪui',^Q2Lݹgvlhn]RiW[ݯ [ʑ%m2ژDI%Z鰲̺XͮxyG̬vs0}_ggy; Wrx8{8wUV$I$I$I$I$I$I$I$I$IagVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(`I^}|G^[^??c}j2xu]s^(hyɫLqs@^~w?,ec@LOR<}9_ ygte彍pYal8=ZVUm S1ĴpvYg/k_o;F;Kol8p״,] f gRc.nX5`G| mdˈK}˰'`~epQ8wI$I$HQk`q5xq&u+܋칥68O;mmQ=W}&Y?lv1-~=?h0>㵬[G.9z_G?f{C|0 >v7g?Ÿų댏wݹɊnC[2۩swړ<;*~_c;`f6M=Y"#GoLN݋/1H}g6e[FIeq<-l/0lg}_uxp<|1oo.~eUm!zLx/W;.0ǐV\vSv}q{"x@_6n~œK8psY:×v1wO_y2#Nw >} ƻmێ@8-ߵW?i;r2mvpx+{޻m*+NɎ'ha'~]F7LevB揊64\|n}iJ^5Uhg'ٟg?f-}F?E?9??wªr Yaf9,w+/s]Ig}AڭXidǹ:xk'72]5޽A7Pc-;6NFvkK+zF/e hZr7itݿߍʜ[-_Y0s+*ѐ3ɕ}|O,LSnMb{xW=yZ}y1ZM?gt_h3.W_!Ӷ|mƼ/oĮ_:${[$I*K,sLǒwڞ>߀~ \tvη2mvЅK]ls?<_«$O/K8uvIw CeɘQlcKW.O.ّNש7aWks2+_1~w ^7gw8c-~:MVf7֐McPsXc*-zamlOΖnεU?WڌctH<߱-/f>!$F5OJoI\/,Z_c,ظPg>zt->gYPq]7NTI$Ipou}#;r]X$˫iKA`|/y>1@tx+/"0~k3jvjJo\ɋlsgh˳V)5LW113\Ksmj}?L^iɱ Fkbqd}X!w?fF7j}Թq!a,J{/y vo񜼷3%_X4OM~wnn5>'dOW^r~m=^]I/hp~w,zQk=M^9[G >2S>vk{L#OxTS[.{xoZ*ڷ z}{""9t[;0q*2{..E.|Me;{9Yw3?4k~W7cϳՇ7'3mYy|o2z'klߛ+z{3} \{I%-:Z.ݛ]4{/;.>򉠴䮚*w.BuSdscbߵ}:wϷ-m8;kOoY]׽SsX䱯qq}67dY*m%ۻw[q#lь* i0+n ,_]ދCnw cyҜK%W^ϲ]eWitd?i_ιssĠ=ItlY_ܬj;љX!h߷p Vݓs#?O}eۇ }S>|LvK[8_cfK/e6~[X&6$I$I$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IBH\g٩!޹]UX?xp]7( ~?~0>NA7cnp~.wK﯎dSn>_6=>ywmmB*Sv7Rf%g_MmƁM5%W$ppf]`o4CCo#SuOх{CȻ>gi}?6awc%8?]?bvӇYe8 &~~ЪSXc4)J˛۰οUKvk/~4 ߶g٧8?$%}>.;3j3\G=;^x8qzBڰpf>?SA^obOT긢rZ Ug y ;.[I;sOo(w>(/o.c?:fDcwr[R-. Sէ#Uw\N$b}X<6R@I$c_k8fg>;K0}Nj]Oy%s̱#\ouO+޿1?Ο}?y^#"~]]bfE8Z/16c1ߟ}cSWwwˣ_0"<0}1{|ܬe^%[_*˯l]IvgeȦX gc}oSO/]/deCc~ mŧfMU 8kehߛVÿ[x2^`3onn@7lX>+dfz(g?+CڳgުOC`^?c,wo?z(YTڤ0fYEK[˖ϲd~лQ滞sӆ?']ZeVpWuy]Txm 󓥫;'s]u5OT$I$I$I$I$I$I$I$I$I$IagVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K= >{ (aW{zsAܯ4WSJ;bo"}N+#ot?zَoym}VcLRɟW,?r?Zgc?_?_FW4GOz3|ؙT,Gޱ_OXH ^)DDp~j_YS}GMsya`gO_wNߥ>oĂ0ϙVg¦뽧J[W;$#Ovg~z0\^V&\O+\v5c= 2́è^Gj괹\m,.#0}K+i+?vrcb; ɿǦOO󧯣_n?I#i?z;]W^1yڏev~3¯x].ae};>>~kt $I$I$I.WoM٪qg]I$I$I$I$_s6. m}VcLVv!޿=6<d-?Ob<>k׻7jKz? I$;1+ϾWn98y-wpy=,Oâev$I$I$I$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$U{, Bﲟϻ.=kA^6VD{}'?ۏs+sgs_[_~kvdָ wľ}ϴ߉u8pc]:p?gL@_uoW1fQslk+_ܝDorVki8Zk{Ewj~w,V2Go=*g'~ڳsZi]{8EON{5F{kGԳ2̬1 fqs]=5Z r1]Fnޣsv*Yo?W#9g_7nʽYUT{:.ߺ]G fvLLkX_$0"(t/W=1;oQ~U5sen-5v?r[]{CK88¶~Du}!ɟWrN1:ad u|k[Y̏^/}=]UE;V%oMos>ݣuUzPlezﵝ}ӧMWI$I$I$I$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$}rN8}qlcX7V+Iys]ȴiAl]rfXy!?zb?V>zv{<:yV擽?%s3Sw%#xIUfȰ#77-*۳ke.,Vx85oyo8Z`wXi@8_o#> O}}O*?iC{L;NiiJpevY&}6uZ,{+?,{ock'i{'_?QMsOd_埴g^H8Ho,a.^p×e"`Դn69Ou:|+оSvW[dqG]^[[q]}> A$bke !ayqWrcђ1eelkt}Mx~z?wt}#<ף'3םw^ eŌ}9nÁw5`Sh{1cV+*1\%gKϱ '44q;q]پُ6UBcӎmcax$I(spUwC~?Gwpz=£x- Gau^Aಘ~ aVXtߵyϭ^G7Ihc6~o}SxǙxп|ov}{`&>5Hw.F?xk _xk _xk 2$$Hcx[GxB?Ʈp{p˫/X+qiQ6?h^>۸OV;+t\P|+xLXk/mqB12mtәǮkN~=[>u-pB00hXd؟»ٟc1=v\MqZkk[cVoP}5?h;pkͺ+[a=J߲ݯ}G=_xw* |}>_s v [Ge. CjQ='wIdzT?Pi< {*XW![]f4~3>`wsDgڜ v[Gw/]]h?m_GZ};= ,Mm.1ޱspCG]wa;Ʈ%'R='?Ց[)]?wNO\#W~ ZI$}ٟ[M7?eҰg|MʲAx.ηaX,EgdzI.[wK( sm`Dxv/y-#3W$I&qOgqӵZ$*쯷]\}39&?"7cN[]v%KDw}c,&ø@ߚϵ͏.o+G_g1jsṁ d ]ˮ5>!kw}L|;&VNckG9.[ ;g*s❦UIu]>+\ ~oněgE0{6W(<\/,S紃G[wّY_'7և/}/TY ]?Wol3 ~ۙP̗87g?mPUJmOܽOJG_G]I$I$I$I$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$v]/[P~v~(ʵC9i.$c?aU\N/ʼi.u%S#'2(sH ?%`⪊ǭWXqa VKW =NmsG3/sD%r^x3^!Ci aݎ@vs{ٻmyN{ ,AȵpUsG91ET닡;ҵ5q{s Vr2,ijQ7WPhiv|lKsOi_Aw ndVGp]am}#{]^㟩s_pļ1Al\Gy_h^u?v\gX1}wl5#z'xɢdUmp,5Oɩζp7䬷SK j hj׻Mm7K_VXd/}n 9h}.K:*oR{?;~a[u?iS%߄~Wašֱ7ďTcG&ÊlDNQe8VYxWOJctR;6_7~pg/o?hn-v.:cֽX4bW-o]ڪqpڿG}˲e|@j9+NI$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%2nkw }oS8]wjOoI%⟾9">}b/Yzvhߗ^?43NX~kL"SӤ=FHI56;M$]qV2jDigk#C$~0a!msh|RI$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$mU0։+;54?xk PŎ-q'\N0o7֭`9yh OdrW>ߗ^]g?֯SxO!Mgq1y^kexU@Ug$oM U&SXLPRҭv!ʄg~ W>j?CEv-lռ $2sVY m zXO$b{ZGy?e`7{]0[۬?_gV֟7&~W9߬a}OJ?İ#NW+c]n?e?xq嫨IE1Q^a/}k߻V7r8[T{]-?.q$>;3v&gX4Mr|Br;~_sbQgc]V~^겯[DI$I$Qxϴ1[XtA'yGڼLQg &Uhqۇ>?m^dwW~9J89_g&}6C6|a]^Gp쵭h$'{Y3&}ퟶƻW~ڗOh}bg~ew뾾%p8}PEBak>~ߍر9'{j}4c id-6*y]:~!7C#Cp4v?K_}#'Gڊ'%S'y167W]:Wk8`_y(~`ڷQɡSMP hvv^Amg)O~Bpgyg/\[pSV7]{X&Ov}~v'Ns;7AmpYy4罐أ=]+:.OcywNu'%zj Qx^/+m۪}ll<f8?j2lȧ b I$I$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$T>ќ|4Z^uxY<]پ|#w}?%1Я ?m.H7o_;*ُzA[nW*/K|?*仏x:̭.]& $O$3'ٔο Bg3jLҭ+o Jjک};ppҲ]i7Ь4KBPZ/V:/@_|2yte]?ݱlqp\/lu]7fgr,k+Ο_ I$.͞ {O%ykˆ/BXru||ryy~_?:#<_k>߲l k]Mb~1vz|(%]şw;Bp#ӝO%/_MI$I$smޗW~YpEW~Xٿz^?g8%c Uo\3J\/ola6~y=߶}/Gz{'_,sO.cُLjDͯ't G ^3_u`I+o]b~zyc,gO#eyW G &_~L$|oq뿇5SWÿoaIeU~CTr>,?Tr(w;; m4Qgsz^ }N)//Go|3'MTo>[7>b?#~ r|WI*p~7^M?UOnܾfz)i^0=>^k~L+x}~ =~f>CԚc:%0_ݿF&>Y-׊#|~_stW}rsQ.z~*l4DI$I$I$I$I$I$IagVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K'<3sX]5zUU6.g`XjԑXo^gc+*XN*"#P|Vg`a1"Z {u<8\'cb2_3 y'n 46 Ṉ *EMvZݢ簭XMgg7tcȅ&8:?H*ij`;5OW5/hcGXa?GyUd>^rav꛰k$}\&¼k}?gcbݐ-͈y༺MqUuW1 ~+l~51:{;&I$I$)22{b~ѿq=}{]"9e݋q=pjnʥ\t}LXݎz(^ ~w ;l`iw+S9Vs-L_Uۯ1JNύYu㳅󝮏a jƮRvL7_AA3^ W^s4I q+;(bKS͛AAk-u-?S?VN7ܼ[Hb[k M˹QQ#; Wew]#"?hw؟-0}/Z=_ֵȁ[Kwoݭ.:, ?x?;\N{/?[O _5v{E\7޽37lMW?5g~M~o'~~͑CXk~Xy+zweng hwlfTl2<5~4㲛q{OW3ԯd-7c*9?w^}uTpXMf郯CHw8ʝa8r> ^31ka$mf_Vh59{ʻY\#jj߳8}->#ZZllZ{*xYWpߥI>p?OԶ>'ͯ]~7ێU??w_]/5ɮ2;/p?GI$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$dzSyDmq}'ՔnC_Θ%>Or> BR|8^?^ttd [JqgWϲ_x[m.{]kG W~i$(cֵ7f]KKKxdȻ́^.SQO$2:_{lm8={Z\I?%g#xAp9PȦr x8ƇrK~OrUTrp~k,~.gXWԮeVfi"?9] ,.ZX /=:s}5||bοO>\E_ @gyfEa<ߘke[6zo^VEԵ}xA^WgxV+Ն#ZO¼cc9MmJ|^%dR<rǩ{|_ e w׏#r+plGLVOnQ.s?۬eٸt8O `sqsi97pp[1Jm6ḟ\`< xltyVA2a[*me|ҩVxxv8<]OuWe{\odʧGgs_7'{ڼUZy`ʻu?mt/Us4qskCP)B<5`VZe5`R%7T^}.}PL=4Lj-$!kx Xr?8x͘IDŽ z܆RPWd aYWnp쳃}w̆b|;S;Ngvek? m*#/TI$cbח7~YouX.$Oʌu1w˻nϵg3Wx*.3> ϫp]w{[Oo{]|؏W9/ۻ6MTX9&v<|I$I$sqnMlsyl{h;ex{˅GIU`ۍ}Ru ar>2Py.kw:HҋU\q?۰p)(| r.aJ?٣EjOٛ?ֻ~`I.َ }stYVgskue\~gOм!߱x,զCgny?mP\Wo@ȽA,˾^w_T,?h\~w,/?lۓW!|~q{uݭkGwc-{]ng}x|WO*.(sMIUϪZ}N\>KX>g,c껓|\}NN䇝-T՚#!A??}ͫnrlrzYMVg|~ IJl}qV/I+oc/ҽ $I$I$I$I$I$I$ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J~W* C0ysYGoX|d3?Vx=MO溏gz}՚#:5_w^C}mX=tc}={k`O.߾Yu~Sc{Ow]"|WPͣ5OǺymD7=q%[RهJsUo@VPR9$⿆t*ndN$:kZ[W-'?H^W~1yZ"g>*giloGp]K>c]/QI$t/%q4pkm]`]dzȏ WBK1~|Fkud/G޿O}stp fxIz/߿=Gk|[W؟N߿/Itcp<;$I$IRzJNG\C8~IO%~[=ᥳj,9NogĤ ?~W*N_t???xIOo{#S"q~} Ow]ggI(oL$ GI,O6&exp<>~ c_u|\\?پ?]ka^Oܽ>9ǂagr?%幕ܢުM<fN_W8<*g2p~fwxGNouYY36'81+ҽVr?iLN?|1gøb%j3~Y|z~_\鸸z ]G!ҭ>=_Ks~ڽw6#EYgG Uװ}8=ެ8\Oo?vu^s_ٱI/_B$9w,n}}9J׿f<}ʘ- ۸v]zi{qYw'~Q - cn??U;~ٛv8vEX/O?x(^dd_xkj$*rU6ݧyTRjDa2Wx>k>/N-JKZ*u %U D*_x@/V5UGEnl"*P`"rP6,/7򮃺=1\gw/߅%g?l|W}mlsV&>?uղG3v$3wt:Bsgp~NH-|q;!fv|B*K9ȵ4 !j0 ?mmǾIcGWxc6~ҿ5IkUwۏ 03_ 1LjZ]OSLG*WS~̜W>ܮ'qp}-{WGf5s>v,Eq Fq;Im O 4.>,ϰe)v%nۏskopoڃTi& ݰo*sp3>?ΫWHi"Ưcb}r5oNܻedFxPv;8?5z/ib6xXفYw Uo&ugge D?~sUܣ:C)ϩ`hU] Uc7BY^O[)vV]|W3{V?mpq\51+o+\'dʷ0W=jcmt?awa^ V="dy.W/~2{2ڰ @Yy- -yWO]5zj;9/԰;7 |׹WS8[U5?䲜7˯m7xY\=- kl{ǢݏwGNM\NI^_,㶂/ql{:I$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I"UK }p*]\.uD~ύspm VݻlmVzl.'%}_sN-ٖz始b0w_oo%/~zu_KGnݮ}945Fxc{OZ=O=bLz+wZ9+6t).3w5 2{=2'%6OwENϬfUpUVYEґkJdʰ.9@pH4X+VsK!{- -yvw 6qZ^+{a_Yk(^cz#%w#g:#lT~gf>?@]cO ̮M=?vwt⺟ -1[&$y"{OlϪ*#tI*h]cWEIulQ/9{=ާU>~>؃_5&{auxU.Qgu_HY?q_ f?crLf gW+>ݲgz>.Spkl*}RS8P*q=>!e>ט*lEtX_j{ 2XN^d=_[pp[x+OM+ZoWw5#]W쭟Op:\Gb˖?O#M/ޔϷ7}d;_oQ~V8UV8R='%d3s۱{,}ݧ?9T]qc=M{iV;~=<.(#?mu}~ ?'Xi>V)q_/?/{ c'bz8al>} Yw.k1EgvG ]5b5i?x;]>y-llVP7*?}^4qd֦gOxU/ &?u TQ<ڍX6B飋"}7Lzף$I$I$I$I$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$/.F/fȹqkxy/,cqlA_a{H>{Oialw:&%7y߳ضavz(q}?+E%/mmVKxk;ic}\W$|oͻGwf?@ͭor*g-zWhI,n6s8~ߒlcSWgFZX/c^ k?3w/Xc63 q>^K^26Jgų8zw +k@ua&+'u0clg?f"} lc}ɹ5K@|M\2l {4ck'+gt͢Wmkx;+S2pnWQu_g[COWsϖյO{Nw_]/:.sk1٪zO$vS\ߣWMk3qKgv)cX=vYs;ӲvGYp>w,~f,sH?ss;6WqvMN`c8uc?y_i1;EΪSVq{GGsW]c@Lԏn>}ekgd9ǡ>+7ܜv4m{5Փm2g؏,ڱ=n0L{Klo#*u`|WѓgplG mmVq{>%z؞Րv&pҽ+abY??}\tj y11ĸ>[o΋~_/ʥ|ɕqUOq>r_`soSVOEo8^,-{پwt}`w,&8[$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$.qeerjgvzWx~k*q%vcZ8ǘVI$I$I$I$I$I$I$I$I$]TGU:\_Xq^~wluSa%v3]^.^=ݖ?Cj3]>{Fpy5y.zf=kZG`گssy-s1q{Vs]2I*}z۳Iw}gO Su=% ovZ8.% ZJff챕*>'}hp+YWTOVg5+;,(ͷo_ϯbwa(5OWae}oIoOſS&xm #J"=ֵ/-f>!s|Z4l\-5Yc#aQki~H̳ i?]nori.u8Ti]WksO/#+qG,3V o_䪭)~Yreﭟ o/7cUdcߒ9.?U vyM`+J}!Y'rY{lqGkVэ= zqik; [ď[e~߱qm8䰶tUz_og}s -= fߊOK:GWf9M||7n4ϳsrs>vzVxxz%pm[cO"f5F̷K<=a%}yX{\H>zvnߝh.$~p*}h dG7jpzp?پFWeǹpsk/ݪ욠1ny?y]SE쭭nK_]*1Y]hxQglH഻w_[+.o5Ïko_wxֺiw&𗩬O۫9mρ_<ύ۾SAc]O@e|,^e~e{+·ǚ<ϴppV?vE妀W<r?݅b9=-ZR\ϩUyx3qxYz^u]7\ߕ$I$I$I$I$I$Kv3?ڷI$I$I$I$I$IASY֟2X4k4i{c#|ǚ_22g^ Kf3'4uU<{sUJa;ƣ?WF]E_E跋|'foovq9\?m0Y|V8fj=Mo?~vZh ~vZh ~vZȆ7K[i~;GcϭOڿS~OZXaj(51?~ڣ GuǙ{m]ݱw?g|o"/?d]E_싳Ⱦ7Kvi."m]\=ޏk/b18V'~vݰEgyQ;yO¡5X-cK\q}8<&E<h~4%[K)DC<,wQ򽋄.?ﭳ3W}Oofߵa>PMO{c2cGмAUٵM}0ګa7^#ܯ.°_fISG5q呑W9~0w8;sr;"`Φvn;{q[H<h\7kc.Ɔ:$c#ڮ?NA?uz&9sW* nm-S8>m^[cy ppgוyڏ=%]>ڷd) e5׺܎w ۭ9ZV.u~O =r# Yۃ?ڟV{tpǩ_b\}ӵu?s+;tE'y wv߰$GκQ~X&v枢icƗp~ys78jhr_ݞ"fo7|tgb6w&dCM]ǫ3 qS'AawLuM#\n'a<^I3_>ٻe%T Y݃&RvI {U<ߴ9אmax⽣}4z=C\GvLOYt-<>#:.]C%vϘ}_k};s[f?X/ae*핻-? ,߲}'_e<xcĮѓX~pcL~dz^8"~^ٮsgVqYro x׵g='q#vov͹gwa?,gW-ݱ?/su~x};^nUp璺߲6>.̾6f1H9A >eϐ=wM.ZxWZlm{_Fv7|V99ޝY4d8{Xx]&mG(r-}+t8 /q}N&N]YqSc+qW[_qWW'_+xXx9*_dO.{6; ȟ>KC/osû?HDGr#Gh=3XgBk Z=[w/WӒWӎ v/[K^1K n5Td8џEk;Dwwi_f՟r1+Ƚ4ХgNY+Y88UjiX/-8zK1c{~rm\KxJٺA/]d'_\fK\W{a^& T*/ 'a':stISsjf Bҏ}@gh(8L ©\ Vd,IRp ͵!Pw҄OrUVڞdhs[K'f0QW9k1d߅,[$T](z7}2K_r2ȟKزOӞ2zϒWtG\ӑܲl#p䳽4qOhɯZ V֦Tƞ$T{5ޕf3j_}_>U|7_vݯ_wۉ]L8O_Uv*5ﴭҰg%~qp,jKV#r`GEzSw g;YTC%s^ߘle@k[#k#j= v>Txt3_\FS?ol}ɯ13 ^bv[[[FW%W~w`<˖1~>fUVdGtG8}ߓZ";apO,vNbA9.h\>eU>Hw^q) IUcqNVg>g🍓e/{6~ v?Mޕϴ]}7zcqڻS=>kz)ypkoM5wa{6Oڜ*ׇ;ܽW"㳉4{}{4c,} gvxazv?!\nͩEbx}O'>&*-5x[e^;'Y[v{ 6{gy.Mpt1+;xoxsC0I~k;.ىh^\.A|אϴ=ӵ݉Mv8`ӁXg>Oq}U9˽KGV?pų+&[Eaˏ(\78kcw:1imOk]vwvdzWOv >ݰ>D*Wg{-{Z_iz^/'}2Y9_ض?ւ7H/z흾KZAlii_N$/6$^ؿ̪WI$I$I$I$I$I$ofߵn$I$I$I$I$I$CrיdvYȷ7gϼ㺯F?YZ}Pd?#S_ؙDI$I$I$I$I$I$I$K$˻?Yo> cES$.ϳ8OMVl߾oMRR}?|_Pbq8:zϳwa9._O/G  g(mpឞ"~bQi^Տ~}<ϚGl,!zyu^q}.ws8~%dp}oǽ@Td!'4NB~JދgPY?Gˢ-QZw1`}QGƳ+b%M~몐$ly#[U4Q ވzq/2[RS;|}6|W"{O?__OKm?h2_d]/}6KQݿ|{N7{y8/c/w?n_xwh08x>e[g~k&c{Gou^/★y$T?=ޕjl;=>)x8_ں`/M?*pp䳳s%v?~?B>f?z#Oks>WW?_W5O?8xYvpcMd]&}^?qO*FGON?gVcskc_fߺ~z'eRgO߻\>/I'8.OJz']7iysza ?8_Esi~qz}>>w<⻝߿'x:WxcXKSdqpwOo_v3q[u:rK7״;5}]㗑^kپe;kW/G&}?4N*};Bb~;qcڎKyv5SzQ^./˿Y?p+>^*gF O S]xշ"f'{#O_e3^Ywz^ )uy{ߩh$3'Vwf+7pN1r؃k9JGl}_GE;>}_w}(qDȟ5bq%wg~ovϹc9foܻ.W ;0,݃^o;l}=3'{nm[MU?&{,3{cpÂgؽgc\;~.S\?>ir^KoMs3}LR itp2K ܿzޟϥ{(?I$I$I$I$I$I%;_[$I$I$I$I$I$_UVQp>Ƿ;!XʾI$I$I$I$I$I$I$I$I$I$+180Y{e.uOj Z9/k;?wwl:$q2{^kI sy_d\ l>pj>>.-C*kZ gο?yAjTq8ϓګYi;4 o;ڮgjːx1<}:q?%O[.q=2Wct9Sr-tUG-R"J?Y\Tx3ng䬓HO$xJh\*UZa3,y{DV.h T!Ihj VKWh cwT;C">o#Y(9\y7W5tӶ;=#?h!5$vKΜlT.& 0}o;=%s_i;tYmK+Lesu ΓJThSI$TAqw}6@C=d\x? n?cgMXw /|6pSgo!y7gx5??#a_a}swܿ_+[k d}žZ80?P_?h;_dpDZ~Kup0.ai^P&\l۰{![hI~=n.>p=ڌnmUgү{cx]ۨccکw-=~wsqq/1ߧ<o>d3Nȟ 0~e4pVفU} oV?Guk?דaeߏQmO<_?`]ZaFp= v|_qxk;n~e?9ߨfzOd+ ӟܳk0`|Yvw>Y!\X8_{kҽ+X}Y^' z5dPkp?ה#챜?qw28gC0귽R^?wo^[F}[O]ڂzW/>*e|Bc?Myy&V=˫?/or55doV'2 WyY4_S$p7,m\bc\3R/wWI$I$I$I$I$I$ofߵn$I$I$I$I$I$T[fSK[>+>{{rɻLI$I$I$I$I$I$I$I$I$I$I$I$ą}Η9ػxX=c0?3DvkWm{ׯe*.=_g[}mW#>`p8ֿ%SP}}UcrvVc'M{d#8_zlhmI[tz6YV1k6ީX=  5_Sf\ql`PyiVրN‹̀Z '`%Y ,%Q>4[O imf|QOcGCW)9\/~w/'5lv?kЊ \ov^]m|W;7*Sr?PK7D"p_6gvc?ޅI$s;iupXcߴ{Eg~cl24\h{Gjv]Vi,r<~Mymk pB0n{3+q[ຎ߻Q?x~kij3fk`pV}Mor=Gu[sDGV6)*(G`fx#s(+2կڜ1OWݓK0Cwpug\ɴq:'b_]|pg۴׾vn.-G x\9}/ThpU3xmk/ՏO|s _VO|-߲K}Xavk/\9ۆI+?)Zœk>8}E8fL~cT+n;l\w/IVWzȺq1g3dGp@P\ٞٝF{eP=29ǥp֗;NwHk w3o:r&RX_n)%\?ج{wuܖ0[<c2=0?^ my3-^w|yU8]KX =BN=,経6I_lECu_K2j)w ~yjݯ:T4ys '#dckݻVSکc8q|UI$I$I$I$I$I%;_[$I$I$I$I$I$f> O엻+ؾqi>+I$I$I$I$I$I$I$I$I$I$I$I$I$I$,9Y߽V}'{[l@ |-,;޴db{^Y}-^ 1jėڮ/靿|lY9l:v9Ɯز|ҧ[${ThLxWݝSD;h5dIw OG |_ĭUCcx;pZ*|PwJ0 WV$o#eͧOkn⌸^goW3)yxmNE_ /",}X_qӑ5#5ܨ ڮ{\[Wl< fw n}},o>g`ؽ"MΟ|]}OG.;mSv3Z--+?ws[m=.Fh]k[/nՓNGŭ]cõS^(m1skZ]Uw7"־sisgsu}>.YZ1Eꥑ)8oΪKrY۾Ӡ ϴV~VE?ի@r~UW/'awgv.ݲ)綐^Kx UO#uΞߏ(6}>O3 ){}?3Ϩ O1s5\-WK_8W{:K31W[O"hG`oڜ,~c}!AO.ٌ/YSoR=2zpm+KGg߅F_o.ٌCeQ'6O>kmo|sW+\Nˑs-o'?VX?<wOg/]'ymTg8xϑ_ZU}3X=7i}, *·2>h'JUK)t5.%=UڞCv!;sUs^拏!_sR^ëpJؚtO/cvpyWe~03Q^U3~$Ӧa&e;FKk ܼ?O<{Fp [ Zd++2x+p/;myc?I1isn{N??w;}ƹmLy07KmVOÇ*zuL:cj.?K?0Gk~agr,"5BٮsUWbrs56*O&~zrO걭#'3~{?4u+Xm-n [Jey/@;LJowi-kYuҳ!_?eT$6mw`-Y`oZ3r̗GE7\}:7a測 >K_Zڱ]M>q=?umʼn{?YKOdʺ)}k|5m/:y?x%f1$LJnՔ\뭿pyo8fck/~_Yn,#FhkƝn]O>Cw??;15a$}j7q#s[p o|[>kM3bo]z^Ob1kk~]"HVP YW9[I#s_k;./bǽ֊HDD<}94߅9\i=:N-}׸Uq-ɒzrvVǔ|r\3co`TVoz{}.#y,/][7TZ#n^ܻ]1w>sˬ}Ƣ=vB?]^K/۩C+yt[o KvVUV0[TGg? 핌:Kb^͂~>?^+;u4}4G,T׎ersx/\c;^/x]VEO[wW乯sG8O=+ z\ӒU9UI$I$I$I$I$I%;_[$I$I$I$I$I$/H"%V?Ŷ{kۘr'/rI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I3׶8A8x_B GiOq55>DӇ<3دُjiS%h#kS+p\g_?3\G.[ݻ b/iwpv,,k?icY{+sn '*M-S){bxnсM k+.sxV;}͐?N8}ŗpγ>.Sv}56! /Mw\j|ˬ2YsA{eWv?c)055衑mtR[G8\oqE& wlܗ9GgaU(< zov) oBgz^wk@X[i=X |lwNɹysq.fZwLWzD-eܲpOCdmt{s$?KY*K_CU!d/ogowi?p==av~t6?"2~8oeԘ7ߋ۫[(Cv#3դG@c앝gN{WY^A{Vc^o ]"ON˫ͰO6[_$w~9ڳnsv Yo~K8&c_?vӯ:12c!߶;yvGǩo~wMm>{?dQ] S[88(\F~~Bw[~?/~?۱USW=sݿԃMQImWvMokǮtx5K-l=X7 > U_wԹ_Yi;9M i +c6k!\>w쪝SdpG9tJg{}x@~Պav4.~KIPm#> fdd5dz%fUdTۍm9gR k-n[L]k;N=O7Wko~mr̬_uX'7^+i ,Yc~/Xm^7(XۿI-/ⷒI$I$I$I$I$I$ofߵn$I$I$I$I$I$KNjл+'Q_9z=$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\p;mȭ{|>+Ԁ'u_K/]1?U+ߙcM}k$JXΗ}=3;5qV8ܧKLu cĥӚƃP/w <ݑ-9[>v3&\x?1߬+Iء?g0y+=_imwɉ]J㻆]Jjs_˿iD,O=;9UQ8ht[; Op:=~~ey)vfa"au^k+ۏO[Se^?w;9?11wI./c?{DPSa*4^K۾vw__U❰%u-Wݩ׻]Q3p'_gl{贈9$ :,4K[ ~rm'~Yav߿dz>qCY=+c`?GL,LX2 1?xsXYVLo=gţx_K},ߴq?j' 7ȷajL;w;m~_Cpcs? WOs/t?fv}Opo/</_ik]OJWdӲxܳO yrz}Ӷ=sL^CKjSI$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I/I.BH{WN^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IP{?7OZ,7G_%8#ſb? z#kkwO7j~>I#~*W1nglq1o/  KR_~t}_-[]%yoٖSq%zGo:/>>8KS}|}K=>Ip\>vNeާO@z+g^mNo>f#|K'ٿz>W؈5$w޾U_wfw˯}x=qp.-c}lG1#}wI!?_S? z܁=_[ԑ0jlj}̳ws>F> ]n~l{>Ô+п85obt;g_PkAu3O}<%ݲO^M1=?OX=#vW~O*̈́Wtzk=NtXWG{Ojo1kl~ۭ\ؾ}?O+?.}}a. ]?|88y.$8,?O3#+wet~qo/,?|>czqOc_qqpUp}o\Dx9zw?_.zec7o/#x 3~}/W0';EY_|༧]^?F'oEUqz~~wWߩ!sXN)?K;f߰8SUԒ\ھػ7") ?ſoiǩӗۋ I$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I%hAUߕ)@9z5$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K8}zyl~ˏmg}$(-K=,fB?.q'si;<| }V4jP;%7Wv ̜_ hy3~5hKSybg|ɨ ;^GtSU@Do/TUGj?܄{c2-hA }k~/Welgw?}Uy0\p7?G.ܬ&Qh܏C&=X>z g݋ΧoZ ׃gTǙL;V~2ﳽ.8?wcxbvYdO߲oDZ*O);{~ϥo<Ԩ3ﭓeUwtƥ-U/9/!.>^CUZw <t94CDzLG@W3c%~ws}Q)u@_k+ywߝXܗ0R;zgkoi᭳Գ4 1QjgFC1[mG_ne+vYDzn@g~=˵;Nㅼ-1;?]ݛ \u7Yg?4YOkIٙ{7zro,CVݴaoGK/'AVZ WjWc0@˿j\\hSwN?Ix/nIygM7 z0r݊בþ7%}ڬGeTӋ^~YeKwj=>88} A^k>N;r=p3^yn6r67.wh}콧xޗq{f8|J\_txx^Fӏ-h=ܺ|T0qj2x{;vU}ڇ6>JYw>].uqXfJ>얌 /G&N+c/??ؼ.n|Wvۅ͋w2yw|f}ޜ ̈ho\wڞpSi?VEdp\GrE22'8p7`/hknKNܽ$I$I$I$I$I$I$ofߵn$I$I$I$I$I$K~ǃЫ+/GyI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$YVQ̯9]? *⹌Ov_J?wgݿ!ca&;$Pߑ]M7ll <_w.Fe$χv[>Y:h+x#S;[kʨu?l'*7lG<k} `wuz7[@ 1{!OEgt fmV5?n.S>QL r2$/z2Y[8:5^|'}ͧd>kk`9),,O/dOt=߻d3ϳkWp{\eC"8ʱda{n&:~~8?]?h{ v(7 ?W1A xw!%#"^ZW_#zK.(y5Yl0=e8!߸=?BehJ軑 u3d⹃)ܻs;}ٔ; |WS45erM~k *vcۗ/w jV6%^Q>5sko;W^-x8bwps5q=gmk8SX ҲJM5cX0 ]_25yۊ/YS( q wL&>7z~{bȣ֟ҷcy]I#=׎佞v[RRV4Og72+aPOlq>r8Is ''+ΐ~[+]Ƿ's ˤxu/;æ+م{SڲoD{Wq p˦+}.xk[g4v{Uv?iw.KGU⮲Mny+[_? ed:gQ<\Yڎ^6[8t^I$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I%hBg6ll6#VI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(Jyƹc=#`*';'"4*p )$O.S'Z%q^0{7Y %vﶽ3S[oniJ?mVshNDV 0RpM8Mp;x/>]#VSs0뭞H2 &}a]Kaq:GvEKgn0O 3Ҷˉڹ_ڜ Y]F϶}8+_%/_YS۵\E9k~Z FW/WnE- O }.^-n;#ԃˇN }Z@rw_s9/鈟YL4.gZxAAƿk?ҹ<4NN$ewndZX)綐۵v_W;ՈޟZchF?-wnE9n.[e}K{Q]si/ #v).7 O%RBx.ov1y&u mLrxI$_k2,w!yqљ?|C]hx%;ՓU!kWf=#iZxgapx}/tջp9T@{8hJ?|YeYit4;G9ҰK;/cbח77btAoP1m *ilvef\8/bSۼtyZ׹ *j~?r>"#W#{u<YSb;{vF=k_G:f|;؝;)m'&>9{؜ڲ8}>]B'ڜr0op>>J3;QeMsq^7d}b9{6W(:ǂg} r2(iw)s\_8Zc~+ӯOw?R=Z?;O%a{E;di aKk}ϵ\wkY&q~Vh>U}eI$I$I$I$I$I$IagVI$I$I$I$I$I$7x; ~8g{ooO?eoI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Y}ϰa+ŶCx}~·\v;lsFTNgرk6#,.gv.\yOܭZ`|W7˹/D;qvku?/B:-qtq0σ 7N8IwC[K?`{?2gϳ^Hߧ}8f?1JCQtf~[Ө}`?vS1\W}4{dT7[ Z4csW+o83 j]awu/5<Yg>{}߇ς/cc}|q{'=/JzBoڱv:2EZ<_?k涪?wqwtEQ̪O?g[h3g݉qz,9oo,*˴=?uۿewVIp?5g{ Zֵg-Eweax9/9XuS棉f%e&veX9uI,o"~eaU޸滎ӎlw5Sugw{~#m4w[}tm=+u˲_ Kx}ޠ.}ٕe"6#n$g W;7}VW}@zG|mkCχsa0Ϻb~dx-~alw;;uǝE|ڇS1< ezz?{< z1U>-^ ]M/]ﳽkl$_<GdaQjj츽}{mˮcKղ̼wRo wo&c{gi}ow[+x$h視VVrge}K3iK^I$I$I$I$I$I$I,?jI$I$I$I$I$I$'wMg}-+譤I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I&sC# ƩˉT^^цVGbc3>}Gq.C'z=tYcoں+̓: w.ܦf\|˻Yvt}^*pYzyMnV>f/wRN[^-x&>h9Yݪrrk׵s&5T/;!w8 ,Ne>'Ke]aKK_U+}ŧ͸'wfHUVw3+{zڲulh}~>WWUMTXh pa|4Gg3mƎWc~Ip>pcJUG^];;Uٟvu?xyss{M0O-^.W[]["seu87 Ȏ!Io/@^'jv,7 puUY]Jټ,~cw8UpCGXWY]ծ9 utq3Xfc-]U=kwwՅ1?golpdd.}XV;5YxhwgÙnQozv@eރip~vb\k^{Y{Uoܯ#o|/yYٽݗm>a3aec]ZT#w ~=kr~v|޹\<-3veXX1ͭi$KVk0;{,v@ƛCxzk𳻕v;*"imkQQL̅I$I$I$I$I$I$I%;_[$I$I$I$I$I$XG=Ϋ+/R ~})$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$~c_3-Ye9?;l4Unod^c/J^vmQW͍rW0Pm [?`~֏*?q_,26Y_ 3!GqIk?6~Kd AP-CW~Ү۞&ݣ.;_R k_vg'VW;os5e~ޣri+7ߓzM)^ :02k!3SaaNV?^%{Oڎae4\}ƫ-Ϗ`|J~X~=Zx+ZǶ;@,n/~Bγmʲk94ez'k]o.gb6Z}k3}2^xO I e{LrXٽzOw.ag"x6!!tg{fnk}\ 5x$J}mOEڶ9j{uR~S{<'oX~M r>_KkKm gY{ayNwOB|}/;m/ߪ%Vx>Oq98qz8_i2i%Ng ZÈ_sppCV^./gzb{GoI v-oW7 cl9̿Y?^m38~_FYvcLO^CK3{\^|BI$I$I$I$I$I$I,?jI$I$I$I$I$I%C>#Wϟi5л+U1lyo;rĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$AǗ9Oo%:.#i%ߤs#{vmu:|CqnWK1]AUS}[8gg/nccWex\.b|z{gYSNMb[s+sc;m>m@|$/Qa$2ʺ솏Gwpc벩izn^۰ݫdVט]}j~qa^{-~ }\y\zc{Sn-3R|oBd {ܚ=G\Wzt:z?ߴF&^gE}6 z}.R6/oï9SW]w +4pB'%/n<{Y߶S;oQ\]f>+9W2]/^K"ev_J}/R8|UԒIqwnO.:%h9}~T3;oݝOQ~lE)dF6_>n-vLp>|?vEuvMNNGOُ^?^1ݯ[M.cb7qe?aCk0o?n_Ll^ٍN+8*o fQRI$I$I$I$I$I$I$ofߵn$I$I$I$I$I$ˀsԯҹu.ū\>nN^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$UWZ;95W)$wo ][}/.1>Qݭu2~sWv;eR//d]e;[Ii褖p\zWSkϬ4U =!޵b}K^{4OB{s-( z<9.w+*UE6"ZW]bGp3#{/bn7%=~afw)DzsH>t}QK}^'٦ѻ^{Lr88x'Dς~ނ{? ː'\ŢekחxqY `g>8qmwvf벞ˎX!QZi$k\։$XqZ+˥^<ҧqqzCc]ݿ=[Z},>+I$IZ+6[{+`-ӽvw{3L9Z>kcw:Yc} %z]ߺ7w};.O;O\_\|>f9=>\GpʬGW6kw̵^=1ɭ+Ww+%)zRPʦꩵ{ZlՓtLP-Puk>5wCy6nCiƶDJgӘ҇[;ିC> ]6Omߴw&}XwnTCsg9+}~vWHX/muT@{$I$I$I$I$I$I$I%;_[$I$I$I$I$I$o6 ڇ+{Eò/$en^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Eo?ygvw_?s"ֺOYYxs~@e| om-sOص;IU󋇅]5͟ C+Vqv熜xK1mv:渦w[#Sa2v ρV}YE9δ.So}h2)etk;Բ˄Z,Un'ؼ/d2<3oz|wݭ&?p}W= }9O`~E-w8u$I$I$I$I$I$I$I$ofߵn$I$I$I$I$I$}]]`~'/!ply$Wj;D4.$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%ި̦̯yE^p4~Ծ(_ޕڤ;㏏e >8qu ?WzB3mk\5VIscOtf+S.;4SUc&3-nN{p&u#  ishsS[W̏uc-~9zN~.5|<5lL/+{Z'qqfzzL_;?A_'G]\ٳڱag6f/O,/3]vwv+m]88n;v~q̯ս:;#_~? K|f'g7]]2&>vڰkc'\aɣc ]Gꕳ~G.)KxWxl{Voqn池y;{~^}Ki1ѲubG%vNot^<~s|~+I$ |:IK7''e*'wߙ{5@^16O 'xԤI$NM8-&9>v <Oo|{ͻu Y~|cc?ߙ~>>><;o*cwL˽rĿ?bd}쇯W=Օ$aw~~(}wj/ &݇z}oS>'^Q1se2,(t1SGU]vWw?vC)pi]^5ݞ۲Y_{`}G»(~Cx*g+}qdDA˿iD}'~gھPCw_frxvx7wپ>ln:rrJ>G2 nbzu3lO`ɿRTAqbm' HYzŻvJof~,\q]o I%zAߝ/Gݽ.qǚ?3?1຾ٿ{+N p3+U$I$xIۭxdǂ{whdv/O]v6/gcٲ88d~ҥڻ/ OS*;GG_wb~ZpE~ t_h>rw޸+φ"E̡YO^m.oqOW4'van1O]ݰpWX˜-~?PY'L%םf'{L^0l3&yt=zMDk=ӴV':E\<K2~ӒâOI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$>_?>o;rb^ ϴ]絟['ӰIi->Mj+mL[_sO.,C?iu[aEv\cFX]; YWz8@la4_VO-;>1gp_Vk6FfIvh̘l}C,dgy%p\Ӟ x\֏~ȶ66Hv:kv#~yz\g>;ot[6Ci ,̺&\׎㾋]4~o;&_NʲI$Kwk<}G/#gf ;vt mtY^}7쭗A_>~lܯK'g/15, ft4Olfq]op'oYڌea[ōo/g^tGఱnh5Ux؟vY;,}V%l};ٯV5=k콷(i3;ր9}}Gx3>#x]{ݗ$c?Ty,^ʼnH,n+>v'5RUDbwou4eTRƸ) ^-NzPkދA#`Sm[VA.?]̋xg.1W3SS'\ǒ?g9 udn>ߎ>5d_# 9ݣlI-5鱠8a[I$I$I$I$I$I$I$I$I%;_[$I$I$I$I$I.'k^}&ǯ?rZW=7?uI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$o +]0]MN^ڒYn@?_>va]Kr2fʽO*O+#:^BZem=R?K>p_h-1ՠ+ JKG.ems5IJ~Yۻc1+s"HG;ΰ=?5\k#ܳ3OzOg*Do+h$I%S/S`cÉ{mxbGL6'_5; 3{]8'R5UO/LYoNNM=m&gǨ NKЫwG3_Dxm q?-_Ի ަ.a ڲZ[WGOַBgyŏ~8 wq?rBfW}~;ݟz_?>lJa'ŬFaV `w+!e9kFܿK_yɳN귾h1r0]oC~rp-ʽ05+ԒI$I$I$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$fŒV^cK迳ioI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/RۗowY_fk y;?.Op=t<g.w}w;ꨓ;Μ _e;38%cǚ츬yEe7%{SN;%/inylc} * o>+=/{7|g_n[çK9̊촹DFl$I$_t+wOH+~Op`O^ng]dw{~#Z |MYRGzʬp^Gף2;{>v2[h52ԟ1\Ϯ?id_MyAw_ܧ[Pi%>sJcD:;m'#p)9n۾B;- ow ϵ̦o gwn8vC߰>nmL )a ]cX)^絭a?md}J˜RNsilvٲn}"˽HlIg~LJ ? ߰]3?KyXY+I$I$I$I$I$I$I$I$I$I%;_[$I$I$I$I$HČ,9nƥ;??ΛǢs;n^ڀok@ZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?g_`ɿRTd??63.Sf6670~sFuۊǽ3|Wv,9y[/.߹ScEd7cwׇTl!jgvnmο7)ݰ0+ϵťփp?h%gokTUaE%kliif̌߼IrgpUѕX6p!J=}_K?ilE8 VM`I$Iyܱ~g]FeJ]~Ww?+]31komyYq6_+ Y7n̜>sۮD;$+=uZvdש]Lzwb]يOf~Z{V'KնvVY}کemkay}֎Y[o 0Jiѻ-7!޻Ŝ<}%kms;5ٖi:>SKb[H'19Ĩ? \LMz0NC\W=ߠo3'/c'd=~]I$I$I$I$I$I$I$I$I$I$Kv3?ڷI$I$I$I$I$o7}yb_>G j)^&)eAЇ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%g_ilN%9\BxE}?*^?(e"&$q*}oJpkc3O'am`#E=Sqp8\e{`_[?mzfǻ`kx_]5P6XxZ9{kgGSk 'Q{?VvƊeo' $I$lNH&Mo_ +?W}M3~e_FWOK@涾h~ۉC1r;vq.px}~pkaoȧw+-wIh<#t]hɘw/:Hf? YsVGo˳%Ϸ.v^LQ߬^vJcm8Mܻ/rQ'k,<<\dU/p>_|z]g>Ǻ9kOF%=wu{Wˍz'ؼlOw\Im#Ș/;ssr+3m{Z&:ݮcfɷ.4gEUYGkêCUI$I$I$I$I$I$I$I$I$I$ofߵn$I$I$I$I$I.k^wa b+?WC8]n{x8p$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/T?oۗ$SvW?dr{Qlr|u>dZ[߸z^1VgOw<3v/PkqrVIܞ;3qGܸ8 }OЎS<A>ƒ_xSܭI$YYud?C}*goo+ͻڏOObgcQ{GW޿>GcG{ߺzqsf>'k|>)K;z5NU>~.7'|do{ XkC~ I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%͢]=};>c >JXj?fAL+;Wjuml^-%xݎvUyq` |B<ISeVV״;Ăn흗mRE$Psf.GvNfwX94)$I$.^FvxW>oNz9WgY;|O曑]:{; ՗&Yd}~'/y{vK;U~w_z wO?c93]ٮjx1Uⴙn=uXպ/5D-|~UNuwv.s_ggY[OogX2^z ߵowV6c}"b"9ߚ2_:W /|Kkl,0218'7W~lO3'~CnfA|~Na{Wk(=3GjC10OYkn*'k>|l;uT}%Ӵ@NI$)İ1đ:\zg7slYW ؟^)ܳ²:>b޷pp7VyS^'y +w9o%_m{]߯ e=dW \g|G+mv͵ upݏLSK{.~6yX߃CM|eP=o;Qk쨵\S '$9pGyx,o{>kGٌ>՝U]f$q+-3ZI$I$I$I$I$I$I$I$I$I$I$I$I,?jI$I$I$I$gsb^ gkojɶN<1}.RfN?]gێ?]=Zo-XXX{}O8x+ݣu9.q3->p4?p5iO?Ѱ5sdw˸u+? ww pxQˣ]XI~}sgӫCgl:=:oC~kgٓ\._trI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Y /zce}җ;.%gw3j.fm" \W7/m[} }{H}A[gM<\1$t-dI$<9ӿfv.VN3+{ppЏi?Ƈfsݱ?s5wn{5_-ӎ͇=l`YcZ[#y/D%<`VOk3?[G,>V6[i0^[޲umr#ڻOz`zfK3<[q`pzƹPMyns };ண^y߹ߙ65{&ؾ܆V[g} g?v_<ʼn^;+}PGI$I$I$I$I$I$I$I$I$I$I$I$I$I$c3Kq$I$I$I$^0;nyӎ~nN5W[_=N]o_Oj'aw8cL)c`hkdweW W_dw)jTr}!~l?MeX*1l?KbMlXxmhK,-k6iķ ?ڧ;N7X_d>Ϩ^kiI$I$I$I$I$I$I$I$I$I$I$I$I$I$IagVI$I$I$I*3 ^/%iT >?}`1zI.GfeEX-tHw {hS{?UX=.muz|F&Wwz_긘!߾l.}ZQzn1KVR\oq켗k=~+}AՇxF~?dֿ$}ZOMj@s=m / '񟶢1QyMձXS^|jݫ!ϻ#Y~sm'r\#gQ[쓌LV)crf9gKrgrK8xl.Z* I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\w㇉ep#Wy/}nI%wk+ɾgvݙgY'r<D~|'LFjT,oFI$I$<ƥ7X?xkiy[=֫qHlX4bd3&\c^LKmlQN4i)1O>͇h ;?ϳ~zW9BnnKl2>k_,lyog⿹av/\~ .QFGw*g;^}\x+/lퟶs}Y"?W'ٮqxEOAkRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IagVI$I$I$J6;;Jgݪ_n߻ezqo/J3M$U~Hg QE|[JJpz.s;Gwx^SG0*񀌢~߮>Fb>/%bvd6W-$I$mg y*=,G+è?X[ aRγRMVPoMURCg5~z?R˒w_+OCo䫮~y?AZj~D /Ͽ78ZbI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%K<V~/Ia}gasƽWc,b}߁+g?v)vz8YS_o#?_ϋs M껏?Aq?8Ϛ?7O~lGoL[^Gm<8fkؿw[ߘyᮊ_S?#KK+="߿ppk?ӗSq2]JI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڷI$I$I$Uۗ`^ִ_"ZܝI$ >Ln哎ڨ-Ht?Zf~ls+k[Yw鑅k,r.ek*DN]K#;ߏesASI$I$I$I$Ųf8̕gNc Mo~ҩoNdMU[ůbr2Ng Eg9gŇ`FN_X`=mK+? I]{b݋^%$ڴI$>º(5>~KUZ(2srn+b ~UwYz'\k[~k?d9|,}S9+`>.ȶ浸fxs?k{N?cA纪x mϣ֊`KC>}|^w}Y-q,s]^۩kpl.dgWkyKݺg5&#hW|q_"X.xKq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵn$I$I$I${^3'pk/ayƷ5g^cozdjx3g +$Ֆ朇jB|sXkG\gjg.,tEo^{޿EqtJOl(O-$v28SԞ..3 wjr^gwlxy'r6dIxtf&Nk(; <.{x2Ėn_xxMch#(wnדh-ܚIWQ6V9f]Mc\|I$IƼCB8Eg!|MmB_<ϳ0Ur~v.?ggĈU2~[1 E ǧ m?,vx*rη<8Y]0&;Нo\n }3w~]?ǴnN>]nEl8=~8Eo}]|o?a6].g |p.PpD$I$I$I$I$I$I$I$I$I$I$I$I$I$I$utbysnI3m3Zd1Egqi> XI%j^.#5VwemMbAI$ gwf9kG |?o R}A>bU;OܱnGSøx\|ӌogg#cgZxJ ~%t99?dv莎xGs)eo _dt6Y[8ޡty9]͏u9yo,>.cz~יֻ?dƣgmhf犝r.P}6vWRO_e=c12ڛI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵn$I$I$I$ʾFU`puO)+1r03eao.$I$I$I%_"X w,zŨK[f᷍ffiIjg1~y5p?gb동Q{2NI$I$I$I$I$I$I$I$I$I$I$I$I$>Z*uzW}?)^; m]I/)Ta}Vo}ؽtlڱ8xs;6Co|InOo2w~=jeo{x.s}βqk]˗fm"<_wa+Ӵu gZ4~k@DI%O'ѓCsY9_cfU|&t[JXdeY*E_g~(e+2?^W<7oYŴZ?if6[G` }1\+Mh Cqpg)_kik8%l. -f֖=cI$I$I$I$I$I$I$I$I$I$I$I.Oe;lIo?yFk~h FJ؎_xԤB_&m?iH)/giewn7T^WS}>\Ye{[F^]17N,;6~.S22굖 s"A]Gdg g9?ny?iefNŗ럑Qslk#]I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵn$I$I$I&x/b}"ݓuHZ)$I$I$I$$($I$I$K#'cʡ݋so>{OWޏq@!% jr5,M ?ܹc콰)x5k® 0>jƟ{?{}[4sb_7_ay/O>ߍc̽1*]i(Ue^.RAn/hڝP^]*ozDǂŞ5_$֮I$I(xf-ɏ2YZc?wqvh''S$? o Y c,ܿ?guÇ_Q;63geSM^>k~ >}K3UUTCbh`}In[[ῴϓ~Gn'洒I$I$I$I$I$I$I$I$I$I$Iq?işg14]I/^!f0OܷIyWڏ;#U/<'.O^.ww<~mu~ݻyί:[gzyvݝqWkʠ|J;qlCy"I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڷI$I$I$^}~w;f[.u6oy/,7czUpӿZ8TsF22$Ul7aS!3AnK9]gq#GM#k'fNm?_jl;ZJCS؏4g6W۸yZ$n?,!gWb cdcRڭg Jƥq81~*-e(rc/+?Q}8yW{U[?w+쵖5i4I$I$T6bTuVSIx0'sp"x|O_Ok_eK9|t rdSDY'6?{eYN_ܻ׷mpI$I$I$I$I$I$I$HYf1n?w^Y3.@i-+'>~WGopʮ$<\ƫ\vwC^|*j8 7Xghh8ݷzI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?jI$I$I$IF\z1~Cz|Vů5?$?OJ .OcIOcI"/8L%`}h/I3CJt+V83EfzpEΟ?VxX)z__翉^ǫѥ>꧇9p9+/#/qO$[,ŸW&Slؿ&?k>]Cfj/?VwD|!\c>;ڣk5_D?ķD1H)lOc W3?_ZXn~ھ3W[8GZX2I$I$I/+׷ۉz^{ ς؟uqz=?~x ף+?S/|ĻVm3]úc}>$O7.oC& zb8x<1-@ $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$B2K9c3Ya>mY?ױdpdeAg3P??] pe}Q3cG)o,\jEd9x˛`oow];줁~Ѫh}[_ wwl{U婢xA߶Y5͞ $I$X]C,zi+ӻ7e>KI$B~;#+ݻ6DFx-Nwsh|E1Z`@s?>ʼn}oz3|֢aon9Pi{=8巀⏶}%w.mgZ, 49X]þpptֿi~go~*I$I$0e`_^W%ޫ,C[3}`AfG:Ugc;hp#U[ŧbr2\v!Ou#[?Lw=Ȏno 1O YnHQ^@hi"]Rpz|iUJhGES F;q%w,SG r֫;S<kI$I$I$I$I$YhYtŸpWSk+tڽOX~{[?ҜwF$^]ܱkw}2wKOw'#BI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$Js!;5GN>&>'xg(_gca;?ig|`o,|߳x]>p&y{dNS+QVJ\gǓ-P/-]@~ݟdwV(agwljwGy8xw;o68;#]v㽿{|K=_82}#c=89x= K~o3v6+2]{ "4 I$HDi+kOSI"2i5_Sm cvA˶b%bb3Rf+hQU]cB8灯]؊1ܦˇ-/+qSos(-t^a~Sqrjg'>{m}sjKd.%Χ#bky˚J^f% fEoqGcͰAr^-ʇ[?.KW ]-i\I$Hnum#!;;%'^'vWKiC}?៴~͏zid} {>?c/9!*8u*Y]5\>sg]>Ψ[f$o?mݖV~԰bA(?83?jߴcٹ\+h/=N8o샰iWg~v[h=,˥xDaऒI$I$}ҟ޾O[7B[g1^J۬i)1-Iywr?rIˤ$I6o u$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$U(ub}~O,\߱}"G(w ldb*~Ѓ'SgX⻿p~{?ϰ׶;VݎY_>:wE4}]|>5 '*fhD[KSkqy~?&1su ͟UkKkȹ+؎?E~ڻ^K88ڰI$I$I*;"9>9Sm h3]|cڱ߇A}4[(J߶_a{wIENUo 5S bU׵ͽ'/߶Ŏ;7ҝU<ٰ$SZؖ?YjOw:po?ax}~h=6]mx O^I$I$I$Y-+/vp9N9/dZh.X7.^ᑉOY p?hG'Hu;fJ*{ps&jguv{h}GV-|mFLoز8q-_=*w)ljQI$^ RݨqtVódlD^ŏY|QI%UE'eݮs̍|BRI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$JFsD,_{}?zyVՏG$_*g;395S/Pްߞ-MP_?<|^T/tpf+N%inkHؿCu~It?_YH+&_7/۟P>==_EttVN'\kI$I$I$,ywoݾf[m^mڭv{/x;L|^kIymi"??|zc?%ߨ + }}}q2c گGw8??xx. I$I$I$,Z?ԉX*{>@Yџ1SC}ujCwb*{_pGЎf?]c?~f}OB-_j{1p~wLloIU< 6}Ajb[é[xkIwZ,Ȏ6GM%޾}.x?rlpxqZCc[ ~s|~I.k6G1> }@&W{{ I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J]͇ ݧ3*dˏma˽p5gGd;g#?w5 de}7_ÅG,w~pqf=/'r+>U?ߞG:pj`#ovqo֑h*U>w9+g}f1˖x|AOvkí2?YI$I%}ȳc\6kWVG!Wڽb*o mI%~}p <v}:,oJ77|ϒCoJ =c¿Gj6c>;57dzV;!'\. =vnlѮPKag?<ݾI= VF-{{t9$~%wۻn+mŧy v}/S1ດI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$%sg21_[_\Oad}2Y+3+Z۬dbrh 9'EZ2ŷ|21O*d;o-6ѯ7~we̯"0<3;~ek7şdV-Ƨd5e7| Y`vkf([>'{3m$I$I$I$d;d[K.qO#^_O? 4W Q6k"}9k{s\Gv\%c;Ezg(9UُisWwY3EϩtK;+ۯsl_.h$qWdY)'}@Z}gnsUė΀F-e7}"߫> '6^yOnI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%[3 2G Y}Fy^W#Vg s9Ξ:? PݎeM|DK+ϳT0G>Y&[Z2pۿHO5;#E߭}`{~wgijCk$I$I$I,|YoȲCDh|>YUߔ_ENdKL)X:VGh.W\?WSoScwz}Z8ӈ[2|Bt1ݐ{a͉'[b69񅢒e;['//}ݲ3=5/kr-q;o}>ƸZ[#y/Q7-o?I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IATx< ȃI@P=;o?SPX3ϳ<3|_g=g;?is[vzx??_vť;Gڀu=XvZ| J~p Ow&|~W2Gb=オY@ ֫qws]OoK>WQlrMoFp"RhϞ]gɁg;mw,jq˘I)I$ƽV gm)="}#+3|8_ra1n;5vQq\#Ung`F!hŻOk{2:=gY<> 1F8H8֭DY"v^V1Wfk=6o< /F֠q}[ڵcxZGNI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Jʳd9LXpʠ1RXXrgO}dVo\+k~w:3~^Ƹ5W90:>:-3> I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K7n}}\,<{ٱke317cf4}cc{M痗-hGL}þY>?'hb32.m̆1|\u>Aj$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$L5om;:l>.M݇^/\g vŀ_8~KW[:5$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iq]ܳrq{ y⪬\G/ҏ\ ߳Q>bG-DI$I$I$I$I$I$I$I$I$I$I$I$I$I$IagVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ܯn!k}7wj»ӆ˨%u\gvY{qlw3rmrI$I$I$I$I$I$I$I$I$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K?6:Tt~5;3;_kS\[p;z'ߏN܎{>%xXx̣QSf[a䎒I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Xl}peӲx ӝݭAw^.p z\4I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KxdfW?hr?KEwO{٬OI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*ʊ{vU*x/%];ם<-_, V'{u{Z"x^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%Nܻ|~GkraMx}gqpg/e}YؤI$I$I$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$L!y+p/ݾ~/QI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$>}COYk=S# ۱~wxWI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I&s. |P,ixMt\' %UpVUCwt\"}g/bog_z},W`oHw3?|} WC?O? }_o|or}{X'Q>5?m.Q>59=MU[Wdٜ|?QY޻=gqq|0?U\&=˷e?Ot\&˷e?H.9p϶(^~ fUNq,ǨKcGrÞe?K϶)*ashcGWX:eXΏ h5IXSf넾X$s1"{__zo<›/mp=[x֎ JHeX%oR[R[R[RYT~ 3G~z6[*J>? ^? ^? ^? ^? ^? ^? ~!ԯKԯKԯH={7JX)HM#7 R^aeiV;ٻv}\~.7CZ 7 &L˴qv[cFU?Iø|_'#}CǞ\ߵ]c?/վoEOZmMTqr?Y/Q}L8OVY^^=b&ws}] yx~ڰkx{]JNwVpY!~d˿iI7ܹ yܻw.?rQw}M˿i8gߴ;h??w*ߴゥܲ?w'w$>lcۓ<1'+?P^6eKOIq?ܻv{ 7&OIKyrU];_?.oM?_?Gٝÿi@wy_˿i9E_͏L{Gf5ܻ1[kg%Ugq []S,cV_ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.?aa}WWs~_ٰ+ǨrԒQ ͔!7; o.C&'޻.E\|<\3#WW_o?'[sKI}dg}S Ƹ|+Ϳo;r_]>s}7zK>p}?z~(c?O?O?OO?O衿qý޿EbV'^_8߇~wK1^>K>]b8eI+,%>kEgI('L$3L%ӿ$>pRaJ~!گw'!渜H7]w߲?~d}󃏋^`H}?~/DLQa2_L$Fl}KCS=߽zu>k˱j/R}0O|Jiϯ}gVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$5=3w=7S?"I$I$~_sKCw I$p?e*Xx;u=8VI$F͑#iY(]rI$I$I,.Ɯ5^0q6WW > I$I$I%Y~!1 )z I$I$IRMW#wnú8+4׏hEh$I$>ս߽t?!^5ًE\+m4r+?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\}??adശ>+GI$I$U;>_s9.5lI$׹bN{a?*/.I$Y_j,O1 I$I$I%[ݖ@x3:9[VKenRر#ӳTھ I="7dp?>W} ÿiCv_U[-x|?of8ap= (ƨx1$I$I!eVnϊʷd!Wf3(,yNIrkl;s-o/.ӿ;L`I*]ևg`[EpsYݓdܧ[kAg|BSI$H7䲊 O_w*_apQxoM—˚Q粫kPwC/or_U?yݣLLJ9u+4THr(C&\gpX Pw, ~v#N.~\,ڭJs{ey/o Grr]ͰDI$I$ ]cs2}}z[}^Asx|UĒ@9," Vs>*O;'̷򅡜]oofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I 3#o0j`\@:I$I$I$I$to\֞G^k2rݑsNQ#}WwNe5p q$Q "RI$'1k 3pWX15H8iב XGO?Gڼϵ]UKuHdMS xo^?e/eڱj/w^;ڌK]$v{;2Z(~gp1U$Ӻw2vy;ǹGGw?m{Gw;ffY:kGسC}RI$I$)Yϸ]xcH- ?O'wf6m7,|wՌ޳-`~]'z잟w35?扇5Yl-iw^3,}pkq(Z6Z XVofߵn$I$I$I$I$I$I$I$I$I$I$I$I$ 1c@=}~oQ;nEshɬm$I$I$Un] vS[6@8Ng~vo[j6V6[8e&%$I$I$-+/`*?ɭP4=} ՔI$I$I$ĆIk;oO˥Kd<_Wkʩ=Z I$I$I$I$ 1H74w^דh-ܚIWI$I$I$I$I$bogvg*i$I$I$I$Y0*2g]t? j_]DqڱVf"k#I$g]}eLs}8 ߷U~j#o 7\_oL~C?qZZ[~I$I$I$,"1hkGpe~c\?~3wb[3[. ݋ "9|콙v0HVvϳ, :ث?*+_sσ}%}'WÏxя{;e9DC}϶/8?ڼWSn&4.E9xR*c^$"I$I$﷙_e3ғcWaw<izAߜx;w7{mvTe"s_t 潁$I$I$ISW3U=%M;3[}k[Qy#⺃?!F~;i?X$I$5^c;qo(cdXⷸfX<'\ /I١Um9;?Vm^il #_0I$I$l{kas]  v~i,o]txFY8ݷY4@ e%ww+?yiˣ+U?!l=b=G[=y̼>n6Z#0Lzu{P%;_p/U\8 L </;fngeUѐ~UkV^Cb6r+oVZOn?G/kߴ}7356A Vs*{l:, vWv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$\oԧ?ُM;?>}gow?^WܿKc9L~U}߽/XI$I$I%nqf?sm^y*llqp^7nƯz5{'o;Gncyp@kI$I$Isn{lᱮ#qaş'v#̏B?9Ziof?Xyu#yhWqz$I$I$IR=ayǶ(&+)?6?DkXm3{~=OSrؿ~G֟g k/RI$I$I$I3/,?k?y{sZ#伟/eݛzy{#0?^/ܾPGm>~}z~9` OPDHY_ &_ghxpkG]I$I$I$K毶B>wμ7A"XdqGzoq0;fO0uVI$IfOO12;2n?M9Dk,?;_$ݿ{V7}\&O,~w]o>A[^-/px?K}yq:=/ƍ~4ƃnj.ovLVzP)޾e>6LG@|xl̮'G /䲳{72_Ex&Ow wϹ~w(sgN&qoj^QήY~%_8㏒8GEO1|v,_v^.^!ygڏ'8= 87\d}odG_lq$UݛԹLo7+LQzG쭄I$I%Lze5^5sXw/2\a{>߇|_>Jcb.YgLtZ}Z>OYi}ygw:/\ny_I}gVI$I$I$I$I$I$I$I$I$I$I$I$K59]Z![0,p4t}9kl8+v/>nMg _Gȫn{O/fN_?4<ֺI$I$I$I$_ו}jqZ@?s,}{̓ ػ]౜0x[fa;?xѳzw̌e&:@[$I$I$I/:ISZ;C&z;}-m{Xy3}?;>*hOcy{:I$I.[k@~9#Y=j31Ŵ2%xLzgWF`| e}QLZڟ~?Zg>}8u?[V94]=5ݿ#}/g Nޙ/Od]So qqi3{uy~Juw!U7{w yP9 Ww/oV1wYg,?m}|s*( ?/OcOݟ~ o?3&,!v/s7_Auofp1?ܯOocc얞{!+X99tK&džs꽗H8TN]\7rW#qsOi;]ʀ81|~w!~ҿaȝ~iiUݻNLjH3&c->Axn˜(B_ۿo#w\,!,ֻV~ OY2 ?@} sնc4w[ua=Q>K{Տk: m=wbׇ֬=Oi$I$I$7W(>'ӗeASY֟2fk7f85·lI$I.O9xkE;VV#YCkWU-(w"1OaQ'2!^ВI$I$I$~}$Ӳ}[~b[{M57ԗ٠=]US2x>[cjcd/+ cCK襃D/fnm`i]zI$I$I$Jsc@iwڝ?[\=-6S=p;Z$I$I$I$KǎfGWSedakkSMX`/oI;o.G?3#X/G_ν?[p8^!(~[mջxuII$I$I$Ix_\\{>{LGZ?򪥿upj_rO<~g ݓjݓc989$I$/?xr: .-ak_C7vw?7.ms]AdEUգ ){KZ'g?98Y73#az?f8N#{ʷPߟUVWl>gwU(`F?wgds{Cq$ڼ&ڟK^|˾ X/i\փAztjn,So\lgW~G5dpQ |%Vs's î5BD o..skmȗ]ef{A@Sf>@vRL{?RW?Sn%fCv!Qk=_w}_>~D79hs[1]5}cwܾip?2cb1pjHԇS\l 2]w~Uwofߵn$I$I$I$I$I$b\Gp?#l{SXȖusSFKm liI$I$I$I$I$I$OuCݪŻe tFϏ}h.g>e~߱9sl#Wc?%m$I$I$Wt'2hmv@{:h>~aGO*sszxWkH+;ah.N?D8ףv.͓ma u$I$IsmW1۱[.6x=^k'<[ߕG iZ _l>3M9.$I$I$I*3MyK ʋFF'3V?m`cHNwWI$I$I$I/3\̖_}X':aΟYgW(ʷ' ){m#vmW41+]$I$I$I$Isifl]Kk[Pgvb {}JK[eeC?>7s#g읶|1uI$I$I$\{-3ٞ+o?>K_hid+/]O?z>f?{j_-Z$I$wK3e墸[G?~m]K.c\]O 9 ?}|Wcy9+[~]XӷN %#X~(^߹m@,~폅GV?ۮ}ӑ'ŭ[=SkO6I,+G;++-ۿ|9߇Vz6`T]uAlKod:K?簫')쬳>浪9V w~%oFnf0ރuc-z~UotY=ٛ`~Eտǰ}#9TiW9dq ;G.ՆVYW?sscգWtG ۱ Q?KGw*}cY*`{Ïw 'X8Muߴ{" ep:C8p}_%dmx" f-k47N˚lw}"[Yd?mqZbWMwvZY_?.{2)rf/P%>F{U!fY8,XȏY}sEwVopH2绁įt'ks8vqG^.Ѷ b7ogi{c1{ЮK;[mArm;=S%Ww{:wG?Ն}?ߵyugy8e&L;e_o#q6|6G,^5$=S)Ue{̏y/&ͽ/9l{<0*=?3}ُk?-\>K׳}#;_[$I$I$I$I$I$/{r>]eb?}I$I$I$I$I$I$I$I$I$I$I$I$I$I$dʘI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KyvZ]Mxh,yy~,=(q1.QI$I$I$Smڏ<s%5s]675hV%ddBb;׬W],xqp;]<ףܜzKi;5D¼/Yc=޿;G/#۪mбV ז읗++WO͟(WsoxͰ7dVcfwK`;3>+;|Y, m#įB~3mmļJ-wXv~;myUd}Ƕ8c~ ?~- bcUacK`iM ;:/'⩯Vޱ}ޕ;~ۿY_xx"_([_2\~n<>c3Kq$I$I$I$I$I$^7+ R vo/_F I$I$I$I$I$I$I/=O;MW[x$`ʠ^ǵZI$I$I,oOm}͗g{=uk#BI$I$I,7?!^a9zO_I$I$I$Ia}}sƮ{Y]^Gxџz$I$I$I$KݾͱOSc~?x$I$I$I$I$e=h*_3ڤI$~cb}h#v |7P^Aj$I$۲y O^c5drtӷ`~?F6?u;_rf]߱GOZ)$I$I$I$vOz~+λ_WYe}Zc-~\wپmcbO|~+$cV %oufUcH?,8Tq;ne9 {놉iȵ̮XVIm^)k?k}z˚Hҽ՟ qGYTαl_s>gWvVX]Cnm`Uf|>zY4r}GbwSN_KWwf8%LFKzO+{s##zk#~/߳}_kkH($y.nvn~уGkr85/vڲ[Nf?cNEs1꾏31~JM iȭbadY$.U{5.}Lڹbm/ĒI$I$I$I$I$U2~`oNھ;k9K}_OLǴguZ)$I$I$I$I$I$I,_Xf>?O[Oweo}ޗ@I$I$I%͜}|?!X%C$I$I$W%__ӏlp@zN6~YI$I$I$L|%12g_L:~?_zĒI$I$I$I$wcouݏ{9yORI$I$I$I$I%w?ܿW;(њe:I$~߳?o-VZa'I$Igw{Ҽ=?~<A3E?sGEqc_? 2?evx?-I$I$I$I$'~}G8xwW%UY?||?|3۬-z;\|K2~j;}\c-KG]Q!?1ztƌy,Fմp6P|L% mYmڸۇgh>u)I$I$I!e1n# v\v3w~wl}>m$Irn_geҎA$I$w>,xNq}p∘[_c1q{z$s>!u,Gr_e߳gG$I$I$I$I*f o=~URl=t~ɿmւ>sq_ .2ϗZ_ {|??!o<+P=Ln1u@ W@TXZ$tS0OioOO|~ee?Zq?o]v?_؅ oBI_h1qrIM|M0z/c178_?.ZM4pmhI$I& N}ى/й~wsX^'o~R~ŧ`w҅zҴj? `xId%w웴񝿰I^!.k#K#|"l_5g=GsUjۛ5TmtA+WOot6\)YI$I$I$I%kWv_nS^[rr;*;v3?ڷI$I$I$I$I$I$lYۻuxUp}`FI$I$I$I$I$I$I%+iњ7g-vNX6&RI$I$I%)v?Q9z_{ J? E$I$I$5ǫwzag܀oI$I$I$IS'g -yicM">gO쭄I$I$I$I%+S(cÉNv~OjùhmV>m]JI$I$I$I$I$GWf=@O>P_m̾{%jxWo^8}nE߱0{= 7?Uke_/Cwi ?Q?mMi0_?mrl~v^[UAoU^]vfbe}7Y]&WupR?m n?__kGݗزiew;<;c㍖.@yϴGw?mY?kh?]hvu 5_ݝ2%Ooʡw;qs.uuDsم7bvW`[;O[ٛ?[\p?wV'oOV'hO[߶ v kV)3lw+m3 D]hꮁko>UUUx"xoyMMQYawLWsmp0>ݱ}.p8T=VEk)o3< ҿN3CI]~W})=&UKcK5DPʓAUOh/kW^ u!)Ʉ$󿵺?y?ùϒԣby<  zX9=|m㱙%~ոI$I$I$I$I$I$x6$q)^m81_I$I$I$I$I$I$I$Gw=ݲ[uϵk8=~\couc7l l/aI$I$I$JX7.UWI$I$CJ5-wa_r-k;,֮$I$I$I%gL[y2R]r!^ڨm> 9$I$I$I$EH^c1qٛ}1=r? =-#I$I$I$I$I(]X/:۷fZmM]}VNad:#jo-v]G) LJv{]Nc ]wdLϳL ۯ1H?i/\_zYpkTVkݛxoߋgO[ ~츤O_رﳟQK==~wQ/~w ?֯r[xY/}D9.o 4\JL,mgN;HK?)'ozʺ5OI{G+;Siw7}Ӽ\68Js Suqci3[HYg0YYaMn@^vRWOټ 1}Kx>k&8#yq±*<,|v661ހIJ8.sIj;~R{ze0<]%:Ȭ"j k(YH+?e\Wg/q,+5x_w|Zqq+*ahk?e}n#y/O0{e7{K_e,6[.ȴYf2=y]Okͷ ʾkDwXϐ?\k]ܻ~+kDqFx?k}z\>wqx໊\_Xq\sGnXeuD$5߷ 8w s݇ /wUJLsݜq$_k?W%{%ϴMϩL|YZ,v=*_[\a?v3?ڷI$I$I$I$I$I$`SrC%[ $I$I$I$I$I$I$K;Zc@O!Ø謟$I$I$\ϸpy%b\\g>Yslh:^ֳ-:i4M.2ki$ji[A jscO&ڛ}agT]x՟:7r6e=N\owk[gzN5wMV\Fox;jiͿѧ[31ɿ?b?Lb+=n&G#l}J`7Mn^ٚVN1͍ #^/{x][`^i7p}y`aB/ ;cW}ch?+]c??)_;s}o0!R^Lx}!I$I$I$x6yu}.n$I$I$I$KsZoU?ŵ6~.6I$I$I$I$I$\ں-f8ar9׃h8z'ipjpir$I$I$N+5$ךkp>+1?[8p$I$~f6;l Ȭ[~{ZGg1߾.ʱrGGƠad=oK<s3%Z?-cػF?LxeJ\WqZU}~T?oVk-.V"ԩ8 _9fYjvo%kehx?vj/ &aټ^O?ciiUk.=ZTI$/1y?n\K_W{m%͏j߿xfo-na4aV;Nߨ+JtIWu/u\'W? ~\ZSjccʏNڞ'OUI$X֗,0'ToEXg_zh3Uq$I$I$ofߵn$I$I$I$I$I$I,zfs~Շ,˻ $I$I$I$I$I$I$Jq5q/6xO?|=1]I$I$K?]}Gf|.Ù۪e-^I$I$;qj^sD}Y_?0K?ݰ./I$I$I$Iq/_bf.#+I$I$I$I$lwnwhَf+0 Egd}/N zyNg^oe>]a3:}^̈[3G>Lj,߫N?8g<_!ߚʿtçR_1gL_}]U}3껂bU>bϿSROB=1_C8>?Ak??pqdS体gp7^홈y ["F>&13~aog+?wcS^k[%ow:z 5?)_>wc0xYOŘߩ,z8xȎƓ}Mh@N{Orpp9ρ[:?׏f2k;vzZC{di?.%w+yGP5U l6o\un?OO,³>5ڗt{}/ٷ6Va\65>}颦}!zخ囍gc}H?]ˉ_k3Q~Qpϑ~#+ 6~҇1G]l ߶iY7:ߵh{y߲}oKy*8hj{>nO^ k?+>xKTp)ܞU>nE-Cq_B18V|*o?ytX?H߻ɗ}=:̊ u ;?N~K]&rͲ]l&ws?AUE;gȾ,o Xg>ϼz\|<1g1ci6o1^]?e'z}NjX22Az~OO_+r.gI$I$I,?jI$I$I$I$I$I$U;x}'\wq>>=xeu_g-6;ILqZI$I$I$I$I$I$I$Jsŧ.im:a͕o?tg=OWcTo?9NI$I$I$}L_b;Nϩ'|>KI$I$I$I$m޿\Godk[Ə5z=L RI$I$I$I$I$I%$G Fo/9j>QKxx]I$I$ ̯#;ezm⹎;`OE]?[qplO5^ީノprƷ]ޕp}odUSX/9z*7H# -^f+F;3lkxMZ{iӋlBlI#iY(]rKWjkm! l[c쭣ȏѹ{Ғ3c}?F_lVCTkqՖAoG%ӿџ /O <b'\+?=*#"E}PEpsk-#`_5XOޮfeO軆T(~"۝ju X{׬ޮ/K?!ς.}-Yݮ^gQUia.^k*okM?ޅ@|fU_W/#?/P*)$I$I$c3Kq$I$I$I$I$I$IB@\'ij_ϳ8m?߹n$I$I$I$I$I$I$I$r;=1<~|+Sk7ζf[[I$I$Qsd4fR? RI$I$\<ڟٲ,I$I$I$^gg9?zbI$I$I$I$;|t5q[MGd+qqќ5vNI$I$I$I$I$I$\Onבj0@9awpcّXzI$I$yRc>k:OY2U%:6/2SX|^GҳP71W=jv;5K?9pѭ%D @k*w"iudſ|k[igZ}V}9vdc\4O./z9,y%Ye=SS2r1 waO]'o=)Q]sY/?)^ٕܿCOmoPczj -l UwߕI$I$I$I$I$I$I$V_#y/&e]?i2`z|ӐYI$I$^Sw8?\?zI$I$Kϻ]Sחw;j$I$I$I$^q]/GI$I$I$I$^Aks(M5<q{vc$[#y-I$I$I$I$I$I%u~ſigAkI$I%: ?]WWڱ^2+s˙ˋwY8漛`ܾiVk}ͷߥfdptv^Mvy+vln3QQs7q9/%swYڱٲL(&]So^ogUg<%?Uk;Yv__dd] =;c "fF >FNļpWlg;bfu16&UC&B׹_WOO;#KgC^?/Į&GʽÇ |h)v];Y`R ﶝ:e4CxZ9\ow{p}? 6ͱ#Qm8Aw^#Uo.y?fp.ȶYlcpV2s56(q?_g ?o ᱲnEFE^}Nxh}w/C+z1C?J\_wzon_)$I$I$c3Kq$I$I$I$I$I$I%?U6MuŨ+{ĥۜƓRI$I$I$I$I$I$I$\oӁڸpGjs2roG+=ҖWc)״@+sUECYr=ߚ՛ .t]^'׮$nrԼo7mU𽾜?6ǻVⱵ}¦}x~Us_ߋGw]~>[CP~Rk~K.[{V̭x VSꍑSc ϊb/@g.V˻,x/ȷ1lO{{Ы?j2>dvxxV[SxD7Uo#?T?z~24o@z/FMvvKcW'w\?Y?񍯱J^EڻpޯnHgq;uq=r`~]5fX䤒I$I$m/ĒI$I$I$I$I$I$oxſ'+>k!Ç/@VEޫi$I$I$I$I$I$I$I!|2i[kXٓ^*33}>g:?^I$I/ ^EasG/QwgiחtI$I$K>S߱CGQzVதI$I$I$_,.Ӂon$I$I$I$KK#w%|{v<:zI$I$I$I$I$I$I/2k-{;G-I$2 &9/6}NwxwqPv{3\~^wg#+US887޿ʿݷMgۂ]ygڟwq܏WkUS[T%|:1;.Ub9n+{q~F=?_]ڽS**ю~ o=~UEP}M=xq vbӷA5Yo&sD+VWTV+ܖ-sr߂ju͍%k vkW{O|?_W%?g1o^ #Eqkv;屙Rc\y/8o}uu~wGSKpkس?6;bvg]RuF߳]_g/8nF~W~})v ?+2nۻ[<@GW=dkO/wOݱ)\;J;KY]J]`ݽTr{ﭣpzȣ.KdsHni6϶W/2wn%7%T(3[5}ޛtv~>޹'r<kWFI$I$I$I$I$I$K=7'+l}1*\ "y$I$_t?ohˑS>Dx㰏F/7_2>ɿVwq#Wr>G\{D(WS2, xKUI3v,q~ywpc9Yxy|gƯݽOGgwc􂝿s1H._Uڪx/z\ܼF)=LbzS#ٔgEg ߚ]N??!\7zo?et?gvOm}8azwJQM&N/gX1M97cG|6{i8wlf?g{o|u~FW.|_L%^)=_O2e]IshfW?jsGmiȅc$K-@Votf3~R[==BJ52'ݟCzs</&,FZ~}~O~*|<OS/SM$R9/# +&>'yGϳ~~) Ծe<\|QK=:| 4I$I$ofߵn$I$I$I$I$I$I$TﴙdNɗ)Sb:iuI$I$I$I$I$I$I$I$}ǦsqrMSyLo=xw,~ۅ_Y#?Qm~.eTxX؁]s>uuԑ>K^G}ݕe𶬌c51hɣ;+֩ox g^ƒI$I$s8<ޕtI$I$I$&{Mcz.Vv+k?_I$I$I$I$ _ ^o'k8 2T/N I$I$I$I$I$I$Ish{N/amuq?]I$l0%{zȟqsgÿj޵`?ۃ&ӷ/bT3\$~jzy+3IZ 8U- 2揾DCPEQ)zY7CZص0dtWlh6XZ1Mܲ.}9ߜhXNkd*Yߺ~ ;`?یW>0 dlcwkBI$ss+Fg -fVJ=U-"*?q>[wC V>5웴=^N3;꼳3oouځXe_ 7O_U?n>2G}/*Q??:TYAwe_ /6M^u;)og_ m?Wm?Wڰ[Ƕ]Sg}6Dow괵5I$I$IagVI$I$I$I$I$I$I,E=y1%uM,.kxgKI$I$I$I$I$I$I$Q}gߊwzXkVͯƼ쓻&G Zqm'8 {7 ⏊1?ʑi?bﱕחֵVol)=8rħyښ0Y߲[TߣP?T/75ܟva7l?f>;=yUzG\#Įw\C'׊}fKeKFN/̷cio^%?Vߵ~?߿]Dqڶ۪qcI*i$J2 i%y_K>hI$I$I$Iyup}ռ?ѩ-4I$I$I$\6O# ̗EV[LMI$I$I$I$I$I$I$o*sK-?Wߏu5~{5x;$T>ќ.,3^c_苟8/8]{1e}F?c_y'`ɿL٠N}9#;mz>%q:ykx}*}Hܩ>Zun,?=O;ֳgٰ8CW(~/m<4qUO xtvr igA#_m?ƪd:Tzcc w˞sAtgp2/,e اk:?vJeWˏ`9Hl{WYe9L_gtz/muI.1xr[Ż(wO)qV8y&rrGU?쓴G{OuVdpz\>^;',_!x?i/!x?i/!x?i?d_埴^'O?3yg%?3yg%?3yg%3yg%3yg(!X?i }gNXyW0gm8qGZI$I$I$ofߵn$I$I$I$I$I$I$v;a ,ϩmE/j]$I$I$I$I$I$I$IdO3/^bQ:2 ?Toyk}^Qˬ]z,z~׃y]|Y?v7< : Ⱦw jU#m^qWhɽⶹ|elv_/)e;.*?fWn8݇.־gvl_}9gəF3>׊p}Nlr.üUFH{4]'p.[I$/m VE{>GOQ$I$I$I$,ێ'O8;Ofh˽B;'ozI$I$I$\MZ}LwGI$I$I$I$I$I$IVel)đt.ǴGwԒIsQwm8MkGu RA +_ea^Q?_&ӷ/csh٬ʧ%}bɩ:x/<7S3+^@ևsI^uY,O--?el9Gy,v }?*--Nωe -|O_]n{H83W${y6eZזWNJ>MkĮX˅ \FG^R)K 5> E^6 V=YUlcrd`z#Z=/wxǻk?HLWz`\q!3zE9]``$_csmpyti.=큗{?ٿo;^#6{齾c`cR着A$Irjl Ww AUC_O]D*?R%V~4N^?{/1G?J\I^X*i$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I%}7KquI$I$I$I$I$I$Ib` }Kshs?J/a8ϱS{z;v~7ӘU+(qZE2=73/02_u8VCo֞>)m3Kcd|K{GxYl.D~]n'ۻ}ڬq_Z,ˁ=~~voכi=dum߄~j~f-~mG/^l\Cgۻ5I{8B?=mv5 I$#[O6./t9|ZI$I$I$ݿˏudd.#K)`JI$I$I$K/?qcڨ̍#K$U.yͧ8wXQ{8H]Otcu7ߴ9el{+'>+f qU5ZPX0~ vcd>[-߱n;v]ھ]>&w̷6x+ךe?U\_cEn[e_A|GeWݓd*马Fo:h];e.fC*kZwq?5G7w>qGkZcoܾbbF0eӦϵ!{!cei q\e.2S \JJ֏Ww<]=7v4!5,eZ?e^ga??J\OCz41!I$I$I$I$I$I$IagVI$I$I$I$I$I$I$awާuRƵ$I$I$I$I$I$I$;zn÷ұ׵:w(K޳\|Y]Ĝ,~%s[^]c03% fdȭmwz؏h;7sg7k}^#6,t?ݷONPL(c~ݿtVgyţ)+[Td e]ػV+x飅_Sm*{~VY{c.wf'jyxp%u+MxǍNV#kx~ 3C?\?tqm?Y?cnڗu%V.'x оks?Gmç9cn#g;YV(G!w_`q z&O=Us Hb;j1zNfdϻ46J?}?];*;$kU{Ls-M'f0qkxk# xԷ+<>Vg`_C-gWq3g+?sG}mJ.C\lw3g&w\'3g*g7w3Wځ*?_*U߳mw(;qHS݋?/+-̶&O!wJJlWw<]K\\< 1cB}sx**{? /`?z-$^II$I$I$I$I$I$ofߵn$I$I$I$I$I$I$K@Gr=?M+7Y8w^I$I$I$I$I$I$e<,;/O"{.Ӝ>wܰܚq5} o.ItJV3ٿmnAL@681y%u:!#f<7w+ٖyܿCهLG6/h1?{ěx!ٕG *Yص]d| տ=O{O: {Unk.$,N-uc"E.>L)9?{^{].ix*i{.=F2X9~Ϸ`}8Oտ+Əڮܻl>GΏo3(fG;mTCGݟ*7??ع4鍿+>eѝ;}f98實ʛ/_wcz,v{6FW'p{o!?UZk>ϋZ}=~?irUx _F[c pG?0V&nK~}\QOlؿW;oiG;wZHk8B =3ևa9{f[XZNxgjSc.:'??w៣%cO*o'5$I$Kk.thwV~eβ?}~x DGf_5֘Xj Px? /c[zoӒI$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I.vSYGvȮo]}׽\Sq9 I$I$I$I$I$I$Gw쟾Y-1?;Vq⼭ݷ}GO6}^Xj_>t\gu&#YrGV7?NF?i^A@w-}ߟN{?Auɑ߶I$^S-.-|=`?5wI$΅oLWARI$I$I$Iq?j[8v)?-_ڻsT?+>};3~_AbP;gI"r3Eo3E+>3EL}??P;g/>$g13dxg$=O)O(O3Eο?Sg~/R~3?{):E/):E/):Ef[z!r?S`?E;;(gQxx/7:EywA٘_2~dWy8xE>j~\>}.lDkWg_bs?謞ޏG/ ? 6_Sӏwgpf!?u5=|WYJI$I$;ualֈ>Y+!J^UMBY Iz26.'K90?W>h;>X߅?9J\Rצ$I$I$I$I$I$I%;_[$I$I$I$I$I$I$si&}鿸;Dǰ>($I$I$I$I$I$HYT#]4ǘ^K6{>7d9c?I??iso޽*>|_Y3ߴt5  ʽCμqƽ/_^;d576gZj?ſcv22Ϩt+?іq^Wo*./8i$I/ xm/uc;jIB΋̾voCc<$I$I$I$--RM.im8KX(d~U}½=@HrI$I$I$I$I$I$/{NM\ "4<wxٝ}Ҳ$,sy">Ro\˯uFgҝy}en~>=8<בerhh{֗KOrqt+&J_GtЫJKf>cжxY_j{gQEt/|EqrV8UknqYךh9msA?i['۬mܼG-6}NdY*/ÿuWw|}Kt?i'aq{8?i5d;mFc{f?m-Zl>?ig06[G*;Igg%&%ȍخIxp^?i ݏ?iUcxƯ#S[[̡ٝm|L*9!ζ ߊ}r?؆㖿p{쵴Kc]de~w,1_kG-4_ѯz_NI$I$Ix./4+{k*ڇ+³2?k{my}^EwT1ZC%Z_eV?z1+?O?^9 I$I$I$I$I$I$ofߵn$I$I$I$I$I$I$JxihhM5 MǑ+'s8~I$I$I$I$I$I$JwnơVf%9Usy9G?{;EUϫ}ր?V'/x}gGtY -dq<_i?|~/ՖGWfkxcy=@ݷlJiy5a}ſ'~.=IlҼKf'uS[FCGA@tk{94 f;mcS?:X߮"8mKȆ?Կ}I'ϭCw~lt;bk»CU[k>/H.uVA^?9I%0/_&~)QᲹͱyoI$I$I$QO<}9ϑWp~Y_{}wk?(™NܽaW/ 8'b6_C6ƻTBÿt0ƪzf;77^oڞ88{ydq?m*UyHv>r7mkZܼfvܰ˕ρ'&Z]m6:Y9_i 88~ϷWe<=<[j~v!n#8KXQe]F%1-2+{F#I$KǾSks }~p~و^]{_Õp"w*=wL6}a8Yu}cw+lUIż-iw?h;3X}q~|~*&6q!;_Sbxf&w){?{kN1|{>o8c|SzWC_}?|q7>k7ٿmyCa[@]dm!+I%c[g^ o}$v sͪ[lq^=AwO-eGgw;әZ߲uZfّN> }kv>>ƭgOdlqk-ўFӈns_ BVv&f%@0 ^DgneJ'͍R?<9e䶧U[0; OsƳn.c4C/k4ӗOUo;9гc6vRa8򧶟ԭ`,yK~}_wq7z~~#Wg# oTrůk OO/f O/>+GXݒ{V?+[muWhxI$I$Ϸ>3j/zj4@}f5Gyx"23޷mqJUg?gOҫs{Oٿ쇳}p0e'?zzI$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I% /-+We}H~B>7[Z4I$I$I$I$I$I$U3F۾wnNF+kUӓW>kՑsB򜟳W/KWgɫOe%fr['^c§v?Wz^=cK?fmXaNjTlwV ҉$I$I$I k ~Eg85v/:`?ۏ |ij#W/+<gzfC"WwGk{~C1.p'V49K̯hJl(7 ܟoOkso\̆.T>G~]V598+z{gyw%fX 5{^Dsۯԝr,2ō}Nk^fֻzWvI$I(9W)ϸ'ȏNŭfxg|bQg+Oj!b.W__I~~?)_X2Qg>L^g_Y?vǪ[짷kEgnjZ8n{MlNG?oۑUbs[U} \\glgۈ/AL/79yYw-+'AVfZG^_;=xI$I$KƱ"殻GoAó"6oG~̞ _|q;gWL tUϪ uU wKxYKS=egӅ/upw&t.WqW1&ԿA:I$I$I$I$I$I$m/ĒI$I$I$I$I$I$I%\Jl㜆?o޻%p-]`2I$I$I$I$I$I$s8&<ו7u?JWq{ĺOdv߾r}?0c_? hVY.g 9<}J3y?Ѳ>8rGRvs=i#<|^ 㞗{t[Xy 'URpĨۑ58燍̣K+C_)RivW#> x3kO]&tXGd}OM, ڵ>ܶ{_/b1@-4I$I$7 jj=$rWpgV[îxeew88ޞ#?݇gw?s;OZ.$I$I$I$I$I$IagVI$I$I$I$I$I$I$Ul'ru}PxZn'noyI$I$I$I$I$I$I,ܺrH^I.\O.&ӧ-os;'ŠyzkDz`uK>wwKیr$y/xIfӛ'߶}ÇHݗ⿎8\D}NmpRx[YHg!;8nsm~XTܳ^6{s2Z?6,yPͯ` OwxOqˣ?/1gI$I$I$ToMwK#?bS]5@\|c}cm}.^^A|W5*r^g. w/Tja[? O3k*c g%?lUbJ/ {.Hakܾ~g2Mn/h<~靓c2mc9?]߷я~n^C _ܚ륮pDo%O9VޱwI$I$eph{aU{"[\;_}GރMX_lϴxןc鰱7w ?tAv_ۼwoJ/F}K_]e;Dad@q[u0@Rn]OǷLI.#n9Bׂ}q?+S9߽+cyLstwQC;+!<]ơz_EB]-X<=ÇWh.{uczֶx5?cӋ驼5}`nQ}Wڳ`ddQkYgYewO|{XaҕVt%o\߬}uޔy_Q\>Z{]r:-粫mڎǍ1+>Kmb g &?ϲRֻAVąCD长)C?K$O%LmO6Va[{zu=>/ѼsӗV肼T񑝯εdvq*TVbͺ8XNO7ybcM]VqMoѨ%`e>+Kv1f5>g X=#M{xdOBLڃ%Lr\G7 g^c?+gt+JE#-?R~>OCqޅp;#uAR=hݶ5q_/ɣ*YSkgv ͙0dsW2i'//Pcd#dg~>{Dkw?mWl϶j.~9;g6 #/>GMA\}#]Uc~`v+y=JΠ znj!̩#2zOK^$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I$|}zf6u\N]طqwgmI$I$I$I$I$I$u6 ƿ|NOyG?ٽ+XZxH?J7=88~Ey?Ow>./S'``w KOgWoG "?5ZOh23??A3?1H)D3Z֎'hkyG AV!+{]WQoKϞ9/DI$I$I$Wvf{?Y+-1|ޮG4w?o_Eq Yy/۟ȱ[򮻷WDǵiz~W96ܹ>ݛ88'SGڏZ?Dgϖ\iV:s(V{Ŝ9-+kWo#ZxL\>kȩ5½1;*þ2[^OUk"jA/kUġ/ż eu˹p~~O_/dvOp_p=n_yՁοK&B?+}.]ڿ;WmO_8^ˀx.S}~쮖܂%o` \{be{Xl#`G8}S=e?ȶIqw;x-=xke,Ya".x/d?,g.dLpznޞengy-߿SG\ڌg1 ?T0tYkݸYZ _eSK}}..r}|\*{YM|p#L*f7իgCtYh2OCW_U} . T'cO!_T{o48Oe>yߵ^~>Oo^_;=xI$I$KȻۭ#_5KORj-R:஧$+Ce2 '(.SN?\/ Ga@3"GoE/5M#3 /߮œZb.%I:~[/PI$I$I$I$I$I$IagVI$I$I$I$I$I$I$b%y(˫>ɟ߹t)$I$I$I$I$I$I$dw:r$\of7/U7j+oPhet__Jε,0m 6tw̺j #o}?Գ ?iȤ5T\/ڮW1W)zϊ2?Aevo&}}츿k3}G%}٬YA d;O{dd5sn,@I$I$K֞ۖ!?yw|;H\vo3, \.o?bew^cj3?v嘔TuLH۩u\Ws, ݗgWht=-ǥT^rs~ma2,Nj_c}?ibwM'앣ÍQ{e°@W)ܿKIU%dLVuǂevKy,~ul/sn+lAB6?ݾFA7cb'|s?%]x\ocį2 Ø.ݟnuʽ8scv4~>~\칞Ō\Wu<}21pjƳ}yox.ugjصd8S?+nܪfTU9rYEGv䯪wm?v[?z??)[=ˣ_a7>jsG沲 ‹_]w١/l?,?_B8;?L xKcm'Bg+aeVMDpA]Yׯ^wl핌Z̯l~ +99|]wmϽz~88y@+sw9rWpr_Ǐͫ}i'ګ@}XoT.%\| }έThsVwQ)ms=}wW ?㗖?śxߵ\ 4v|_e??iI$I$3aYe>*Gw>Weg~|7Eﲏ_o vG_g Ggߓf{Y*.]gPg_&9}MOaeY {>_?s>~o$I$I$I$I$I$I$c3Kq$I$I$I$I$I$I$I%Ʀ[K^}!PieB>(I$I$I$I$I$I$IQkgixfNN^KOo^2ˏw/18HeUE</b}ϻ \ȅYi{42^GvyW:sYcA3V$d7NZ}ӎ滹w#qݟ'셽 7v^+6U]ùcgp bU[?pj8x#*{ֵR]Mubv. ~Vv֟h'Aq]oal81,+m3a:]7g1>dﲹ7qϧ^[sx,4x~]ҖWݯ[{ .kߜ.M3}.?̷񲙖<coC?q\wz y>1}OdpO]G/5> Ń=-hsm:44rge` _HSLP|ʘo~cp^ߙow?)[=Sw~Rz )w V~G^IǮhݢ,l?,vWд,,<G/@{ߟuJrl5`qy&K.͙߯#َÌeEx<1 &\dSq\+r?qzUp>{אӒև~{~u`N-ұuYluz&e^@w] w}FV? ~ZTkƷej6~~ ݿ_xw#]'yw?]Zogޙv{G-4I$I$I(I( $x @Qg( $I$I$I$I$I$I$m/ĒI$I$I$I$I$I$I$?x}--#>^}O(^I$I$I$I$I$I$J[[0NN^K%?!޹x۶}LZp~Ϛ,WZ}ݾ8;Y [u{ {j;_v<|K.XP}c9{,qoOw7]'O)WSÎ>~y# )'L~>\>HeWUA ۻ}ӻQN>X(/k#M'^w1Tp{ךӐGћSolUYF77MdI$I$XCG7Xsn%}='rެkhcCk)t@|W eM7OO]ov![lino閎/ 6< lY_w}jRʘ:;o~ɵ,xy-oip{ܽoOx|;S}p +G4:SZp~W?7vݏg~wJ*sTYZdl Y]ᝍO2Sjq?אd&MiZK9"]kau3YwߕvjOaGyQ_~"[\Ta@Fðv9p̊[A3 uj,<;O>n݌ksxJ['ݎ>P9hX}f<3%ྑ+EKeョlw1mLG yuh2ea{)){=c )us,&75B-6prV~ >OvfD`?@grȺ.,dbIQŇr{nq-}N`lsG>z|I${'eڜ}W//Q.w__/FN\/۰y~lxxbd3I{9V{=</U[ȩ\dO3XCúL\XxZ>v79yuf3G~K/_eIv+?= {v{G-4I$I$I$I$I$I$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I Gk?_:/UI$I$I$I$I$I$I%C+w/ϟNN^KtЖzlO3< 8x*p)Uz>p>ƷY _?#x9<^o7Ie轟U~RY\߽߳45'yI1Ŗ *_ើ$w[zh/7gz{y}.wL_sq{&&ZG?ow˱p:/S<}fG޽#z?5G\b﹵~9mI$I/2_uzM|ҳ_b=~[xYsؿd<=>>/ l #/GQͿ8z.ھ=^"zaϼSƾ=R?_*QkczW?6"#rw JvGczo~?}e8rAn7c<& <O+\0c~&c~ҽ ^O:S?בk"S =LfGgwt>_0dQ#Wkqi2=nːGƯQǶ: =&ǧ?4'<\1(G>6GTs_9//T`e~ݱ귆c zq{~xn.MpQ⸌~fp[;s>a;wmI,ؾe޿kQkMb߲?_1|Vp:%WuRqMOg8"_9gM?SeGyp)>_>|+;OGJy~|;?˚|id5YSG>轻<}_㖣_~^o|4Esj޽ov;G-DI$I$I$I$I$I$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I$xI$I$I$I$I$I$T2wr/uS˷?ӷ/lI%G`?MXPwܫUwAQ~{;Ťhw^)ݮ kz,td wLEwv UqI>+])x]G=?jo·ұ a0]^G}u' @|*ɢ j_kXܥ _Gq|}> \S<؟-98>ώ'zB:9|p n}öŻysgq7{~;Me/- |3ʝ3Dd׸?^X`{s[U1ެkwVTI$I%䝖]pvE_@e}}FWS8w伷3ګ2/cp?VG|k_3:>Xٿ{߷D?~5OR ~rt¨E &ykm:kX?G_UC~Oܽ/_z|\>ֈT[,o?K+7O>5xg;"ћxc*2{ie.#~x,}+r&5bqX91с W1t U}ρd}k&ZPµ\~Q/"Mu<>{ݷsN!CCK_:3 [ro8[k߷3?{+9Bγ9{5ӐWi!J2@ZI$IB{/l#k#}=?H湮 옸7mKƻ58ӹSKxYM5\hߤd{Z4Li{f/SMV)GttmWbq#oz5s;?N'ۿm߶߳ݜݻϧ~_GNgdyw??j;kh;'0h/V^7/OdH5ĝ،k2:v^}~k;z?ϰes^8+'[쥍ZgtzߤdA^[62?sQ})i}ښSbζp1~>+7՟k%U>~[q>`.^G0>|_9]RxkYݷOOGDqx/>dS]qY^1GaɖpxhB_)O_Nػ[;fUu'YK|/1]vVM5;h._>C%]^EB̴*i$I,N2ϗ\wi5pzb;tEv&?XcIhJLݫ̸; ^7]Q$ ^&Gf>GՎ >_K_SlsNsM>+ wߗ8词\£oi;]X-'_okwo%Z_k_<%O/Dm9y>8p.}/;?WKy(W~0~M5{󵿵4_M{]ٹ4k8y+{͡cd—*(y[ݿ|z~oUۡϴzp\*[g_'!({=asBj#~O#},~㫄z)4ikw1~6$7t?O}bMjk}9 w- Pw?+{rHa$I$Iaw>ߗ}yb?c2~hUB?h\_?cA?k]^/u '%zؿ?g;>|?y>tc}o>Lm^W߾{q3[<IXߴ{q;8WpYUslu~k~ +v_>vA_1=|Tf}:g5+1Yj)?lvmW~[N^'a6pKcĥӚƃRI7PKSg^W;cxI$I$I$I$I$I$I$I$I$I$I$I$m/ĒI$I$I$I$I$I$I$\wY}ۘ]O?+I$I$I$I$I$I$Yy5/ ?|N[TOU* K_MľϫT;+{ʭix5{?ۏx\};pgoEyl$N=?V|ѿ8ݷNO3qߗRmj߼vn3m ڽsEg_,CN^mh%~w91xvߢW`,)E3y~lus,~h/i-/C_NؽFܙ o}ĤY-<XԻ_[s1>U>bc㋞BI$I`;Csȹngrqs`Zנ,˼=pלw]9gw7#S[_T.d%[dv<>zpӇq9kUvuj+|sY]6[}e~ȵ>,L{r^8Xwg>~5]$~s?smz%oQ?yr^iI~ 8ᥡ#Qc搹ϓPsȘԪ>EuXot7bV$@ʱk_th?Gn'(I,[{~6w\~6[vuM囟{.?J)H]ﭬO0?XyG>Cqmp<~+)ݑJ[>;YFC/wLk&y[/%߬_/?~_X?mMz3Lp&W/K_m/߬_O\~z/q%`|nɪʃDΚ_?ٕmWLǂ3ĭ3gvcd8c}.Wq+e^ϥx~E.[¶{KenedF0؞e2ޏo%ucy?{9g+>,ر}n9,&6|/!c&9+ $J i7!^75޽_v;G-DI$I$I$I$I$I$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I$Z _zRI$I$I$I$I$I$KL?˱_jK[x|\WKh }]ժK;Y4Цx?kcVvO)M?*73ܾ}.?^W\6VŮ⽿\w̺~vWwۭŸ2Ȓz2j=[q')~xnª+o x-g1YW/wwoӎʮ#[]3tz_k_h;N_h?߲n;f6-8c6~:8x.n}}qpk~?cؾiȮw4%6j P/;,lJ̯8i$I.?d{@W1jhʧIq.@ת=h@UǑ_kW9-K~UO}`.Y ~]#ܕo6*xUZ$eV*,EqfW_WgzF=wk\_|Zw̞׊K裃{+}+5joUI߷Y}쭮m|)q}ari~&En<Xy/!aٱ~{SՏ͏w<6/J-$I$I$I$I$I$I%_vq^n]K3' <%r7#_pE]b3 w}xi,c.c;Pu_?{.{gwW~fm?/ٿwN`][1Y|x;-wP`y^?ez>CxWwS_釗ƹ' :D<0c6|=3YgD/Cfwzx>oힿ8Įں8Y6ͷ{OC*m ?[o1~h?Ż>y9uj?SsݦWI&.ky^e:-oѮ?UWY:-$%*Ϟ |<1[7wkmɦ9sҶ>vN> s}?Ss<+>UT19}sc?xS#eof 'N -2j~wju?]v#^/oŲ-. 'j=N.uqD.Yj8f9*ަgYpOc?8}y]ӅfSELҼv5]kȬ[>Szg+7ѳ1 b,T(mn;[]SU~5h&5#s=q|q派!d߅٬Fg?ў*lYi+;Y'gxvInCYF~kRYlCܿ:8ͫ3w~ƕh}eǪ~ gqVT;+>dR:~ofOmaʧW4uBߛ1rR7.u͸拾~cw޲%U8o?*@ a~57Oj(mO zgJzgJ#vu=5KRG/J5`ڪ5bT돥\oZjV60-%?ּjy=&g?_[q. T^X:?4"F(]gV^AdȈpt{a_-| _W<|vyz\bgK# $I$I%[?^=W~ETg/z_NI$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I/O c,3/[I$I$I$I$I$I$Xo x~Ec\LO3›v7L5oGK/;^tEpп??]߲QFwcrZ=;]5w7 2 y5\ q]?Gȏ?]ڻnUNc+09pZkHVmm ﳕx(}<9;-ɷa`^g||+/ݼ3=o.ҽgfd4Yޏޗ8<y/)uv{Z6a\ӿr/CnoۗM7A?_ŁqVÇCj[ eUIeቃ>(^v}"_m_@6q +})/е}7l@|w_enŬ_γ·vw8J~Z+R#С+7kԿ/ݗEٞ{u䴲}vUw ?T;߳ڋ᭼R}7T?ƿn߿z{Gmo~>rqy\CܼU6$sY`au-͑Kq].WVovַ?]+dUVO߬<̪?Ynv0[aYק?bznRB-ȶ )pANbQ\ےi\ri?Z%WUe?5_/~t\_o噜7 w(] \|ZZ,ˠ7Ylz\lA.qïͶ`۰de?I$I$]@^54[ʭ~_,vI$I$I$I$I$I$I$I$I$I$I$I$m/pǃjvz|0q湻7_|8}_w}. 9Cw1MOu8?"϶G5R~*?p_E oM{P"}g_EMo8GM>foEG$o,/H]M@kHM忽R?C3 ?mH;* c* w5R"H]M.foEC$o,#3"3So3Wc&'=o[~^k] ~_EKg*,{kH'~ ~I3"*lk?OEH(_p_EX퇬og Dž/i#~M?Q3),ϴ_ƉWp's]W}ӏ|~Cyدaɟ9??/L5fP&u=8o]h>֏䦳?M=<%9ߎ.wZGn4=oޟq>w3?z!1 λzm}>e]/vJ~/qȳOoU3?xQΜ?O,[yK+halv_=GzS9y,\?_+ F?Y8cl0vޝLb򌯵sӋ _s?^S"6b8N.D+I%gﶘ|_ij.d}_G y!d OYqpΣu}*=Oo~ѻ;ބn%_9ߢVQqul^Z>1Sc/v_z|>1ockW X̷twi_;y?-19_0ⴝWT3TP>N*l(-t}A~㘎kuIo, __͕W< 2<}6㏂u^3c~}ޟh O/߻qƽo/⧧+[Oo]/"W~v-88gTr6ÿ?{SuSve7;5|kW1u< _xeQBc'c{|ykMo|?|2_ )[+e}ߏ7\nyͮ_] kfOhXη12.Sa_i!޹/{eHw]G~}|Lzߵxrgӟ9,~ V@G;O0&B6CsW)B8>;{k9Ve2>lwavy_y²I$I$'P/<[-@ Q$I$I$I$I$I$I$I$I$I$I$I$IagW~v7& jy|7>~dSG-Ϸ;mo~(^I{+-?Y~?jljwGvG߶tN;?nvN`Q?w?jWQsh?TOn(ucXa̟S=?߼OEՀ^&gkVU Gʯ\~. rEqU2j?U=8Xޠ~2S۰3_*v@?T}WS}ޟV*Ƨ{Vwk%Nl^_)Od|U[%DHohA- -09)BU8ϴzPCc uܒ>7/!-;3?OAK?As?AIٹ,Awrw;Hw,q7=-l~ߧ忴?5:z *wGv@U]_<'_My^6=V^2c7"l9]-$*ǏO~+q9o~E}ڿث*w'ש hr}dcx+ ;ulctՓv?黆bSee>a3QE#%Zp=/g\jSOZVN yV#>/{א?Ȯӗ}M&:.so.R=:Tvq?K="~ F}O5v,MU}lpٰ]^IA:#\'x= k}7*Zx=v_}G831-LiWk"WJT1dgms(Wd15 v>Eu?lC?Zc[I,F9zoO A_Wk*nmͬUއ.)J6fCi/i]:'Q -wOeYc\汪(Vyd{1 迴/pfW}.,gQY,hW% m1szlz1햼c=~w?ysr{GpVyk]:sl mˑULw\1gߙIs;cgV0X%4[me^\A\{ӎ?2?K~r) *JZlX9?lRy=;?V>nv.ogΊr*c`kcf 2c%>vny'հ7 |RIPvOz^\f> 1kfY [-y$hOnup4xO5϶gLKWaf- K7#cgOڏW s87Ұ;nw+*i{%6?*?FK3Yk| r;^qTnvl?P[Nv4}?>gsiiagVl6So6"W~vG~`! '8}؎ 54^ҍU6p 6d*}N ~%J=G,|E8s ~eQznğXdʽów~݉ܪX)<'Uj;Ov՗~?w;h,DxԷhvs.Q?~"Ogz~y oPtWw.20b ~ ׫!Z2}&BUou(s=OB>pVO?h[}#fדNOy躾`̌p?}3}EHw\SWã*}x=otLJ01]~ߗW^c놳3\a}FE/Ȯ+~X_J+OGNܯyKY׌r^ifZ_g&&u.6b}-ĥ/a|l_;!;=>>-[ݰiXOʠQ;|O[ F~OЯv?5ߴK]5]8#wZ'eWfO ?,}W2ŷEhwF#+p>?dw}Ssmo\x/+ 5@c\mR:.߸aUVq=YݳOOGDqx-O +5&`r>%q8YTS^c3|װvgFC~of?g?˿^70ssgcP`vw=>Gq|EWw @ًeӯP^5sq{_JoC^COߦ=ibT[.=0>kwtF7m䴷?]<{F3s-}eUW<>x$-5(bc9~kvkژ6lZݧ{s1C9u r0go,?aۚn+vc+aNߖ?G—20lηIyL<^S-g A?Xg/@ M$I$I$I$I$I$I$I$I$I$I$I$IagWw>ۗ/U?>S;,{ųvXǫzKm{_i6NC$ex˧s+Xš5_#2wS]lVjYk&?۾wGVu⮟wsⶍ"[>w:}Z +2pwo2P g;/~~N3lca3wGg:d3~h}w@'7l yU[@eӣ r͕ߴ+Xkn;sW=>f̆s.-Kg=;U2Xlϊd_t︝!/`7c>~-M{_ka ^`Ja&K,9+vo~K/;_t}1*:黎}^d:xaKouX_x[iC/x︖vZfzj(sד:V{9TֻZ>ez\;;w~ɴq=ݗSpkIsGzޅX`U`qem w:.?s~g~#3\tOck lvO8Μ+S5[c}GZgz~w> Zg*UwD Be4sL[AfKgY+x²x]eKt:|ЫõB3qV6EE,i?t}Ͽbzg?mc[ݱtsC&{F`̫grYfX *\W\kT y'ڌw,[T* |J(zeB;-#HRyNgQ8xD|5A8c@+mxL;l!vs N p;|M9#ޱ\~k1.7iwΩ䮞?59#)7w@_7> zg;v^6KgD<><[4~vn0/i/+P>M;'sl;[:]GE5%YM~}_9O4+W?cxiT̬fME/WovI$I$I*@'/"6CVo?9zٟ Gi$I$I$I$I$I$I$I$I$I$I$I$I,?j.KOo`}?e{meYQ$ck/0R|w1wiµ/j$]W u^9y_ؿWb}8T2^׉sbA*IfGsWY%W엡">興~_|+sN_Zb̻Sc=en.S+c`53u't;]x~Wq[uD)$;>ܳʶ˃"4#y3~άvmw<[ +_r0{ui+s0̾qZ<Ǚ^я(ǹ5Α⮤Sr1M-1a,Ni\ry%# ]ma!nC򰫹\Gs.O5/;'zc}/J=2:yy/P5vj.,c̫I,ر;Cm5>?iyڬJ;N=d8ziyPVA~/|k4[=wlMm91-Ӽ9.6g0=e8:K -}=ޯ<~\_Y,w;gߪ{\'ɥy^ej-8yW[ :25|Wik8/ 2<11ًCjde~ljݽ/Y7Ҙ#y/x8ζ2H4y4?<\MK,T.î2IJ;F9$Xs~c=&UYDn>.K5x7k)Sn :UebWQ=yy=ǪqsV3ii+[v/wbV~vd@͋Yys|HAZzlv;3;Kn!_ӭudȹnω].lHVD9%ӏg7?Hd}v~J?IUر8?O ?׳UqÈ~o올>?iSr3;m?S,O׳Olj~Hv|f:7v~#z3xl x}+*70e6+gs&xόĄ{F1$Fvlnjg9ݢ;'ɋf#/׷Cga#qG${?]~ҫˊ,H오v~JGa~_#{?z>3e{˿3q:sLŬeX nUï;*xs+Jk+VS`"~cհ[W2:\;GU1<"ϧ#xoUk))ד^څOYO3]ع??ۦv^3=ƿJvC`B0aM'쯟{{3[;T6}RUaDsP|џdٿ?; U$I$I$Vx{rϳ?I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~乶;=7u\TYOQʴ{q_lx߇}N+p^Kٰcկꪏtm?y7K~ xC ؆N90.a'A${.,˹/87c_X#֞.^?MZ}wb-hkdc?&ȉ@zٮ ;Z3*n䙓JB,fNzS>QgxUcꆓ|SXQezzI$Z>cG#sv"PC&?{1ylU>kg]}!Oq%٤Kɾ܃suYpQw'c+Ov?ҟ/iϾOğ?xtr?ޅy$*=W<\Wqz?/uzWZ=/QY Z8+elƆ${  u?$J ܼڝ:iIC?QEr|,S6>C!*_t??U.?Āu;FcƘOy;M{yp Nf%\,@UqqP?w.+9VPk.n<*~';z)cl~޳ \s *Ǿ8?9恐q*xĻkOSw]\~ye6~qONp}sGu"?c; 9o'[uw{XSa-\>ݏ~;ln#,%{.;88%x/v6d߭(8oNoWk\$Y.辏'n@Z$I$I$F~B{bTv|e?iI$I$I$I$I$I$I$I$I$I$I$I,?jㅒ{~W/1E_j2{xp?Q}hokq)1zK>.:1w さ{]'VW-hc ߳pg_G.q;f5f轼7ԑZ_kG2󯷸uvzKӷW){/g;#ѵx.:o]=c-<4U+2)83}fpXؑ>mMfc%kG3ssX*hcį)lu]- ,/ݓ;%\v`p?k)*= _m-BgN/l3!7Y]/Cj.QӄUg`?/;ٿ[oz^x蘝f28w#Z,p{C#Yþp'#yo.:iNF;]i홸«,gctec]g|f|]=[]4p?"ct쵏0 KQ{QY#Ow%vj_[˜x.No}y q$rv^ y {x#=ލNsozhx]ao$Ϩ_/с28kI\/oY[8et2%wgsoy" ,lsZM8_,\}PWqZ݇cLm`kdtZ=Znj{ocrTrnn'U? [ߦHQmZ{`P몛iy([z+4eO:Q5ӎaZP"^:!3G7+7V=9q}K[*QuS3NI{fUwwrh{~gx>_qq.{On9;8ϛ{6?.{Xd8jѳ&fcp7#s1CɦL*ޣKҟdٿ7; U$I$I$o~W?jv{G-4I$I$I$I$I$I$I$I$I$I$I$I%;_^KN8G4o;?jD<Ul.,z68|}kGW}>qp!}ӎ[q n^g?E ~r=W?{{~|Lp]_g'z޷8yFfO^_Y=+ϻe6q8>hL|\|uOw5U<߶ާH' /_>(>cY/LV~q]:K?''˃׵p<{{x#gdG= `EoL~_Ece~늾.9ׂccg]`_nx_<1~,|.n/G'j?v{3%CPDot ɠ~H0}w5V'v!>_c?|0*:瑏^Lto1`dpOS_t\0?H?* 3"7oEs8+#O8}ܵ໏f}38xϊ3VOj~v]W@;a?x|CGVEhe;tAa\zw)ng^z\?W#>^+?f^wާ8<]RK︞uQ<=?]+ͭ3^84ԟUh7'a=!VʳҬ̼.j><׮}~?qoaq}%>_SWÒ;m!9*c|K?|Y/څIK&>}*^/C>cN=/Ǝr$})LS*kozO3*՟e]?\{잏l5:@qLWp?II 5JA3/}~~>U I7 7A[ OoV~k}-@7Z3'M?/?veqzOL8>Z8z!Op~z돪=/}|9:?bevJj!rq_?u໿e~ώkGwT~Wwg?Vm\н?5w/ѥO_ԫ6ϧY9ǒKu{7ajI$I$q mSA}hxI$I$I$I$I$I$I$I$I$I$I$I$c3Kr m4FL=tyn j4ӎӐ1{4/Rŵ9Uc-x-"O%g@Mi3b`vRag]Y n 0xkIJMNTY/p*}{tg4?g?~1mUQN} `ky:I,{~+XXIim}=Gxq?1S;gL#y?p2?HZx㪾ʲJf&o_˻6Y.?^߲_gcpc_dȸY3֥_eMb@;mjbSCi5EHYd=\~/VxFo/Uf?tLh:~m_7mcߍ$dcpZɃ[ BJq}ΑVU~H`?}??6_i׺`E~ʹZ]eu5O^Cxkāe52chAI%wǸwKޅXe G4r=adlw,\nDgV~[s wwL{ ew˯.}hv>C.X.wL_Je%x[_h`S[ ~dϏ43lv^~ۋGƓwX+8'7}N)?W]ts]_Ձ>ڽ_K<^iSU<,o #rȺ>ʾ~kQ.=UGwV_c6ֿWlOA~[J}Uߊs=ߵ׌ڿ?ġv{|ɶ"?kg)ƶU e4 <7خrauUԑ>j~}Ǘ^=?E3@G@rqE`E׹@8EE½e'uxݫW67\l9,xP*ʶ{}վvZ '˟eGQEO+6bc!UΕUc87^3>بykIuK[?{B{ߓpr%7k3}'܂2.?fU:rv_Rrn.={|PݓwԌY"ܿrPg!!c_.en_{b)k"VSo^8krz\b+'42^ip'A̛N7G@ZB.dgeb:S]C\ 3YU'ϒ` |W?uj*a5e :98=״t$z5o_I}fX-TI$I$Y?i n #`y۟v@~o:? I$I$I$I$I$I$I$I$I$I$I$I$IagQKOD.M84puaQQv{U/zCmi=Jޝy(awX\?ӿiYw]0?#zrob|C<y{dNy{dNv._i޸7'yw!~w _Ixe/xe/xe/+;|//y"2}^WKfWKfWKfWKfWKfWKfWL{'z<{2;^WB3D3r~{;'z7'yw(~ ]J;/x3~7?w?=oܦݤdGS]XW-'QAܗWs(=jUKTNߟFmo v=]ZUϺ/VпUfqJl_,UBnYoTc1:j?o;(YMn xZ>&8r}vq} ?J~)W]"]'W}’?ӷ*Fc$|uҦڸY:d oi[߁l]s%fљMM(xx}/ⱥ9K[}3FYDOWUܨ:xZOW=S?w_clf7LKnpa[?g?/;1-+x&8tW}J8">K?i%iv_zޯ8<ҿw>CyڼC2yӮ򱿅gg{&g6VOtɹS};Y[(݇bp}1R?die,pkwu7!64~{;5Y2/7l_]߹_qzn;S-[]\_[;Dм{n M ĸ'_Hb5 +~U{xpdz9xO_]Ew p?Ξ /KBH f9s^+&{/O݈ctGf~ڗy#]]Ǟk.a'?Vm౯_?\]%DZ ;Q35x:>*d:ZV_NH«xtoUC?PUFʶ7փH N=#VvE?J…j}{ox|\K1}-<54 Ǝ[múaJ>-81yiQtݕ]TVlt$.L{=ꯩeTK\ '"{>F>uO 䳭]dct.i1Z_kwp[Ĺs }ayG'J>Es*{pfo/&n.T[/(?Ag/+1!xw]Z~ SV6O1V\n'ڳ=Onwf?6=eؿW9p=ٰsG8o^[|µZڨ[,.s`_Bw_ghgvq{<;uve:7Į?d:68kaK58_3[1cORvWpVN95(U)bw7M?embWܩ6V01봗ƈU2[ G 7 "wz~/?޻?mh//?}AN[c};"l*NT}, }, }gn&Z+}>o$:{}tԮ= T?{/fWۮkj> UdLj#e=gis~%_ih5+\%Rݮ_HViCf~_{3'cٿW?z }.?RsO~I7%_c;!7ߪ?=}_Q_S_My58_-g\M|Z=Ύs/Y-<vF;Z*dmMkTISCUc(8zZTIYm~J}iQs]pkŧڌ'b]}~xs6Q[^+\v-3?`ߵ'_ۗG4?;bSW? ٚ\{7/q9h *?/XX״dcfV0`l r'w5_e\Uv+pN2rXqe!"gMWd{6~5ζct?$Ns?»V_ɿˬ85sJV9BGxOIb³*vI3GWlڟܩh"v[ec+|B9?>͔{y⼺K+sP;ݽ+[[!ߊ6lahFi!Y^+H~U\+K _xTX׻^ Ʀh1?o^I̻z=^m?^5't?勗.};ytǓ_߱2 c,-;]漿 }LЈ}KW%FO?N$//~Oa?fɹ\3~T o{q,?q޿uxy/V콏/?S[qh߃{7;`SS{*g$5?r^Fcs'׈+5y?gƧ~EgGv|.h?LmP<~pe?a ̧!浻vel$]!MSKҺG0ICytR҃<(>X2:76Hip{]ZU,o#➊]YIK'[ݻbQj&t_kn-ksʼnq(.õk2ɀ'F*'۱-eGvG;yfG軕5bN*ٺDw|^ˋ{/mFё3 uu]A+^}fC+%ސ'b>v#X_j>7g8^j'ڮ۱ۍUt338Xuے`ѳcHsՅPo7*xΟy`{7ؚO&x43NX7q~M\dO  _.}w3+8vnYƲ=5x-I$Iy;]wA+eq\g㱎dxʾ/gH;$-lOiؾ㷹deSaV?1[ 2yׯy-w0q{@<[gſc=W~s?TvϳNfXD޳_Dg?Ygf+;. >gKf`x.>Xmcv{.kK+yyQ?gpc?iSŭֺNJ2^Z+/q5un> *ZVio잾oOs C\?6{ʵo~gN3]醞?^ 2;plGSW5{U%5ߍmnwqmVq{ULL:gg5?3\=? 溟S` w9k;_k8.`zq⼏uoPu_M}ؽ拘.qvVbz'X̏]2ͷ@-&Uivӏy<r^2^G^$Ӧ"{r`uf3D(\+BǛLv>ύ>5`Z{(X4G}ُ%j|@XyS392Ťl*8Ud?ܣK2'R1U!t/uT$*#6۽R³m̲@>_?sRm{g,//iXko~?n͏@oNp_rI$I$I$I$I$I$I$I$I$I$I$I$ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ߵ_W? jZhG*)~zgjv[?zJXLaguU;u]gsܽ6}J=<9_)ߣ4*0>'ezN( 8!ͭAs_gs^ꏦ}3^ .w6o\-^7c8~:G\jMe,kGk,;|L )"&Ǚ[-mF,~qOOyY.?ۖqPc;skxG@M I$I$c=xDF m֐nߟ_U~s`i?r.]>93AX9y̜S;h9˗<ԽYKy%7 Wx|Wic?mNi ͜g *9I/;Y8yY_yovf`gs?Xe;FP~C^(N?T*Lmksoe;.mSAC'l?kr/_e_xD Eeǘ8䫗8W ]Yy=Jf?U?>.wfe=C1{,1JvX4Z]V>w/{;oJRI$3;_m6vxeϭ.ufεф ,<WqzL \m_J;* 3^Cv=V|۱N5&X \;~3yT̻^;Oig՜/mQ}2K}]eoRs}þn:Ao5hl|5,/;2P]c5z8gWo^*qox= ߏM/R>e|;&;G֘ZUa LnZ_2#a[ڨsY u^I$I$o,wj2?eysW_glaI9S  gR=7W &9|A=Ԙl$xE>wwя>6݋ӯ̪;]zvq_%wWk/:I+q_'dRNo#CkTs\J֧+=/ʹ(GKWɻG />ͱ|k?.{bTv|}ŎWU-2~v쌇TZLx]g}>)!meٖ=Zc*Oj/y]VWX.NߗM%|/C܌w@~xQwL? *}xT_Sh{?v*CiD}'_/Qؿ?'e,pL~6}ig]ː_$~kXy/w}V˅.n5Y]}G^ɐOF=󵷝ܻ~v._^u0~2&?';?W}2qcۓutaq2a{-% J>ƗsCkOA_*;/ڞŏ_̾k©iͰFGߴuo^& ڗT]k̤kw"ԸPCp?G+ǾܐTho^_;=xI$I$I$I$I$I$I$I$I$I$I$I$m/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$^k5%Ozgz_VqYˢKVg5qG?o+C_Uʳ_/ʺo7glWq̟mv.^[]z Y3=r???ds=?W64/Ea3w[ЏOs]p亾J5nO?YyOaƾw__|gPj?x}zrf~홈q >W{(~zN( ߱?(GS?xXno#]?a_֌/K}bO.wokx!SĴ\RI$I%k-oD~nGDuׂ=ܐkU2n+_گw{4dKkq> ۏ5p=<~qo\OoPgܢٿZO m\#Z53}qLJXvc~|py;w-/8G%qwwGo^5ܬ9B9Zʲ0~K2}.> se2ˣM?SwmSgޫ 2kC~JzIXw)]#wڏN?L*?iɿ/Wz3#cz'ٟ3ߩ%.wk=qc]n'M&}/i>H 6}oCdg!; OEBnQ/7)^3&z_e??j$I$I$I$I$I$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$Ib}gy/<Y,O%dgN^%.y>~..cDLO!gڮذ~ŧG1Cm~cжx=a0Uo߻G@vsW9g.kwjxe}#,]?o//v..#??k^a>KXvh^?-PLz?пca_}w/߅6\CVJ|;~aɟS\_owbV.33ko M_NW ">~-mNu}LEUۑS=: ĒI$c~ ~fG=|ܔ=[+0ϲ}CoZ>|{Epr+~_,vI$I$I$I$I$I$I$I$I$I$I$I$m/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I1!`.'+3M3}w SؗdpG Ѿߋq꾧Scx#z.?W'฻{J nxi7C7?WogI(d?߱{a}wO)\#ܼ1zRo}۵*zGvZá^M4Ou?C(ȹziT^iN~ }<[q}z%xe6pq./K/0w fI/;nwsxAkMWgQUB+a894>*L,˻{}i?wu*}NƠbJ@M/sǏRi,dU?fsklw.M3h>Xg*g1ZX+ݍotq3ռ|\/|I%jx-d|˓WEs;~Cgb'?=;bfe/012214 a%gus{?mmS|Y )v70)7`}f12xjَ/}ֈ¼nTo%+<[XSYu:# ~}; ?7fkPN>Ez}Oi ^jm,4uXrT -cJe8ꇙ SwVq+[B76SXv2[O?u}m(8嚹Ys~KxL:, ,xY-?ۗ5n_-I$I$I$g5cGѮX8ENJ,C1k~=z+m6?>0rZ}c\ʮ`2t)춷N'Ÿm_9tOM@n9GU.1lq[>l+ߴ_g;F/3O\ Ue[H2=l]¬ZsCc#B]t|n~׵"?Wϓo}33|YˏÔ$q~5=.&Uae~L.~9}&cxݫ?VEt8e}=c6x1 ?؎;97cusxzx.KwV[X~o5~}/)d˶v[uWW=wnez\&3c]y}i[+uZAEY'/XfaÃĒIyWԛW _?^ {)mr6߇'q!ܾ~<w.1dZ=g5_FKdeg$.: 3; | q?n/}dc1chmgXJ?ݱ=|.Qz7d=޽.xckzO՛wa,PweUJwj[d(wfnI*}UZ+mZ{N@(h >뭼\΅_w'O+w%{Clq8upzM҈= ]&2^'=3cZ\qyxXv^ZI*__IO{GAܻ}YUdY1Ό~)Sm+ L=>fLFd>1 30|;e^&~PN6`4̎:8rf6|E`JKCR/pisr~?k$I$I$I$zƛZ?\kxmvC P ~UwSzQUosac75?]}E4Ƹb?]kI$I$Xj]mpW@پg<I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I,/=܋}LGV}=!}Tl]_;Gȏ)&qy"| bUF0CrTh?+|l*@K9~U~'~ݙ?+y4']<6ǚ_Sb}{,?QKųj. eso~EK~e ?keI$I$Ic}oo~Bx{_/f/@ M$I$I$I$I$I$I$I$I$I$I$I$IagVI$I$I$I$I$I$I$I$I$I$I$I$I$I$kZ \=1zh4z6(y?W߿\]>ݟޛ;i1 ;U`ꟂZ7c.?twZǸAq!w?o%eeM{=\{lplP ;eoq;zo$I+^I/-E+VɿS^/ȡ'5w5R̋0^WY} ;6_Nw Lq5R<s|󟑑Uqv+ 2wUI$Ib}$vG+ƾ9߾o>_,I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$!CԹ .Vם*8z@U7޻|1[D>k×-~sۏ>6}3|_v=b]Ew\,.JIh<$G?ڳvcPl𻜟%ɿyp\\ kY5cކ`o;r~O7W}홿3_ (TgC*x5=;FEճp5M!hkato>}e313K[&,iUrǢ۩ce\moy =Ʊp0yߘ̜w>b:.ñ}9zټ<\17*{fl7|]=+g_CiTwuxw+hd,g`y[lvKtOgb}L=W_;y.=h0 gpNRQWO? nWsk=?O`Dϊ/NCퟶżUoc[YSWa[1]\W#/C=/h #ҳWw~۲{}Uw8O­q;ݾi+%?jᮻxx+wEϾ?ھ郛+}T#VSo_O"I$I$ epٌgg[mFJ8HUf}6nw_v_fَvK/w".xOݻpԹ&Bzd׭KrϲhF~/;31÷ha֯,q/׻n+_abq 3|hf3oV}__s?!_0/ޏ҈^;_l,Y~M~_;~^ }>[}QػwLlNq7dϱŸ /'?Nn[Xm~Tl;vsݦ_K-a<44Ic}ˌ~~Bkj6=|_e??j$I$I$I$I$I$I$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I%kŗ_d?ʼn [_Mxp_NaX?q30ЏG<_w%w9,<쏽zjwj8ݿ>/QɟlKczUb*eQ[P'ÿD+42P'Fv7g =\W'*~..-W7dLJҫӟO[nW}ە\T}~{V;`ُ~8.LƿK^2Y^W?vNuo6r=302;OK9gf}gyWhĪ)t§%|"I$ID>Jc_siz|W8N)'^G{s>xx> uaoO]c숙igO"ϷCwO]ks?$w.Qqjt1QatX8FROG+_ET7żSЏ/?n;'/_57uTuU,lp~4rxl>ދ;XOg~!;l<ޮL_1}a|QI`okW}ss{oovZ$I$I$I$I$I$I$I$I$I$I$I$Kv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$I$I$IyO{o|1?iq? ?Gks^Z'{kCrx}= z/wmmcp|gr=?OuoټMq=R}K<~+iNp= Y?d~x~<饟IoٸK?f,igGg٧s-l Nߊlj:<-yVT^ƼCWr1_Vx5* T:{gg`#L7`NEcaiW}=ʻr) #R|/u7k왗7,n5~+q* ijՁIp0CB@zl+oEaV]dB]5D >I%#/oɟ;//h>fgγaZVQ?zKXvNfqHǧwO,?GH1|ח~!צB{KHwVѩU;U,.MY>8b} Wx9XicE? s/3iq \cA˻XX%j֏UmuB4*_K W(p'ezoᮓ=<,0>K;w^7zkk}*L,L{e~vNهٲ. ߬<Gez4l}~cUW?ImzG#{vK3k[Z8-ǂO[2~(ļ#E]!ޅY(ЋE1Ҏi#ٯi곸OGu஗$?%Lj^GwN{'&R;fW}5h9{o_NI$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$K~ڲ~{x>p7#Լaon]SE.ʰ=c+g@mf~~wf<{?iwpx>AąݻUcṞ,Oߺ܃yݿʠub_;k{ͼ^cT~;U-pw?_>|ϩ~Jwo)?L?/諶wx wϨ j{ 0{AnEtxd6;=;kI?)D l Ywb}e7Fc޸lk+9pk (쮖YJ{_j٘5g~*Yc?#'fcR^ֶ|Y_ݱEvW*{xye0zV}EFE?od#עK;q>/-ln^k5SYKGɿmXǷU{){} }2 m68qtiXM-ʸ8AtƬ2c&,cKdG5;s/R;~jnEÎZ+5(}%.^}V2YR+Mw!fUڮ}1Kc k?L,诼C[08 X_zsCF|>w?W}vmccg'xg&cg# xg&c_g? Iv~_o;?i79 _Kl>8F?qzUwM6@\NE_yFdȰ;oE}ڻc&1Ճq%fWw`YDY²f=s;E#O#xZLs^*ȣ['DuY] ?Ͱ].+ @хٻN+pޟ޲W^wg^+>۾_tot BKٷEd)c1{ھۇ|ޙ.v>뙕.{}xw`n=CJTjV}GVUs;]W٦VCH U{mӧ}οK>Ç>k;7y W1m_?}>ßoj)EecsC-/W,j'gm)=/S{joޞQ{jWc6|XZ^Epawgئv©S=siwllpn{g_tw^ٓCEQ:Zhqje,cGYEƦjwAաL,L6yÇ2>v o1*ɏw+jwt8Ǣ6ek<I$I$I$I$I$I$I$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$I$NK1x߂OhpO$z|Fg_~T׏hvwhur?45~K_ޱq>eX\@~^sٻ%]ʗYv׏,/[}boЁ 4~g>7?w '۱nR`v?aww b;w =|o;}?۱'wݏgϰ?9+Z}9{?sa}_?~b8sOY!Znjx} w1lr~ 7rŨ=qrխ+쿱Ҫ6*~imvnӑn~ s8mUNfv2]~46y9]`_s pJI$w~EX`?i}>)\|=[N3%AYr{uvXm ρW~|m OywS*yXڟd]j9:ڝ3k]LK,GG_nKš7rOs nUL{2%n{nMӂ p6Eڹ+N͊N$~w]:I$I$m<^yyogRu q?.'tcF+]&=q#&k\wij {L~0pߟKߋ-Z^>w k_;VÔxj6琢,$/wjKy9q\? ߕNZ8J/=? .͂@L}Ef$W?{}؟YiKmZ+k}\{'o[E6?G?5ܤ~ TOg/P#k/+ߎ Y5u}7i;Ai-I$I$I$I$I$I$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I.h?fT_Aj̳;p}8ZlPѳ~a->2q ?HϨ֎G+e?t帹V6 ԿĎU}k_핯mI$I$I%sŏ~;oNG//UOIo|L+s .o-ٶM]ϴؽWW xuue8˝%Ӱq𝫟fiATI$wןߎ*ؚO&xyg ˱o:~D,:r>oS6vjCr'}=jߵ/.OώfG~`Z+&a_ '{l"?r?./yGZ"/s{OZX[|>s[ޡJכkY<WXt-?I$I$L=/n-kI]@+.{{WXN'%5_,KEBB}M䯘K;TYy˾KZ$xO3ؼ 4|kc_ytDkU|kIz&+88O'Z?C,U2.vDqtYY+WL>{q\=b~DWO??mj{[>?oW ^g>C6-}ԏ5tUZOz1)b[Y.iW*5}Qƴ{OLpWfeYXcүU-?,x0Kz_[";nzI$I$I$I$I$I$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I//kyt59=.>ew+K݃sOk7wj?Ri1]~d0RI$I$Ibw|"c'ӧ/qhuBY|vswo#n};m7UeEa>ku$I%?"?j0v=?Q "ys; };ڞۯdzG[;{]0=R~}콰dJ.]ײps~+n=M+Ϟ76"k3i 54} _3 F{ u+gs8b?F]bȻ/Qm{(h}37:[4O>_ܪ ڳG/uf31{6>C-g?WLkplc.1@G%;Fce_m %?쯰ie}ݫ;qX.cwnߍQmpՙ_6W>M;smep7g\wbiW{G_xW{ؕ? q}$r:j3qʸZ&L$I$I/wp?l?3½I$Px$I$I$I$JI$I$I$J/ $.)@^90ikڿWv"I%dgwb ] [({Jޛy%]7bȩwGzs_ܮsy{"IЪ8ep>hd~8~m<5L,MಋxljugkO+,79|cdUoˡ坖fX@h]Ҽvd:q7v;-}~{n?*m`sUos^(tMWԮPӵfq\6+]w3j{zOf1=_ޫ$I$I/흿.<_tn[??y\m}0{4r7ٗ"Ru;@Rx5~wsk~Moqy+dIoupRפI$I$I$I$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$Xi;ٻ觃+{O}B=y[ 3STٕ/SqLn?~Don%?޿ħk6sU]==sU2{r≇F^'w/eVuI$KV;~^c,?moN; q?qC|})%|;^1.tI$I$I/\=Y7|U>ڜ&ln^BvJJ!TI$I$I$I$I$I$I$I$NoNڻ2[i${:~݋lw_evh鞪ӰϙFg xJΩ%_>8}9U2[5[>.v\?Wp]gg[1?zNzGp3/'g tw+cD}9SC ʽx~Yoչ]˲x͖ďn9%;޽/puXgCjwy__,w?B۾Qø]ٽ:g<-'Ee+;W}le_qX]wz殿U}z$I$I$J^!Z˅Et:>OφѿL~oEo3"kH?"g6T,v_\]?wq hz\7+㏒fzfUkף$I$I$I$I$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$Y?h0qlˉŏt^#Go[M=*<_Zgo-ey@ds2#Hzr-<^'*d\\w4 8-dQ\e5ru[ n_lґ;~?ikІLl39͟hÿ6~+~ߴfK.6~w/˸xdBLJ܆L1GڻtWw]uh ^ٿ|WI$I$KǾ9Ǿc/ҽ/HwV_Y~q{}\;e5۝[%"oo*C/U?ϴa}AȮQV7[bHWgro#zdI$I$I$I$I$I$ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$H90gn3+;v۝w[?v\<.da}|OSc8w:I}Z 3{o0ǹ\qFM@vqM&՞>v3mήcWzOToپm.{c.b{_7WOze9N$I$\}5nOy;9zZ& \}A pflo ]9;_*#;1j-+#e7WI$I$[ۻ}~%/.&*7tr_Rc݃B?~_{V'K J_=C1~d/yg'g X?iEOj!@ek4F\;Mxzt\ñ单\N|䚜<+n=!M?ʗP9ZY1aeh^ o\W{s]|Oh\rߚſw]q5G_I$I$K>&'t~ !Z6cRneg|'׽7;Eqݳfϯ]_*EL8ǒ+;8F+YݿKr2i{y/_k? M޾sVSo#zdI$I$I$I$I$I$ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$I$y'L5Xjmq}|@s}ZC+V=gS=>K0!J?P/74pp_5ޯomwb%-Wػj |o K;uN}|kI9D^^%}dNT I$I$jB69n^oڞ߀~XVeP*"q>+흃3 bc-!w ?_tזY~ڹw#W}/^mk]kj$I$I$I$I$I$I$I$I$I$I$I$I$^2k~N+Һ^g>?~'ؼ*!vgC^yUy=xa]c8YGcpd>mPwmZ͓{xnVprrkn*k W_}r1OG +-gc!u?ijLU]P{5w%L,%A;3O}'\|KhPuUw- bWK.lsh.UG4n iJȶgw {orCsQh03i5^?ma\y.`C-W~6?XzI$I$W{Kb ~Sy'W0'kTs,s;]Kܾh]{ȟ7"Ӌe Dn}^] .% roި f:Y8/b'w|k~vֆ߃H,W? kף$I$I$I$I$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$I%}x}}^L> ¾AC,A?fpO\O[Cfv/ޟ[?^UfEi&Z|t3Y.#^Ot~pyCd1wy5q9֜i"o+sS B6|`蚎Mlɋ}~ݛ^o>65^I$I$I$I$I$I$I$I$I$I$I$I$J.qxе?pN>6K-k-kQ$3NV.]Q!A\49Y^[v3ho]#xO_󏫧˳]`Otؿ7bSM -`YG3G|O ;O/l?? 78GԿO1|O $Wi}O|O Yo@vĕ?_%w'_I]W+ ?53:c]1{W'GI}'_1;UHi}l{q?/+&pYV—^zWJ;cr9\h=߰XI48o]vhm.bI$I$x½W S^S9|o޼o_ s*ߜK\Q 'Ӑx,?hÓ? MM:~I$I$I$I$I$I$m/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$r1hɏU\<}콱i2ɣ_;7m]t8qzU?v_W.^?^zj^6ՙk˞0>Xי{c[zw羹qmT}9j ?^KavOn-s=2Q 'mI$I$Jv|J;Vf[T|'q2{^ W){{"a;~ 2$I$I$I$I$I$I$I$I$I$I$I$I$b_>?w?'{=7 *I([Uw6$&leKS|YCڷ* #:x3꘵䛈X:64@qV@S-ƺo5-v'W7ES&L^F׃̋4/~CvvP0,A s{~Ģ^sW~Wݸw+14},z^y=omuJ|?;#r;~?kO> .2LI$I$K~[cuOw S^W8͍@ל3yV*DzNE :T2Zx>}毠>ʓ{9<'7\WƟw$I$I$I$I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$Ie=?9>q@6iw.U~!'x,q6sLٝYU0~/F.smf?krWncV%1iprGK=N's:/_V~GOdmn鿶}][{=Weww+>|l^kgq?1~K=g.VJbl53m^w<3} :j>&AfMY<t v^y9No0N_Ureps1&SE$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%?o.j?ڿW$+$I&w$JMV=P %홣=~|O|>\߰j,H/3ٵ\exD,Gew=&V ʹAʹ+-+صY*^~b3j}L{O_"?';i__؏gq>v~ڢk}԰p)uyqle5Pvv* sׅqD{]KL}giieg [on38.7GUߴ~q96=;9Uma},>KQ$I$Ix_}ۗbͰςO~&~==~Ui?F4PX}-"'iޅ~do ś˸I$I$I$I$I$I$IagVI$I$I$I$I$I$I$I$I$I$I$I$I$KbS\O?쓷ٗZjXxGbc鱃>p?YGL覯<|>lfp|c9E/rm~WƏ^Si%Sh|wzrn|qO?{n6z]fgo[OEG7?%~Gf#KWDqo%ud~Pg8`}+Sؾ&~WG0%vl/+<#foEO$.􊃿$_Gc?/lZE;iw[ӮxxĮ';ڠ[qv<_ݽ߫+r, SU8VoN/ppug>a?CCz?/e޷q./V86,9#?veC/OGݸ>K.|~._!}rƾȯ{g|$x#Sgyvzl.?eoSqg^+~< qfz&ysq;wk;~P`ouk47w8$z_7PpaR?aof?sl}N7t^G9i?z&W:[IMo㪥i :J86{/ٝNA+ijS+OI^ĒI$I$I$I$I$I$ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$w/L5cRs#/H&|K;+:osl򅙶hٽAPWr[k+ k*kI%g蒋SxQMm+d=jIsm̪^s*mKҾô3GF/'ۿ]G%wۿ؟nw8~ox5rSG#0>?층 G옶9\m.{h+76_V_n.<|ܯ kH;W;zqx\M;-tv_a^,Dqwo4]nv_i pZݲG 8KgYs ?}ߩ)8Ymyk󭡾Cdxwrhh^r{FChs\?|{Kd+@Tz;poR?ػ-֗!vbC}r|YOo#jd{hqmk[-Bi3͕~j?3+ku2mY.su~h쫸U]?0mO?kA>~GW?2yqe{?#Qƾ2?zt6"WF5o+a5 ηkD1yY݃-"O?iz~[oax _}wsRI$I$I$I$I$I$Xm㱙%~ոI$I$I$I$I$I$I$I$I$I$I$I$I$?G?#?g8_b*so)Ӑ/Tqj㢝.7G[})] _Vq/`Fa#kٿWvsy/dI%İvaWWU.:^+;8g[i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$T0~wS_wS_wS?q3/hgB_ur+W@`5_ !F?ܰP&#U@XmXH\'l{O53U5ۯx~564\4ߵ?g;mv;E.Ӡyy.}#1g>3+tk>w4Ro(\ޗ|${C ǒpX\+)}xݺƛ_&&:ڙn8~q^_]^>Ⱦ1;s>KMWvv*jgm)=r-qk0wn¯~K#%tw_6zq%Xa=r@0G W*cwn0_CAS!~8ecK%C禥??zjf7٪pXͭ;Cۿ5xg2tX9K[YGzj~!S~vsi7/fo鿴Woj㓚 wqɱ?zrr*nn( h 'Io}kyNzy3OE M.$I$I$I$I$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$I/,&?ygjWs-sK[K'6 v;a"5m}>}3^~rMssOW Cm]<SfIFnBϲ?+ҒIq7ShK[#)s7o8_gHrڥ᎔G~2K掫"V?-+;]>?m{_v!&Ē^'޾em9xy?\_jw~k kv[?}>z5s՟4G?n?ycYivz}>>w</?=9O5fV:[xF=&y5tUg:z,1 ygfgQ볋ԏwSSG? ęE@jp:?z? N=j"%Ow6ӻ֯n?VEޫi$K?z1?ןQV.r[ʟ.%rݝ *} :V9?ksZ#\tI$I$I$I$I$I$ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$I$FLz{د=vf`o>_'/GEX9Qex⣷wϴ97Hq⺿?g;7j1/Sp=?/M6p؁]ݿ3~[Y{_J}/SL: ~EIރ3&S}{}?jp?SzDx/6-n7ۮU^7с%1fv囗nL ٻotSOX' ~NjUki>`xԈ쥷#mKg?a{[<3Z$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KK[O{1ޅ_ %A?@?rm~`'aൢ Akgtw1*JozȰŶWF?-~ eߺ~ eas%kCUR~D#QFU뭜|Nl~WBqe .,2?o)~_-7w&BK KMzݧhm$Ixh?i?zkhe"]kk>ϥXjkkt{{WN[cc.߷`ǯzpdW=ztH0|Bw*ULOUuOU7{߶_i8Gg_!W1wg_ 71G]lُ?3g'o|C3g#ߴfEW~#y3G}-pAgϴ??iuc{wrޭ=?O@DςRI$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$fgbZkLO"f73af*w[867vݻ_zJӾ&~Nj/K-_poJW>{zjx1|N^prz˧',dHĴٞ~[^,~x5⃳.}/W4q._c4]JM^funsuȷwqƺcdp/ɯhX2I,/] 33BI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^w+Wto &ח\o۬< lwTs9?%-gwb{'o5î<|[|q4rx>ߘ>ؽ9_K_T&=ϮˏLj6N,gM#jq1:5zXC +8}տ˫`Wk_ {in;/c} 7fڭOٜojonfCI?=A>%Es]ؿvKwc^Of'=sT.߻Ok³//#Ңw Ib3e}?鍿+}`יgl1ZIxpi?z!)\DoQ}Qmo)W3V/ ѐ2sxB]{d; 73ȫoWcr+e hm?[ɧ/K6MokvEGڍeo, }PSn*]5_%oms_aqo^u?d?5Q<3h{l`sLI$I$Kv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$I$Iql~oAVml^w+]Ľ.='O/1egL _?f*5|7e Jņ~OҌW:f=;F?ay?NڽS ,Z/-#+qgH;l׻dr I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iqh;'z<\:^[ݿz{xdo;+x.sx_^kx6of~x cv^+Irzgnߧǜ{b:ϾpC?!?wy^O)v?⪿KAjؽ]ٜpz߅llܸn} -r>;lSx9RggX({!bw+gb_pKj?zOW~y.kZj~zG33%v.VWq{fy^C_u_?1q+Gݻ]- v'Z/}Χ<^伯'/^V&^'Cj]WٯYz'_1۟/_ʾ;#-wϲ9v}Veb_yD<eWuLc/\7þdY]AcM}]WtCswyL?s ~(]I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J5]ay.7Q3+?ol-~o*]+쵟sc,&Ix+}YuTeP`;S6[P97^Տms˛+3wNR'勊2㝇x55ݲx*Iw#Xg͚uekHP?ȘԳ-7g^v)_gRу@Y֠{K}>XPێ+z~ԙ\uܧ1faU?@?G~)$ιx~EG"v*޹E_ufoq}p}ov3+鷈zg^$/ۿqW.ńv{U=9?iC;8;UQ(߲ݣN?vlFgxi(]15~5f;3͌_ԻW$7v\p~eca{-]I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I(]UWk\$.cFlэC'<j|ФpٿCngiX osY}cnȩ?a;Z4cPwS:1^cP|Un{g~ב OK~%o\?0\wfK18=>3 [,?=S#.Ӟ0yfZ!<-_g2G\G7[#B͟i14gXxzЉAsVHƖwwb>eo|}Orogzqͧ w߻7L=0GyOoFp"Rg?gwq򽟶02NUVߵTn3Y?vW,%.cٌV].VdSe/`b8͍@כ/_Jx&zM{+7}?zvwl~;LkwfKhUp wkp5:T6֘!z;NT?̟ڸzO=8sLmlPGOx~CE~wu5UޡnbW_eutr}xE?[h?=wOO`S>A3WUc0~ԭ cD5 I$I$I,?jI$I$I$I$I$I$I$I$I$I$I$I$I$TX/5}.= q>߀[$I$I$I*=ќ|(}̮hNI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KWn}-s ɾ[ 459w}kab:ً]D$2?Yc}QC\6rmcϳyپuhsT4O?u?agl^ x>^KAUbxK;2*A1Y9?j~7woCl{a_jڞbɭ|qrg?5Gpʍ;ȝBsPue+wV?szO ^<]U³ϧ=eBMl -v}Umxח9G h]?p{uFQ&k[?wٳnn=tdMp^yKkG?pPfy-N5^)6I^۾g񟤫S]gb=-X['y/;_l)Z0Zg҆X@3RӸ>o'́[%n{m2cwr]/_p}q3Fmx`?+Z*y+S_wOYeou@R2\ԏlo\Wۻ}=2xmX!]XTw\v էc_]]v KAn.^.\+Yw\yxo;8I\ԒI$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$K] ~`{+ģqnQI$I$I$Y.7J~~k5z3I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$HWU!!~}߂_ԟ*?cAdzm|e1O^?\eޱ__ j~>;-.gQ Lg+pGo<]U71^]~pz['g *g`~~z~z[bnkxc'๿??gYiPIz~U1Th6,>՛#xo_2OsηDa V*Z5pwK}W. ?O222\/vuG|_+^/:/bL\%cƻʼ6OU.. }JU+;,{+cz_s{m<c㏽~~3丬,/W㉞J̮69<,Dr<}\Oq|AlnOC_1+Un sWjW=Z~kfo񡯰I\3RQzI$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$Iy{wq?vɷԥS`[Oشc}o5I$I$I$Jrݻ(FE j){>uX?VI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$@̬2qr~W>/>۸b~lo#?xcg#_;̎#o,u}sݛ\]z_|zr{ULC/4]њ?[kՀmZMJ _oMo?rU[>?zǩr1$Hk*$,L|WV5e.ּ{{BmϗT6>_367l`s-0jOf_tE=6S6{!,LQ-.v^7&ߵ8L{?z_yb({Z YAYwz^;ޅ_? MZ[e k]طXoơUcI12 >Q{n÷W[ڻ/l8~\-?}%֮oy|_h??~[/Vo$$I$I$c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$T2{,"tZϴ^ dI$I$I$I#tYR-ȫw{W'pg I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$y9~.)^,`7Fs氪)]]/y YϱL >ۛ+Zf g}Xbk_%p4\ڬ{m6G?)@þ˽Ä-lϚkWܬx~U8]Xk6ev`*p]wadݲc%G.$ CGmͷLz]G!ÎGS /%Ưj>?矰*/@'ӧ/{&?wH(Xg*+{xUw{'4AF t{KX6U{#bz+5x_ ^߬WzIt.W-<=G;fpp&^ahoEs.<./';;uɱW]Ci?"?~[/WI$I$I$ofߵn$I$I$I$I$I$I$I$I$I$I$I$I$K vl.c>rW~|> I$I$I$I$K[6O>{ mY+2==K?hnβewnəY.[LfXt}?GJ+~U[aԹqpAV.+ x.~gx=V&W_ﯧSE3-5}烇<cⲷcfHLgI>^5^,/ ] [I%;9_xۯ`Av~vN^p7x{~O|<]Rs *x& HX]S%{wG_c8ޅ1+οWK[yp˴bXdj^a4vV ^+'MOt?#NXWg::*uK+kL| ܇O=jh߯I$I$I%;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$eb*mSTI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$U0$p%3ed:xs Wwu5I{"8lYUhh^߈U>;kyz@V~tx*yg B\^8qqvzh%?7ӷw=-o?݌ƞ/DvWpǰ6֕nkMo*Kv3?ڷI$I$I$I$I$I$I$I$I$I$I$I$W? #SBe ?/|x_g2+ߨ%_=ø}Y8ߤ r,.߱rlgl#wTƇ2i;Zx\7 DI$I$I.o4ׄd;G{{o?Q~8O?cEⷾ7\@}eg ڣadZ+q i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$HYu1s?yWikwOA;W Nx~7=Мy\v^?.|WܿtԿyi~w/?5/nڍگݿ7n;cvEo`#Mw7X7S{6gڹ_ea7 >;]Y ?h?c;v秏,Ov7_ooMx{_oW鿶nmXk'TfWaXS.1O] v,kh]|Y#j}3?w?4g3+0H'?GG؏ MkVw?4gXd+aYb>OJp?KO ?mIdw?h\~#_m|,o Q<_i1)j1q,^=|e2J[!h1[Zns?MNWfSL?d/%IV\G$'5?Yc]>*Ӝ`wO+诱-?7; {]/19g"{7Cezū.I{}t?o{~zrXȸ{^颊8&|WN~k_oM+F?c>i_bi_V}LOi_?Jz>}ֿ%10qpǽ~k3E.>&;hMcM+EgR`JgPJw?4gGF~'m-YN'՗}tOkyeS{Mkǁiڳ_/d{CG^0cb9.O6ி̜z*h{O Sm/ĒI$I$I$I$I$I$I$I$I$I$I$I%:dxWYC]_R?Nj],?~O߿}}W= >?%'X_>ץe}?z~QkG?N3z+LZ_ˉ?$I$I$6?㻏Bׂ}J|>`bp꫊'/ފ߾B?׬Nؾ~7dO7+>1<]WpI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w.?>digد1]WZI$I$KQ,"x:*?W$I$I$I$I$xx~gxk28{u~x*#+?x1¸<ǔ"zx5aoUcg;ro>r1Bcv'Xl~u a;2=&+<Cʼn܄?-_3 y؞GWTbVnhy.Cf4_gٓzuf:wϴmޗ 8#z%=_Azɿ\QӆARQ,I!>&Ĩ׏>qgiL%~W?{orW<՞p[<ھ۵/J>8oW}gVI$I$I$I$I$I$I$I$I$I$I$I$[^@_50_⃶}u};_[$I$I$I$I$I$I$I$I$I$I$I$J{ܞ͟EM{XKJf}Pk_=;{i̫ұ׹H:oW]#[]xN1?W#@/@Ogʽ+{.$I$I$\םݻ=4$ py_?vX {|mK;-Qsxlߙܻ]Ub<\D>+λ؟3J}v ?+^۰2̭'[i$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J|Oyڦ %޵u$I$I$ϴv\C$]I$I$I$I$I.3e ;>?xm"c]JAzBl`3++ gf8aWűl̦5ȽCN8? ߱d?t] W'o8^1ݭwW-{Nͼ1҈ (\HWa,ovwtJI$I$I$۫qQ_9pd=d~V?d~nlw= >c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$To8Z/Q-.I$I$I%ߓ﩮l ~nSӎ.%ԤI$I$I$I /Nẕޤ>k]%0k>>ݻN4e68 8^~]h?5cg)pC1ikxo/kOڌxG{]@+.[ѫi!F 'd3ҾwՕε{G\k> (lm B~]xiRާ^K=8~v֗>bg59WgOg~V_]Wc6yti$I$ ĕ=s1r{X؂HO/TqhՋWӐZ Uf8xsOekkoyQUͮ(:1#^C8T<;5g gX_O}gVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kr)un> ?o,pLpv^ӏ]E{+$I$I$ub#ࡍ~.w⌒I$I$I$KhpkeGp5fOc=D~c'gwz8Z5}eaΎ@ʥJ}1pc.u}]g6k&,ae3) s,B0>D>eQ<|{~ 勍ƴCMŴD VX> (cׂnܳUㆊ˽wfK/xFIRyv`v\6ckCKZJ~7ҲF.?[Ӻw^NMT1W 'i} ~vl"=_\++N;]8TQvYddwleX\ه7:h.gXkaC߾c3Kq$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$āA=SQ}K< '?9U兟o_a23,  /Ꮓ5˜\/s,oKCsjٖ~o̮zdtDq?Y۾;u߹?d0`G"fLكqRwh̬x_c>gVAv̎^B6}?W.W(pn7/Kq~Yv[1q'7ػovv^\8 gS^K ;*N>5v6>(p%egw)oٌwq|/iOBqOn@~#q溬;-[-q5/M+iK4V9Xۭ2g?lÃg,p\_`와g~wcd>dwJoc}}e߬?w`dpr893jc⹱U;fɟG[-iƮc-`sի't{e|w%M;]nc?{&~Ev3~U,ΟaG!tTg)g앫7/}m/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%C3,w_}$g,ߣx~_ ߵgMo؆XZnU8o gdCYݶ76A;WVvf/gP2̰>4G =rl~>]x+o6~^[I%O 7X^wkγraXYο5u"1Ⱥ U rXOV暢X X=ߌU?GQǦFUV}K;} ->SWY#s=/p~зxڤI^kSַe{?maQ3&#i+c_dyG=|=FxS{eyʃ;g߯DZ~KT_حcW7SFݸ#MY4jd+X2s펋þX`UV3Iƨ/zm/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%}]qS >ݭg8?jNS=~)אgpo>Sn_ƮvlInK5pe e[ka߹O?"?iHoN!?q>:>M?EeEڌW?vqfd*_LO_%_>ߗZYC mtit5fV3vL#F1<{qZ>/|r+*չprW,}کzޏH{PU޸.o͎Wa̿ӟgc݂_Μ~3v?swoI9A?###V>Ad__xGDʷzv9H Y#= +K7Ʋ2Maz@]Fi0U>K~U>}ï?/_pp}٬;kgg,?F̦qx{c?Nww:&յ#7/um/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%7A\tU_;߽xp929ʩf@IS p*ȻSO%6w\?uA/߮<>N{pn߈&ox/w!#޻t/忴g|iso[HlGIiHrg,kɽ+-q{*V54籰౲s2*|Oe2Jy7X:AZ9.'9,mGG~}άE@(n%7ZH\uȿ8Ojw +:0Ec묹jYNW1rC@~ _EVe5 ~}̢/߶{NMݿc;awsI?-߿-:s3[Hw!;o ܳ*Ɩ _|ggH*Um\Lw1%p_o^j*OWdpCAʿ*,o`wjg^0h{pWku'o;+^s+ Nݲ~`d[<85`VOkбܮ_KC~G{/x3~ҹ_j1,iu1<-w yeMgPYG9-zCtfWt1eqT0[f8%8+I$I$.c {+`Ե冝ȽbfoSxvU>>\+s_,/8tXK} ~\qΫ#d~gサo83cvc gVI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I*?C_FWm8 ->K=3O?j]uЏ^{pZ/ՙ/wioL~W|H8嶐>1%1{W'߳<4-s¼?|*Eab:wKyhk4C)V>Y. 85vm: /s]22,Ӳ R>q}?+~׉OKIQac6$=>}x¶25暏]S^}r/xa cK8y,̏Z$I$K+eyp*oVc+>}5I^ڰ)ktt_Ew*|9865F̲x%+U5#Vow~RpG["߶jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$lDX ]Y*}1ζӹjof;sm;7ԈZgkĪwv}p1yJ~~ҟ'eo忴fccawK(ai᩠ wCwϻQ?/nl.fl>VO{P~9={稜"^z=ۊfaoXgdջE-nz(JW];\,.Ko`,}cg^;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$=y6w~ww]JI$I$I.73\O/o'W$I$I$H5־IFI$I$\{Xy쪮'[]WW+5O~ y_e;ퟶW>gMh,';4gF'_gK٘ʲX> 7'oUq: ּ޿j8ֿ%WX^1o;Gp?.bҹ c-{&[3=x}<zȿ)8#]َnSc#~a~wCgӇ1x@^pg>e%g;jݗVh,|M+`I$I$Ju^eU}֏ZK~;[^ )ҿ%j5.~'Iʪ{!ha{Wڿ3eSNGK>cݗ?E\>r} ?QSޭ}r~f}__xӵo]U>Y+wv.3/bm/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IS}/ʼOoubBWRI$I$KI~ \3J\DI$I$Ipg>׃|>KkI$I$IFWnOݬ5ppV~?ġfS/.Gfo扁Xue||D+_?.k?z~ +}zs;Ҟ<>}n%_vߌW_uÉw3?jݿ󍅿_Y?~8ekvL~'s'z';AwPWa-?"jI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$3Z=?w~S>{] }$I$I$?oa~w'_bI$I$I/0EC$$I$I%^w ~]Wpp@$c}nUxg_"ϳ\|_q#~T߳;'r4 v?[?Y;ݭaHlլ^>7 7s+M hh4wwp~[(q=RVI$I$I.gd߱}ďzl}zԒI$I|_]:I$I$I$샛ȱ7rI$I$J/=P7>BTI%K]~fyenq.$Irn?r[I$I$I% }W;)?^I$I/~ǟܟʫ^۞x=|¥t~r3_?̬/^;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$e q, xq$N]k{unp5]{_ /kUH08Uw~fn?5?\rI]`~>WomoeU/گ moomMjs߀~ڏ/گ molo+lpJ\gzY۲;eն<<j`a}O/57lpQf}=+moאex,հ ?ԳK~'/ Y/ԳSg}wYYח︕wWY|ץ}o.~ڲYfݱaqk;#2?mK_mΏr_t~\'Uc?mV_k{wnZk;w<}l5P5M~ڟ!K6G?m `1~?/~~vW@lY;. XD}j6}ƻ}_~7i ?m~~ڛ;#g_x,YpR?m/C~jMn?E~Om?E~ڏ!K?W~f]w?5*'oac~kkIcvj_,d8g!K?3?Y?,]c?m|>>wY?ߕrY^CV1lV j 8}ֻ>wd 8Kգ+m/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$U2}9v#K.߲]8nyAa]vG ۯQ)۫`hyT&7Wwn$eY*nӉYc. ۛ;o i/![IKv_CmS~IO;w˿Z~1eW1C~Vv,aisʼn~Jld}v~IgƎ'oe`ӟiA~sض<~ҡ-{qac[6G'8S"Wq}OEԺ83ޮR>.G:$ۇ[2vyiv;XtO/w^Y7G_d쌩>g /wQlctYְ4V]Ve 2nlW>Kyϰ4W?="߹KYSj] 2^o]Uڬ.rNY q>V @srZKwosz' })W_.2'{Z xm?ՏSonr*rc۩prU<<%Um .ԯoiSKrҭ`{YTv >h½6y:߂ {'wsz'Xui0-dQ[+iw8h;_[$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I@JI@JP<@N<1kODޝ?^?PK4' |zu zu p3Br֞:P~:P~ޕG9Vx{m乏sO`.Gw>^S3.ic윜{8e8M$ Ukp=+^Ss2msg_> u{_,Ki]]36>Js[`I<{ֶaqXGG&[~ .qT|^ڛ:P~:P~:P~:P~QC~!GPq9w:XKBT%^nf=mp]]o(}K?*8wSc7q3?q?'v5D!~v>?cLϤٕiYV֟ m/ĒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$}ݩf3v/.\e~z?̾sMܵivhm3dxywWrx65f*S7 Uqy%Z8:}*ayDIpBcP(o{I$I$I$I$I$I$I$I$c3K~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ߿D2?&=ۺvGa? ɮOC'}wC'}wdfe"˸yz&sȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOKȆOCwv]c6A@ endstream endobj 203 0 obj 164947 endobj 202 0 obj << /Type /XObject /Subtype /Image /Name /Im13 /Width 1485 /Height 937 /BitsPerComponent 8 /ColorSpace /DeviceGray /Decode [ 0 1 ] /Filter /DCTDecode /Length 164947 >> stream JFIFC     "#()%$%%!'+,,-/4443.4444444444   [!1AQa"q2B#R3br$4CS%DT5cs& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjz ?I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I% .Um.{`4d]Wqf_hMtq1Zsãs>7g}1K쟳ugQw՟skġn>`}VI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.WcЖz$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/5i{_2\Z]uwH {L}<eWgt{އKs3=9O?O~jϲfqvn|Ɔ-ĒI$I$I$I$I$I$I$I$I$I$I$Ic=Sw}Z?&ZG0DI$I$I$I$I$I$I$I$I$I$I$I$I$\1)-˪I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_"{Zܷc7ks]]8 n&UT5Tek@ 9w潧g3]7)w޼|ڤI$I$I$I$I$I$I$I$I$I$I$K篷㟺ga}G޸Mw0Hx~vG%Jvv<6v %`sth?u޾>̒I$I$I$I$I$I$I$I$I$I$I$I$I$K%?%޹uI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KQ)~αadX띈=Rz"gr_}ukwKGfeٍ{#Zcfw*?lOݲwXYI^̒I$I$I$I$I$I$I$I$I$I$I$O3-ɻ+hs:HӫoP?b=q7Ov̈m^I$I$I$I$I$I$I$I$I$I$I$I$I$I.WcЖz$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?=[X߽;Jߴp_)>'ޝ; ]۲v_|ƪ 6$I$I$I$I$I$I$I$I$I$I$KhYcq}+3^7>s>@WؽveSjmt-c~+;/7pw>vKeO<˴#=vܾۗ^]#ڼI$I$I$I$I$I$I$I$I$I$I$I$I$7O o]RI$I$I$I$I$I$I$I$I$I$I$I$3?;/i 7xWGU}s*nfL:Bn>}ol㽕(`?qKI$I$I%_-p X:~NEt~Fv ƽU޿I$I$I$I|ʱϑw^3w}X4d`I+쟺c/=x/9漻ci?T>欆txq<˗C>wznӹ 67\:|I{8Y_o;L:DTI$I$I$I$I$I$I$I$I$I$I$I$I%o\I$I$I$I$I$I$I$I$I$I$I$Y_j3{oY7/E >Bd9*Fc~g38FZOװ|o>F9U!]>\x/<)xk9ݣQ{hwv7zObݓO5WLy$I$Ic}7׷mvGE޳wZr2].|Yy?`]f.mT#o _I$I$I$I|igĥ= I&6A{t 58 cګl Z #I$I$I$I$I$I$I$I$I$I$K?P}}z|fQWLϗ׿$Sf3&~eec&[WqqZxgJԒI$I$I$I$I$I$I$I$I$I$I$I$I%o\I$I$I$I$I$I$I$I$I$I$I$I$ȿ70;6;-|. NOYbۉ/ v;%qxGt$I$Klkepl)'<n[C%:uw=POY/ly9TU$I$I$\=ؾK~:??Y2M`^qv̗5d4&?<cw̻on>5 Yso}@xgF:_a~v?Ϭ2Vu<JI$I$I$I$I$I$I$I$I$I$I$)ڸs{?ukl>oűߘϙwY_:fz?ľ'e-{^5Ԇ|}22>3ZevA=Woxmӭx-+I$I$I$I$I$I$I$I$I$I$I$I$I$+1JKrI$I$I$I$I$I$I$I$I$I$I$I$;_cv_r˯uumx^݃3O{AC]w~ϵ<i$I$K_o{}qq{i vuϛI]دf>avꮻ[NAGvd-/}*SEP[o'fJuRTI$I$I%=K}y`_Uxhd9ג]K}홭x?Myoid5גdI$I$I$I$I$I$I$I$I$I$I$Xnglw{ߤ1Е~}˼]C2ocud5ߤlk ȦcCM|5;۪p`uR჌=AuF7W?}&7!k0'O@I$I$I$I$I$I$I$I$I$I$I$I$I$7O o]RI$I$I$I$I$I$I$I$I$I$I$I$[pO]}ѶUN5 0y||;w_e}_/Eyu62 LOٟ=?h}J_[á-TI$Xl;_e{iuh8c]}6}ck1iѩ|UYuX6x0~DYN^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K⿵3iwh.#?`SNvf{gyc{t;ܞ.υۗ.+o3C?;eExa+I$I$I$I$I$I$I$I$I%Wwν7='^<1,sQg$ؽw]6=9$V{eBZ(fƿY5bבf&UzuS/?.$I$I$I%o\I$I$I$I$I$I$I$I$I$I$I$I%G~0ܱ+ˡߛ`b$x_0'q7#/1Wٍ>ױnl;$I$+cw.蠁"G\<׳v+v^crc5|c|wpjs8pĮI.gbso 4>ۻn3)̨;i$I$I$}swl cPdra?ԗXOs%Ińo?R_a?ԗXOs%Ińo?R_a?ԧGU}s*nfL:B>p{o;c^*o_ I$I$I$I$I$I$I$I$KQw:~O 3(\O?d?]{%rla=OZܞIz||~W\Vwqe{hl>_/?iĻ/?gK%y#?/_l?Oѷ'qLޒ8>>?%R6CqjgQ1\ҷ?_lSַ'}x/5C'.=WKu~nOp$p|}N~J_[ͭt:5׈)]'؟gzۨ?#TI$I$I$I$I$I$I/ހM.ӏc"9h=sY}4iw5? j?V" c=\N6}N̳D&@o{t3ͦ'kwA__$I$I$I$_bSB[TI$I$I$I$I$I$I$I$I$I$I$I$FM6c@<1s|Oj_F,ߴg;~K5*c\"VUMwScmƇ12" I$sA#wq_i5`[d29*C;+Wl$w$r='t`\洑[-|K%ytݣ_Chw z7zcXѷۭ]^wϠ_M߱}'3)n_e; ƚ:$I$I$1]w.۲KC]`}S?o /iE/?/K"/y 1_^7_D_Ab4" co pgS]>82~2}7d2{{㳷pY?TI$I$I$I$I$I$I$\z?c;ގoy=MÃs)5KsL8VD~ke1ˬ{|?h[PX pWe i8x Ww'Gf#.)g| xyo!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[K o>UVwϕմ!]__m/{W[]?fq;a^])x`~%ѤI$I$I$I$I$I$K:دY}԰-xuZ).Glwj??"[ ׌]Ku:ܾ.kpcx?> $I$I$I$+1JKrI$I$I$I$I$I$I$I$I$I$I$IQ}vOøcazZ(Q1;32q2+ɡe.k\:v,.Nj}y7גo5}p3'_u}'D}k22}Fp?gY0U]iuv>۱ǩM 87彫U3s~[qu>v]wq_DI$ ?Joz5)} -~{ml>R I$I$I$I$I$_9qw\kY>ەv=S@kL/I$I$I$I$I$I$I%SeA[[KCu wU0i~5n#>h-~\oy?m&Nʫ4㙛,<.7 osɳ(tk^渝^O?ٯ\N|e8yti$I$I$I$I$I$I$I$I$I$I$I$,lEpoF!; ѿğewff۞f8, +I$I$I$Irħ.$I$I$I$I$I$I$I$I$I$I$I$߲_h;{ >g7ct3<~χ3CZ/L}q=yGkڿh,n8Mmo˙)?f~wbz9<<,(ޗ 4sEv*=vNOK&__wgoɡY)ds>(s+tI$^A;?M0hcrF5q5;\@?T~NW}wt;&}$kAhՈI$I$I$I$I$^ג>≮NƀDCzn9OyivWտ37O9O1BI$I$I$I$I$IBǦˮU[K %so~c>;ȑMͱd룴vj9^^?7M-ې25Ɲ,~+{wk{ky%9d}&:nsp I^Oc%n׏>2H.?5I$I$I$I$I$I$I$I$I$I$I$I$IBǦˮU[K %|3ƅ@fKkc&V+9ĒS ꔒI$I$I$\1)-˪I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%˝?t!ɹ\5>q8}Ͻ}VW밵8=;3`kI$I$I$I$/zlUUy9W]_m6gPz[qkR ~֤߷c/j@z-o !7=12F_t{?fO{5}߳q\[̈́0^}VI$I$I$I$I$I$I$I$I$I$I$I$I$?n}]_-v#1ݵ7JӼ]KZ1[Gy{I$I$I$I%o\I$I$I$I$I$I$I$I$I$I$I$?{چw wR_l8==qI$ˠ\D_Ab4" co /iE0(K"/ 1G_??a7QD_Ab4" co /iE0(K"/ 1G_??a7QD_Ab4" co U}Vֹ=ݐ= ߿ŧm]Ï(o?OjI$I$I$I$I/Ʈ't3/ _gޱ/iW󉖞 _I ,|gё[mMpI$I$I$I/9}/},w߲Yc<q "W̉$oQ}vc6]؅ϡ$I$I$I$I$I$I$I$I$I$I$I$I$I${A흌Kޟ/%_ݿf~SܜeCb$xRI$I$I$Irħ.$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I% ")U-{$8` ?w,flc۷akXyz?m q q6r= RI$I$I$I$Iy_?zon^/A|&DWڷw1xfl|v)$I$I$I$^Uwr0%_:|I/~#Cq?VI$I$I$I$I$I$I$I$I$I$I$I$I$I$hQWۿˍKkYֆ;~o)侗I$I$I$I$+1JKrI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IBjȦncK^lj!|1>O{Cz8n?@^-?n~Cc B{TI$I$I$I$31F&K8ȭXَ&A_>W3{x8\ó|%a}'q.U>&{ ;z;wk*wziun-<?]3b-0MF;#,?5d; c'?i R_|xJzޯ{ n5wq?>۬v=\:v=?R?@v]WݑhUk'ϳrק>9qLO^lSóDp}|f}8j]`vK*۲-ʖ_^u@w^K۬v=\:v=?R?@v]WݑhU϶aacYgn+C~q^pI/c:YٻF?lXv_^-~7pZZ`h~tk?@v]WݑhTYkmc|xZ`Zg|4&42٬hx_%ӤI$I$I$I$I$I$I$I$I,tۑ?Mn020Iq5/'_`s;Y~:qDmpϯ(^I$I$I$I.WcЖz$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$UM]cj=02JǷϹqTB/.p. k/.t(_MYMնڬik!/'^/{h~Yc0gݻ ]W ŧm]Ï(o?OjI$I$I$I$k+5՟uX>2# /8msCfGxW*xg3{TI$I$I$I$I$I$I$I$I$^ mϳuvYif~ü pI$I$I$I$I$I$I$I$I$I$I$I$I$\1)-˪I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$@Yy/[cxZ%|f϶'pY?<)w/O?d?]{%rw/?$aV00F;~F7I$I$I$I$I$IQx}dSm%̕bŧeEc\ i. 8$I$I$I$I$I$I$U{rݪv~e8upX n9*97= eq KogmkCnM4+YEwU{FwTY0%']yvo-75Q_m?SѬ&Okh?ck#>k!F+g"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co Ta2.}xc6KEN?!v]v`Vp2ORNhK%?%޹uI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/{~b\0 9$Wj7mA/IUsnF5ᲷuOBgmC/4w}u'1Q&>N0=Z ݿ8҆8?9$I$I$I,?wBq迆bjo]KF?qu{>|⻺wo]ΟWcu-}M 3G I$I%Hwkqk ͹XH:x?_>I)uWu6:kpsr kp~Uzî`qhHBI$I$I$I$I$_MYMպkqks.R:X]4#͜@/I$I$I$I$I$I%>eNW.B19>c>{b*8p#Sn}2se"zĹ;{ϥwjo ַ[aj]*.C*:޼ݶKDk}`?g{䆖<>+I$I$I$I$I$I%o\I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ݯ#_gBѬN#祹#}q3":`4q>4w yf_`OaimWvPC}[|I9!|ƳչNlh$U{n{xlЯ~cÓssbz``.7?'I$I$I$^s?{|~ɦ>|Ⱦ/[w_cػffn~&>G.Տe̍KͿĥse ~n;zǷ$I.ca}Oau64|Wta|{,2XO2NZeGO8=8KQbaa}[Wg߲t6?m]SocfۃO5}M;Uw5*whg`|]}7Gj}}}ʜdU׍:o>CceCau fNc"E76UJ?_fedO7ey_Rݿq/~oo\K'.=WKvĿy_Rݿq/~oo\K'.=WKvĿy_Rݿq/~oo\K'.=WKvĿy_Rݿq/~oo\K'.=WKvaƧߵ-e6?uV3˟U/>&F]{n ]alTcn4e{I$I$I$I$I$ٗ{o϶?kopӋgS`9rQ睻sqfZY{0,GrS2]QiӚ.&ux #慹#~duwנvnq;n%x7kDgjI$I$I$I$I$I$I.WcЖz$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^ǼԷ?|v.p__M=kN}o̚p 4I$/lmV4xyn}iOw`6v.U  ŧm]Ï(o?OjI$I$I/#zG/ef!Xpw_=/^>o.ecpW߳]gڶ7d0p%0q"'>ipexYMlp& &GNpe<>5fg#]zkKv _ҏWYv9*w''.=W?@w-씻7ߥmW==O/.`7c*5O]UG}Yy_ƺ zJbe.{15y%ch] 8'vc-^+ƀG7GcKI$I$I$I$I$I%c}k[n'9^}8\O.ewLӑw @.V}ﴬ+KV|9H꾰I$I$I$I% .Um.{`4d̾C.%j?Ƿisxn?.5 'ya!l28}%gߵ<6d3m|3SyqyH8x܊b> /2e~}qӶ݊Pk$?"I$_FXc}˯fWOF=NíϪJSV=5Mm0@h i$I$I$lEd|?mĆwnÐkoƴ~QƟƼ^@I$I$I$1؞Hp7|G~?{tr-r +s9/f}YN)~={D}͉6=D.bg1;~{EusXge+"[zLsqq_:Gwko u]DŽNۉ^% 3'ڼI$I$I$I$KE:> rz/m_f?؟ L'ʳ_9s]R>[k@wV~Z溟Grn>N_fI8q>dg{>ad0k fg%OZI$I$U{n{xlЯ}K)зvLvA!p۵WX"X!O]RI$I$_qAmՆ~ 쟱ۏ?Sun1Z_d]{YxW/p?R,is;ղ y I$ڱ;hm*[HskĒI$ؿa{q$I$I$I$I$㣴~>ONgU~>qtI}/{؞ɖ/vCSl.?k}% .Um.{`4dw?z~}1rnGr?jǏ`LJ2s> ~r{_חp}=/|Hןƪ/1]7ޯoM@wkgn|O?-w[=LwzSwqpsϾY!>M zJ )馶Um c 4@4I$I$I$I$I$_=gw"fst.UO%eSU9A`lIW\3.[FDtznn?9lJ]Y>!6H+~LJs<g7_tP%w $I$I$I$I$I$I$I$I$I$I$I$뗏-/ʲ;|I/'w{ ց0%zrI$I$;vwP܌ken|gtvK :o^ka1"Eαy9Cd :?I$Ix_s;n#xʰVp&Gpg61 z{'o@_'=j$+1JKrI$I$Ix}_ڦպ]i7腛kd=6nm3Zn ?qyio8gNM}hHk*>{q2ñ,o;?{ykwkƌloT3o李Z˒I$I$I$I$I$I$I$I$I$I$I$[رGo{n!poޣ˒I%:.Umnc`DbݓO5WLy$I$IUsnF5ᲷuOB}ACG{gPyHi^-7oi>묾<0 qw $I$?MR\δg۬>`ZAH9x #/%cltO Z$3܏u>(4U?.?qte3K$qG-F/I$_$I.Fv?^ ve=yǘs~K$I$I$I$I$PmUV@I_;okyz=[= =~c\*I$SW;~eظ޵vߩ:E{?}^?p8 D8 q$I$I$I$I$I$I$I$I|1}Qv#U= !9cdc7#:pNǚNf%11#kOS5{NGo}1عJ֓]LjqS#I$I|9>û~9;=!2 $կZJ3o2YS['n{7da_#|k컋8úxy1zGc.g^Q9^m)p*?ipkn7|ii~6}fK%?%޹uI$I$I$ ԾI$I$I$I$I$I$I$I$I$I$I$I|u>h%O\>՗;'moV ^G,)]3osXce6 {{-<{ 8vn[xoŰp|<ǒYwn85OnNI$I$ՑM[mƖ0Bb}3q1۰5,c0zG-]b_f,SikcOSwOUߤI/I$N>ކdŭڎ2Odž 餒I$\w]F5~>vksxxxsns=?Fn3zA|ؽ +>eޏ;YS 0|I %{UUMwScmƇ12" I fbvgWC#˜ιSeA[[KCu >l\[?kxr8'8o˟%مD[MNo;9>ᶮ\"ˊCNt߂?[lvK7p{&al$K V_ťW_Eԗz񏝕2iuX57Yl'ͰIWvolmvc pҴ?gĊٝ_n5܏|v;tv.@hw h7wnÓkY+x<2zd9^I$Hxx5ѾEy{_e=gcx>L:>?>ػ3Y,ƱƳhs[n'pF-?ގCk_ܟ94E ш^ϭ"tW7O o]RI$I$I$K?ޑ7v0"ןq.cz~l;f>2~?I4c4>kI$I$I$I$I$I$I$I$I$I$I$_}e+$>ݾ8~w_[oz*uVֺ aOӇC#TI%I$Ŗ`vj-n[/xSCI$KJn68wK]>&:G; vFMuO@'07{ݬyb5߀%{yUwv4] m]r^?ٜv0pr-c.|K=s.o>fjmBD[~k+o$_ql{~~rZcp{_笠Q1o9O^K}e '1[c%^5s'c^Ნv5͝sjI$=}?=O8>>\<KN݉޿Ƈ꽬w}aࢶhf$WԽbv>щqF-bc|\1)-˪I$I$I$@Yy/[cxZ%|m$3={pzpoCN1;n#xhŬVR|u<ϚI$I$I$I$I$I$I$I$I$I$I$}K/n?ݛŋꔗwyoqZ~{ſdu}ݞ[.89t:L.$I$I$P)mXױC_;O^z`6&=vŇ'_c6z/ m>ys]I$et;_}wSf;dM^^y> Ժ{KcF"ytzWc'1Gdq>'op ݫi{wrkkk3qgs;.K{^?p $y$IzvMvf/$ÇK8@_O$I$g\k}Wu=f?^I$/Ǯ-á =s?c\̮"/y 1/a콆K`S5ޓ/yVI$K񏉑{8ۭ6q$oA~yWv{/+ђI$I$I$I$I$I$I$I$˿NG7eя:Ϧ^OQzK'{_Xѡf[~|}]QƶXxETnO^>'ogvT:*4`|5N>'>ߏ-<3"5<|c+Sz?g?Ûڜ}×G%i$K;w\p#&I/w_kDuحuXⰓ>??_NGI$+1JKrI$I$I$N>}w.ɋY=6A':c_11sd8{wt=I$I$I$I$I$I$I$I$I$I$I$I/?ƟH}s?K4V&FOq3LK۳ 7{ch.6:v\I$I$I$}5dSe7Vjcćva{=emL{v7w O]/Wow?t1NG=I/?ށϫ/`z,Ħ'3fO ?muCokvCk|Wҿ~/`z.ĺ1^O+uhw ,nǭ8c(\_haNuѱǕv O1/XI$$K`vKH>| I$^9o;'g}%pG?U35)$ _bI$I/g|RäoA~yWv{/+ђI$I$I$I$I$I$I$I$^۰{o:c^+w_+1+}Nu}[$cp!Nwyϫ^<&wn;/ymdGxtN-oڏ=ôsi!{K'5->ӼXOQ_q2 K!zI$Gs}f'u Z[sgB1BI$?ğzofb՞aO/ TI$WڞǏwj*w6t_"wݾ1]`=A?%K?/;hpMܨun-4ӁoWI$I/ގ_vKۻ[[Yk I}!^ bnǥ"& 8_o~+RI$I$I$I$I$I$I$I$I$I$I$I$I$+1JKrI$I$IyXfkwx:|}}f;.MnwN:D~fKu q86˸~EٿG}AvM87U]q2ǧs$4{wu3R.S0Ws`$tc{oo[]%{MW78H=I $I$I/ޑ)^~9?Qqc~KI{̿?$I$I$I$I$I$I$I$/zlUUy9V72!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_I/ /eCau%̾C.$ٗ{o2!Ymf_d?!W_d=K}]_Kqrħ.$I$I$ߺ};̱׹e{̸{Zdx~37m-i _}.e)[S3w,w5¦S>3 o^I$I$I$I$I$I$I$I$I$I$I$[v?-N+\iϷwLO&='aGdin&^SM9v=2ˋ|u$uo}zuYg~.tg~%bgGx$D#~b;笼|o+ ڪ;}&7SIxrI$I$.}]b;-uƏo5I$I$I$I$I$OdPuxo_G09/dI%_4e7bcck.I$I$I$I$I$I$Isa}ԋn؎iwwW~kdq3r^!YcYi ϒ ~֥;>s(kq]ӏ++/\v;;.t6x$;篺+~ߧχI_I?MR^I$I$Om {U O~@lI$I$I$I$I$7OY_X?;<.>#_'11ߛ߲?OUx1ɶx$I$I$I$I$Jq]R.̧>W)]eNM.ŧ\5C`B_b_Ulcb-iK/'%g/c[β7g^.^Y}}wquwJ]p|[cvdď '~2>>SN-o h_}3avj[olX[ȴI$I$I$I$I$Irħ.$I$Ic_g~δܩphw]6LH`Y#7}^q%?oϿz?'}ϒ+u72g?o?~z߭'?˚_#7}.S?o?~z߭'?˚_#7}.Sf/8Y/[ȓK,cH*߱y̾>`]skw_#/ /eCau%̾C.$ٗ{opf6'xɽ]9 s I$I$I$I$I$I$I$I$I$I|4gIb?v|rwyoqZ/#7[K/[?6I$I$I$I%@ۉ/E _6BKλݘX͟ph}YUuScqE?OtQU=bc}VQMg+45)KÒI$I$ՁUӽViZO; I$I$I$I$I$7NM8Np˥X -&/I{W}ׇ7v:V̪ӷ2w/ka^z7,k0.U?'ڿѽrpk*ohc[@'tv\c-p"E/?/]?n\nxv<$I$I$I$I$I$I$I.WcЖz$I$I.;?6}5\X"xI+gi\/ oK Af3_sͺ>4$ߕ o>UVwϕմ!]__m/{W[PB}4)췄9zHB8f u}< iIk*?@d?˽|7r*i Cܿʿ_}./@d?˽|g.ۧwjmXX?7mVqQ8~12"܊8kwcLJfЏV9Լtp?\/GKsdadᮜ9΍jI$I$I$I$I$I$I$I$[v?-N+\:CvvWn],$mW˿#dgk8Y]goJ՟o/+]v1z-}V`q'Ë뎜^ I$I$I$I$^Uwr0%_:|GFj;%W_?IſlV}˻f/a#q1|m_MotukIJ?;]1ooQW74?pf6'q& tR:7V?;5UYmdsd',o:#쟴=Y?꿯?i?OϹp& /5-l,-Z^Ot$I$I$I$I$I$I$I$I.WcЖz$I$I$I$I$I$JVE6SumZuQvU7⻁~a66ËNjs3%zW_Y\~n!M?\R|tg봶M%1ȻTI$I$I$I%_G# UӫWk/M݇w7ilHp=dXY,"Ucf8|g{O{~mq\"aQ_B0g[L3X8q"<׮$I$y$IzwYxo_]~VT#w_JM$I$I$I$I$I%I+݋/3l;} j$4؂I$Ic=Sw}Z?&ZG0DG7%q߾ٌjk|Ϩ[myIOoe\GmO0?c;=u%|oocU2\;yooE7Xo/XCѩGOi筭_˺`dOߎ 1$ >)ͫ]b`DoWNI$I$I$I$I$I$K+_u5m~.5W}%7@_Kq YC*j&?:;8ѯބe_rޗs^~;ޛm2W s4iJRI$I$I$I$M}s+sV}N |޾y[{ln̲L Rۯ_=r_I1د8ov9\ܿ#zrI$I/I$ھ'63 V8ӢWЩ$I$I$I$I$I/~#YOq_%xg\87WjEuXt^d1_avnrn]yt;}G2{j9܇.ZK̾$}5OK{~_:=c5}ˮ/{9Eݒ} ]oٟ몮goqӦa';_izy/dWocc|I$I$I$I$I$I*Ӹ~vuơVX_gf[vU٫w[;5I$}bv>щqF-bc|GYn-۶59ğ5_VӅ/kis^:wg-jI.cϳcoqȱUR8p#9^q;f4kqAp .q"c  CwaKF^]3b.OoY4^gb}OV.+>kyO]RI$?_eEvdmq. 8} v&;>w<ۛ=͵ܽq|u>h%O\U#߷}HҲzwAD?S|dv?Ny0#\ĒI$$Kws_w}붽щ$I$I$I$I$Kw,݇'广i&=k#ϟ|tO=Rލh'k)$}EG ;ye\w[]oK[ovE@GqFDrƺjn_a;u{.qoGస|\I$I$I$I$I$I$I$I$I$I$I$I$_bSB[TI$I$I$I$I$I$I$I$,wv:ZYh:K&;f:ڛYpeux>s q]:~\2;.?ǩ{ʹoO?ohvxP4ih:>c>ڳc~ߩJI$I$I$I$I$߶}+Y^X9mxq}kp[!xZJŹ_|uw~Ȏ9#UR^/]XV沼sO]3b/}Qܻ.-ɹƾ00hc/Wh7׏ms_9$11շw{cl.m8վa;<'(fv^Gp:( $I)uWu6:kpsr `g3> oixΝIrK/`}W{1| ӿįO'7c0r^Gz_MotukIJn;}&&xxLJ5۰{97#׈+w_7 o_=wu͂vxI4LHh߾kp=OOխQ"aF[$KI%:.Umnc`Doc;h?FV#|z[?.{w^KF^]3b%/ؽ Ļ/?gK%y#?/_.{w^KF^]3b%/ؽ Ļ/?gK%y#?/_.{1bp;N^E[nAeb> ./9MݵMlOKF^w޻ޯsϻ1s}Wτro,[?c)#bmVgxl_d$I$I$I$I$I$I$I$I$I$I$I$I$I.WcЖz$I$I$K?Ogھwъ{kqn XpI^+GFKwn{dG":{tI$I$I$I$I$I.޲Ek~i_k>^_ 2X6Vt?hY_aܗWQGc=p=A^?Ƨ؞ɸ6G>*."Ucd8D4I$I$I$Iy{gN WskWB)0@\j~lI$I$IwO7 1akjkH'ȏ*I/,Nfnm>dz;R$I$I{Ͽl3r>f}ґn#V a>RH ْI%G/u=: >cc|OK>{}گs˄ps/ػO.p{+r˃L##cnͯJ6 у'['.=WKvĿy_Rݿq^߽3ba3Y`s;w.q|^3/DZ4^Vlk-<~LzHBg·R0IQw'Vsۭ. 79>n]UMwScmƇ12" I$I$I$I$I$I$I$I$I$I$I$I$7O o]RI$I$I$W迳ݭWWcZ#p|y> ԾI$I$I$I$I$I$wz=Sw< s`%\O6Bߵ+Mg~g[ Uӓwqy=hr21u}5㹶Q/; ";[~ߴmEaqwڽc۟iƿ^5##ti$I$I$Kʿ?9glם^*?L_>N׻#&qYc]؟h>z(ӯ$3D'G^{Oݲ1YHCN+I$[?d}U<*C8G|AVnv^Gp:( a*}OO$_1?R>|0I%T_۬w2TYI$g/o~׌OԗYo "n?yAUWOvwZ}~Ӯ\"YeeY }ogv9ߤ7'>dWrm|z6m1..q%8Sia.5ύ|JI$^ǼԷ?|?a~}~_j z?8\eP67 έtkޚN%$|~{}$;`~qU$I$I.WcЖz$I$I$KʿގFDV#6{R1$I$I$I$I$I$I$1؞HÈևq7g |'伯w?7Z_^5"Ɵ ⲨޚʪvO%޽ {\}?F>p=~z,=qq=J6=k7x} }.՞F&#y$I$Is[~}6̂Ӎ[cczr_$_uYu:lqs%$/ϻLA9$~Gbv>щqF-bc|1F&K8ȭXَ&A_}6-.Ĺ9<`:?6rI$I.I3N,_Tz{mMc?{i?gƉlDzq~oo\\ۏ=د"ۊ i쓸z.a%g;~)kNGpoM?RTIpyoZY}u/[.#0jo :d\|5EI}/gUms'L?MR^I/W$'_;8}RI$g{RI$}7v)kq)vEDd{]\I$I$I$#CrӗI$-a8N8Z[ م  M[$I$I$I$I$I$I$I,ۺ}]fRX(k )Umn-{ `7cٿgػ3~F^K(ǭI_+wϴ=e}.߻S^6=M7<)>'>G)-:$IV}ةV_1o`_}KJ{eeYaNCgO>ԒI$I.WcЖz$I$I$KʿގFDV#6{R1$I$I$I$I$I$I$IBjȦncK^lj!q}Z\x.~:.e;~w{&\2lKێ'O~kuY 3_f՟ܨG\=s.L3v~q+ġXb$s;W_}kpzݒE157U_4y_RG۝[)DZԻ-zΥv^?ڗW?O#S>W's1- )u>1{ևGvi$c/ [r}Y-D&:_'v>՗;'moV ]o}-wOY]\N6}N̳D&\I$7~SkYgo8en@v`z8][Ɔ[5r t\YEUzҾ]_X}z9=O|"?z_'  M[ޚN%$|# I$Wܻ}f\+]f8o:o.U_Q/1]cW# sGw$I$I$I$I$I$I$I$SGM] RO̙+?ğ{S?$W菵Yc}̪FQ-.oz=ۛPއ}}5dSe7Vjcć(x[x\!}[c=h,ʯ&"VI$I.WcЖz$I$I$KʿގFDV#6{R1$I$I$I$I$_;OwvMߖa?G:zȁ?Ƿ*魎hoYm屳5]E|.ikw|_KǷ+)iTgB}C߾z67',5s_]f>xә&7k%eS(h|/~oo\WK|䱫m,?t}Ol cOc|U>>_Hf&&# Xm!Wȩ$1~}鍅MwՑ@=B9r]2!Ymf_d?!Wn;EYMT̗br53^wmgo~U-ym?]f_h1[ܻv6s_ MOsXp;ړu߀ʸ^ 1?,w|w`9^2ӏQ xߚĖoaή"Kg ]gCE}[^n3/5\Wc힟qL}ܛx|Q_,ϫ6`0D䖍=Wk˳5iyDj6_D;ٔ[yW`0k/WN_9//fƧpcpdr/~Sn?MպkkV$՗q\-MLxqǵ\)û ̊ 0UTٟ?wvKO[zǠ $~ھvV&]3 x& $I/.z*k X`?0 $_bGӦĒI$I$Ixf۾Y_z8]?QH3ӡ>#}]eXm{̗̒mIcy‒I$[vGʄlC{~i$I$I$I$I$I$I$I$VKӊ׸?=I|?{?|qƦG>_Gz/?/?Ɵo}S7Gԏ/fyl 6[X'2JI$\1)-˪I$I$I$/WN\G?mbI$I$I$I$K_kV]x#^7A^I$_f5*ik;PI$I%kڮ݇iofEe*I$K?cke;i%=x}\_F}ws^{u97̛1>@rto=ûSKncK'2de0w1wxԎb'as $I$I$3q1~Eq9eػeøvC7 ̣] /ё[m޽#?=g}4ݻ{,'ZL.}$Z|=_L1>_Wӱe.žcNegn[˖s /_yU߻lvm,DICJ %?Bdde3[i.g )"馷[m c$@g߳?a{Ovkd9'vx'>|LqёUkI$I%I+݋@_y^ 4I$V7[n( 0G_/I%uV6ƌ fLVnf'o~N^Ex28l\wKF^]3b%/ؽ Ļ/?gU; H}9Wg8=?}{[V#KIhݻ=9:4dDX/5I$߾?yO.~u^I$I$I$I$I$I$I$Ko_;Է8{cٿgػwyoqZO㑛Q+?KR_+k?qFoDU/UI$I%o\I$I$Iy8YYtdky?mbI$I$I$I$e5{[i/E޳wZr2].|&Q{`}㹾_w&>{/^q*:_ٜhq^3?R]e$9AWdOW3kkq?kgQpkc~臭 {w Ieطg8}LJD_Ab5e.v,S9v l'l[7%+k)}peeO{*ǭtZSa cbcٓ{熺Z\Fٻڏ}ے,N^]11+>] &܌Y"@΀>3z'躬kmV49ayVoo=h}:Yc5?/mbSNEƵ}w#gQvݝ84;#&p[z_Hg ;5\+]?HXBv\gt. @AiJ'գOC[ݲݛҴ0W==OwW?Ob~~>b/؟mZ=Cv..47<a)~z0)7p2 k=Go#~];#5pN_9y7/ktO d.M/}x|8Ǘ ϱ ;a 9Q_ӉUʪvE8-hiӔkIl=Gm9Ź::GNBoX-V{Ϧļej=>zwnԹ$5zsoLlg[؊NZ?K)Umn-{ `?`U0=gab]}qԘ'K?އMV/eV8d9z &79~Ǻ[[-#{G,̪fIY+k'{+a8}-A_V$I$KVN׺aRZr+t]wbw_IŶ]Va]w) |lh?=τGqiwuMvŷ> lpzH\n]ǵ\n̻{ }hN- 0  I$]`kC;ovK[Q2aS>$_s{~樂 I$I$I$IZ=9wa[Ya# ?nnyyp|$FmǺn[[^Lj-#!AzwYxo_]~VT#w_JM$I$I$I$I$I$I$I$wyoqZ'^dz?w /g|R8#7VӪA_o{wͺ'lw H^r3%g:zI$I.WcЖz$I$I$KވOz<8'9ti\ϷuAe FI$I$I$I$_bdv܌Lp_c<.izȦcC|=q21F}UmF~a4w=H3(~gkߒI$I$I%QW82>S'M{@MRe=t7߾dW.yV?|uzy]6\`hI?r}M3i!ۋKEk>~;&?J=wZE9tTXx [ohGvxUi4pq:>#c ̯wnn 5{i ú5{q .̴7?">;wVƋ [1@oY:=>흛vSazz(0I$I%C>q{}ƢVDx.$I$I$sGp;c*oO ?}'ojh1+op* q)Dׯw̏hp{qy9KdJ/ac?mnkuk)௸c'}vףvfQ{cדsZd3ut6-.Ĺ9<`:?6rËq.DY ]$I$_$'|Qmkl820ſ{=ղclwi+]'&l:ZHsw[띳J}=j{G.#sX]@v=?6}./ˁwcöT,3t}KĤ[]>Ey~~%S Fe?7-[5oiE/?/Wg =OGc?ԉ7r8_)Yk+Cqq֍XUbc 5Fq>,v덴:\֏ap_)Yk+Cqq֍v{'Rj9_g e-t;puvϳ2<9*.>vSX"~ ܼ=N(#}+Nc& ԶYJ='bw,Jw9|_/Ub{݃~C}Lk\:Ozq7yL.E{Οg[v_~S=/ƩSxOϰwۻ":s* Ȭ<ZT{fپ}⦿yą/Svqi8T2zx;|[ݛ+6A_M/ô:+VFj,cI$I$I$I$I$I$I$wyoqZ'^dz?w /ޑgڞٖY p&:y]WMn}V};գ,^-`/g~wLCV^]?y"W_~OvgU>=I$\1)-˪I$I$I$Wy7q~vlKԲcEٿخ˚ܼ>[og8 ̎2`5$I$I$I$I/DK~ӁWjxx:Jkc`JNiXi5޻C=T:{?~{3^SrKxGؽ Ļ0gK%#?/G_.?z?`?jrW.@y*h?wmM Ƶ9ܾ<~]3b%0+6ߏT?Alƿp .q"c  @l 鲧wMM;!>!qI)MWM5lpk%/?a狻Wq٣t$dϵr{GqzUK L4~)+oi-Hmuq*`OXi.߷}U=4m~K{}| րl}Ox-?m }m1#^Ash?wmM Ƶ9ܾ<~]3b%/ؽ Ļ0gK%#?/Go},v54f4I$I$I%/?ŧkk,kS`>y8 S2?AnO7Wcj5OmةUmx{ Ă[rE"[kcSm\|}vƣG>_ocw77c@Ӻ/W#5>7؜7#!u$Rv%%#o:;fk~5i$I$7O o]RI$I$?zъvGܫOix[y/U[ӞcGncFIĥ_ETs˫qipׁAUeisPᶉh^iE6]]4mcN;}]-ټ?+0 Cܿʿ+>ou}xt=8I$I%ݧIv':s{^%y @ #|WUi9wEc>z1-lIx/{,~rxxYfQk/hR\kW؞ߛO-CS+{.sS CxC亿_7ڞ_tŷ{\_w d!i>aeۓ^]v:zWD֝@$I$bw¢Ŭe?ܾkAw`vUMsF;KN0wۊ.ثI?ckhe5{nc8 ~7r*k_aoe#Dh|06iog US>^?I9uC3{}vWsIkoW8w7˳vOqj/}'1~=ܿ2YfMis$>Wߺ[o Oݛw7`3]}#YSV x B_e쿾y8M55u㆞nf8XcOzb[{t5 h#~OqL^ON(s㑛Q+?KMR^+^=ٸjc[e<^I۸zǂicluVׁ= H|ls}_=&8漫;}Q޷<|s@^_xfz<r'?O:~I$I$$|7~WGjk!I$y9TU$I$I$I$I$5)K× #ʾn?g\9~Y^I.vױ?-O_+/?te;#ˤ1k.TI$I$I$I$I$I$IUγ3Ӛl?,|9YuݩcKI^$>}-Or߇7=6,|>(lj#k_l}L^m7 /ٞOöVUqMy-I$Irħ.$I$I$I$I$I$/lmV4xy}e;\2KVdZo,2~n(e]SG/>$bOs(c~D_=#ogos{}:al9Z(^YMmiDH#%ۏu[ZG0BK+4{V'vY5URY7WjEuXt^d1_fuYu66ڬhs! }xYvWMcXmӯ|h87wXګl`/gM5е6@=`O+'[Wj>}.0Yk d>1$?3oK}Xjp2&K+g ^\_=/O+?|2ܻl.idfsؙ0I>MoK4wFu'ۯ=w9ygӥ1}7Iz b/R1ݏ~mF/cXbvFыXy4N۰{o:c^+w_+O}=~'É'f {t] / WOe/vL282}hd4 ky'Q}).^gi'#=6-cGkaiw?)3j3?w?yگnv7ڭ嬵ϴƷ#~[v5Xi;{^f;;M}mED|gOG_Mʋ}J.# #}5dSe7VjcćI$I*=v~l/V8SY>n'p~6^=y4>8to_";˻vn&[w+?qFoDU%Gh nx#_EVh묻2s_m` ,|gё[mMpݭ`m<^acK 08JzZ>w E?s'DA)?yv:Vͮ#{UU{}}z|fQWLϗ׿$I$KI}¾A{g^ۣՙs>K^2.7HsSk[}r3%g:zI$I$I$I$I/zkS9T/zz}q|-|xy$ݰ*3՗M<l_w՗_mo Za~OeRq#~}vN*27#G#$I$I$I$I$I,{}Ǻn[[^ HS7ؼ,ggs);W1؜K)sKgǦ!aKK%y#?/_.{w^KF^]3b%/ؽ Ļ/?gK%y#?/_.{w^KF^]3b%/ؽ Ļ/?g]ٯ=E7[3[]fpI%o\I$I$I$I$I$I$+Y | 6Ǫ ?:AZ#o9U}s{-ތ8VE'&嶧poǹOc^_Om]7%e#|2uۯ_=rI}CGkW(þa]y7-_o;7כ^F~MҡƣUsWx<iwWv]̯X[fxZr?k>.:G vɋt3eyhwJXZ"kK>&c<{Kzd^Y K/<,=|$џVυ>uw@և#˔UIBǦˮU[K %|3[FE8ׄ΁>E(kvO\  ~jǦiU[CX M%[V'1Gdq>'op o񧏉/;2k '^dz?w fw geדC㊻F_nğoﯶgK|tr\{omxY_{,'Ұs%VEԳ`ӗ־ye%O]Cwo=]ie Ƿ{Gv?{6owS^I$wyoqZ?gOM51خk'@ԓp?[Wݨ~Cli˸zǂ}}.2~v (MDV~u4S$ ~e係~}:'Wgew ܌ߑcNq l'ƏJdI$I|GjE>=?a%x~}`/{I$I$I$I$tmGem>ƙlSv| w{ړu߀ʸ^ 1?#0{Ɯˉhof>= xi?8W03k,`w?`u]NX}.vl퉏Wa Dk}`?iE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co tfvWhn+nwsğI$+1JKrI$I$I$I$I$I$I%}DiZ=: {a]%y|2o?u'kE? A.#`wo5]gd2p}x8ޓ+28H ?=QWo\\ڲ{0}v0phn>5 ᮶OR$|(h9 e1_~k+Rۿ/c\hXnGUW~M5: 9$IBjȦncK^lj!|1;wڋp{-m>%ջ<#)uWu6:kpsr 7}.r^q]eD WaлTI$IBǦˮU[K %r9KK賽$,o y!R__q`ogd- nq!4)vso=g X]o/"eNΫ;B?ħۜS֫}x/5}]Y6w ;o/0z~ ^7_{w۩5Sq/ O᳈nRiç"z>0I$I$I$I$I$I%o\I$I$I$I$I$I$I$w]o8=X&D_^s߾vϺX6zۿ=":k]'D_Ab4|/[ %+s0.}7quSV=5Mm0@h i$L=Cqɼu5>g#;~xw=ZZ0_]v>;F'rwUGWɟk>1{GƖn7ٟ?wvKO[zǠ {+$~sŭtoCK$|AW>}_ܲ}ޝ57-Ӗx?ۏ޾v\fKp9״ R_pKhwnUuT8g%Y3FmuGA^=rž}vVQUB>z޴W# [Jg[6I$P)mXױC\m_u: h߀ {WwYU.4@J.߾w'^wFC}coϜc$KwW'M9|G|`r%Mo?y> Ծ)mXױC_o=_GG^ ~fɲrg|Go>ï8B}`inn]4Y=5`_4/'j`[VkZ'#ȅ">&Gpg61 /ݯ;;%YX\([ $I$y$_Mh«~mg ,P<<#|Ⱦy9T^;>vBۛ걱͵ھz_FYN^I$I$I$I$K?ޔG\?U+ V'Źٷ_}Їzz0/CI$Ic->SM] MU-6~KOJj=kaSOOVۆy['TK餖w}yL~?_3aĻ/?gT{ 6)G^9~w1>[mѯpc4zۻ4imhw1j?ƴ\߳7%nk^NuU3S>^5}SGWm=>»%>aY=Ê#9֮/xX̢2`Klw$jǦiU[CX M$I$I$I$I$I$I$I$+1JKrI$I$I$I$I$I$I$I|Qݰ-]3[u<,tUR^~.׃gzv9}Dϱ㛾vCգs-ܶāGON ڛ.-mGcI:uI$nax{-| k!<Gf2;~nF&K8/DZXٞ4]?دԶdv߅iNs{noWh~V=deza.L)_3uYu:lqs%$?o='+1'1ދxdtwr2)% .Um.{`4doW.W{ZQ?t$&H\Kď,ep㧊g"cOĒI|u~}SWNKqLT׽iq~{?0pƀ@$>g|=^vVlǯmϟ $I$I%_tss[kqY#D!pi$?ğ|S?JKޚN%}g=}3W0:{MDw1K?qoCl.\LLq36m3|ؾ  M_#v|g_cm<.i/γ>Ӛk9,ZI$I$$WOxFmul|59ͫ> f̒E$PmUV@I\o,u4f4xM~+ĮP9ڝwU0p{V[qp;\G_wq-lk8v׍y7?Ɨ'ۍ@$rqgkػ7 ݸC;xG3.jw~$9䏴kӧ1:C5ޛrU%V=Ox?7O}ceXڪ{̒]3}Z\N mM֎ ONj/ I$jӹ W[Kf )}O_07 t곿qoCl/wyoqZy> Ի~zj ..}a|ؾo_kmxZ8KQ>0ik.ȷ_/U Ȟ|19>dc*[pWۿ=,>ۓCio;ys,|R}_mZߵxFXOm= 0`OCN%}9]y05ge7Mniӳs".?Z_2;[d̶n>G\^9\Dwj_xCsΎa% yI$I$I$I$I$I$I$I$I$I$Irħ.$I$I$I$I$I$I$I$ŝOWy6&=e}}vXVPM+4Y^O)hkUqs< ~|[3f5'p>|?o+h̷^2?KMo"5#kоݩm]跴1jz{7܇N)lmX=CA^+?'[k?txZ?+{}iy~oI|9[ٻnCOgp}'[ljV]սG$\eP67 έti$Kp* q)Dׯv8=74?|U.ypv_\u%ޞO+OSOSYcZ|!0d2cO11+Iu_a~w϶y#X,25l_A}/Av\/:׿wOwfqb$I$I|?}p̛oq1*+Y܈w)q~o9<} I$1^M*hs]WM}Ÿޜzq9c.D|4/e}/Nxstzx/?3v".[m.{dd?}y]y$_DG{RK;w\p#&I/#Sf ol}0>vgayo~ 컙_[ ۣ#e}Eŧ؜0Ogq <|W30.-uYC9AU}E"žu?_U>z޸.$I|>jίb;#Ҳ.Ƽ=\}ziJ'ϧqy/GwdžJZ}{U|=^v,ȯOu&ϟ.$I$I$3p;3ɡ]k|oݕ8]kFtJO/躻[Z][ָkAaavfcbc׍C'Zt^s,?P?KMo?y> Խ~yoq?{/+.}o̚p ޅebacF>;O~OO.ewLӑw @.cض< >B 7m+p翀Y]Dl𬵞*k. p얟Ũ^ۿoNqK\:l %n۱;k^Y,yPz y^jϱ̯e8m!k>v?XMV/0'\;p}øz~2mgĪ+{Negm%ޗsÄ^II$~ćo޿q?to? RۃOn5zţG4Ӛ㑅Q*ի5ͮ1.$I$I$I$I%Mo?y> Ծ^s.c@wʽ~}!8滏;Oh=}v[~5oߦO2K0r;~n>^3/DZ4_Q_t[6aT}ÿ4oCce:.Umnc`D4t8Ye;@h7c;h?FV#|z[?.{{whg}٬w 끡{!]U;ٔx}J{Zpq;U~WNaowثӗoېYX/}7Xi 5:I?sv37oc"%t|Fל$I/G_!_~w~yJiy8-2?OVoO&[j}7/o}xXy5e2tq;c힟qL}ܛx|QG{/7 mn/ؽ63>̷"h s~*[ŶV# ";s6vĻ0gYYo~f;k^Mέd.c~e+ Ng!}nnS\m8mXq?cyo}J+hd=@غh .ۚZ8YM̾C.%own4wLLCx1c0 UwIʜWzeaĆq >o 8ӿL^9;>QYvVE7 ~p̗CT j8vkm^z_dI$I%_Fͩt$; UxZEe| lD}. p]I$I$I$I$I$I$I$I$I$I$7O o]RI$I$I$I$I$I$I$H]^5v8;x/32;~nF&K8/DZXٞ4@^W!uOx0>@I$Gݪ=?[Ksxl/>}iǸ\>ѭDzٿ=S>lh>|p_F$}kp1OOұQ"%H_'yfvlvk3?>v+s~v>3+G{oj>}6j,Vpe ?%oZ}~{okGIGN't3/U0sVe`z葢\4A>C^iE]꭭{ Ȃ exEoCB$Lj-I|=r2F}vUB>a8۲dg1f]\\o ޞO r,oz5h_YW.­UCay$I$I$I$I$?MRX87ڗыޚN%+݋~=?Wy5_1bWVE6SumZ߰}ǵqѺd8q2t7D4wo*nsqX8v~ |WwOf{CfwxǶYSo5?Gː_`oXg.-hQg^漍%kvn4aݙhof=e >.^gl{/kuzm'I$I$I$;7wާo93`**vSmmϭm⬑"GoAdb_/*ezvQuy=G\ѿ$I$J|XeܶQYܤy95}ۏu[ZG0B;>h**x.$ϗ$I$I$I$I$I$I$I$I$I$Irħ.$I$I$I$I$I$I$I%>wgq1/c 6y/"[c8%w+#'d`YS8]goY$\ۏwo}Vܾ 1nW?_k.y}\\Lg7bNgS1s\R.[[ן3njǦiU[CX MBǦˮU[K %xyU}kkߦkS GoL<^I%{c}߲ͭsxs(>lF-B;mٚlm5]>f#O?&+7//kU6wȠ/c5Wks\ 6˔K)mXױC_+d{Ep~wM.dy{#~`85'}OÐUMwScmƇ12" I/g|RïB__q?"Iױ3O]I$I$I$I$KޚN%}g=}Km4VS>4 8/ I%ٻs;bP6PqH龋Ee}={wqԥ}Uz/ 5~T{oo[W&g uQOWba >/FW= ƿOOkߖ6},kփ_'l{tϸ5e &TA7zcXѷۭ]^wϠ^.ֻcU:{¹-*l,2p2,MKdl}\P _+sťGMy|o-[?j5[}Fq[sۜ]n$Oa>}=˵WulisCXG-O%ٻ?kxMPͬs1|Nf92_o|qYv;F??d{.+b:Z2ǀ|O_f8zux|Y> kcC\ad? W _7cݷ*@A<ܻUw_Ɨ1=ńqrDb~[V/dl5}a! .2 k !XmJRad? W `ۓE\tqpwDC`~= ߰_bqE |I2ZDŽNۉ^% 3'oٯ%9} &ctk n'p~6^=y4>8to^98?n'ܮjN5eXs6@u7 ?'='כkmwiӒI$I$_uYu:lqs%$I3N,_TI$I$I$I$I$I$I$I$I$I.WcЖz$I$I$I$I$I$I$I$3ϳљ:'b^2,g6Wx/Iz㟵=|^.S'q^KT\yWqooS281;z vȺˮc.'%} %>7rd:e1pXFQ .s3\>u=>0_j>=}%>3э|zP}; 0phvFM᮶OR®Y^_ww̢G so7upK~߳u7wguLc%]W_}Vq26=.telCZk# aO$FomT w5 ǩ\=cs 5 XɇgBv_+5㹭/<>F6DL=9]۽z_|ɪ870z*k X`?0 }g)Y_c [WI.\M \I$I$I$I$7SIa|Oj_F/'z>Id1#𯝒^$A2sE=CH=yIQ}vOøcazZ(Q1;32q2+ɡe.k\:f_d?!Wo߱xXϾ2$SslwY$+oN,xww7ydGBAw%AZiSy92#O };EU;&So״6|h$<߰v3~;xgZ=Rÿಿ_]mw}G},d=y.{cG._%vwL ]n%PDaUI}GnÍ1Ѵzyruk,s[n}M |޾X[fxZ$I$I$I$I$O_dQuݸo_O"9Hd^G߸O;:Lp{RI$I$K awkzqI$I$I$I$I$I$I$I$I$I$K%?%޹uI$I$I$I$I$I$I$I,?_CPܿtKٿjwE4-q'i(_uXu6iss$~gڌ!SÎcH1c+GY}o_`b*C`GL~߅ 1mUg_+_8hYmwjmv~ïğ{wk{vߊγ~5ԅ $I.W]}|ѿx~+~Y6)*axm떎LJwNݝ;9;&p[D}/|Nl7##侗G~; wcsȁWxf[ۿ~eoߤX]>0 uW{H/ӗ:23hDq5B}a'doV'w.SI$I$I$I$Ewl--dYt?uz;ޱ{ htH2 gN]7^^Ulw=]xj|؅Ϥn|۬ŮE6~pig|jK,'9ZkUYū+AlG=@ܮ$I%^_ٖ+=-o\s5 w#_1z+łPYB Hߊ߷c/jP+M6 ~5?&@=$p !xv^Gp:( /R^+&CXg*"y:!}0FEmDq5B:I$I$I$I$I/1gݾ3>vzE|g|ؾy#최,ͶڌMk?i^I$I$yz?mbI$I$I$I${kxNYuPΰ10?V_|WX+o8f:g}77V/grD_Cy7bG]I$I$~}lYeloww;Gcz9?.Umnc`Dدk?aW3~kxZ."Ucd8D[Vuk{^8y2S|:7Z/_T?=I$I$I$I$I|K3r2_~EDq9J?l߻z'7Ҏ?)ߵw/a2YfMis _XrKRak_ o _7c-YYy}%xc^方E$Z=wIT_K`~=ܿoǻ[ _XrKUN;u݁*/ǥH _XrKVn_n&{hwڏఴկk#"ٝSkh<6\)s1ˮ/5zܿ07 .잠z/_>/ {imI$I$I$I$IaGӧ/_+/'[WSeZ#w_I$I$_.I3N,_TI$I$I$;hg^|jeyWhv|Y ?n}O޾e<[&tF7!뵌I$v;7&qWcz_QO۷P?g'#О$I$I$I$\1)-˪I$I$I$I$I$I$I$Is̊wQG+[ -;-GX Ke'IUnRi^~}pu=u\K G^><_i/w'qc# zk=уCqo uzi% Nǘ>Evˮc`pgtOݺRޮqk3&/ޮ Oy78jI$I$KLJ}~k?."yjw+._cn'mįmcu^I%HGvNxc*1sE)$kcc3zUmkDtI$I$^c.^F7&WSYUV|оv8^釁Ikm˺_0q1~>&38(ǭVٞ@GI$I$I$I$I%9hN:_DuGpXk32vd$I$I$]ė܏N6^>7xWeƳ_ɖ8)y^-_̖28kY"wk+ /d̛<5:7.;W}Yy=zm<-hI$Ih.Ĺp<`4W89x /tdVktG\$#I$I$I$7O o]RI$I$I$I$I$I$I$Kw߸~c)/?/!%sy1ՓkYk>{.sS CxC䳗>},gv$sCѤ?Ƽb~6=MsN_'_d}]^Oqs$I <<>bzCI$I$I$^c?ď>哗nOo,Fbzq|!|ݰ-]3[u<,t_D,g/1ګkM M?#;^C9ޛUmԺ#n2WnM51sY:&<~`híߧ[]1> W$I$I$I$I gbc ,Lqё[Mp%_d6o}:9_Ksqyt^s/1iؗڼ>^#澉3xx^Pk}_qs1;~3r+ơe kg\[ǷϹqTB밾e&[!x8jqwkXiyvw7<$_O}?g{o`YT[6;[g{㳼SזW}R B;3ǻzUu/??0?ZY}LFZ w鎅fNc"E76UJ-4ߟp5:qz}Mc6UBfbkq0nKlk38\?'b1V+]w}b1μ=ͩßIU;ٜk6[>bgL?',;aMߞxO^'3$n -c4(8t N0r;~n>^3/DZ4^gz<꫽cYjtXIok=f%]}h"\8yVna3ps[r*wpl '_ck7> S!b^ 7s=N'្>3[~cձp17k\\LoϏO96>1>\l:KzCK6N_ >' ;7+H:v>kaͶۓ[8r,Y |ж;㳼SזW}R B;w#jȧ/ /e0?I~i~SFM dqz6;!&wU߷b} dHI\ucid ݻ-!}IϢ;/)㯼Sט}".J?e?c;ގy1e܃C*l_9?u˶̌o>+xz ơx{l; r5-gq_bcY}5}yY8=)k[+y(>7[/浗> xYo~c>;ȑMͱd?Ƿ.ϥpgo{}ߞ>?Wo҈'y?e1;}V64B=?Kp<)vn?{sn{xy8n^n8m;t8t=~wwfcW4߽9?k[?<)vwO˸vZL?Y>3,gIyT|ߛ m'2ҟc gvk{= ;>cz2I$I$I/Ư}3ObvCI: #I%#}q6$8p67Ly_?ㇰf}qd*]M9ucnH>>I$K/=v\+qth /_I$I$I$I%o\I$I$/zlUUy9UuӁ13- ,ǹ x+E$I$I$I$I%\|oo]~UUPޠ+Ԓ]m]q s=7})uMʹl0KJIq_n?g߲~5v_q A7ro>}iǸ\>ѭDz~;{p4:]iuqc}I$I$I$K񏉑{8ۭ6qGc{u鱽ZF켎ᛑ;,u:#2P}]Tv!m8ǟҋ/k#d']ww_mT7+%_A<<\3COtG}?d~]zr]]s@ap-2NϒRI$I$I$I%.~Gp^[]gqk|_ݪ?ܸG=W5)KÒZ=ǿH?eTsVrI$I$I$I$I$I$I$I$I$I$I$I$JbE.XS9[0cOPI$]?v?6H]鼽!X\Ox}tI$I*ǹvH?2:C, IYd=^I:W=21l}'?G?[=/N۲\[`0^}WG/Ou]m]e"6N I$I$scQKf9kɭ.@=9D;7x} }.՞F&#y$I$I$I%o\I$I$?sw>ٱ2#{epݯvFv ɡUޟoOOox3`8G{UMwScmƇ12" I$I$I$I$aJuj%O۸q;?g'3'hS}>-<\ &8'fO2$jO xCC1 gr.uKI_Akэ09p;.|[6=q$I$I$I$\W?mxq osA~]ܱ,Ľ`&$xsTR^Q"{-o l* [赮y.g %xB?sW.ݝ_sƯ+eǽw06@;o |}X\x,h'pjO,݉1K/:7ϱk햆[meτyy;_|n_m˯.~ugw^I$I$I$X 02]~DH_"`dw |LfqߑcjNq8vׇIsĦ_̆6KޚN%gw~F ɽ5޿W}:>c{f;]Z_˔{Drwhkc[sZ8O)nid[,?XwOƛ===ՐIC?";I>E~q'f7w[Fv^>7=5|S_Mlwkuk@6?"?|?pW\z?րl~E3Eu/N kb]p?:KĤ[]>Ey~~%fNe4kPEG,)]3osXc?{W[@A";nHg~Y>p#I*]*qȇA`{slς4pgR? I=&`Iss8zt3亜//%ܶ6fo ֟Ƶ" co /kA";nHg~Y>p#I*6qxkWCf|ߋ}lr[W^nӏC5'R4c2-yq.c < yl^jewr*Ⱥ?րl~E3OiE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_o,__ddX~.>w?OX> <}>?^7_ve\m8.~ .,wv:ZYhy_`z\}zV6t<1#'KWvn}Oߍk8\_u: h߀ gw<D`کggp4OV_y!ir>}OW888b&:߲v/C`~=O Op{&':\kG|۰)ѱ̮\Zr1_7?}»#)Yt:2r[ù]I$;e787ɒz6~K>^lj]v\k;m=!}o]wLed@g.o?_l\ۨhǭ6dxkiOٟiO,r2ccs~̕QMXM5hkr%}5dSe7VjcćKc>},~ K7V?ʤI$I$~f;]Ƿ[~ծADm}o[c=h,ʯ&"VI$Jq]R.̧>Q躬kmV49ayTI$+1JKrI$I$O_dQuݸo_O"9HdI%<}ֻCp#~m{I$I$I$I$?MR^>vOv>dYGL'ƎA5dv{oŧD$U1enU/ikl|tO,Y9,w@}X7__xnQ_b;'}k8^q ߨyc_izy/dWocc|Os곺vLM׸\er?w?o+=xYC8}1ۻbp;&eE1hI*9]aՇ1ʻӦZ#2d$Vf%7W[ku\[o=I$I$I$I$@ȯG85s($I$I$I$I$I$nf'o~N^Ex28lGPmUV@I^?8Wcs>-wiC|ğewff۞f8, +I%Gw\N2[hŬR|sX?pΠ\=&>v 2^LC oC%tSV=5Mm0@h i$v}koۑ?,p@}6e7V꭭ůcI$I$?ůb[C;E@L6|9_qۑ{x+I$W :w- `vykޗjwoƾ44V"CGz^} [7aӶb~֝_Iyw^;uk ~DtIrħ.$I$@Yy/[cxZ%|6_ߴ9% "EL?) ?hvۜka1[_Qvg~δipio6Ly^?~}gyƮ1{#Lsx7LӋ)$I$I$I$7SIxr{~#oᏚ%6'/% wXy\6GZ\N6}N̳D&X}NNۉf]!1'ov&Gog:3( -_eڋa;)Է͵T;XXj"9˪Oe{E6Cqה)uWu6:kpsr c·$ob4KȮs73/d'/"̛V\:5̠)uWu6:kpsr .yƧh߷wv;\*keo;까,̾ߒ̜L1dK\0{oΑNW{}^X, =ꞤY=wq2;KxK,$xH]>}+v972goh3ìqq{F0>O+LKJN3Cdž$,_m1}^}Z[K)!eav#}iqVhxğ// L_WVVR?GÊ`m}]J_mN=Vwv?-\*#O=^s a}i{&:U |I/eHw_KFwک4wL:1{>0 ̾Cܿ.%o/a}˧;Xn;xY?w.n|I/eHw_KFwک4wL:1{>0 }]eXm{̗̒N0v덴8Q,5>1?O,>E<}>?d=K}]I// /eav%̾Cܿ.$ٗ{/ؔU_~-o WR-Ͱ// [_m)Ȫ[#[ϛaTf_k!_o_d=Wgs=OGԉr8// /eav-+oۻܝ.pg?Yd=ZW߷wv;\*keo;ٗ{nrw|UCE8&wT{ %\L uG>$_s{~樂 '`U}VzaY$Diگ_hOtWe4;.$0{G,eo\\ڲ{0I%mǎu]nK]6/æ_Ww_h8ܮipw]H`Xˣ]^rO-ͭ}?G؏S]M?[[CG;uH+}$I$#?]ޕmpqIäI$I$E۟ w_BK۞= "6W햟}_5ʤ~-߱#7Vc֮}<.|89x /tdVktG\$#7O o]RI$JV=6]u\h+ʾOc!ՏeL}5l_ڏu˶|?o>+xZ:$Ɔq?q_yK{[+_S_ioZ~+U_G# UӫW,{w7T\Qg;K뤒I$I$I$I|3~ϵy3_1ڙe0U7bd?Os X^oc5Q`"wN݃}97#[@콇}.فNKXzLJدY}԰-xuZ+;ngLCxC)cB~=ϴa>}=˵WulisCXG-O%h?!;x-/cG^|Y۾n^yk./S'xObgwnNqn;ſ1_v퉗O1=ߝj:o܋m8yyT]u#OnUC9I#89x /tdVktG\$"_MYMնڬik!/&״]z0vHЖ3ז=$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KGܲġab`xr^-3?ptdWۚMp#|rrU;vEkvVAiwu$|׿f0{{~XSml??ç%}c]{{q/c\L-I$IxG9aKrT^?hh~ܽ:G_H~-16koپOY3Mk\\X9' Z?f*h^ͫ/.Y ݆nu5e9 uI%2v+U^~+ $BJy;/e׉C::6#9_g]'yI$Cq8c8@ڒIrħ.$IaMKGtokk&|Qv׏o ^GS$Ԯ9$՟w!c~ii'yگ5zܿ07 .잠z/ tg^c҉s^KI$I$I$^8?Ɨػ̬X'xK_lquϸeuYߜ];=9UFYhx >z}߸wwpzWp ~Oiqwmsl`]:;p~\^ׂ1 2L$II$I$I$I$I$_fMյϼˣ?~Z?9v;7&qWcz_Z}U?qWe3.qG=nFy$I$I7c?/U7ȯ5⛷wËNqn;#ߝ2;~nF&K8/DZXٞ4@I$п:w̌߳,5;7q] ?%닕w߸~c)/?/!}E%c۳]Yuݕ.2N᥼>8$I$P)mXױC_5/?f{6WociM{cq@p!y3>Ol85בtGCgk?ǿovKqmt2`=O U?g}J X˄ǚ^jǦiU[CX M@SP -{Z>6CfI*i$I$I$a~846֞5-$.Ra|}6e7V꭭ůc@}I{nnKn3 G>%^d0{|p_eUMpt~I _7Xy^߳CmmVbT:/ JՑM[mƖ0BTSV=5Mm0@h i$I$]g_߶bWNV3rMCc=_xOggXَ& ۨp\߻+s<;^ >v\>qkֲѶo}'}݇|kLD<'to}5dSe7VjcćI$]O;KWKuM.>D[ÿKOLNƹ2cFx>2n;|v_r˳.~u7iQZd1ڞω:23q걳Mu.'of6&=x2xklGI$I$g}9eߝ7O?H#$iǯ|˲ڻ.5}LvD~}B܇]ckdh4|N]nm/.O"'a<,Ucfx\}u,fͻ4o/wy.^y, Ts=c?z{o.sH2<ļw;k]w<CJI$[uwSc10ZG" ϳQu,4ㆵYoI>P/q;7+H:v>kErħ.$I|;[>_.QL6=f#Z>xKfMcb4d "A#WՉ.vױ?-O_9}b֯RI$I$I$ϵr{GqzUK L4~)+~XX_g8o% Ӿ㗙Mqêuhl|v;ƺAt[ŶTkytݣ_Chw zU}(ņl9'>o~vha$I$I$I$I$I$I|8>z5`gNF4kgg =vݾ򝋐[ =:?5؎vH؁1I$I$_ |߷P1.q$^/?OpP)mXױC_ğ{S?$I$I/zkS9T/W5)K6{R1$I$I$I$_nY?u>59ͫ> f̒+;r_M޷Ds_f`3cm {{I/6{R1$I$I%Kc7~*{k--W+?އW)5KkgF~C&bfUmg3pkI$/zlUUy9WovVm亲+ftw}]ݝyynmᲶY[Dp6ר_h>s6X׷%8~fd}+~}??qʺ  hhk{u}/eZ͎'OSy}׺fgrr C[.C_cڳm`pV`|+W1MT\県v[g9Ȟa|}Cگ>ٿnY+ɰWso j߲vqkٮ}޼{ǣ^|%n^2@1-?wBIZ˸a[_aa#BUwܯ_asr]sopE D%?%޹uI$?6x_{vs8|^:>}r.uKIPI%Xd~՗ݏ,k8 ԯ_qۑ{x+K߽C8i׻4'<~係|{ltO [`%}I$I$I.r#z,8htOYH=žL̾2o|qYs2òw̼Utꬃ xZ/_\w_Or#3ŏ'0H3_7}];4?1~1+ҿ~vع&z=kϻ^{I$I$I$I$I$I$Kc>}mxBYS7`ה>#Lߛ uV6g0Wݗ?flrm7/\I$I$I|?`ysk$i1<_$'篳ݫw<7Uκ+_ W,ﴘ_ۗ} / @ۏu[ZG0B7@}"fY9{  RI$I$}n?Y6ɩc@]x_qoCl/I$I$I$I|}0i_hmn?%s ?+q}Z0'Y?/kWu̾@&H,Ucfx\zYx4΢4d߉ Kp.`oY>+蔒I$I$߲EM{k %loԯھvV&]3 x& ?|߼׈?yxOgJ1$I$1?k_ϽݺZ<=\'>jf6nSk±wݱoG ;.E$I$^ڌ~6]}Áo\ r oKTPmUV@I^igqf~wOޮ۪.~?Mm6[Vk̢7]efXD|f?b.kr=mKs328Ƀ|TN;}׷Yc_2oݾ~-.v'fo6F2%wZ_buVZ;鵮I3漓ٜ_hr;^KON]$ Xy8~C"WG%d}_a[+ǹ;Y;~SKXemk>`/.I$U,>ckUU'g._AQ)Wk{+Kpp x?*)馶Um c 4@4/zlUUy9W}gqiʯSvvHo,{8hq>2C^k'8W⎟T,o'ѧe9Zw(qrdykRI}r3%g:uħ.$uNN^]>_$g齏I{W/->b.[+mӏ8f%lٚn̠j.gN^xC};>Oh9ȳ-[GX"Wď޷IOGp,O]ػ2C8m<#o~ۃG.n ¯.dqzaG]t_fuYu66ڬhs! I$I$}%{#dG>Ra|tO=Rލh'k)z~;{p4:]iuqc}no߀8U|ls~gFqݑ{*ecx?Oc 8$I$I$I$I$I$I$>}׹}~2(mh}Z#C|+>ؿwV[aaNX%>u_X$I$I$}iER>=@|\;uuU lppk~ȣa cbcٓ{熺Z\FPN^_ k0{k=ލr 1̓[&MՏMt[j S1&b1.+k".[m.{dd7vkڒI$I$]&F^;7-}z+`.?o_pޑڞو_ V69:P?qoCl/I$I$I$I|gd}Co/ʳ7ɭ&W?#6[u\lp  nom^2 N5ou %|3r2_~EDq9Js>gg18}Ch~m}I$I$ƟpO4Dӟ~U~v V^]<x \켎ᛑ;,u:#2P܋m85`y/vl}|q$78ْ$I*=v>їܲF-fr'<ɟn>}YLm^NL g4I$A~}}wlv>w-{7G\Jb=OMWLqp8/fa7/חC:;v/'Q1į/uy̯?~enM1|]weM>~ ,Sy d,'cvOlq@qpI/ʾ Omv7q9߱!ZbM6297$ ?2'eػe=?C.z5$̬>}wwww@Ё#j{>^K(ǶDWى/?ޅzpK\Kůo?ih~E.@pAuz)~7rn\wN?]wnicǐ<`KޅEڻlsu< gE|쒝[uwSc10ZG" &e7~瓌 ٘/,O&yt/YO}n7tN/Jƙe;!ap8'p~ܷdz=}27]1)-˪I%mEl압*g qg>kl:=oUW}?h;xٸxC--~o?d:kѼ-GĒI%=gټۨs#kOْI$I$O؟ddwL66hL/}ks[2=OOҭP&aNIYgw~F ɽ5޿W`ůc31~󇍙[r(x$/bDLJ#`v_4ddfjƪ'l0W˿hw.3NFKټW.ןpsˢs!'/ac?mnktI$I$I$I$I$I$^Uwr0%_:|澰}}펨p ZT<:ؤI$I$b}qr4ips㮒v^{ >l k&_ˈwĭ^33mSS]/g -UC@X|t/X,Q'i`3+T(kmV49ayTVo_%} Gwd1l(d=K}]_KwOfqf;n x=031x?^w^}?l3r{[:N*~!s һ_e}n&g[%6?vX> + OqO~kC??Vٗ{oSeA[[KCu vd{h8ν5,qC[V=6]u\h(vI2ʃKHVUq;nλ"\r-w Qpi$ NߌdqYsZ26In h# ̻ݏ闞5} !~7s{S'qfIV6.5c[] >u+8]ha)8T9̝<JI$I$KXu)9Xt]7WjEuXt^d1_h/s2;~nF&K8/DZXٞ4W=/%ccxZ+ĒI$ݲc߇w[52mnII$KWGhC l-_ð! ^1%]ڻ>%d5甈꼁$Zi~ geܚUݐ5ѾDvh8niqoy^G:Ƴ/5:'Nnq;n%x7kDgjI$W}98 gsw\Χt%xٟ?wvKO[zǠ bYgٯ]3sƋ^88&C!u]\XM:.̯D"FXwoLWbp2PF{`]2߽Ʊrx &?W^Ox#CQ1;8$I)uWu6:kpsr N^Uj%=;9ho=%{ٟ=?h}J_[á-U?JvO~O1Gr3>~^8K'^dz?pKY^oG719vo^/u5^'44* cЖz$6{jI$I${U9a9Wk?۞<ƇL_C}c};#Cd@I$I|=>ؿwhj0][8 |yۑut[\O SS:Rܚ{͍@z~CR]K3Z\ܾ m|\o3@;+)nc}aր֏?mgM+z@>0%/_}n':jI$I$I$I$I$I$I%_G# UӫWkqs<<\[w]sˬ{DWt$UM]cj=02J~/_Zsio@?~W\K'.=WKuĿy!R__q/~W\K'.=W'{3vf?qNK>F:"h?sڎo:x1 沰2~K2q2,ƽe.-sg\Ÿq]Ǻ.̻2 UU:.Umnc`D{iLʃ2.{>0JI$I$I$I$I$2=/Y[jq< o&<,ȳO ͝s W}]Js=߻z'7ҞZ8uS2* ȹ*~~ /V8k }]eXm{̗̒{}g{yN -d]wwpsUqs 9ta}XmNDG4'.=WKuĿy!R__q/~W\K'.=WKuťۿGLKʻPO]'`kS;ovK[QXauƿw틻57d~;?|__t~}n Vr+g7c6Gk:*9{#wnE]u\q<+[e5d}T[mV A 섒I$20`v3XZxyuq|I/U#h_ic@ͼ䉏*I$I$۳pddo_+ھeOP>rޛh)馶Um c 4@43~F^K(ǭI^v}#eN{m:iw۳ӓFMp@ut4C4'7hÉ^{-~:OuYu:lqs%$^~vOj&ܗq^掃]wN׻#&qYc^.?v}˿\*~6]@syzK˿/<-fonuR/G~cjwuf=lIp|lo^1c!g7s'?WGu! u;颾lIv?^O6zo:)͑ѭ>S}U[o i;Rg>av+;}xx©UYaJoܗgd|HVgSR~ Kv[߱\'v7"Ou?ciV?]@lI8=Wn=SunZ7Z8Ycojq].U+;THbq|a}1JKrIa'7ccL>DKOr//%ܶ6fo ֟ƽ ׏[0YЉii3z>oڱ;/ clku :-y.U}'*_y}÷gw ِ^`c] {N.{%_+={kpm  ?G̵|}CگrȺˮc.'%{WϵY|^d~>~N=?Wx1bWʼn/~#Cq?VI$I$I$I$I$I$I/z; -݆gМ:8Utڿ j -mG[dɆ:Z7k?}}ީtƾxu,;-w \x2ѿ U3~4>8!k|YI$I$I$KG_sYf骱[Tr^G[s ȶ_a~?)3j3?w?/H}ȧ6eWn7qꀶ{7 xK;Ey6 7?.mw~-+}*wZx1ӿU/5-l,-Z^O[ad? W _7cݷ*X}Z\x.~:-C`~=S߱=ƑU݇nHO ؼ,fQ_`s0n;ϒV=QV5wm`W8ynv?؜K-d;8(tD/7Y0Ěimn G VeJL eAZ7cݷ*K{%_+"/y 1ad? W _7cݷ*U;i]q/ᯄ0}e '1[c%߱=ƑU݇nHOgE/?/K"/y 1_?,iS3o sY'=)9mn{)b[FM3_gَon5zw3`sOP;YI$I$I$I$J}˸feµVcU:.Umnc`Dد8iaw[F@wGv -ĒI%J;Ӳ1a n5Y1Ϡ xKL~ᅑ:2+uV6cWk}=-aW>׎|.k$I%g}YWrwk1HL蝻v.qa[_KHI$n7a}A>)GY/+ԒI%O\O|z}pE=͘<}{^7h=pћe].xG?>&Gpg61 /?gp~vnوհs>%I/ ò͈}wOs<U+;gWz~H&?v}1JKrI$_+k_bGӦė[{}=벏ٕ܌w9,-l4c/ quVױ HPG"[f8tY=+k񆸟({U9a9W1~ӏV3 wj#D둕_g?՝^[L4LjVI/!9?f{[:Yͽݧb9gxUj=>zwnԹ$5zN1;n#xhŬVR|u<Ϛ̫.ͷ߈u5uYu:lqs%$Y0]qqq.qC>_WTSV=5Mm0@h #خq:έ|}6e7V꭭ůc  M[$I$I$I$I$dg>?ߌ/zqpWs1;~3r+ơe kg\_ǰ`wssucÙS9qj9q<)vO?k]{%mF;vJ[Һk+qݑ{*$HXy}%ؘdᮖ9ѾAuX_n3/X>`\w^Blq^>\.̻Q]+7 &̣}Ӆn{w;Bpv6,# G o>UV%>aY=Ê#9 ؼ,fQ_`s0n;ϒQoǻoU !XmJRad? W _7cݷ*G5s'c^Ნv5͝sjI$I$I$I$I$I$I$7hޟo53$*?7cݷ*K{%_)߲v/C`~=oǻoU !XmJW9OY"gm 54/͏57r*i Cܿʿ?N]myl o_Ux山}|.iH??#{oqW sô3"GU$IZ˸a[_aa#B;ww۩5S.sK _wv=w˃H54\+{}| րl}Ox+x_2XrfoEѰ'f[f}tWQg?o~]醒^Dp~}lYel'ϲ}kq?qzV4-Ĵ) $Gwtg& dm z #/?ٷcd(pd^y>:32GI$?ƷNwvnE6xqac}wWq|KkoxO^q+I$/s2]3hųid?GlIՏMt[j KmN=uxb3q^\ի>_?}kfuY-aⱎ[]g/}K}I$#CrӗK>q;hX*cyH1r>jI$>v>^'xgfd_[yKg'cp6_⫮w鴸54?v%?%޹uI$I/g|Rï~#Cq?VI/؜g,\?zw) OZg^FKn ?7&+Nk5?VSo`?7O-_?h{َWqw3DkP_Kd{omw {v@h >NtrJybN_qcS|eܺOn|KߔI?sgw~F ɽ5޿W}].ʭY59w/:˾ ~d?Sձ_i%\8epp>b9dɳϵ?W/곾чa5%M}\k覬zkUU5`9_lmY=Cc/~#Cq?VI$I$I$I$nf'o~N^Ex28l^A|`U0]o^UV;/?ӟS<|s˃":|b/؟mX}.Ͼugb[U sɒz~I$^)?Ưi]Xzs\!P:>EdS]j{ Ȃ~}iER>=@|2YX!b?g\1E6]]4mcZʱ[#8\R Os:,OpYNgs I$YʙE^d^CQ>~4oz2K_2ƿ2qq\."x?_0}YhWt-9.p>BI%>g%OZI$P)mXױC_$o1[v5una{Oη[g\9g?@WI/7|_Fp6xb"#^x//d#`.#Q+7O o]RI$KM㺲G=0Bؿa{q$/lmV4xy7_~2}[q)q~}nfvO.h b} UmՎ:߀_3*)Komsm671@wϽwϵ}aSf~uvlw=W/J߲۹e7+127K|oI|Q;vwhP|enU_i/N}۟\#x$I$I$I$_o>kq"WHb|̎F}h`~vp9ro/,\Nlʣ69K>nĥs_]̖2xY"5kB}7V. q:B>%aa6,WuXn:5@'nvos+/>3#:Oﱝ[7Rxeńq|nRiç"z>0I$I$Ia_kq6Lhck7> S!b^<)w/O?d?]{%rCܿ线_<)w/|] /,{>z߷c.?W3<xUQ_#湎;eO0\>=2O K!]g\?]xCHs#HZ/ɽVX7 D_Ab4" co /iE0(K"/ 1GۿĿۼ.ŧd^DS},oGKŵR?0+7 T?K!"/ 1G%S1iuMWm훼?Bo [_]ŗbӂ2/i|g+y763YolET']dE0(K"/ 1G_??֓ćfӊG:0>veڏo^)V_]maE0(GorYU16}|-qKJʺl{r0.sZH_%~" c?O+)h&g oik~[U6kGY???a7QD_Ab5.mc}|Zj.7#ߎ^C5aɺ&ht0o{.S7r}}׈DUM/_?nݚSoY'ŷdM~ZXX?HwN@?p8 ?Y?lYRyp]O?d?]{%rCܿ线_<)w/O?d?]{.ﲟjڻpoKA6&?TFet$I$I fw geדC㊻F ^0bS]M -26_v=v@wq3g? \+wvک4aӇQwf=a OyqaZ\ v 9 | Cko\k#q#~cc>߅UMwן;k;%lďcK3}rq^Ps/pOǰgS+wlkwcSrp9y_WgXፏKq{NJ:}ZH]νj3;K{u0͙] ꇍRI$wァo9)FL_2۸p?'!Ԑ}88T rm7Dٟc;]Fr呖xeC2[$Tɣ90=8@$K{}6{‡(y |oy::_FYN]_1)-˪I$I|}Y`pv%4Y=I5x^j  M[$_j{u$a{XTɟk>1{GƖn"Ks/}K}3Χe zEU:ʾa:qN /܋m8yyWW+>US.nM ƾ{N &7 3c3'"<6R5#K?c~qmc~[\;+#~a|  M[$I$I$I,i*'_3-w"D w/ν7=e3vWouX"Lu_X}?g{./k͆&L~$I$I$WoGwxݝMێF9ߞW3k+3\>u=>0ϴoyTѮ]7,,'%ן^#U4Wƹ^|y9lue;ɜ>)̻Ƴ"яڸz{U ˰-/ǰ!UI$NsȻ슱{ꬸT<\G.EmȺicX .'lߵw/t OS|qW>O7%W3ZumtiwcH1?/Lr,o 7+&c|%nv݃vEظtے+Ua9*I$I$I,b}^is[w\dc}_-p X:~NEnvnrn]yt;{}NSC]c=_L>gWiQuYu66ڬhs! =98ͿVͭ⥜'C|;w]Nt̴7<Ief92_o|qYv;FlmV4xy}o g 0nh9sokOݞ ;=-.xec؞@.n}?ߓ*s8HTRI$I$|̾2o|qYs2\|z0i쳎W-쑹 ԟX5}{FkrKlӚ[>NI$I$I$ v݅]c~hsWg=Gvn3=nVmk[ϧ-_KI}mX#v?}vXma_IyX?d/xu\~ڪl0:W}Y>'dz[D2LG>՗;'moV _b>ՉF'mo OWI|:~lZڱfSi`Tͳ1pi$I$I-Uñ]u\h $I$nM_fCU_FX~/ՏMt[j I$Ok?oڻȲGD;{D$;@gi^ ࣺW鏦=fOd?ħ.$I%]F}68?_=POtոI/9[_~O~:yJ^?oS_F>n=:'Yi3_g{}!Ȗ0+Ihϫ}y:L/xg2L/]㛷w>Ó-qfnEL8&u9kWc'[i~^ 񩢛=.,!ܤ~Ggd](}psGÔPM8/"{ON5>vGNΫ՝N)} fƯW_n5FYQi9֋ȦcCM%0ڳƀI>g} /gUms'LI$I$I$Kȣmn!oyY}nOt=>/Je@;%/dcvSlqT qp݃>cC\ʙ˔{or5/a콆K`S5ޓ/yVI,ߴg;~K5*c\"V7zb{=sA.}]He}Z8d=~w?~}g1r)s]n=Mǰi* $?:꺌b#,68d=-*Ŀۻ;݋MUq8}׷]KZ_}.@k˽|7m-h_<*>7q?> X`2!:@O ;AV]m!}:w-}Et}Y}itż? ]]ՏMt[j ٻFmݿK2e&Jnf'o~N^Ex28lY_d=K}]_I/ sn5wC-o13Ǧ)a,xvU[gPS]5,Ows_76v|1Oek^_ O?d?]{%rA; {oho&59@5eNN wCd|Bf_k!_o_d=K}]J/sn+;I.#a~i\>nf_p~N^E78tk@I%:.Umnc`DL̾2o|qYs2Vf^g/kmU';w>pcQ`nE]u\q<* -jӁ2.,ǹ+9%̾Cܿ.$ٗ{2_Yre=ctu=kqG)s]o`pw63c"?y!R__qU?WH8/"- _iEV:}ʐkOD5*ت;7ާo왾qު<q_a;ۻ-por଴|םwod-.Vpo  o>[VwϖյGO8~V7pp|}N~K6O0(]\[[K8IMYMպkqks+ݗww3qsI+vfhz7kʸ:6܊@5f2xLzWfagw_e\>\Npf6'xɽ]9 s YYi~ve,kUݐƹD/ /eCau+}.qbfZYs@VI$&G~W42?x32)Umn-{ `Ϸ.ެ}vUuA-9ȟ%`UwA}ʜza`ĖpMoK4wFu'|},q_ay 9$>۳pddo_+q+_O6}֟ycIH]I ge,Q[<-hAi/oOԆW"MɅI$I$K??1S;=a/tTa=9$)wSOyt?W(?7ZÉX8?9`9+^\4i{E7:U2_Yrf_k!_o'qkvQs{A\6ls>s$>D?Wħ.$I%mK_=POtոI/</o>I?_}''kdW~UtzV1ig>*b?`q{ww''1qeP- Z7OaŪ[u̓}p8@l@frI/c?wZ>cܺY!ӿҁ@J.ڼgUk9>[ ^n3賰a54fA &;McGG7R|8&cmǺn[[^Lj-#!^v^ٟvzO ?^gx}ƩY۲sk . |5|w]3b/j}/0^ɓq1Q_J}GӦĒI$I$IyW{s,k/E6]]4mc!%cv3> [C'[^7_D_Ab5G؏S]M?[[CG;uH*g7X;wlırqK9}O @Fڍ~йqH$u_o63*̷fۯ-"/y 1_֍?M=M86\ɳx}:贾fF;-qىԠ߲v7υ{˱:5̅?nz=O%ۻbW;^&% .;u]3- ȥ xI !XmJUbـ׈+]f8ζ[!}9YdN;ιٯ8l_u1Hٞ15ڛ Gre{%_+7/mݎ7uCVZ>j/xX̢2`Klw${wuSNeAA|`avɏ;f7ӱ8=wyG`~%$I$I)uWu6:kpsr eav/@?=1W>ZE~igq8>>3>~5oj-k3l}\U6S.'/'ٟf#3UYƻ;_|n_m˯.~ugw7υ{˱:5̅Vcoʝ6Ɩ v4#1Fvq׻0Kw=`=:${?k;}xGeU;>ϑ+I%:.Umnc`Dt`YNf[ܑG6 x%y#?/;گhkT8$-^k6ŝ_jwrm]XU#-mǺn[[^Lj-#!^9ݭ=]s,kx;lhiE]Ƿ[R~ծDi/h{_َoq6t@tkGR:_+}c>s}:Y#Cd *>}e[ [{Ac5# Wws^{u97̛1>@rtIx{~5f;uFߧcGI$I$I+]>0 uW{Ha?Ժn;>gS9ZmO>q>fvE. k="W.'ٻ~}=Yo:zJ0vv,Fz-3qqDKsp;:dd+,w_ }ϱcWm).k]-ػfپ}⦿yąG{%_*Ga|ō~K~~/>kݷvM8t]YX`'cI(5屿Iw_K|5w __8.=ua#Vo}V5`t``ߋ bSB[TI$, kEso~!O< ؿa{q$^s?|?<柽u"I$I$I)uWu6:kpsr &ˍ\.l4<#g]]t~+I.[[CC9xmf~v>1;3cj;.`\qa2 O{>_xڏ_S_oG#1o>)渤ؿa{q$I$I$/zlUUy9Wǿm'W{2,bG 'g| O}; 0phvFM᮶OR ;z>FC~OѨ_uXu6iss$+79B:,F.:fe-˻ 1{03{&wʯ}٬okOZep.?z?;wܛ}nǪO3 5qu\nf_p~N^E78tk@I$d'뻋zx-iE0(K"/ 1GC]%}]$<~5+~ac>;%c"E/U$.%Yv-8- S"|G;7osƯmtsݾ^ N]na1),O{_c}ݛ#>Le§X܁`^>#)Umn-{ `jkZ gyރt*>_pf6&=7xkto@^i'wN*Y]m-7I$I$I$I$I$I/*z;9_ZsI$]݃}f'x u/v5o\v*K;ngLCxC)cB?" c7n;W[L7prg\WUpNg 3{FĿۺۋMq4}巷]DSՍ8~pSo `whθnhpo[5DxXt]n=Mǰi+l=R']⏒qwne/N決ԳN$!&~U(ߋﭏ6Wk"w>g=r[q;{Zm֏GG~יڽۿ؞IÈq8g G䳿" co7yuoeɳ͕Zxy~]^eo ewl{/;.KXWY[}F1ods]n=Mǰi+&?cGVR|xc澉}3onF5OP$l:Zڻm :~GP[~n_o~6^=ײ8lZg>1lc犽9c|:OQu6|e:צ6|oO/o\j[evfĆbGWr>I% .Um.{`4dwp Suג}i{M?z=g GvpDO3ynǺiû2"z0i~XۄSuǯ%Y_S5UPʲqgEw; u}3KGkwëk'|JI$I$I$I{oAN]qOzq2nu<ݷvj9du?V7WooK{ofOQonC}#ܰV?{'.s]~!O}]_KW 3c3'"<6R5,eCau%̾C.%~?< sȳ>N D8.Hasx[x\!}go[.{osskeྺ!hxO5$I%G}~m]hKttJU/_}n':jI$;?ZeGO8=8KQbaa}!?؞awq8qays&+sl,4[p;z`/*I$ItӷvfWƹyg$ ُ=jps_wc[_ $1=^"vO2pXgr+39~w+xZ#f~;_Av12Z18I@8D??gj}/0^ɓq1Q\r/r>75n$I$I$?3)|y]3>@kpq2;n>&38ȱVَ'8_M_y;NB^p{Go;:P+,wO O3;ťMD z&pp 7y7Z>D/hzkUU5`9׊qBn+ƲcDh 7X}}om,u|3a6`}ZWgew ܌ߑcNqI-ϲdcvSlqT qp[s ^u]_Mlwkuk@6?"/ W0LmC`~=oǻoUI$I$_ϫ6`0D\Lꮆq'k߁_8vww/A}v[ncO`/u?^!{V&3+osO$I$I$I$I$I$aJuj$IwOwfqb$I$I%~=gnnEmӪ nB8:G32E$[4}SMtsꪶɰ*d=K}]H}eEߴո8q=^ ?鍄i:֮KGVKl{{k7pM,F?+}%d~ҵ#qwq!Kuhig/גSӇWo NȔhټjγ~tbu+OE#٧Yk%v/--H1;OSNf%Mi{i/ 5k"aWo}2j'L/?d_;ene\\o/qq tגIqav}۫;~q/hعя[Ƥp>'O3 ]W.o8{Zt$Y& A_Knq;n%x7kDgjK-i%S?/ I$I$I$I$I$I$^-;N m>O<#_H$I$vz>Gq§5|h#'_bGӦĒIyfsQDZPrA_+ڰ~~3_~h/hQs"cn[|d.WhN %|k2v?!%|I$bnnf7oɿ/Rqc8Dt@]ǹwp?2CxC,/ xIURI$^qOv?Jj]oo xxrńo?R_a?ԗXOs%Ińo?R_a?ԗXOs%KbXY6O f'5.f ׭] n|Aoݾpoovɹ}tR_˪zE޲qit@ gr{gڌ+mm}dP3=&y{K4[vS̻חry{z6w4}kߦwjۚxYr_H}xf`1k.wssIkgk]݇lcX{49CplGvA݁U{2O68v|_.G,dz& t΍ ~{{rs{WߜO{j_^?ڶ>ڻrs+?.לݻI:1 VI$I$I$I%{뽜vmց?cZBQba[[+]>CqkoZ{v6=*,Bg;M]vʸKq)e|MonI$I$I$I$I$K݇l?xI$jS7}Ҷs< ĒI$I$gf`SM:*km/M>1#fg}m¥ާ_f@/"s{_n- CL.u^?h93wcjRA";owe`wVK\AwkSow U:h~@IPI$O>Onm\,he``o x~K/=#[O|opoqLW`lpc~v_=]mU#|ٕ4_mǺw V1dA|ĝ_2wNݝ;9;&p[[a7e? lnSZ,!o#Z.UMl=ş>N^3:?ŝY4} mW]G!hu_ûN}aq.%+n;/qmmY|3v=J'߳}}w=dڝ>>sa?Լ7{魽Nدu6` jƭņ.^Gϵ 7}smf4:1 e{_۽CYֽ:\94I,?fq>y.Huvjx_$I$GڏNG~#2?4/q}6x~T{W[X^?ڗW?OO{j_^?ڗW?O7dqm\$`-Sojv[pwl2!G񟓗qdqYv;ι˝bӑo I']M5е6@=`O+'[VW?_u־eGVm㱭o;y_kڱ#3Ubqk˷ ĒI$MGok3־6|_=POtոI/<8[uXqp🛃K KmؿA[}m tO4{*~7qzg/`8/_7ڞ_tŷ{\_w d-{oo[Wgz#u3Wb/؟m^w츽8c6d2I+ݻ+_feC_ꝏgZc]AA|’K}+~N)OS{m?.3ƯѮ^MtE|/͞_+$;GpΞg ;09jaٛ]7T֛/dzMw C]qI$`{ ,oq5l>A0tH}ˤ`:=KxOpi$muj>vk\n#nL6A/|SV=5Mm0@h k8vw f.G> `[Wn r11K d8{houIQ}%5U*뱕g zg̟1>b}YOޯNp?;#sg?obxV|˙D7#-?j~_=tϧ3e{@{5W A~K_s¦>7$z6ʬ-홶w G]'of6&=x2xklGI$I$I$I$I$Iyw;E煬ί~qWm~>noQcK}>|?D>wFYNkqorAV4i.k4I$I$I$I$I$I%I$o*w]M44t\Ia{I$I$0;Ջzd?\ޜ ;ta{w,׾CXO2/G䌿VכeVV=i ~A;[}v_bcWUU׵oLSq>MԲǵn 9x /tdVktG\$/OtSKx$Α]/ٟ'_Uﳻ^Ζi)~. /GǯO t5 q.xRǐ<$~{wjӁNEE|`+Jya;bWC6H;6[/@e/xvI㵇֯tܷqmmEߧu]׫WUQC%՝׵{lQ7>Ed_W3"smʪ<H>ݛ[{͍ǡe 3>$JI|9ŝ]mx8ܽ~=O.wA~dWOO&^Po%_[18\Cxzr5}E5߳4q^$?(zkUU5`9I%k1-=NhXhO'K~ϵڻhe}tpgh#y}+ @:t>k?_]m A~K_s¦>7$m̖eo~E_ev_ݽ{@:il$I$I*=~@y ^ 5U;_{_ruԶv@ǯfi{2.Nj's<'7 up!r?Q߳?k;~n#mr0[u_h_}vq+p_[H~R ߷cyۯ퍆_L C ?<콊*;]9˿,ߐq ܯ_I$IyW/r>75n$K?3.=eL5a_p=v>їܲF-fr'<m>eC2[$Tɣ90qGj}+oF+?rfEI$ii=ez~wvgv<:9@׸ ҒI% ")U-{$8`iğ~e>{Ux 8K'ڑu#ySv?v'=}kբHpv/Ρ4;= I$I$Qbʾl+#Zx."8)|׬_>;Gev+ɱ{hp&/x"JiL< K[n]@%}iwk& .|u:'^5=Yzn}N6L:'r0)-mwWC @tls+vfX@OW8u%|n3ws˧-h鶳u^'oo{?4\W<I$I$I$I$;۩߱Oை?ؿ} H?G?Gl>Dv}qpSјwO5owi{}8m-{|#q]ur{#psCN]ŗ}dS ~%Q6ۓ8~ISͿ}iﷄ5zI1 O}' V5S~SIhYg{/t-ΖD~ |I{8Y_o;L:DTI$I$I$I$I$^G?ؿ}1p!kym|I$soǶյ9%'྅I$I$Wo=h}:Yc5?/Wi}ފPpLo/=%?ޛW?v/gڻ^f}Ϋ/xg20KuǺ}/,tF>;O=O_O޻=ǸTn\OOM~ bcI$I$I%.Gzd8vMݿ]Բ]1&GQ|z^̾㍗سr=S[,l||c}`OC-)][uwSc10ZG" \¹suG踎~pwW~;o=/c[GOH_.V}Uqv1_OQua>)lmX=CASI%eٕܞ;je05˩^Gwv}ǻl?.!LtO` /ȳ&8΍s( Gv. ׊쬂If"ז__>:[轃vک4aӇQwf=a I$I$I$^FvPTL~m5-%|y>>lі/qN_2?mާ߱#ǟs^pŞno;6/q-ϺH|CA-i'0%?%޹uI$I/*z;9_Zs_bGӦĒIpyoZY}2r>+f+.&$X8?d_ٸG;elo|޷2}=W|Xo D"9x?u90}̪=_W!avNȦcCM$I$ !XmJVWoiOvq+ݺ㺲1)c][Q#~{윿7u]9mُpr$KGGiX|7gvǖ:_Qv^->lݛ1s,zIg.!߁\?'Jq,k˦hѶp 7$ӟojyKcJ7{^}!ͫ.`0 Qd\cna|ɀ=^!{V^o3+o;}vsǽ?>>&ϳ8_cXӗk_hoYӇ~GR?K(,供3يnׯhxxI<@]I$I$I$I$]x7߅UMwm1mo{b*q;hk %Y3\Diu$?= ˒Y>T.q{W f>DwOΖtI$I$I$I$I$_7uV}k,kVM; yrn|*\6|΍"B'} 1Y[m{D˿ _/Cdvl ,koz>q6įVu!eշ'.龫tI$Ixҝׇ X,'~87wXګl`/;N]R\)!+j~ĵ'S~5 m8| 7=>zwnԹ$5zcc3zUmkDtwァo9)FL\KF^]3b+]f7_D7lnRc⏚v8Y8Თ5Ѯa$t1iIBÿErY}%8c^Თa}}/w/dc2׺oφ8O-/TR4xa!񯃝oyv]>UE C 7k8=߷ѝ{r1ov7zi|GK)/<:gŧeu:q6>@@]JV=6]u\h+7~m؝o<(=[~75n$K>]o]4ِ#dǟ;_2.Ϸуz[]Uo\t9߸_{2ow;zUzoʾfvO/xx^ro}!껅w< |{k gn^k<܌oV_I?Ĵo3[!Yf- s`uI$I$IywW~}L}\>{oqW sô3"GU$2~K2q2,ƽe.-sg\m#;:"Vw8G`^FK>G5κ˽&O].8?Gw?ޏ}>}/ܙ1îrT}lol C{ Pds;Pu4>}8V6<PѢf({}_ⶬrnt\zv^陟pkm˺L/tyb7w>9Vd׈ǵk]./cI$,[_cZ]X'0L%M$I$I$O؟ddwL66hL/}iǸ\>ѭDe$I$p}4>xlk\]D_Ab5_MYMպkqks/Ryg~6c>,-S+ĒI%Ggcev6N׻o;GBWWCg㍑K{q9:;H^ۿoNqK\:l %  %Ysie7icw'~1ٛN}?gr☞?%iOm.~Mm֎vgzj7}k־6I/sIUvn>5 tO@KuǺ}/,tF>;O=O_$I.oϴ_cۯiDZVc\8q#O]5>NssNx)*ӷ`~~u ƽ6VWǿj{Gٿ9ݪ[8C]f%a{3fv+3ȎLqV,{mTod|¾y˸#v Ϸ/3:h׬/zK{uVq] \=: =gټۨs#kOٗ1߱`7X*V8LO?6OSXϋWf?s(ܕ$h?okc`}qh#ߛOI_Q$I$I$I$`,s]p֠^g϶l4k< ~4zI1 ;wpe84}L{'KGC/َ^f36i̓:l5KW`wopc۸捰ѿä^cv[nkis,@wX&?*I%s?ܬ^?{rOqz6qD/ﺺޚcG6oĖڤWcvQvM,-ids<^DxLze0w1wxԎb'astSnEMn0Iq< U/q>2sq+w{mhXz{O9I$_+kyT'UW$I/zkS9T. VeK ]nGa7QD_Ab4{cQkp+qqT?ZLo >po /iE0(K"/ 1G_??a7QD_Ab4" co /iE0(K"/ 1G_??%>zXݿ#y??a7QD_Ab4" c)>bzǵz6=[[ȝD}K^$[3ZSڮkA ]I/D?O+)h&g a7QD_Ab4" co p)MWM5lpk%.N~pb`m7>N 7%W3Zumo u}Awf׹W6q9/sZ{/i3{vWK6IwW8'N;}׷Yc_5oﶮc,=K,"H|O?wtg& dm z #_`2+s_֠G]:I*=N^]##?Ut~3ŭ$Du._R=bwїrFUfr'<ŋ]^ܲG*܏1}M^OxiYGzE޲qit@ )"馷[m c$@u}˹5g|ҒI$I$I$I$Iys&&~>5">^Go6 ڻ'ŝ߳v1~Kٻ_qۑ{x+KޚN%.\YW>KCxa%%?%޹uI$I/*z;9_Zs_bGӦĒIrOO'Gφ87wXګl`/?|ݖT]7n3 bW\5sd'/dv9΍s!y5_cfwz?N3福ik\+#?htask|H:~vnq;n%x7kDgjI$I$I$I$ՑM[mƖ0Bܻ}츘cƥmpEۏu[ZG0BI$I$ϳ?ϺvV'qUosӋ>}zgg3~}wo}v{s!%qI$I$?_ci]X |t ńo?R_a?Բ~*X;wOZ~Kʳs2Kr,ɽe.s\C^?4b9$I$~b_0ezvQMy=G\ѿ*OI$5)Ky֚u: ]Y#f=G t?8:e) =8x45$KlO_g;K}ON]\@^y4~S&h>ϴ"f[},hLnonbQS&֎N>gq ^_cn'mįmcu^I$Iyw?j)vS`Mp Lsw[rĽY&`r:_OO۷P?g'#ОaGӧ/џ?1v'm̱wL?ȷ'?/ju~1ϴߩd{;0W/#?{mnsLUMwScmƇ12" vn[xoŰp|<ǒ>_l{{k6[u+N+?5*}%.XdWEONbb=E$I$I$I$I$^s)}94Z@ 푩--{Egݣ,Y{kX˪t h=yoQޮsxngwn<_DބNe_mޗlA~-ϰ=Q,Oz1)-˪I$IyW/r>75n$Kr>7/9|t_;ڳuz17$I$I$I$I$I$I%g}=vSMqqp8ݿk>a ,M=H_QQ#mS~ǎx$J?o}^WhmLA /vvїK5 \I$v{Ɯ ;- ,Ǭw|p~MTzS`bD{{%+ Nm6ZCiA!A$݃ok˯éxDnt__|߰]SQ1շ߁$I$_+kyT'UW$I/zkS9T?mbI$I$I$I$I$I/??bxqO;o,y/OcI%m?iϷY}msՒ>X$/I$O$>ݾxy~w;\3fJuRTIBǦˮU[K %|wv_sLsF9,dz& t΍ _M=d>˶4wzQ?Ut.$I$^ ?~÷KSYM ͮXgGr~rwXcy1>Kl{_>2s dcw|g3{^Ok얖hTy܏3!Է,`4pw{ۯ}n_:r}Y&ni]m6\gMjjEyVl5^K90$Nҵۻoqp0̴7o1baKCxa%%?%޹uI$I/*z;9_Zs_bGӦĒIQソ۲wz_|ƶ860,^G¶& wąI$I$I$I$I$I$>%{+1WMuMH⎋lcsK}|[[I/}uGxxcQR ݂>7v? c L$N݃}97#[_'˃wt!ƥ՚<S/Qi*j.ֵ=-d Β><+I%@w_=s6٬oCF5#礗ٝX߻ 0F4G[-w \x2 _,yjݎGж r: xt_E41c;wvYMrν~nOp$p|}N~H_N3->GfT?N%9cy~%ހd""Y]LtrI]68fٛMe<hQs"qA9ymȹevCSgxϒrwYn*crJ}ogvb2Bz?`h0m >+ -4+e `vJq۲-6ʬQgxG8 ~;u.ǫNǴXgC?*yN6e7|-cu־+ž}iǸ\>ѭDww ה\!AA%#?/G_.?z?waKF^]3b%/ؽ Ļ0gK%#?/G_.?z?3Ɨgg{|I1̾Cܿ.%̿}}n#3gf_k!_owaKF^]3b%/ؽ ğ~ { z.mOO$}K/{7͸WwgVCHxW;?oϿy/OWw\?ln̵(}nI$VKӊy9TU$_7OYgv˜C#͍y܂x[|9->[ۿ}ؽacɵ#OBif8m-c]0\G%hO:ۮ7[hhmazS+wa~ϴ=/or{66pӚ w~{e=÷'t` JVE6SumZr>7/9|tyc_ps^?YkG)} -~{ml>R I$I$I$I$I$_l}ѯmMm`z-0>d~{ſdu}ݞ[.89t:L.xGl_fH1b; Y g[>Us\qc~t`߻υ}kSe7wjcl!JI$I$I$I$I$K11ɽ]-.s|>V^{(m#cwDѓ}wqp]oO%{=KIw/O>hY}4iw5? j?Y7c-Z_n3/X>`\w^BnhªUcxq#7\ۿćlK ȺIxhV6]Wk0?;mH}?tqtzxA l?|;64Gggӏƨ ڽw3<xcRC]%}]$<~5}=>w{{wqӹ}67zI$IlMݾOxxc8-?5ݻ~'?dUægK"߳Ogc仅58ysWi_.vkr3&WLʷѬd{\_[I/g|RïG}oιr$90гWfo}gi8|_$`dw |LfqߑcjNq ;z>FC~OѤK_QC[?ղ^y_ a?W~Jv V]6P`=a|P{4St I1,q2e~/In~k檰Otvﭦߦ\x jIou;0)-mx@ _qyT'UW$_RjZv2ֻ!>8IxI$I$I$I$I$Os]U/:cClK" t{7LG}ˊ+/܋m8yyW:Wa}7C6 L^7axҟ}ݟ׋|?q%L|+lm scЖz$I$aJuj}9gNI$O>Oqd#aGˊ*~fM:G _iщԯUz-}鼱%о?kq=ll&WWdžyxTW}0W}!S}-1;kǯpʚ~c}ʿ@&{v|;No<xq%Q]߱p~/mcF+nEuxI>%w.;]\M+ő|=߁C ?}ypN/_}H=|σ&:q|x|G|11Ӌ@h_R=O቎_4G 8i?x_u#O>SAw8-؍wZl(w>ߌonw_.K yk~~I|?~1ޯ/|/;7?p;?! wlGaq7G_d~O{j_^?ڪwtȷmȨ# "]e$qq6ȭ{j_^?ڧGϵ 7}smf4:1 wϕմ!]__m8U׊rpYs"/9=q}:4=?K/ W0LmC`_#mSƝ$|B`pY}}=cT nkxT?eG]].Î\5 ad? W _7cݷ*T{ ?[c3Ә4gW V+0X,~mG/ W0LmG"߰?}%~G3qpb !XmJU_q6ܦv,ce\B^͙- #mSƝ$|Bۿ؞IÈq8g G)Yk+Cqq֍qzbnqGn~vo&\{ToǻoU !XmJU_q6ܦv,ce\B^͙- __p4vOVY5_9skvػU׉io ~=,a#@@lŁm8~5ddG:zr^&EXᡖ A݃vzXG_MYMնڬik!)I$I$I$I/ zbgZ5ύNI+RI$I$hOk:[xcl{~~1r.uKI]w]FM>vsqtsNzXOs%Ińo?R?h{~oq6?@kG@?;Tpr;~n>^3/DZ4^GVk}knfLz1JXOs%Ińo?R7XOq~R=?\ppG>>^-;_|}-WXlw8BzCQ]ww_mT7+%_A<<\3COtGZGzNot|C,'9ZUz.'^&:#sO|ϻ>$=~?E]꭭{ Ȃ.<8̘c?jK,'9Z ~֥S7W\NShӣGxI/Xkeb~=N[-3xz[PO>##ńo?R_a?ԪwO7%u'y/]Wmٕ]?z;CTG?or8=N98e|Oj_F/UG.V ¯.;za]u^V}UNC[S?/{Yh];xKq)}.wMz_r,:o)$I$I$I$I$I%/M} H?{7L)u3lˢeޗ{ ;'n'~Ϭ|u/zkS9T$/uX7p; r /I%?%޹uI$I/*z;9_Zs_bGӦĒI%/ˣa+1$l5^+{jSvA<`+߿='Uޯ.gsڏ!//8I$|Lᛏ;,mUc0ؿf~v۪f?U4RI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%Mo?I$^ ef6e}u\Y[[._Q\kcw.Ssŕ5N-|kC˒I$I$I$I$I$I$I$I$I$|Oj^q۩[^S-"-pa*DuחJ]wj-m"w./џ8#7VӪI$I$I$I$I$>7[ۯX្q5cc3zUmkD\L|oe~-[Qޠg+xw_]՗E,mՏMt[j 7SIxrK㑛Q+?K%?%޹uI$I/*z;9_Zs__|߰]SQ1շ߁$I|cc8qݞ`ÿxx5ѾEyqdreU醴#K#pw=G~gb䷺bRٻWO ^jH·'լzvW_Oa@;O/y/7 _f$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/zkS9T$I$_쪲?v|1Ӹ%ӷ`~~u ƽ6VWKW}2C98z>p~i]U\~=@mzdig"|3/wa~߆~k X`2!:@O gn|O?-wK7A~3'sͦp$5s4.{\N+C͑|}߅o*2k>1cgf ]``>#H#*}.?bZy:qӺڃ@-ʯW?O?'aMbxG'wج 헏oݐ` .맻jj90^^?;n Ӗq]@xmʹZ?'ړubʸ ?..e `wl{x|gXgY'w:@ .?{GN|sOdD፶|"=8jW?O'cMxO?*=]*qȴ!]__m/{W[K o>UV3J^?ځ[1q;w_]AcOV'YfO xTMq-Թ6<6~Nj,u8ϻ! 7p <1r:<]^*w=H3(~gkؾ#CrӗK?y輸g>[H?"9/Ƿ~3}V= &2o|W/wj?`31xƯ*j\Zg TI$I$I$I$I$}K/}SCGkW(þa]y7/m>ϳݿ*qOtï̉m^[o>2c0͢)lmX=CAT{~콆Wӆ׹/9_.,ecL5yė#6[u\lp  lo\I$/WN_96}Ya]}OR]k $I|:2;˽+Xl.<`قzqHwUnOʰbߩOZtX-u]ذ-=Ƭ̓ O;o'vvgWWHk>Mzr<$jaةU{$8 $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$KޚN%$I$?j>e흣-~#xq.o6xf*ڬ^eY# lnGG[]W e'IU $I$I$I$I$I$I$I$Əu?`]xƳ\ZZ# W ecx?Oc 88~fuxU ;k^ KO>]_bGӦGvϷL[n]^@aU_bGӦĒI$I$I$I$IBǦˮU[K %xY۾Yg8sHӡI#ՙN5X28}jo:D^">wqaaѮ2 w:s#z_DWcЖz$I$aJuj}=!*X06zO_&i$K?[ܿ/vuws13'|_sf_h^}Ϋ.̆< Ip/_eT#wJu$_'=j$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ix_9$I$Wgy8^q39L|ߴh3nM*{"VR{Is~e.w -ckc~?^I$I$I$I$I$I$I$I/ڿQF< ƃt}OGyk~RW+5$4U;:@v^?o։+_i-Y3Tpo"LxJ,>F=8Y2>oEՏMt[j ڿ/BF ƃlOuZV]w#o:;fk~5SV=5Mm0@h i$I$I$I$I$O~S~!K.ɮX\`?pseZ{ǫ%T>EŤU틞{u ̛ m11~@{oo[K o>[V)~k,S A9ʭf;ڞNٌ}YlNt~=6*/o Usn3O.?l.WcЖz$I$aJuj}S$o.$I|4gIb?v|r~ӟWuxy6k{dJK?ޔwd-1k}vW'Xc]W _bI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$=&NgŰ5'3k 3c3'"<6R5,`{rֱvuhkmV49ayT/zlUUy9WGk߶ʯKh4lyRI$I$K}=ȿ3̌*EԹIOHW $I$I$Js= ՞ZqG8uYu66ڬhs! 7wGpw!3]v^OikU v^{>lϧ1s'Yˈso>;O1Yŭgs(vI2ʃKHVI$I%}]ξߛ>ǿ>ɚn$vcK)88x%L_M^Չ~e\ycGG%sIw~ٰjugk߲xOggXَ&  3j<5ֶw#_bSB[TI$_Y99.ٱ_~K/?ŧkk,kS`>w$Ko_;Է8peWqꃃ[=46t$<gU煙U~àvn[xoŰp|<ǒ _bI$I$I$I$I(_uXu6iss$h>pgQ$/bq}} |Gf_d?!Wo~ՓE\wpoODeCau*=c~qyz3U;g7:V8|U s<~L:H1JXOs)B?g8 ~Ińo?R_a?ԧwU~Y1cXOs)B?g8 ~Ińo?RAT.Syϫ90H#)W\6qppo&x~j|eC,'9Z ~֤߷c/jK,'9Z ~֥;ނ]`Ws`GT?߷c/jK,'9Z?;NݯZ}^dy.+߷}ƑU;mG~K7}]I// /eav%̾Cܿ.$ٗ{w{"闙PwfEx Y$I$I$I$I$HY}%8c^Თaj// /eav%̾Cܿ.$ٗ{2_Yrf_k!_o_d=T{y9}?yĔgy8^q39L{}]I// T=ZE9/2 ̋;w>pcQ`fe Y{˜\FI$I^Sdz{\(0Ueav%̾Cܿ.$ٗ{2_YrVnf_p~N^E78tk@I%{w}Oᓅs8Kݽ?ᓛO-sgI]?o. տ2O o}??Q_ngvZl,*Ku]ur o߶! 5N='=8dU}u-λk[mɀ?t~13ϒI$I$I$I$I%_lgS .g<|Kge5d}T[mV A ?}}yuuX]Uݯk㑛Q+?KU^Wjy:JlcdG~;/q5'Ӧz19]Famc~36DC D c}K%?%޹uI$I/D'lV̯D3"Nϓ'j`[VkZ'#ȅ$Ko_;Է8p'^dz?w V=6]u\h+; 6)GCܿ线=#'x~UAMo!0Wp}z~jcįݖ_wn}#Xf6O-].7i}}wDYeAXwĸ24}Lz`/ĪCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线o8gNٛue iPs" ~֥ ނ`Yo sdG[>Mw,z85C_}؝7O t=l(ϼ~w Jx>k[V%v'dcwG"foyۏu[ZG0BI.Om=wvUi J?0+7 T?K!if߶϶eSkv~5]/~S>Ömke3i~/M7wnjw  I$I$I$I$I$I$I$I$I$I$I$Sr.ku1K]v}5>W{FHʶ}&1~ <rZ]Y=+k񆸟RG"[f8}K+`?6e~!z:KlWlcُd;%vd4A04 >]x??gsnو~հ ks._5ٟݯhv:YOcǩ? -UGw\N2[hŬR|]Yn>e{u|$xgv9x #/%cltO Z$?_b߸Iߑ_9ݏ#'A~U%ߨnw100}Nۈ1k3O3$7O o]RI$n}>}߶b亟AMN#Ǚ˨ ?ćD;sJ_ "F֏)$I/j_}]}ַ ^/o[o@sg28G7Lܗgk)շoq)yqd\|`7kްu]c_D䏛+~ac>;%c"E/U$9$I$I$`+}즗X Lho /iE0(K"/ 1G_??a7QD_Ab4" c_)k+kiqວx?)Umn-{ `_Q}쿾w{F?Cg !OUϵ4s*< ~4:I~ <-.צA.<$@|7،}7oMޖA#c"O~=F M}߲́C ti*Ӹ~vuơVXo{_j>wM.3 `hJ¢r.ku1K^RwOg}5mkx}OqykyByvC?5d5/<>bv<7KoޮpۮGn=|^NQ>כBu죌nN<ޢ:陁qkĺYȖ: /ygn7gqZ76{CVr}a$jyi{l43C`x]fvsij]r'ɲo~ 컙_[ ۣ#e}#&c20,{fm8Blag,g?x^|׺vqa` p\ x{\~m0~54SgŐ8c;²}d[1?SұYh%HXk/G,;+{'y8oUWA<>N|B?C`86.mLXx3:Z>Ax?= rjK5.wQXWw ^GAܬ﴿bov5W;cKIϯJtQ}=ކd x*זxq}7hޟo53$%;7h>oc5Q`.sۈWak&>g L)SkI9l~O?g~Wnz?ds@?_F?c%u:oLۗ 1L)馶Um c 4@d{ou5{v@ir1+ >mlrk援gَon5zw3`sOP;]W=}5zqq*?Kװ/uՏMt[j I$I,?k}5=^3ɍ^36{.gpr`?'atӲqnpsuƴntOm{O߳?aef W7mȾ 0=qӚk6d^@3{}vWsIkoW8O_ݯghԹr2=׻:|d%H\n{mn6l&]p~ /9mUs+kx;tlpq1~>&38(ǭVٞ@GI$I$I$I$I$:>U>SvOsk*ap$7ji}'"~}Ǭgw/W`2@,Sky@k-9Mk-O/:\/{s}g~}I)LJ?ڃw~_[C_ys.'RusK[OsSE|Dy/Ao>ǺX[[cV HA=w[2X߲v/C`~=oǻoU !XmJRad? W _7cݷ*K{%_)߲v^흛vSazz(0I$I$AV;* "/kA=Ǘ/ğ{S?$3S>W's1- K\wwYZrkdKwNQ+鿲lf5?k2)WvΡ׷= ۾ޞ;&88D¢Yf5)qk:`}=+צ߽R&l EѤI$Kޔ?he߯u\?ɬ=1X6,VK.hk_]rO+^we[1~./I$uM[9/p<_fq>Y0B ^Gxu\w|p}&>>y~?%"}׺O貙%8#|?g?՝^[L4LjV/;Z2ߕH#ӓ^DvxKp)+͞"!@/V/ܻY .ɥ¾2@ p|lR,N千ɸ79^wa f6]ew~1#愗^# kv?xG[]'<]u>d>7[;wNo}tMo{u.?%A}Χc SPٙ[N.KW]*yO_w9Եz& |K<܌oV_I?Ĵouo>f[(m3ad8侴)lmX=CAY_j>_ݽ}%{Iэ|:|ݳ3>ۗu3/tUW_+/'[WSeZ#w_z>Id1#𯝗eg{k[p8M>~'i/J}ɻ؍ Le/ŧq_a{+/mކ%Y[sO|.;WY1n_NǺ[[-#}aeW) ˸ZLz$>}ޛvL-uW\ENh#{X`mW8?垷?ܸG/zlUUy9P1;32q2+ɡe.k\ܼ`Srh=8}^|>Oru8{zYw88 ON.|:A$I$+k2,"Mqy3Kd ?R; vFMuO@_c;wzvwmʧŒv=ΰ bu[ϵv}w.?rnKg8is#cC^kŻy9}?yĔo}2j'L/{7g} Jf"O3y$_Gw_ݵ6;-i{ϏvOvbqYU{]pឰ|׻I$I$I$I$I/?Əuo{]?wɳʜZ#2W*I%榪?_zmURh~d\Rp-ۗut0/t __1~vvf`zGW3饰I$_bSB[TJV=6]u\h+31~ٜvvG{G_'V_nŒ{kԯv<g{U~KIph?ؾ˒(mw'q {Y\lSóDp}|f}8iw?+{>NLڣ#ԟĖW ©ݟ&̣Wc7[B/];zŧ#%@Yipۃ|6x7 ^*Fη۝N)30ڤI$I$I$I$I$I$v\]+|ø A%|wt&X)||m:''7Kwkyiu#:' 3c3'"<6R5#+eݿ8҆79t1ƯNlގijf_ofN&EײxlŮl^}2k˳n9oCˋ%~w=?K63bU]Wln{gܗ?x"^|ؽ Ļ0g]`h0m >+ -4+}{=?ύ?n7gƯ(pX97"wmIetqt_,lcq)s@>Y%~w/ν7=]vFv ɡUޟaf ]X~U}h׵ֹ~OX&8ߓS¸I$G;>nȚO-iy=xdoCc%}Wlpu-w s%:.Umnc`D꽃ywF^ {]m-.H];zŧ#%@Ydñw:{oʧ  W=YMn>.sH2<ļ$pƗ,fQ_{d=e Y{˜\FcSe+/V>#O2Ȟ瑾r.uKIPWgy8^q39LS3~q͗=q /܋m8yyT]K?ny?{||=~?.${i?{NwSTr.uKIPIlSu5خ6i'>hh>ϴ"f[},hLnRK7nO|.pi6~}\_|Y.c]n5$vO2pXgr(}%9yd9Ѯe$Zi~ geܚUݐ5ѾD|,̾ߒ̜L1dK\0;w>pcQ`)-jӁ2.,ǹ(ǹwp?2CxC,/ xIUVot˳5ypj4nRixuqc|`FȺˮc.'%wr)̻ʬ-ϙUWA+qg-y9t?_cg~gӞA;}_aظ4}ti؏5}C>{{qԹ}5Z:_f~wOޮ۪.~?Mm6YV )]pϧL&y[#|W}ceXڪ{̒}S ;qDrrܾ#!fX:KqO1ba@~$I$_bSB[Twe;Mo;}"$O~]Wݘ繾 97rKC9=1ε[_ֆ t_-p X:~NEx}׷UI/u6q#~ /܋m8yyTOXQ_mg94G/Ώ%7m-kbg{ 0d7zcXѷۭ]^wϠ^Kǒ3;ŵk05\)&#RI$I$I$I$I$I$I$9wkg&Xd|uz#ڲwm[Kg_}ߪʩks)k {ؕUMwScmƇ12" YOn7t=>/JƘ}D:!yq]@xmʼgYc v^mQ\o@/|z.$O.~EU}_ A[_;KKU#FBwϖյk.eglLztp gDl?1GG? A~K_s¦>7$_1fxU%G o>[Vwϖյ[rt߾&SA{GmHOp}\GuGT?_]mjf]7^ES.]`wlLvG?)'?ӏoQGĖ~Eo+'[R'Կbm Cܿʿ?N]myl {wUFvȷN GUۿć؜KsKcȺahEuĻ/oׇWY#}߁s}g x]mï6p~fK_~7h qQs"a,wn-[S]w,_oqA[_;KKU#FBۿ6RN{-7`,>.ϫqH+`qUe6}NhK7ﲙ'wj+CܵGϵ 7}smf4:1 /௳Ӓ٘=R ?qb{"#Zݞ5?_&]!݂1q'c. A{.d6z\.sz4Hy؞HÈևq7g |'䵱;b"^׉VKxoeT߰9/[^K쭿c qb{"#Zݞ5'/az~>x#S+S6gՓf~q<Snbq./y-O"a/h/ɢY[+⩷tNw?OX> <}>*56_H0u\_b{ˍ ݺK]DpmWOٞVOo}N>^JD_Ab4 _7W̎;04p'tSv ǽğ/qĪa߱x,屳5]kx]F5otSv ǽğ/qıۚ}63IXA\OᤒI-_ٽ_ɶ+o_zld\cKO3N|\د6k3{6Os엺P]#61t Dgze{s4דl3זs]w+S#lO+*&XvI KxOMIwaGUxoa,fr܁J>!;.5}Ϻ]S@0!znRiç"z>0Wڞowuq3 w&t _'[>Mw,z85C^'oo{?4\W<I$I$I$I$I$K~Ļ`Z붐+wO迃GN~?S}֯22d{]K9=6/x} }.Jf&!'ӹ*A /\:3{}vWsIkoW8m<~\O,b7ãڤI$K%?%޹uKw,݇'广i&=k#ϟ|?zS]o=ޜǮi]U\~=@mu_m_tz瓟y6zwT<bHv[vDv+o\~[:]y/W_y;wٜӭg XVs>'̾2o|qYs2~ks]OOձP&%^{B8,=̷Ɯqly>^)ໂmS?2>Kq%WiәPwfEa*xXxؘPᮖA$I$I$I$I$I$I$I$_%ߴ:綾 d j#b7w.qsU< }ͮ_f_hwRs'uG?fohnSiw sKgI%wOS:[m,gkwo=vg~%K폜^2f_k!_o_d=Ywq2;KxK,$xHZ_d=Tq{wͷ3dѕwuv=FLdGKc?/f쇹%w}Oᓅs8Wٗ{2_Yrf_k!_o_d=K}]Jq)yqd\|`L/h~31;n5 {Z Qٗ{2_Yrf_k!_o_d=K}]I// /eav%̾Cܿ.$ٗ{2_Yrf_k!_o_d=U;֑Nt̨;3"a}G񙍉3qdNC̾Cܿ.$ٗ{2_Yrf_k!_o_d=K}]I// /eav%̾Cܿ.$ٗ{2_Yrf_k!_o_d=K}]I// /eav%̾Cܿ.$ٗ{2_Yrf_k!_o_d=K}]I// /eav%̾Cܿ.$ٗ{2_Yrf_k!_o_d=K}]I// /eav,4I$I$I%k/qûPk-ϘURI$]SM-ʆ"~(8Vk8n!;.5}Ϻ]S@0!zkG1]>ƙtᵾI.WbYmc_Hr+濷_l{>rϧK$cho@e'?wm;sSoËW$I$I$I$I$I/g|Rî^~vOj&ܗq^掃]w}O޾e<[&tF7!뵛2YfMisvo-75Q_m?SѬ&Ok/f;/nNٌڽYlRu~4I$I$+1JKr?g>w^?OUau ~);|v_r˳.~u7iQ^$13tʳ'=;gKA><[]W2{}L~\ 1j}fq-_g;LGj-~st&5+_sQcۋfAsɱ9L.$I$I$I$I$I$I$I$I$I%ڞÓ24V>xD/|ۖl51=1ڷ}QGq,u宧&DxO}3onF5OP$K:بW\}ᴰY.xw;T{؟=ٷɈ^+,ma8aojlag,g?x^| nkxT?eE/?/K"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_D_Ab4" co h{'Rj9_g ],]>H `|Do؏eN?cKO;w@ "/y 1_^7_D_Ab4" co /iE/?/K"/y 1_^7_G]].Î\5 ֿG鲧} ; Ho /iE/?/K"/y 1_^7_D_Ab4" cO/--s=9~P^7_D_Ab4" co /h_K/V`\,o^ ^n3賰a54fA +"/y 1_^7_D_Ab4" co /iE/?/K"/y 1_֮/xX̢2`Klw$}ߴM#vrZŀ0=UL/_bE} d>IGad? W _7cݷ*U;i]q/ᯄ'`X4S1o 쪖4Z<2knυG[`c`"vػU׉io ~=,a#@U?oǻoUv;OXMgrxx5ѾEvn}Oߍk8WX7cݷ*G5s'c^Ნv5͝sngLCxC)cBE5c]4ڪcػ׉ho~E,yHZ)$I/㝔zœ{,3ZY\ r.uKIWU~v V^]<xտg}9r{ojX繼Ǵ{kI$I$I$I$I$Xm){bG 'c\DOȺˮc.'%A%{;n#xʰVpvsqtsNw=~eӶV;kF$w||qlpʃJnzYqzt{E~3޿nm1;MZva ?qyXOs*={=?ύgN]7^^T>>"?qi4~·}+𙭿?U;wƺH[ŧck!XMdkCHUwƺH[ŧck!C'ύ;w~5C7~}~K'l¦p7(9]Y>!6H+g,'9Z3ށ~3'a/hHk*ٿ#[{=~1;?*PO>##ńo?R_a?ԗXOs+Y@vӎq{%[vh`a ]z5R+xq3%9i|DA^K.>z3JsOcD|"=8h}~'?dUægK"W{]\M͑ |=_+M6 ~5?&@=$p !sud>1l屾?WOst5TQ1̻N|K]LtrIJOp㫴7 qy:O;s9] j<<Y4vN^e6cpvl6~> J4)<[x'﾿}wqOO?~oo\Yt}ĸs[E y4wp}9T6=q3%9i|V߷cf޲i흮:^m"yG*}}orm|3Y5=b}rߌkp?ʹZ+f=P!-'m_<)vO?k]{,:>NU8- O|IGe]59/0?T{wp}9T6=paz='q}_W c8~n7p p|=>~jKF^ee61 Xʟ,?Y}yu(dpcG'nn./*ǧC@?.:>NU8- O|I'sns=?Fn3zA|wwq}T4=<huq qSwݿtkf~mc_k#$Q?3{>޻{nu35uYi~ geܚUݐ5ѾD_? G8f_?ȹ۳>''zmvwϤ۳8CmsCfGxW*xg3{U:)"馷[m c$@LwﷴݎV%? 5"4$I$I$I$I$I%WvΡ׷= O.ϥq"ZgJ`rqUxb=}MpK' o>UVeO?ٯ\N|e8yti$I$I$7O o\Wۻt+ lC|Y^?ڗW?OO{j/#{/j y Kk^rMXM5hkr)I$I$I$I$I$I$I$I$I$I$Ϸ_c_>q2ǧs$4{wu0޾wb&7or?b>I.[ vY׵;º{O*i"ZJ=?Iw{[ƿ0u<07e<*h{K[TvȫnU /,} 7xU> wݱ2*۲3C A~K_s¦>7$O.]`wlLvJ{{;!.%D[Vծ wݱ2*۲3Uwϖմ_]mZAw3CGP5kG_*@k˽|7m-huNu`3 #߇'@k˽|7m-h_X24o%@wz?3:'*?}.@k˽|H}Ĥ>g8=<{?ƏGee5_,0?Pm/x߅cR~-:>p|_]mhǷMǨ#K?"/ n'v㍜S>e o>[Vծ ݱ1ӱ3!QDk#nEh>ϖ|?_]m/{oo[@F~M9U]knՆκ(J}psV?l#9kFG+Vuw]:+' ; o>[V?lǷ#5kBX)v=+)Uq>@o#~Qp? #Ʊޝ?x4?T36dbw<+ cC]P?_]mN ;]ozJlSüccDp}ݎ|f}8jHOp}\GuGQ?}u9+bUhoP{ ʯ@k˽|H}Ĥ>g8=<{?ƭ _}.@k˽|/7'%Y^#3mĵ_]m/{oo[K o>[V֍?t7uDW=}O=72h±qqZ]L~wӄ8Gwϖմ ҏKYv5wѡ' o>[V7e<*h{K[Rhْ\/? w@wϖյ5{"-"X/; o>[Vwϖմ_]mskŏoۑ.Ϲ8lB]ǿb nJηFfM5V2.+[ki֖p Wg18>[>3>~5 ޾݊iMqw=:ӪIZ}; 0phvFM᮶OR/D}cM}@ ?k~c{*ũَh-uNI$I$I$I$I$I$I$I$I$I.WcЖz$I$I$I$I$I$I$I$I$I$I$I$I$ۻ":s* Ȭ<f߲vxGg2_;=6d8ؑ||%e?_k`D1>.o8Z<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线_<)w/O?d?]{%rCܿ线찦Oo}'m`OV?XOs-?{rq,%ZKuĿy!R__q/~W\@g3n\,?wYa?Զy!R__q/~W\K'.=WKuĿy!R__q7~}f3'lͺp4(9ߑyqn*ǧCH>? r}egזu񮟸l N=[vEW?Ƈ۞ߛfHdz ,"ù?>oj~MnW,̞/ Uv;73%/mc9.G9μSN;G$ATH]?n}it2ӢF%?j>=}%>3э|zc$?c>11K d8{houIM~7۱ǕtN(ti$I$I$I$I$I$I$I$I$I$I.WcЖz$I$I$I$I$I$I$I$I$I$I$I$I$I/'wݻ&lײK {k +I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$܋m85`yѿdٌ~ÍcC^HGǯ^ۻonTp0èOi$I$I$I$I$I$I$I$I$I$I$+1JKr~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮ~{dϮlYutm.{[Iq<+Rq鮚s.2@Pȳ&w8(-=ۍ-jclp? q*˸]4]UU5ep;Krɽes\ʽ̿}}##۩\nvGk73/c?/"̚U7ȠvOՎ?8ž]]vUȷT>j>-' qH>fTx>0RopYk<Y߼ݣC[ک4X:1'lYutm.{[Iq<+cȆOTqۙ Kd˹*w ߶yGMoSOj݁[p-/ ]m¼f #ϩKouSc* <`(w.MtәuUV1 u4>mm49Ä-x4~{dϮG?羔} ?{zgrK}O^qqȦn̺ڬik !Rڮ7`V;KxK#B!>=c]U9emr ]-=~]k;Ou][s- d ({"PwfAA4ngCxCJxcQf=oѭqm#VZE9;2 ̃?>/V8S vOՎ?8«GlWu8tmnc[Ai+G73/c?/"̚U7ȠvOՎ?8n'p~N^=y78tkZ=D2~_=D2~ǿv심:m=ﭤdC'}wbevȲZ[g8n>$w?Ҟ{gJ[o: ַ3\7ҫY^5)hk:˸Se7f]mV4}ۮRiuqcOZE9;2 ̃񂳿yGM{}O^q;4[2@fe geYC㊻\F ?{zgrS7[iʃ2 =7w ߶;~K2q1ƽe- sg\!>]")2jc$8`Y^5)hk:w ߶f5xp%=Fw ߶񙍉f5 qk[;Zimyw"w3sC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wC'}wge3nlXP endstream endobj 154 0 obj << /ProcSet [ /PDF /Text /ImageB ] /Font << /F5 3 0 R /F9 8 0 R /F320 155 0 R /F321 160 0 R /F322 165 0 R /F323 170 0 R /F324 175 0 R /F325 180 0 R /F326 185 0 R /F327 190 0 R /F328 195 0 R >> /ExtGState << /GS1 93 0 R >> /XObject << /Im12 200 0 R /Im13 202 0 R >> >> endobj 205 0 obj 7779 endobj 204 0 obj << /Length 7779 /Filter [ /FlateDecode ] >> stream x]ϦGU WB -&tbDI!W)hj\ ݤ PBbR@hL&ZPJ*(gf9s}ϙ&gzou̙؆m4㓔rc/|̹oļ [ݬrҜ1['=-br'獙5d?P/)/^CS8'!˿Ns6 (& & kl=υmgy<"3`d@TydD3#᫼T*(`?rQn&o5MG/vR2Qe%u^~mt uI^ncJ!Z>nuz8!Yiy/1P1O2L%ATƙ "dќ &jί̆aWO629R`SA C , -RljIf*ض[E8_'0 &2,!`u3lx8L. er IaZG-/ {]e QG ٬O7hJW4OqWRR1FĜHF DQ#Y+*̏*.ny-l$&)pi"+9We,?D= G*x%Ǡ!~0#+K9Ž;H1z WADSO`̝70*'XRg(6ƥ7:sc>G2'ԑ0k*71Ý-&*Pٮ?'L:8L3!_c\oֿ:UE?cU-h*!iHt5a[2߄&G72=:[ެa'(D€vdX7R3wFv%% Hi[fW. (+2gn9+TS< Ь7,~x >ڽ!MP[ɖOMcYl3pJ,]WZگ9[ %s-X`oض |>oh;,ā=]'W63Q3``V3o^Maf̲ìzS![IcrK/Q\sv? 'A7an~Qj >2渣/[F \!& &B۶i;rєOyV )%\A^}eE.^^lCccn%杸*r_,X6e yq*!Ik3\lĸhq1PxfG}lvNJOdZs\ 'Z/%襖Ee iDrVSǑmOԾ'(pWX ڬ& ْr֛ } |_А31hϾ2lI N>l}vb;2ae&N/ۤ%}6< @I}!z6VC|QqFUX$'4QW'>pmJF (⼫@eu >I>OКJ;_R5JT7(;!-sZLH]1OSG1 検eAk^K˭wn>^-CO6)]C8Lh|hTgƞ! gx:5o,ڊNRb6tDhUznjJWI6PKiVM*ܝ D":˪鑆|1Aew%EŸl*Bu,h jS|gu'şTSD!x"ЛIBYY,/4OK$JmЙ)p礋፧2BM=MXl*GcEƴ5@W:v^$->Sk]!YuO+GQQGt\ʧn&a3j@"DCE҉@ː.Iԯ9#b;넔o]h"R0))9E;m'Bmڼ5s@5?Pa-ث b"[1F`U+вDATv~OCR6pj+>#b"Byso"(cAInIoyLxv{\䅴}be5%#é}BՈ +W4'Hj@9=M/ bzMbdX41t/D@a7Tޤ3 BxdWgg]@`bAZ\ĠGrckA?qlNJs֪2 wתmUws^,S{Ѳ+{kGʮ?MJʮBĹ^UŦ~|"T1BCu6J񀝬֦ܧj%=GSX4dۢN_Zkj7U;Aޒ=L5(w|xg`Q&"[EGH*%l $1D"TCT4]U|!P5@Jx,bp.̦e*m1lh^osA[rdAB'j"rׄ~k+J˻PJgmK.b}xSӁ<lB$S{ՔҶ\-|rueI~.'Dyw} $Je]/ޥK^]hZ;0.!o/4TE(G ">)X[-O(RTax(-LLU` Ys%*OW=裤@0(ljV0*k0g>9Px0㴞pd>l bX휱Ep_< l?bf%ݻZn,nS%86rgBlQī5Wm^oxN {\ͬSGTDbut辣0%0~ Cep[.pd$<.r5U^Lw7/ >XKdc6~H-qL°̷}pS^$W7( J#(Uעt]| aBuF \[Z_L,/?!psk5]!=ŀYQA6oTu(n+ҧ<>@V۬ˡ3Y7=hm.NYh*^H2kz=wڏ2\oNa`t6%~ s#WO( n/t;QU*w8_"V;NڈBC !,rP-8BB+qҊ+uuU;0 S*v08 ÀC0 aFa-N)iwܮү*مx86 D!_! yH 2 .QʀMzdzd#p 7y QX69=VaۈEC!PXH "! (,BqnΡ ;0U r (@d}mV8@YUUYS !ΊpSẕ{!HT8DU]E#+Fq"!(zze')-kκ=PĈ#jqD #(c 1$Fǭ ˜h[:1BD:m1LڈBC !Q/8ďG^qzE5BM|uqށHf8B冤|''#/t3g͞\75M{ϸ`|.N:ɽ BWK#?;.DLxz-\M<%gA*2MyRcXU6_zm %Ғ[|̥mq T晎.Vp)i>OEXg+] ypo#4s+I}NJ5VEZCRד3_mط|#qh*r6 JkV,JkV[aPRu=ӐH|fNz^h)"MiVۉf-Y'} ^Eŀ„fiR/ zF'QZajFk%Ifg5屩t ’<Ð71\x:x,.di}0ý@ 4GiVQbҺc,8y T*K i5 ZMP#}1dc,P|.?D mn;w@$Z@J6@Im6L Ż DlH2bhk< WH ,[$SAlC@&|@0ꆭD)Wdre^:KgTD{8WrQ0FRNDbW5,+w>I_ikڋYOr.>#\f}z7!ՙ"L+ >C|F2b)B)¤7l=$-&Ɂaؚ#gI\9B$="s$ػvs8fT*^R۶ݤ&?0SSrsZM&azd Bi~@ ϔ{o,2rB)q_:z,6M/ endstream endobj 153 0 obj << /Type /Page /MediaBox [ 0 0 501.333 763.151 ] /Parent 98 0 R /Resources 154 0 R /Contents [ 204 0 R ] /Rotate 360 >> endobj 209 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 38 /G26 39 /G27 40 /G28 41 /G29 42 /G2A 43 /G2B 44 /G2C 56 /G38 58 /G3A 59 /G3B 60 /G3C 63 /G3F 64 /G40 66 /G42 70 /G46 72 /G48 74 /G4A 76 /G4C 83 /G53 92 /G5C 96 /G60 97 /G61 101 /G65 102 /G66 106 /G6A 116 /G74 128 /G80 134 /G86 139 /G8B 140 /G8C 141 /G8D 149 /G95 150 /G96 151 /G97 152 /G98 153 /G99 157 /G9D 159 /G9F 160 /GA0 161 /GA1 162 /GA2 164 /GA4 165 /GA5 166 /GA6 167 /GA7 171 /GAB 172 /GAC 173 /GAD 177 /GB1 179 /GB3 183 /GB7 184 /GB8 186 /GBA 195 /GC3 197 /GC5 198 /GC6 199 /GC7 201 /GC9 202 /GCA 205 /GCD 208 /GD0 209 /GD1 210 /GD2 214 /GD6 215 /GD7 217 /GD9 218 /GDA 225 /GE1 227 /GE3 233 /GE9 234 /GEA 249 /GF9 ] >> endobj 212 0 obj 18812 endobj 211 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 18812 >> stream xl \W6\XUǬc&8c&1.Ѩ Ei7D1HEd쵨^ii[E`\BqLd2;y/:,@WwW:,spC4sƭ[aUϽwQ^^vRFS伒sfO0W~ŞĞOzg|h?QO#V_ ~H)Gܟ_{u=q'8qc9nC;}vl9 i/HXH;~E;svtYڙ ڙ 3kghkgMΚ5K;kvLmTm,m"mbmxY9sshW jN.]8S0^pvlEڅ hM.]4[(Ahv xYųh%%SKiL.]2[dvBm4m mmB+s8[1zN8 sE,]|{g^:`RN4#-ǎwGz.^/n흯_}F#ihLƢjlFjCԸ4nGi|z_4h&iD4MCfM&9iӴikNh5'5SӚNͻ4]5ݚ4g4g5jik>\|\|TӫLr@Ѭ_Iʉ8n V)ܣFgܰ,'rq/q#H~=d?/SQ27ύ)MXM=7<=?{a77n.nƏ\w째g9Ӹ95ܼyr/C˻Enq 8{IN[--+Os++Wqp;5ܺ7GwI쳾kq;)3Q|t+B0{X-:VoUHzGX|.N(V$I ޷9pt__+SN"~V*_acQ K/7't +v[e V갂jHfLgmb7#IeP^\3J!fFCECX;AU]`,]vI 2uI2lVP|_]-ďæфE`)7dytl^'T^|,ݷYU-I.off3!jkk:&ax{u{}ޑdW3*BJ qQ2l.\݆QNű;~/}*c v/B1^.WYp2O2-Y%y@/ $/,y{?M/F,Zwai2V=ݧl<`._ʄԊ2ط{{Hz%Aq#zH(]LxO-4*tD7=-;LV]%l| T^( 1U+tn?:-k#Yu7GScO+F)8E|>q@~"|ttE] \97+yJp*>o(G]Q6T(d9`6RC:`6e0M층J҅;tT0K&(Rvo5oY-BkZdoUqFJ߅BZꝾҦY^(Kz3Х")i5@Z̨:OJ>,NÄz{Y+HS,UY>ׄ3 ۩,2C8HdG @->cK+H)^7ީl!Fvw;PU (-U(Tw6 ^=r,ק{XЗ]淮"dN#.%Y"jk}#ĸqL LΤ~,1',k"E/B^ixt}J})Kh 5夙3&\w~(6qZͨ,Vv0qQ ܆mMWJQPY#oZѢnK}t|{z`2 ipb+.٩t}*Oàe!7unFMlN4h&eمOFw'I*廠Pًn燡 Qw y 21i8SIgp6p >Sҹst}$9|jv 3Aad } E1yLL4AG0==@ǘ a[S%``ck3&51Yѣb#x(T>l۽8"v [Etϲn5Υv`0TR njƻSnTVh> & {$K5´i< v{!lЁj(7GYsֆQ^Hp<'QHyL/DZE&V?'^B_x+,+UUsaM3_EWWسJ1"dV%?uO_~$)0EDm,&#lB~{";w@]e+˓Мb2z b~v: }~&V, ab"ѢI\'{DTFⵂjg+UQH_z_Ѐݎz(U2W5;SB~ܨ,2{'/i=c4}5W>4ۘzX2" |'扩)AނP 6;6u&*\]Q4EښH&yy:j%k"ĐƯL6|Ouo{#]j*ba^! ^ɛW9ô[ =zWYTl{:,t}uvodWl6͙̠m5i@N^Df/_]xϋ3Ώwmy ¸pʨ:!}eʆUo"{e$Ξ>2zsn*Y>{~'& VD,XKEUwЄ^t:2 Eo 'F$Z:&Yt82oQu*/s~1ϧO.+_J g?$ 7WFѨKb쀘,Xi7u&yyrw#˻ v}\e:M,tT%ќ];3 4`Uogyׁ(LP0Ng5rS9|8CG =|FOHAfpS`]=jvhF`FXYL8doCo ,nO:MG,(йHll g<~D2.0vX&X~l1ef9ȷ {ÀnGii=h8'M*rʠpG;Ph|bj %y8f(]EG;8ML؃lQjb‡og4'6%.HcfoHBcnQY'.?6a`A@n<7t k/vbEw+3"{7u}?J9jPx$bC3B)}Qkg@ƅKyAXC{)ЭgPߗf B{ÈdZ9XсIoU[R9aHߣr5;(ʇ7Z3*j_XP,/"W޼ z>jHc{N߂y_#Zs8|iv}nGvw,/2u!GRK8K-#"uu f ?f#f:"BO߫^t+ MN2|={Muߗ՛\IM4:Rϥ\JЉ@;K>ٍ>d:fy kpw]3s5;%9(~/%ϭcThokWPh?[_Pޓ4VyE+yJ݄UEaOAzYV:st lt!E86 K衭ݰ|/Yj>岝1")ӗU7G\z!#)DX4vCH<6!?DĮ!*y#/ st(-ֱ}2l2%Ϲt*t!dXz .NjgM}c gmׂϦ@gy>.K %ӍY -z" _~k5`7.Y&{]dD 1+}1W66ǫ7GcJGEȤ949 T&`<6SBɯ. `Y B1+ $kVP.*ӡ!0؋?Cǖ# 1tbJr}7MmF8aW{۾ђU9]c.(K‚6^"-2@J6Ji`x=D#aމ:ʶNrHHMxPa|9^5Xs5A~aue}#CL4Ns 7Ag#`͂Cķ;;6g 0J#;G-Qhm'k%}.PRiIaA"$ln\[H{m(RJ Pի<)Y4Dܮ# &t"ۇ5$0clspq;ҏOCQY=ra}h+ ^JQ|:y:E殴B;C?.o~u"swDbf6n%?Z#Zw])UY`{9R}?՗՗t# /y>?=r8_LAޯD] ԚsmAպn쎅t Щ,;;q%(<NkE(7uBosb8,Qcj7a25F;]+7\\ KXՊ #bԢf(:H IyBjp~0Ot Ag}bNꕤS˲Ymi0kQۊjQRv~À'"}>H2B(u@>pL+uJ~[ 5X9}l fk{M)Q&mM1 alALyIOg9n_Kt/AGym4#? ~ie02,}~{ ut̖_b}D7lGn|Γk>БԀ, 'sdhO/%Qz,8d5 r~Br<*:*r,s*:i%Wg<p!;ւz  ;14 Ʀ&elWRq#H=i fs :pA0˝ Da(nk}! |꒼PISt# o{AW#{Q(l nd[X,Mpvg x&qf HB JAa BFgaoJxt0T+-zM%1SzPB4ݎfw:b}$S_cD !_;,TY =glCo2LvV(؍ֱ2>FȔh_}~h iÉF2LkK8Щ0濼 Ѻ"b!豅zTvĭOWQpRd21Qn7>0A Ioec?G%F}/v_KDVM w!ԾVd"{u9m#4q(f9f2&͡ ă?w m=HFE-UK#}FӰQwTG鬭S|.ػ.%=zr$J/őlAUq:RH6V*g:j}@}rc/ܲᚧoosF k"F 4a B!P׿oVnbǶEסY|$,ꖺ{P0e$l#,'!I{Bl聬< yV.$hw+ eB)^Es#7YzjV?ߟi+]f$o\ā cwxw; ϼ*_}_.+SvkQⶔ3:!VBơt.T}!Z@^PRC~IIk110}S0N_ZMz9T8jC5sv`02{9:jC޻ ɺ#rf jϚH5M!,͛t0$`$yoh * Aw27g0fɉ\[MFSH?$ dzwR#D<{ƄC;mLSXj!(^o(Ecs]>C-";UM@ Zr@Oò6^ 75#/=$2s d8nWYW"iHdhj [7ӥ<}Zu!>saI+KtUVM=!8xa 8\}6f18÷5^'=C7ϩDVz"pg~X4Yvvv"`Oːr2K e!SaǾHR%h@WZZ\T ̓|  ̭+7 ?pckϯPVcs^LU Қovd|V、6bԸdWטPY7 KTQ|*r  ;#cq4ÿAS3N\B3Z0C+t}<F[]tUc=ޣCG{*> юsen-[:T4tLvR B!t;%{+@W\\>JNd=*e0 ]BFn#3AlW}t_)SOzIЛ=ia_·mN$EYw;( ёt|dz;72-|H6N𡺤KdA2yH$Hoibvubju_Q2\$BDA%d$\Z  YaHi*mѣHp8;)9hN#اF^#G0n&~9]1.`x'7QQbX A њ{V 6y%j_A'#<3}.i>ċS(d P_d%4oO 䶊Rq1t)[*1T6;@:&E$/Q) Ug/ tg[ă'RUd<2f8f&5Oձːt-Sx_4TUUU`WgoOCQMq3iU{v @}^a" beITU)$)PҞpBn bTjp:4;*OsǞ`l-ـ( ]٢2L57h%JxpNɒk*lJ]Y1)(/g@ eY}fkFvC^?5O}EW Tt+E'Fι8"UdPY!Ɩ_dMo6ثMmK6ݥ+Tn-r@؎'\_:SPjHI͒a8@+ F{ŋȖ KUw*=w &rk602P$XYwT.Rh,#AzְPN(#Re=a>K/ހ*F5M0GPG[KNZLJK t*ּmwyhbVVpyMOLHwǥ!/gL.1 Zm^ Vf.U)dd[sH&5a襛,|ge d#)wTꋪq{"*j?MeP6 Z55 Cu 㴉fsH8^NIsfY^d2jABI_Ƀ\C뱱B77Nj9p!{%¯_SiT ޅʼZ^ >bjXXA]⚊ML=5x"Wa`'!p;yT{yb+O"ꤟlu̓s {@2uI7|r!w6Dyow]׿+ ORj&y_ *lWoKBbk )r8կOY3zZ[+ОVwth|;\QV ReynbNw{/ލ4ȌZQWTW6N2 ] 0I~Վq@ѝ+.3f hҭAnC~9-l2dzިEz3}lr#p#Dٙ| p9mS=<䃈ovo Ia=xef oHWjgKA䶦Ff; /j$2w%fBRUDay34{H]:o _ȾYg**CáS9d>YAiei]@αn)VhKᝁygR]"LG=8R ?x54/%ϐ}d"ь6k/Y~:EZu:{b@4A.MC!R40*xNfKx!E# 05d9CkEW1cv6F9L gd9xOzN5}4 KV&8t!u]2E VCyp;Uj'zv2T &z: {geچ[Kt^̓D2$dWjfYmR}A$(ڟFTpL?Q2,xV ʢr Tuj:^!+̗-ޤ\ ,Eȕ'W.޾(N,֥FB1,:l3J}KE7lڧF0_Tz2A4ZA?dN /!@@tփR& YܽE53. >L3RYcL}~ġGBLd7;6OoX5E㨤e\ OKȎ%m(#Z" 0+v_J+[ٯu @';z]ЪSrYYv@q.m 9fu<ץZ66dnI^t~>ٯ M}fgu2CJ8 ]u{z@VAK1`<==e].g"Q@X3r5êQ{l3jX'2cD43T>&66/Qѳs "24'#-ncQ v|Ô2\M)ֳg;' tkE_uw.Uϲ:"dLH'I2%t=#).fF* (AŅ!țDOϧog5|7|%LQj޺|qU| Slj>AG0^E% bO{{c:'okQNj'^fp3k i>OicEXF6Y ^4ؿUR[l9֝.27(CȠ0' VDPte\u1ߚ|C|L1CIQpE2.̙Jg͢sbݸKDe`5GӐbV T6hf܆jMb 0:zy 9+3TS^+0G%3׺n@7ܠ;}xb,3MeNT l\Z&Cn`7VfALڐzk5ߛn`#ojC.d@4%OX , Y}qjFj{`;rjb+*i"yRX/4sEHY-2++;;l`ġP`_jd[-P (ʫ{|,尠h<+dM`USdHF;^rTW{k@&AL9l? dpvIպohJKD'տTŧjD%hJ7! kX#il|$1 4Jt{uBɂ&?$Hs~P (lڷUvK;!V0TWWByqzyJT_MPK*129#1}zq\!3FR$DY2jCb^_+;tdəL/9~*肗s @x;+l) 5c0;)IVsH!`j?:Qw WR*SA)2n*^ cTrhbsϠ;mΆcd|/r;Oފs3Rro`i߈h[ J:F{Om ercIDֶL|^(Eo8RXb`&Jw/Xm't,/ Rh7:BartbUEod8;hsݴQk?kxQܙwСH+e=^ seR-&F =g-o|t OtNڕg SwGf3@ʢۊX|H6a*$diB0{~`N7OP)tQKX[#I<{63}%tHvg늪vJ~vEo"#Xrd9*.݁HnvHwEux9IʐH/@;xu!!at>p6_o/>#1obQPMK 4= ^Wm-Mo;tIUmHZGB+GB6j!͗mγH6Ճwl0PU+(eeye9tl y$#3.dz;jSk Nsn@=^G+M*@g5n`mkbbb "SˊVqdKlLwslOUt}JE S')ĤqR>f`, zڰxR9 Jqm |A'lp8E$] xQ}d\KBܿ gLZ=tPy`z;&1Z|ZQ;'1XNGiY't&252Kv3 3CEs>>&Zq{&@o|\Wa,WI\wp% ,WnRAWB]LͧC<3R Tz ի h< ?{hsZ&6dnrKy㑄6G$ Lm3rNqS' )\RHlƏ5 m(;yc5L4{'LgI1:2 3 4t RTj0X* t(W?m9ej3kyJ) ehɘsq-S|-ᴫHy=r&Dm^4I Z#sȩy~f);K*]c\mu5}Z'TIjԋ_# V=4Bx^` Ä%Gxz N9fefmjҗ ٩y3[F|ȜS?\/z5EJ-Cy '0DG?|/1.?)+ <?3gNGEEڣJ~8'~ի43'uC,q.t̗&6g`S5Ux>W7;~EP萃ڦBzߋt*Ufc/pW_MW,O­nU:62"L^br1~q7+OrM. L:Rf[ fț^w[-hb?cyhm֨4&O646eŠ)Av.P]j',9>0N=Scg2^m{qm~$rԜPRb-}& !<E'Yd=dH,_wM޺pFK23o@ꔄ0C3z[WHVh/ "+o.; Z٣tEAx-u*}TM$O tb:yat$OBI?뜓Mmu6]mTP kYjW#%x0ժ)$Y ؘNc^6HPs X;$7<#=XIo" {%2MY,ȅRjdRR&s 0`jlOUXv9@-BFFTn.5Rn5Bh/&܄2ߖܸ֋=9(~58-JyTfwL?[BbwR}Hv۠ʷ5(:\%+B,дuqYdֆXmĊ"۰%˹!( itb3֤qo#KXb38I5|ʂ Ԍ@E[44Ij6W_<<}p3T縠P.eP=c,\u+R5sM3z:|15{marcWCU ‘el7˵ ̕ 8* <ǡІ]+Oli4Ꙛ 38 :ӭft[`MAצN/Ie >.XE#|%]+C>; 3^_?v1Lk넡khV-]fڦihzןI.^>ittk)BEEA0L(g9}}<%|YFk!py}dm :F0h uF1k) 2, wҋg%X&bɐ5)!KSy0O7u X> 9^ݯtxxf{kZUlS2@6K)WS!tÃj40s1Z.OY5lN[ NI~ :b<AQD V,V},g <ςNL $Ț[mzIZr6@Wԛᇀ bo>P!Ƶ!ПRsKӑ3­8#LD78fyAsmkB}"7"$C!enCUϓk{,VLOw*Iwu;i :oEV'[=vg#bI*Frcx2i>"Ϊ=,#pRK[bY%K) &Kz9^UW8q7㎝$b4Ԩ8pcn;7F~Vhke3AjEl[DK;+o7Lwgc!2|qzrq7#։''!/yt`bjd^ǫp{/Ba27A'2y9p'=G|"Wwu?͠"|`su/H/Yԉ^nA/1mf{ot(0xS1 2UCF5c/`%\+<L endstream endobj 210 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXO#2BFzBookMaker0DlFont00536871280 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 211 0 R >> endobj 208 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXO#2BFzBookMaker0DlFont00536871280 /FirstChar 33 /LastChar 249 /Widths [ 1000 1000 999 0 0 1000 1000 1000 1000 1000 1000 1000 0 0 0 0 0 0 0 0 0 0 0 999 0 999 999 999 0 0 999 999 0 999 0 0 0 999 0 999 0 999 0 999 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 999 0 0 0 999 999 0 0 0 999 999 0 0 0 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 999 0 0 0 0 999 999 999 0 0 0 0 0 0 0 999 999 999 999 999 0 0 0 999 0 999 999 999 999 0 999 999 999 999 0 0 0 999 999 999 0 0 0 999 0 999 0 0 0 999 999 0 999 0 0 0 0 0 0 0 0 999 0 999 999 999 0 999 999 0 0 999 0 0 999 999 999 0 0 0 999 999 0 999 999 0 0 0 0 0 0 999 0 999 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 ] /Encoding 209 0 R /FontDescriptor 210 0 R >> endobj 214 0 obj << /Type /Encoding /Differences [ 80 /G50 91 /G5B 92 /G5C 93 /G5D 99 /G63 210 /GD2 220 /GDC 225 /GE1 237 /GED 238 /GEE ] >> endobj 217 0 obj 2987 endobj 216 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 2987 >> stream xmV}TUMIӞM9666V#~Ԇp,+,JY~aveau q#H4AZ֐b4IcӦ='a7}wf߽wI̘&3aۘM9Vt]Q//,[UnJ_0wEK[ɇæ#p仩)8OiiPڽ̴;Tao4:M)3wߩ <0f:` 3a0L:,- Z,|ʲ0Ӳh%s%)KV%+ӒE-ޛ`w߿~65hLkw!̤Bf(3E=7U7>0j޾MnyH"748ُ1մ"j~r_8z41T>ͻ s?Wmkpח рz㧯<{n=L'Sg͜oS7yoYzf U `{kB8M Щ-A Bd,5"E[zEsPPb(3Q_uԦX7~*lmE~1܇σjmJɁ$d G^a#i K2ԫ Qcu-C|y lBd-)JZ1 dle%)NJ$nkk&Nʙ}EՆy{Y Pǎ/7umj` >8OYpLPH  sz/K5[$ \<{QJH9xssܱa[y5TE%+^ Χz # O9AnN7v>2+lu/{@X7e /)T7yc?yԱip`ڐ^ ܊U/-jpc$.]VWz<DR5bec!t gZih F2ɾ +j74bYK>n0qmN_E"Uhd ;Wm ttg|$HJ^$[z%}? S"o쭬ZVE?[z.;ZA9u5b#(mp7ğ߃#7gP'!z|}&6KO#O;[C؁{'<8I,a/UgZr3TLK_ɜ7ڷ_8`٣B%Øp{r<(|"C4O!h.de'& )+>;fȐ'=}d#8/ౄ80\d1 " 6q׃NBBPTD8j:AHJ,9e$8;k(<|ᝡ)-""6#;̮t|١,epg6ꇗ_5zdY!d5(4ˡkCI'??"r.ɪ ,R4j?p*`&$6 d\ݺ W}<=? J w)7yMS@2֐xBgs^7ݍ"ŷɓ&߄e$屹$5$ZMo F|Yc M \DO<%G BEbf]h 6 d 4/!;hq3ǭgx _D/Zz M,ʢg}tAq3g.B8`aW 䭛g1⧳}}Ysb]^">/К0+4eg!jȊD pGCYlm{"ʁ%~3ϣJ>(BG ps*! SH߶ymJ+U!({ 2{cl2H@9ԃGv > Q A( Wm䥎v 1s !39gXob{z0b ǕWFep뇔heNう'꟫'>6kJ;99Њ{Ey5Kd "l`7-B`=CV^n2j;{փhn>B;7YVe1tm,168v\(&Phg?ۏf7)F5]Po}J^N7G ^5hd{խx}_h6і(ܺaT\0$P*$9 @)I{!/酲Y_5I˴xTeD[MdY峫KrM<F8wXmzVTebo$'tj)KY|r@y ;M-WlH!ލNHh;*~mA'qz%^~(F5iIj8ba#w bV.w:7P>z! FO<$vslz#`T0q~|é|g~ ȡ陬i1P.^ s 4>cxSѹ =js|\4yF-nè֓g<֫":^ endstream endobj 215 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXP#2BFzBookMaker14DlFont140536871281 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 216 0 R >> endobj 213 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXP#2BFzBookMaker14DlFont140536871281 /FirstChar 80 /LastChar 238 /Widths [ 999 0 0 0 0 0 0 0 0 0 0 999 999 999 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 999 ] /Encoding 214 0 R /FontDescriptor 215 0 R >> endobj 219 0 obj << /Type /Encoding /Differences [ 33 /G21 48 /G30 52 /G34 57 /G39 59 /G3B 60 /G3C 62 /G3E 66 /G42 72 /G48 82 /G52 87 /G57 89 /G59 91 /G5B 96 /G60 97 /G61 100 /G64 101 /G65 106 /G6A 109 /G6D 115 /G73 120 /G78 121 /G79 123 /G7B 124 /G7C 125 /G7D 128 /G80 141 /G8D 145 /G91 150 /G96 151 /G97 154 /G9A 155 /G9B 156 /G9C 165 /GA5 166 /GA6 178 /GB2 179 /GB3 181 /GB5 190 /GBE 191 /GBF 195 /GC3 200 /GC8 203 /GCB 209 /GD1 210 /GD2 211 /GD3 218 /GDA 219 /GDB 222 /GDE 231 /GE7 235 /GEB 247 /GF7 248 /GF8 252 /GFC 254 /GFE ] >> endobj 222 0 obj 15560 endobj 221 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 15560 >> stream xm| \Sguu8㴵VGN}ѨAQ,"("F`H mMBbEEhmNmxN;383gΗ{׷9߭V&{_Z#s?r?ä0̏2o\ao_ZVVWmϬK,+5s9RϚ:3dJ~>?z~cىg&>N|yF}q<O3}sS1}d\#~Y{k;a&0S <0Sfü0/3,ya3k a32yaV2jìcL0]c)d av3L9T2L50L-dz20q3L#&02Ä&0Ga1L70L/ÜasߕΞ3S;U9Ksii_}5U;wv|ڹKfj{U;ovsSh/_\:S\`v<K j,.]2Otvҹڥiڥoj.K.[]>K|v%2M6_T|훩7iLcp'|utźM[ UZ_shw{}`sh ?o~^Nr(EH9bOq8S\)OҘ"xS|)@J09ENiI SZS")є#))m)))Δc))'RzRNJM9җr&lJʹ))RScRG>&s̰vy-Cyb3Ā5b|yY[tY=3L~y>*0Ӗ2Ӎ df`^133̪gf}%G̼yL:fy=Y 0K^ys9}H5#4_r}U.$.cn>YF"/qֲ|sP4ݎ$ɠ u5w Ehe?=rx՛AvMkrHe=ĵ`pE#\n:l\I'.^>\]'(@yKNRo*$Pƛo 8N U50Wn;#08s쬛,^1O*IaI#BBL%E[?%i/;|?7's1l![X+|a-BB^H O>:+'p-%lȎzmvr畏9a5K28%~os&?.’ܷ9g,}NAo>p1P+Zt#k ay7 {=Q(/qcEUG Oiȃk{pPV|!k zK#Wp&'ZI~2E5o Nsnv48,8@8 DY`"%[`oH׺+V[g6Ԁq_APMNY+_[VlNx(;X~f1W`]w7 h̵lH pL u*ӹw2\ku} lq{⥀D \.Ľn.FBy<^h0E:$b~_1y[;(Nm-vbNyZ--` m;טlkK{x:\̞@㱪r"3;ADƝLגLeP_Ӝ3?dn;*Yifsa.Z A|r_y[j,XB)^~tK4J o:Z ػ 0\Ckl6{[py$n\aP^5kםZNgȫpjzheV kmo› x.\˗!EN /#7yYfVyaczT?V['o~$}e pA_,I~!&W' Z٫/7`NְAGkc{۷@, ڜuA0[;ᏼʉ zNYI}38SHI; g[4Z0W+9A0  ŷ9â x%1-TഋnJg/T. CJ ē,e18Q9"'(&rG AVy#xRu),ϸj\*6r'8"+IGxhO*s:`CJo_!_إ&eCA 5[܇7rKdo;4nr '8t@nڡu&+k MuPnڐo'"p|++ZX'"c̞Ƶ=|'y-!Vo1Mpڤ3mDp~ǎkWlk XKn]% hn7FƠĽ&RWޖTm 6WgU*cy(U;̄+6a<60T|pԁlnZ↽6=xZǭ '-; @ɿ'~)Ԉ,91ٞңlgګ4 in{؄ګ>-3 r4V _ +m`l%)MI{\;,^MBɇ;gXld/Ndxׁ 6]۪==WKpE_)Z {M`50wZhrϣL @ko PQ&pVyZ W.]N_mhڬLr![ KǍ , S&5[12GT  a5"=M^$ E&VcD<͹5H<$]TeyJ#ՠ(2*db_!HQrn.]`)ʻQ :tid'`0ovda>.Z6'S40fKH&Qߐ/cwPw^D,I@oN׎!3ИSy.68/6&J@܎,zU0ҒuPm-=\ZQ)n1A@`#Eu"7 :zxOy/Jj0o'5uV6^,c8%5gc[{hÁz=$sQ+޴t #VNJ4?f} Oh }Pޘz{X۱^HtF0D#~mwd4,P\lȭ^d~n5yyϑ5s˟εLC[2[hc6)Lf64Fkő@0I%=l` o$0Zz<ȝQ )7!U֩wf16eD,yA{r: gffqFwy#"+ .N. 5Kqmgd|2LTUMʗT;M&ݙm!l9f6"{pRRi ffd@fȓ qVLyd UyRP$XJR#,g3[Z8nŊ9ЗӾ 2=~>}T({݆ H _Ug϶;Nk-! |1q=&(MYJY؜,ySj(-PµC"{+]msD ;l]hu]5?+5XĎoY{HmV81/Nƣ燳~ !>9 fC]@iV&DfOUeK İԄi kodPu|,plk^!L<]* q^8|lS eRܩk< y6.ZilQ@yg*D!'Jk_X::(ڲ:X-;%| fU-8|y%_2Pǹ2Ee]:Dz~+8},/goe)߇yY]͒[=[\B;˿&M"3U!Г d"@i*}1Qr@ ̫ZX^w{ U^*q.aхQ._*|'06K`]{hzaU5mT;`|!ܾ˗cߝ&2e#anm}hj?vB{61_ʟ D#Y`l@5'RkrfVnf3`끦}:. x,o}:Ã!] v݊{vWYЂ|V٠)*6[hBB(.M%q34D:-Rgսqe;-jLv* t=N.W hEl; H+Pmgnxz?\&C[tNp=w:軞E:'aI\>ĠKBM-bp oI cƝIRH'plEmv-nF}F 3Uԡr* 7eN#IG΀>PIVzh+7D@yюFDeE]Uko1{؅ 6O]?>48 s> O^ pdhxJyDf0m Hͼ͢vqU,W*Hg!arS{qGoVYEvxE7(/s.۽(b/#qT{Gy%)~%?~~&'GUIܼӔ KDN.#SѲp".Mj[mpv=D"<""%Yntk然42f+h ǚA0`s8m jf)wi; &>Hr.YV[-v &:xԀvݐΒƄC(Goi]0-43ðTDCG\+UL۠~A_U{o!]>+"p4 կ6dD]﯈" `JĞ4tmY2mʣw H[eKhى0-AP˟<',w[9*Utd3׳8t :$`?*sT%w%FYW $IB_09al?aFB/ykP"ddT2o< ~T+:~p+9udNX{xEЏ,V0f&)hWq()>/v}MyYC`#jNLۏ5*t7ם=^EӨ=ҡY4q? yHUt+wf b{eo2}٪HPPh]=<!nUf7d 9GC F Q6g!nt)k8tUN:FYg2T:1 Ci|ͱ9 u)#j >V k,&۞M6) 6p:MVwjuU7^O,b\`F"%$: ~=WG_N[Nt7?rl=3.h@jL&9aUbEY eb:ȞVTVfqv)h:]82XGVl'6A/QN- f4<~WF(Ŷnݲ1YBm8C\ף]Gq@kU(Q9>fuG`aHqȊdyL(5NN  )_ԬFӳɳ 54Ejo߼'?ԍ9CclF<1Z-4MlC5n p^)-3(PA|E18q91odZ$qKgs- 63r~D)#;Ŕq@fqwNŭ^p.q)H3'oq7x`~2G3 m"~_t|lx75.藉';֯rAno CA^ԹN 09jQvt\Rt*W^܁׫>EҠA2-<0f:R[*8;rvtxuZ0=Uͨ[6): +҇\-b.\zonb2\ތKGU3jbYMk8\ӻ ~{H5Q\vǼHϼVEo!4^F{#eߕ.ј`#V -KqvS*,,f0M5(Xe&^mkHiPe΍jsՁDs)2CQdO5`:`r1GAziNÁ_.jvh𞗲msiNfU!n}dc0\AhXDۃ1M.39e,\zPd'i-\*+ lDWGctGWO&Z]kc0B9# *3JqEP򤹚as3QBFX;V.78`taUa-O_T_TIR'׾qK̇3-d|;R!?twٮ𛼲i.jє^ccKZZhNdxF e)ŏ`_wZS=Km-U`7)K<_|m[ɭP rJh"3} *#Xl݀nr]01/BNTm Rՙh f󲤬zhyܞ9J NA{Azd=rB@,l}vF21^j;"FPg*%I:B _I %+j܇LJX+62cUOGaf{(8^] YieGQ[>ZC<6 쥡knBh]{hsg [[ڡR) EA2Lqdolwhʆi@Acn}ܢ~V $rFh95!EMA0H ~37v/ֽXOzm u+]BP1n~% ':{u'Mk_}ݧΜP[8h."`=,)ա4;x1shx/#Kbȳ&lxkd]Hs9iW3TUiDG(%Ouv/5)sA_m0Hkևk=n \o@F Tng.)\&)4p:D6Mt!:hֻjQCw.Y,!I{ |UT)rǮ#\DU/_+¢m[hgnqsz; }cCd~ W롾ր UkZT8]" ~zi}ڤ_Teum"+ s8䲉PzAe $O(OW(Ai;(g6oOgoqFsNm#B(=#f YO.>ύFI{Ns?1׃M$}r-O^cTSh ׇ@.km8KZ݅}!u;/%׹xOu\g WG⦿%O(oFܤhxV?+ROx[;_,q=|}[i:F ?ogL!vۏ FuI-DCkwVYNԿ>o4+~Q!%U@)QeL@| VPVn>-Yrn5^V9G K־M;EW/ڢ~j [<?R]<ռ^!{4RT!6-*恤pWEJyhxCvu3z e0 Vd˶i{O"# 5gko?xɺC6]"A*( 5$譒a\ۈ"TB؉3H$*rIsAu2CSYKht]e6򎍼1\uwx|x)ϫIڻ8~&}#W{O*7G]NܕMP-]T'lEATíƈ#bX;es5q$GwT^͉&T[tmFZ5G.Ss ĮH k8#{s :f* ~o>vfln/?ʋ A5/-woRSum+ G4f/kTu& 笩D}ڇ9Z){emؼV\ U:թ#I-MԚ_A;NG`C+quQ*kTe՗>X`O a/\ov7۱2Ƌ# ꤃~"b巭A}[31af6Sށ;h j=Y8B~*C;B2ZLu?sm> 5!J; 6),akPѩ:}4]@'y<4[Q*򗈀R9! pw qFߡ<@pd_9i6^Zb; < P}ˉXfS:*]%#i>bs^E&s)V HΣ7ýALjAƀ>T&)()ldC\l6ax6ஐ c :??A~\e: m~mv=n A q9vۅ2((gܤ ȯ'+Wl\k>A}!K;.H*v殢«+j}hW,Ge5 zo\pq؝mƥ6_ڣ Ң0m\y'#n.`F!"0:k-b3Ug`i;%C|Ll6@YAzܠu Qj>Xn =tJ,ʕ:cB/~Uڐ`5IG(}֐IAODO.o) þtxjOT7"ႋr6O^\rE9S(@^<5Auz^--ikNN3L_5(!Ϗ; CmZ0:`/fAoސ!@cˌfV0H1m̝O `؍XܭVJ e&]`F]O)fw'Ჯ.jsU&laH@Ue5忔Ԓe&h5c SjyQlU'ux*;w5n>Su7mٮ]P$ ZuLwjo]0h6.aH?cOFS3媟ھ#'*|J /6T v UdwnV?bdL fEuJ-V>VF ƹQHȒC㑖^?׿>w ,g0Byg䢖"5I6bQa̅e+_C=lq@~h_#-؛\⇟v$IĠda/ETw;C{C:LF0;PEwR. e FMmۻ&ip#jsÎn0Gt-:d&3Ti`|M 潉<%?<AA?{Xsr/qH#o߸E|n}a87*Cq$r]2DMjK&u jqa=yX™e%WѾLb0Eb-:MnBO)3R(mszF/P\%9^K/Z -lME7PY`6`-\^mYUW^z|ͧ^ݾ&@~ŻvfǠ'q4H# Z.9l9ݖu]ķkXR̵Eb=fԚGht* ?U62bn1mQn5FQ =˷psVqONb[TSKn$ݴ:-thZnϞwmg8e,'UԿEro$AޔIsKQ**bSIeRT)iE}4kϖ*OANY$*kP%:{2O=uSWK*#O@9yps_V=s7lIyȈ-iOSKw}nq;8>א.߼>;8S9 endstream endobj 220 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXQ#2BFzBookMaker10DlFont100536871282 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 221 0 R >> endobj 218 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXQ#2BFzBookMaker10DlFont100536871282 /FirstChar 33 /LastChar 254 /Widths [ 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 999 0 0 0 0 999 0 999 999 0 999 0 0 0 999 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 999 0 999 0 999 0 0 0 0 999 999 0 0 999 999 0 0 0 0 999 0 0 999 0 0 0 0 0 999 0 0 0 0 999 999 0 999 999 999 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 999 0 0 0 0 999 999 0 0 999 999 999 0 0 0 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 0 999 999 0 999 0 0 0 0 0 0 0 0 999 999 0 0 0 999 0 0 0 0 999 0 0 999 0 0 0 0 0 999 999 999 0 0 0 0 0 0 999 999 0 0 999 0 0 0 0 0 0 0 0 999 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 999 0 0 0 999 0 999 ] /Encoding 219 0 R /FontDescriptor 220 0 R >> endobj 224 0 obj << /Type /Encoding /Differences [ 51 /G33 54 /G36 62 /G3E 71 /G47 72 /G48 84 /G54 96 /G60 99 /G63 104 /G68 107 /G6B 148 /G94 179 /GB3 185 /GB9 186 /GBA 199 /GC7 215 /GD7 222 /GDE 226 /GE2 233 /GE9 234 /GEA 242 /GF2 243 /GF3 253 /GFD 254 /GFE ] >> endobj 227 0 obj 7396 endobj 226 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 7396 >> stream xmyy|T =籢ᖪ *""@kق$B$ I&33sv0YH!"VDpՖjz^zy'CH>g|d %d}Kᱵ [ƒ**ʖo.۶w +v:3f͜:mV7_1x0@1?27a2„H-??~W#?ca < MAxD& “ Lga <'sa Xa uP(͞gfN&wӹ3sgʝ1/gre{6wKg.ܜi9演pZ܅ r/.۴ug~_B,99Kre,O7KeY@V0+2eEZY0n$gQ8S~'pBaLp׽=1 ߝ&|*ʄ7¸>% w ۡ4l$],z0#&#bJr =+E+@:KMQ$V+3Bf1R!gCBF._x-#hfEw`S\x!w)D* khs{M/v/8=XhYe;axRN5r]LL;=͵6!*D>5]D) 2d;=?{ <#{:JT`beKs˅?w "Fm莡wUPW}䠭5~Nѭ) q%xPU yPjo;L6+ؚ\ z>Agڶ6w%C0h0.= G\١fPCFTZN~`}rY-5rS}M'NsX.N- !ݬ(l,ҕp)ޖt.rҙ2}TUSn?#v*X4`p:\U.m^ 'Oun#%#QzLg,+k^p^搉}WbĿHçeJdf|ü:obKSL"%fWZQq6cxl,E49& 3%ѻė̴Gv>?&'),v}tr}s!|gs9!hӶ!?lO=f$X"oH:Y\`ircClXlHERR"\.WZtM:rnBc(x]- q.t ^-eK[r%&:_;[e:Ah\ylQ={(#/.IQ~Lhe ~3ՇE &DͲ'II* kYᰣ!;o4" dW/ 쪤X74?&yU Cm@C$M~L +IM_%EEDS$5^^|xcI+=eYɏ9}`cًļO= +&[2E4G\E$JbaxG~qvF v"˪[jS5p, 6GED#[z&)ZE0Bdi#V M. X$Ű\cXce>w +!7;< '1ѳ"{Db$9tݓpftG&WHdǺ&vg5 lY\@nhsgA990Ap2^ ǠVf Fѡ6Ǫ}v'FH& ީGj\ w;IPWױ<6}-X a6ojhIn+"Xi076B4pdv_GWXWIyؼ.gye\lO랮)_MwY/"^lI5v97gm{\M@WSN>[PTMC0V]}v޼&Q֛C7Yvwe-!|RWr Fs(=oΆik^ w~!}-H'9s qM:FÚlsGO}/6/+_75]&2cK_ ~Z Բ2V6jʶl;v_t &>-Ag!W:ȆV]*&GV Fm255d]ZTG6#ohђRZT5OwiX>Bok}u-O-dCV@q svvFOnY[g-hc;eIp\j>&A A $&'L%%M*҅kP;)=3$DH7I1 B┈k^ #ա?rS#Vae.r%+KOtѝ3U ?}7Nu))thU6n[{v떓"pNy|ę,w>S:7@TRrw[ Zi^$=1n.7l"SѝL q בO.kmv6w?H掝-;Vb*p0w@ueTx2 h?"(r~J^VHOvC8<*7gI틖Ax!oDHOo}ю(rW4FbhcdSش)fQI:ymEj)U:MX&ږ>*W/ЃX//]'V:]BCs/ZD824Wٱ04MĝZv#|4%[`gO@+A/.R֢#vd2FLVXoS{h`YljT< 9b!_De0f{$6-nT+=`Ld$ġd9XL$2t6"-h'g7<"g͠zm{IH}2W.訉u])puleG&L* +R&8 {ݟ$E$B`3`mI_N_N]pAqTwytQ'ЏƲ[ f܇,3 ak+I!]Ir0&&*E ?Ky.T˴ڷ=TXF 5 0װ/ 4 ?GRj,` y=!Mnx>])6s_'*{M }zk" jD.!.k]`O8ŅC]} ,N>6zO別y3>9tj$mj*Ç4,kmbvViW Ҡ$NA8GXO#`ripF!r5keCF q-|l lGx!ͺrcZ~4kOZ43hš=jMk } AQKKi=ĒCUcD,T Ү-Bj>#0M%s.E_//p9˷>v33og}.p*#sͭ($V<Ȏ 2Hhł|]\[ tB_چ1=/G~b%e'мSٲ29Y>{朜J|j 5+RXRE 6co jҍ%+qYٟv'!8FHV+p[!%(>rRN9AkkREȌO@ʭ }hb!KVۆm!Bח~Q3Uؤ72z9.?2H  7=KPzEWSIx=1u`>RϫP3>&y;*~)dLY4b008mj@2zEZS;Pһ̼>`L&]|+Cwԉ檍PUy64RuGt;%`5ٱ5+zS/8'VRANLo)_ʂ~6)z &xUL0$tƂ롪z v4N,&~2b-~*)r2II,!9W РN'ܫ|3nK`ݽrώnxWSఒ_Ry'#66D]_.{W9NəKӕA4^< f6hڋ9`?yȧ/p@+ Q\y3yg1r**u|9:49{]{\#ڬ_o#c p\?7qRb>@B(A9:ZQ+|spc?Ni3~U3J[cw~Mxhplj=Y[ѵ*SDVްz|;:AX v U'o`>E%F ?q«̯AUtKP N7&z+r/һ`ml+nlSk%xʵ`\VqTE*[1Yeo(,Li7~y͌Geۍdwb|0:pyfciNc4 GF<`1JbSzhMRGVt.UA)`^  O-=Go"?% \%a;_1Qh#,0fy{ړP5JRT /oKJ>o>g-b8#(Fie,C{73q69mX|8o(}ƾO=.K݌:y۪9O vBْ`m j`jH^= PNШ1 b0¬)^x؂r !*{ԅ"8kX_C|@ub1F6dOc?X塀 tGCxoşXly4eGؘ3sofc<$õDnNz3AT?qB2FSt] Sd=.o{ lXl0&zEYȊ0b3%E+:4rybN&"jl]=9r&=6}Hw_o:7HGv/ʷbtȷ]1]>>PT_nV/DFs7Tr҇D mhk({SDu$I>a{p"3ozcR]JH@G@%mX!/ѝH}~y10`Qp{ѵoo\^ޞRZKSKؓOIPܿ=1pfboС"^œlVG*&>},IkqP\ȇӻĩ-Xm,r+XK50.]-pjW_^&D"΋I~u~A";eJX!Ѥê_YV8-m`[_'+W"]b§Gio80:@Kxԫb.?((Г,@w6G x:6tx)3Y.]n>@)YErDJQތ֩ '9&~bQԄ@NEٜ(rMy| *9Mrcr vhkӫL<$Vؖat.&sKptDv~uS=y`q=3*һ8,F_~,)˟*nNyh4GH1Ĝv" Orra7p֢bs}^=!R/ǫ=k*=ǰ/,3T=|R+HT:2<:Qal ӀG!07HQ9MG> 5 ܚ_5238w`_ OlQVvx&ڳ!$r;(qp%*b11kV9i̫跇PQq60t)6a@{Eej 2?Uù.NuC{*B_Vyh-AMERTH>5F[ %3etyS7&ˈ102cok,vWP;٥@O;ҵ-LجM IsoM+,iywCYM٧&o?^YjZLJP4Hl=h-OأۙX9ued.If sQֺ endstream endobj 225 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXR#2BFzBookMaker11DlFont110536871283 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 226 0 R >> endobj 223 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXR#2BFzBookMaker11DlFont110536871283 /FirstChar 51 /LastChar 254 /Widths [ 999 0 0 999 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 0 0 999 0 0 0 0 999 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 999 0 0 0 999 0 0 0 0 0 0 999 999 0 0 0 0 0 0 0 999 999 0 0 0 0 0 0 0 0 0 999 999 ] /Encoding 224 0 R /FontDescriptor 225 0 R >> endobj 229 0 obj << /Type /Encoding /Differences [ 33 /G21 36 /G24 37 /G25 38 /G26 39 /G27 40 /G28 45 /G2D ] >> endobj 232 0 obj 852 endobj 231 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 852 >> stream xmQ_lSU>w]l@ Da(CPۚP A,Ԯۻ:{ouѵ:eI/U1rr}c"!dˡ#yp@nٞ>gǮviZ R7QK[G)miszctuv;גa,l&<b%ۚ y 1$iB yYwڬYw۬{l^x-[=G8C#120I 0[ C 3i'm_uځҎ2곘.O]NUq9wɗKd!p)$G^(safCПA'O<,!pKqHq5bmO&_|a`j&έ>Vȟ{ ʘUP'cŴJҴ6>U1|Q: GfO 5NY'4'uN#ˮl Z-C+U N;VR&j@*W渄Eyn7.wUO }tVV|_rc2;& ?ࣜC7^!Q&)T ꍞ r|z˵ox\ \7a (~ endstream endobj 230 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXS#2BFzBookMaker4DlFont40536871284 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 231 0 R >> endobj 228 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXS#2BFzBookMaker4DlFont40536871284 /FirstChar 33 /LastChar 45 /Widths [ 499 0 0 499 499 499 499 499 0 0 0 0 499 ] /Encoding 229 0 R /FontDescriptor 230 0 R >> endobj 234 0 obj << /Type /Encoding /Differences [ 36 /G24 47 /G2F 57 /G39 65 /G41 67 /G43 78 /G4E 79 /G4F 80 /G50 87 /G57 105 /G69 108 /G6C 121 /G79 143 /G8F 149 /G95 161 /GA1 172 /GAC 227 /GE3 241 /GF1 254 /GFE ] >> endobj 237 0 obj 5871 endobj 236 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 5871 >> stream xmY}\Te?9?,is+\lE%|3͗0@E AddÙg^98( ۵V|ݽݺm؇vstQ{LFFr\r2ӧ/ݷpeNɳ--Ye>e4sKi)Kf&.8ɿJ[U3 t0 ''II$G3ɕԐ$'5&)I$O7ɗO $5q XFrFp|:' ˍ%ww7ݿ{+﹇sr`p ;MtJz?EqȻ G")jtrL%ܵo{5Z! Lj{/qJwi({y||9n*S۱MϪfOomDCS")#Woؾ|y**1Xr/һE|QdAEV1E~hyn8p "0Vut8XK{elk( nNFY@ e5R㨫9Aq:з2 ײ8S烻P୴g ͠GD$/H ikmcJdNyLj/Nr3;O  r cV> d :K5j- 婛A.wո0t)u* -,63b(z؅;I.LT`!2JEh @eGQ./{%{bC + Ȳ쐱_J cY,_%ܩxqhqdc>qE׊J_!*?ك^pdxgL: ՈL2"R<RԂCrcdoNхPGb(_t<"6$mn2|b1:I$%7O>US"#@"K%Ŋ l▼Pb)o^dKygh*@D$Cc+)lko+63:<[Y84ܩm4|E尷YNEf0t%`(zV&?hN̶I)Ez~~A'3ltNou CT8czWܜ (X?/HI"אJmx=^V:s5؅Yqok$`l!O5wjJ@\#ך@4Za؄K2-vv狅[kb0+Gl1.Wi*)_@Sqd-)]@VN_z{/T}XǷwCIpcl1Bޕ9*uƋNذ[eDT5x0 ft@/d` ˍ+t}? vehU.e@:AmټmkX00Fp0e6N][ BV9L*yU1w3*j\к#UU^|]9l]P$평Z-)2Y@`cMє8S?CEɳ@6~u*D1w5=I#U:ф~H P`z2R߱ L5Rġ|8eⲊna ޝ:aKq5ܞuJI Il|f|Ϙ2#q>EYgcjeOKi|c6)=vf%ӳ@f?x7<N3|: TfC,P aT) W903{2*@&mbKit,gLf/#g|Dֺ +y}E ڹ뚿Kq_YfWOӈ'VTJ!c`kk0*-r yb novoV{J[a V DZw"2> r%M<>Ly%-XJ.KEvu &z_CY[fڣ@o;>a)hI^y.tԁim/UD{0Eeu ^v:]>搫<%*9mMr b̫0Vcgņpviٻp]mMTi07zJE[jZeˆǨE舣ϟ̀%z[CWei="L8M׷~ #cVp t|l~[Ml孻[zKtcqF8{?( [(VB 4w2+vZi'x+^>H(|g:Sh΂-o9Fm0X8o4[7wFt5]nH*0qfrlwpö8TDc0Z5[a[%`(13Zy?U YnP;Tm?(-& :ۡfOKSsf@]iCu:O)cܒQe}j춆m A}P@T|j[z ʾhy/KCZ`j\Qˢ&x؜3#0%MMfΓ'i QF@n m AEiVfc #޼hq f9e3_.@YuIWk\Yx+.m D]!燁 b<̮KƲgH!|L@ef,T| r ^z!FM.? \[,͛jo}b(e{r[DAiu.om](.׿`Oi~lm=>fi装<Q2Co1w*H ~Ճ`V:Ԅc@24z·}s8V-(ʂ(Fn~鏳A[%J{=y-{L3 rd*mLamoƚ la.x.0ni `ժiQCsn$#Naݬn[Z\5KR> endobj 233 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXT#2BFzBookMaker12DlFont120536871285 /FirstChar 36 /LastChar 254 /Widths [ 999 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 999 0 999 0 0 0 0 0 0 0 0 0 0 999 999 999 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 999 ] /Encoding 234 0 R /FontDescriptor 235 0 R >> endobj 239 0 obj << /Type /Encoding /Differences [ 33 /G21 50 /G32 85 /G55 101 /G65 214 /GD6 218 /GDA 219 /GDB 226 /GE2 227 /GE3 228 /GE4 229 /GE5 232 /GE8 234 /GEA 236 /GEC 237 /GED 238 /GEE 240 /GF0 242 /GF2 255 /GFF ] >> endobj 242 0 obj 6143 endobj 241 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 6143 >> stream xmX xՙ9PjeZE,n$0)b !101\?d& HJPhK1]bu--OLLLggK9%e&e&IYu۞*- w{uWW-YxYrz}s^)5#+5s2eRSnMVYſͺ̺]/3{a&~ww?_3OL;o$#I3$>Iz@HÒ4_DKJIZ%I%)IZ/I%w>ŋ._4ݲuk׭[8?oI~5yO_~QzVًJ^gW_owo)=KRlY,G3˕eyOdxHM~(?B6GGUwM;[AkpD'PQ8}|*nxϫ s 䋍j*ͥG!؛%d1CmPϱy*v9t5/um9[q~8qcøfl| uN;g nCA.t책QhNݩIN_+ 8ӱ0A_ܖLΏ-亇s LN۟]IR|jTj F=$eΓ+id?9v]+DЗvv7(k- Z3$}gcPfHk dwcِd).%Y%{lve']^)+#!~I9>x^fg|7v#; Ʉ/a!gmըI3Bgg:4GC0jr]ˣmV:OfY@eK[Gyn`gg^!3$IjW_'x<ղ@ &F`p ;]qIGhl?yK#v~wl/~nlu#og{ߕsTz mMF}p{YVU.*܌.@l7fC#+v@/+m 룍xK{pc=z8ܡs z4juz|Q`Wܶ2|iR>)T%78fCkoX65ȼ Ç7Ү T>NglG)ENM d/>=}kIպ< c漢,>y%R̥N-rqE5`sdvϏ2nڅ]5- ( (Z"k'<ŐS /\>`}ZYOQ"+/n3Ss >#GG@SD1wR/:@JcDU.bx XЏԈ(Quun녔on?/*EmH#!.jCdy6ffjilZ8@f^a߃~'@7R9r:sB8ӆ;KRu$lIQ̲ghRM/Ҡ Jt1$TgdDlW;Cz4 vɬWARr]mUt2ӋfI2Ҟ L[yt\¦a?ϵ̵n.:']y?A(Wm7 gu)S{)tȸB}gFƧ[0!eNTCpş"nw׬߉bLAU-M`c4QAO ^K= ] qQV0 |`诳բc\\;B09.p0A˅x0r(TŇF06 OӦjw:Nvz +:~Q#MKMa5 d{#ˋp `Q RP єYka\/xzLt;hfc+4Ld`&+Iͥ|Q=a `&^\ͪ*sGncŬXg53w9TRzooX_wt<5 jR-xXa~6W!Qj-C^Ez1+כFThH160k/F=,j Ji;,W$5r- $ >&ލV/7Fn.d‹ K 7sO$BuЖP-}ү,j]?(W+9=|q2DC1Ҋ"̊:MnZ &]&\:/βtxlNd$d'U*(]ܨ37 S3J'f*i:T1rV0/]ɳKrדr̼-0$3<S5ĬwA<6ڮ`&rÑVL:^K(}!X6fOk3fQM7DKCD;y!'q_a-B_U{)}ʶ/Uw_qٜW5YZ6"Ns+[X5W-|ڃ#2&gMK6U I-R'c?2-K%E h1ci^\Xk j:¦  :;k8`̗l} >! GlvUU]5[%mHW~u.9+Ak&F__zNa 5**u %'ZFW` 0_KHU³R#j|9QB|x]W(J' x_JjLs$_i:Qe{.vOZIp5 ܨۇy7TS3o^^W oUq9P>3z9@:7Y _>:PezcJRkd QVH{_U}S^Gkբ>tF*^nATc#%X/!<0|u/CC^_ׂ]p}0:$3-@\RCNo WFS[_y`2 fX*)B 94$DePȃge^d$ՊS,m$wTq8p>T 9kȨK(s_#?CZ+jژF~Oӟɼ@nB$i=6h}zunn5RR ÈeTs&_DCcHW-8Fq 2eL=d& Dx\f3q\|$:|D!- HP߷eIS4WˢVLVh1БL.UTx7WX/b||D6u#67k`  齐{C>@~K޽$=|{.N?p\K5~*, jU9 ^57Ȗ5|QWd%&'-m%,%Nwu@Ffgϔez+_ʯ-ƃ/|Vv uh6\~ٍ`Ӄ(:aw <`?gwxA x3_sXq m?ɳi) ?BD#F&hu4^nBA fdA;"u}aGhEG2у1}~o[!l>6JAI¦p>sS{؇Ve\MXbq 7۬YT8e@w×Q>0:I` c۠?g/(|`╭ F3ޑϏ^;ӅCh9oF!=qWf8('/ev~HFG2 |HN`p<&Z@WF0ETAHfrzKP$v> endobj 238 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXU#2BFzBookMaker18DlFont180536871286 /FirstChar 33 /LastChar 255 /Widths [ 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 999 0 0 0 999 999 0 0 0 0 0 0 999 999 999 999 0 0 999 0 999 0 999 999 999 0 999 0 999 0 0 0 0 0 0 0 0 0 0 0 0 999 ] /Encoding 239 0 R /FontDescriptor 240 0 R >> endobj 244 0 obj << /Type /Encoding /Differences [ 33 /G21 34 /G22 35 /G23 36 /G24 ] >> endobj 247 0 obj 2030 endobj 246 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 2030 >> stream xmUmPTWhtM5ZT@ NM&H(Ģ@ B zw?wweeq]%A12f4)v:M:L9k?zVν{y=y}Nd128ǯtoÝ/h*(ܼp[E?6ߛzKeeE2{3L=9(gp>S`dswkEXtٓwǭ,帵PIA~IAAIg dur'3p@¡Gs;9^ /OoPML%YC6]~'dnP.FzB WetjN`6 Dvŗ%Ү4Z-oѴ]%B3Ϊ_׃GDSy_"Y@xL lrREaw*  cC(88xG]c[c2?242<n jv: EwR6|O`oEoA.Ӡ R2āHŨ+@W.jKAhmZpSvF5{FBXi{>V"0*f!AS[`T^u] SA <j,QֆW}`79bLixdg؆a!F v;;Aju=(C9σd0N3aZ.i?qND  3A ,_[6#yBGbbCݮ6R2yZ&HPUVd0D['Ѓ͇ 5ha?ތzQi(6zJ4ԍb)-16 "$x-)3,<%8uIU `p'UdOW N@촕% >Ğ~^uvI0*~+/BTт>Q&V\nt`uR5/HAM{TJ=@i}@F$[ ׳b4BU<[T3:s74'ڠ ^͹&g?CsGzEq<{[Xo'ʥs@0[UU)sw?6d+c- @y#v/eOb;)9Oy6oedO˘+ms%EamE.߹-Dͫke@}2,6 =M&j)y!_fY_iOd~ 5o賏 C(ꎈac狧 ?`lV G٢@y$5s|%hO?ތ&6E;JC3H˳m $/=.5֡w8P,C|RH"MO"< ,~Ƶ fYُ.Wn7A~q~tf?Lپ5 (TU#2+(۩kY:$ۘf5l4e,6)D%Rl>Ǩn%}JLG7_qՖff]nT 5VM"W6\ 2q@<Eg)>9y Y7 A) H x=L w0]'+44I3VZQX+cpo @.3. QgvqY<ǥ'IpIA~ tJj1!GubkA?A08g x5Yٱi첺$2H=k?,P{DKP&.i魇C=0tu/HI |0ec$5K$Y.K< d^K}sϳwB04 <+T=$lVWϿA y켒4&%IXNUf\ endstream endobj 245 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXV#2BFzBookMaker23DlFont230536871287 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 246 0 R >> endobj 243 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXV#2BFzBookMaker23DlFont230536871287 /FirstChar 33 /LastChar 36 /Widths [ 999 999 999 999 ] /Encoding 244 0 R /FontDescriptor 245 0 R >> endobj 249 0 obj << /Type /Encoding /Differences [ 38 /G26 64 /G40 73 /G49 76 /G4C 77 /G4D 83 /G53 134 /G86 231 /GE7 250 /GFA ] >> endobj 252 0 obj 2660 endobj 251 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 2660 >> stream xmV}TU罫!MMO5ÚF_D F!ADE* ȺY7 pYua QbIԤi$im䴜&i<̙ys߽$+ IXuO-{e͖e¹c=`ܸ/D`̘1ckca8y"?L"N L5?Lۉo?dt8.:"e e(Ձh-3=EY b?`A7 pzMVp %;پO%hLWnD쯫 ր_pK$6GjX h=ujkE=Xy:+n;|(.ny168`%+">=-. YI".>|/iSuRȈbCpqO>!"mRe`qDO=|!͝!gs>$l WjGT!}!Q}q49BzH&8^VBAPU@%׻UzU`ɋl"U/"/ `U*4ك| [| }WEuն-/gF.N_ꯀa9&ԋ͜[FOC-!qg|Y)[X"d;9a|@MP)ACal}!4/Gd;G'ܡkv,1ٲ&7 ZbYQ7'Urj>kq4&8ZG+6hNՁ6`c(:;:%RjӕHwGP )}=c:N?hvE iǑF7oM-08;|4zZ3a&o*m\ 55>,0嘯n%7vJyRHL;Fxf" wSz`PJV]pkSu#{R/ zSmQ*_3st GKbg+;N|tfpWϵ7-PS8ZdQ?Ʊ+]a|م.AS_@X}ʍ]Z %{n+I][ׇ1Ϟ*`c/r@ڧ 86}<ĞBsTf/ŸŴzR;Fe ح@)P}!Vr}K/h墳3HݸiIЉoWbrf \z+YN=MVK2"üWNlUÀ֠( "EbSA5GDwy( MV%,3#-ψΜ/pE* _cMAbWD*,KŶ_.{>v{W_9GA9ƕ}$yW 6O)*G!ҍPCR %ҞJxQg_ %e`3?6(_1gH]%Sy,B6afU)ojKk}!R)[DY=bvU~ҥ3\F=lzn*VOpaml'u1e oP+C:qV7u4j WSUog';|wZZ ḻAGw˹K<͓Ufqt sUʭ4W 6<"wY`v& 6wU8ڴFJ8y9T, >58pfEOT=sS@+7]j!]_8+e6a3PO!V caa%ؤv9td)gh;;h{Wt=oֳO0ۢצBЫ PsAWWW꒛!a[*FC/>WtvX,ؘTJ}]e㨈5ǧ,ˠ3>]Q;B޲sh_+qSAK=I+Dj%ChE*tr·#wp"L.6oy!{Č+w s *'/9]cyc'/_d l<* n}݋ǝ%[R1[) 0l18_%O*1oti$*Uh} ߗ15N[0!/WeI endstream endobj 250 0 obj << /Type /FontDescriptor /Ascent 709 /CapHeight 674 /Descent -241 /Flags 32 /FontBBox [ 0 0 1 1 ] /FontName /UDZCXW#2BFzBookMaker2DlFont20536871288 /ItalicAngle 0 /StemV 91 /MissingWidth 0 /FontFile3 251 0 R >> endobj 248 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXW#2BFzBookMaker2DlFont20536871288 /FirstChar 38 /LastChar 250 /Widths [ 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 1000 0 0 1000 1000 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 ] /Encoding 249 0 R /FontDescriptor 250 0 R >> endobj 254 0 obj << /Type /Encoding /Differences [ 41 /G29 45 /G2D 64 /G40 69 /G45 70 /G46 71 /G47 74 /G4A 75 /G4B 76 /G4C 77 /G4D 78 /G4E 79 /G4F 80 /G50 81 /G51 82 /G52 83 /G53 84 /G54 85 /G55 86 /G56 87 /G57 88 /G58 89 /G59 90 /G5A 91 /G5B 92 /G5C ] >> endobj 257 0 obj 7438 endobj 256 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 7438 >> stream xmy{\lH Xn+5˄I?9Q0ZxAx\& $AxJi+3yA-seAxEB\ ,AX.iZ2c}[cZc㬱ӭ3s/[cq5kTk4kָܳqָ8ktk kLk,k\kK;d w #FS O ғ\U}%?FxAA/IF' -+&!'OKg9q(C%*.2=6 4] 8NЕZ J*թAG?AEıXdOLn^t`I*Rm*^DUwwN}W:VW$*SBeN!z]Be6oxߺ&ԅ \J9!Nht3t~hhks*K) G \k-1'YD>̜Q?~d4<&9ɟ<Ğt(=6)h-UռNi< Oϻ ;<.*÷jA\7apV Vho7FM N5'YbkfJ]](i]Kغƭ-dƳpcvi b`|OnP[c) l!`׼*G~N$7ݼlg29$bZ" jo6A5Pfd- m?M:sJ[/kZrU \3ar]UsޣZ+$N`A{}A z/y#-Qrts2ʮj^:h8Hxag/ ); @4(q)"\C:ujӹW1.-f9>pثcDibN2*tES+],v ]#Hl1oC5_Av>OqDp%E>z7LW^rAoarѩdcw^hZC?%Cd#_V\6 KV:(jD[Z cq!d"39!3̱d`a;xDkE.,&4[-wkN].Hb@x[Ӗ LrOZ{ Wɪ,2gJ-ԕkkN~`܂-4GIU`6QCAP*)]_JwUUj0F*\OJW 5JH4Sلyԓiz@+jG; &ᯪWxb6؜I5̒ZSG vv>'zkv/r iqU)P#bQH乎EPQJ!d+$j~jH `+nU !(Vwa~J :Ӯj`Vwf!gsȐgeZz(&Z^&-;Ng#nUP˴E l"!5BU}vm쁝r9*.hI=H_=5nO.0߹@k&S#3!|s)פ_1ry TɖSx±%NPOͥ62Bz%s,8T/^PH*fD+l ZhGUr qѻWA,ɟ8@W9H)@55Q?1 w=iNh bcX$1룾'873>cW*{VKpFWA׍(D:c)|F9vMV X @͏jb Y?67V"ڥ_bfE9վ_j)tڔbAHY'ohoS8KrWJʅʼ=E ;ީNLX@)CijiOhW0/4fХ|G ޛ:^pw:ঔXꞍ#Jؑҳ\~):Rspd!w՗B.}˕7EQ`%~X%FJ[ʀtLp=@kqj}`Ɛ.ds>VEPm4Pg+v:S=7A҃JQ9_ rmAGpJZ!=x4RJ7sF5\0fj{ E\(BaJK af(t)9=1p@"#|K)M&~JBK$lVU!Wx;^\w=|A#Yժ>v#,M.QEhiV vn$Dva##e3CPI?mS ]TWR?e&-*N[ fDd\<ʼI>rSbٜ(+xL+%w@=lSr̟1mAWi8r$ 9eG !hN3l;B0cO&~xPz5C$"c["Gu$=OCCaE#'OjB+Y@e:ك¶糬I)ХtUtڡ: us 9nv8vBms5QLu`Ԯ>M(.H-V `~@ƫ\<MĴ0xg _n1DCz6hl%`f^ޚ%׳OS;˳aNم[nźw dErgY9?& OxM,9nXXg/]{hh7 05~1URÎ-k aHٓlۋHVχG03"tZ*Rfˉpu Ӟc39`(5n;海t37uidKY R}z˰/0{x"2[','==u -9_7W,'H6*IӃڰm (J>bBG8=$xRGa֞xN'Unu[kmF#i+`IyE.o[U\NIwiATI멧]1kŋgr5qa)͈1f >{xt){n.G^7#`<('Bع2\^iWDʞyGRڒCb?<mh#[٣34{mm0|D+P]eS@w <0$遽.Ψ׽\;rO~3jJPR_PTYqۉxJfQH{Fg96[1":TUҪ 'c$E\*r@W堼G#[%uG}M&D5_Uh/rP5XOPU&U^um GvE1%챘R: *c3iQOpς$55K$+gQF7rpȮD|䀴Ĺv gSJK\iщϋ$mcs+_Ln qׄq=cs%e:7(l1Y@Wq)Ƣ 1k[j06.mĬ6v\MyL[i>\oP=8K;iTT9*t@y ^{:K Hu$y?nTB@anT ^yg:)$eL,o VeѕQBNweNs(j ݥT NsqDo p['0*CGx HFyU9`>GsiNӢkCոn,~>+rerψ]yFJ\mBJXڅ%yWxvR<= :vŦc)+x-VJ[mΙt~.ԣse^c Ŀ#h Bj qLO#KG':Đ-Pd'itc)r 5oC|O']8ZŢ$njD f,ˉSm^aat^gsfՓfn2YkQʖ/iCjW`^ %P'3ϋJ m?|46wBCjy/ls+v$AG˭.;bJB6G5 *s ծ %VMh04bO =sE3-: Bަzaھak>O䴊W_MUz:%e_|i$4sKHف c!} %Ca9dzn㻎zK`> y9L\f5};ȸ"AD)=4LfcF haQ&:,J5 jrՠ)8g.iabx\@l8S/M&IlUouNy~ƅ$RwҦK $&>?=f|y7g L_?Gos§,&=k7l$_`gAgI8dKg{!]9J!dtx$¾\  PTc``_{I1V`1VAu۾~}#}A]M]Az >^^_ QKH'[I =D -}>ߘOxEߔc[cK&Kÿ%J_3W`#x^zaw>lB>th)EGp&4gF˱ AݳUl_Sd*Űk{!7$:ی8 >hhO 77$w5CE6|a/\ ϼW %|8Q_@(TuJ5m`z1[}{͗!nimk#q 2M{YĶ8Bɇڸ)j{KJȉ^ZL%3M|LOȵ|° Q>av[y7&l3 =Yˣ;x([mi+]OͱfJ[ R0^ {ܹ?Oy-6lFؕ\ydg>>5VQ2ݣ Y:]K(Qe͕?)D]Pw9 [x> endobj 253 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXX#2BFzBookMaker19DlFont190536871289 /FirstChar 41 /LastChar 92 /Widths [ 1000 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 1000 1000 1000 0 0 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 1000 ] /Encoding 254 0 R /FontDescriptor 255 0 R >> endobj 259 0 obj << /Type /Encoding /Differences [ 34 /G22 35 /G23 ] >> endobj 262 0 obj 279 endobj 261 0 obj << /Subtype /Type1C /Filter [ /FlateDecode ] /Length 279 >> stream xcd`af`df``d`P urvrMN-2vq+160560744)!C,S7ӏK> endobj 258 0 obj << /Type /Font /Subtype /Type1 /BaseFont /UDZCXY#2BFzBookMaker3DlFont30536871290 /FirstChar 34 /LastChar 35 /Widths [ 500 500 ] /Encoding 259 0 R /FontDescriptor 260 0 R >> endobj 264 0 obj 148853 endobj 263 0 obj << /Type /XObject /Subtype /Image /Name /Im14 /Width 1872 /Height 1190 /BitsPerComponent 8 /ColorSpace /DeviceGray /Decode [ 0 1 ] /Filter /DCTDecode /Length 148853 >> stream JFIFC     "#()%$%%!'+,,-/4443.4444444444   [!1AQa"q2B#R3br$4CS%DT5cs& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjz P?I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$8.wn-ӊyC1_ea{p˳%>9y7Ӌe\+QokP%_/"?k{/#ܟb}LNd,Q~;k Le}soUǙpW: SI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I,_ȼ@/m^s<{~UC?7meoʏ~VKWںϲC#/\ op/Y=`}~ʩwg#+-{KO'/x6c)!1{;wp9ƵtI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%9}[_3=ј?Cl#Ϯ]/_Fc3>?'7{%oK$߱ėIc߉DϱM^Iě;ė?ě?7|NIM^Iě?7{%oK$߱ėIc߉/~_&/~$M^Iě?7{%oK$߱ėIc߉/~_&/~$M^Iě?7{%oK$߱ėIc߉/~o~_&/~$f}?ğ$ϱ?%oOoK$߱ėIc߉/~_&/~$M^Iě?7{%oK$߱ėIc߉/~o>ě$߱ğ$߱ğ$߱ėIc߉/~_&/~$M^Iě?7{&7{%oQ3p?N?gR7{%oK$߱ėIc߉/~o~Ge߉1c?Ic߉/~~_&/~$M^J?&}/~$f/~$M^IM^Iě?7{(ę?ę?7w{'7w{&7{%oMo?$_J_&/~$M^IM^Iě?<Ic߉G$ϱč0~f׏Noh'I$I$I$X?o޿%y5C?^ڼGR{]UP8;_v?4/Vq`*on?}v?"kq5z ɿWwsOJ|?W}7eUzv涖#cw周ag? O7Pb_?A1Gp[x/oĿwٿag? U;ߓÀMйeCٙ&3/oĿٿ(Ņwimt?A%~Ζ->v|wb5N %cp \w؟#wfۈ6׏?g?=?A%7Pb_?A%7Pb_?A%7Pb_?A%7Pb_?A%7Pb_?A%7Pbc? Xxg;жӾ/o?A%7Pb_?A%7Pb_?A%}(10%{CعG]C^ٿ%7Pb_?A%7Pb_?Aٿ5K4Q?Aٿaf K(1/oĿٿaf CGog%gs-{~-sĿٿaf K(1/oĿٿUd'@vuZ_G@b7Pb_?A(ggb_g;scpﳟ%8? \w=<&> oﳜ#af O>{'Kvٿag? Pb_g? YT}EqdpsĿٿaf K(1/oĿٿaf K(1/oĿٿaf K(1/oĿٿaf K(1/oĿٿaf K(1/oĿٿ%7PbCٳ@b~G}-G^/sĿٿaf K(1/oĿٿaf K(1/oĿٿaf K(1/o?#{d,Ssu} {(1/oĿٿaf K(1/oĿٿaf K(179Pbd}Mkd>{ٿaf K(1/oĿag? P?dL~r}nfۃںs?A%7Pb9Pb#=э.(1/oĿٿ%>%% `7Ѝo?A(5عk}|6[e~v ,i{_oĿٿ,߲]d>͟(g?=qwka lzd$I$I${A-?㷲~WSxqi߰"{o1>\c/r%|a4oJm{ybI$tX8oP:W$I$I$I$?ӽهؙS/5-u~S{Uy5_ex`kdgda}# Ռehs /8?w'ӫ[{} wƶ{wێ^هniȬ|eG,?m}Yh[hj엝wf."1m>> o'ا(.ʬK/G gwGG[޿ g<{I$eTe} USI2KhoT~Edw1l$aָbHN 3vZ[IcJhub ֣vI$I$I$I$I$I&<`55M$I$I$Lc6i'[I:I$I&rfe?"AI$I!;AB $I*廙`t{TE4(Nkpx|x'I1Yλ}32,]ݟKyYe"t*Rs)]*\ԓ'QyI-%!$I(Ymu}N]K q"5web9{V_V.v&fɢO-ή[^:{U~p]lJ3Ɏ'y˿aP%teƏj7yn7f6\ria~$JRK'I$7xE~y$I$I2ϫ Rkw4I$13? xI$]zI&LqݐDج:J._{`;W{m.ª]⬤U\׋ZG%b4 $I$I$I$I$I$IxGWV$I2k0>uWkDI7Dg#02٘9`´b$TD=i$gcX ?IKߓnVknl'I$I$I$I$I$I$䨶>|ƩI$I$Iwq}pI$I(W}sWP_%4I$^'n/ǜ+$I I)9:JR}6/R请t{solt~hZI2jy7׍>`۽\.;~=C"P-gݜ.8+ɝ5m$Migrulgwl>x1y&GڿSXo϶=}{<]OS5, ǧ mi’z Uv`{;_;O]L5иv>^->^$;};.[t\g{gtsGxQu ^$o/'xל}es; '?n_!{v{=G3|KľCV>g[П+6-\Ѷmwu= g]=zn1ñ5OR9XSg;m&f,}Ϭi 5|}XVnOoQr0Dxc}׵wkߐd@i]VUU}=Gk/n#"[^a2άo쑹m$m߼8I$I$npĢCs.0[c"I$d0f#HLcHi$I(}$O|Qw.k/adgຊ.4X<+(î.VQqH_Wy$W}moPI$I$I$I$I$I$LK??|2 $I5pg"4!Y^}~ hdV``t;h$r,nkiWI^*=#"_0IK?*Վs^G=QI$I$I$I$I$I$TÝB4aM$I$I$IATʲ˩5k|UН$I$LA':$I$D"tI%H]g0%Q? trNgwλz>KMjtҠC#RӖ>USoͰi}oo6z.1鳠V?zoؼanFAom(bwodi< =}cG,LJpy.,j^lū!c%fl?.v}u%.;vHŷGNݿsfF=~/E`;O'x{ţ^5|d;/?WlnUYF}+YO:Vt^灢D*9ʿ}v჌CU~vgFvvl[F#+WŦܙ>giTOlvcA [fS9{gi9-NVw@ڬ>&B¯fu@?QMv0`j~>ޱ}eV7GB ;a6W*> ̼8BK~9ݪsh(O**7UԒI$I$fw ˱)X!M$I25vSi$I!tT,8}($Qw%;EcbJ.Yl Z#a$:=f4UBEyI$I$I$I$I$I$#C+YO+^I$Qn5u櫍SI21IUV/oŭcXwH[mBH<,ϳ'_loI%wA($I$I$I$I$I$grY[fG <$I$I$Qw$1%Fuc]/oԎ$I$Qz1pc x<\I$HG|P1*C*tI%V?ׂ!0Pd'IAP2گkYLuZI%ccz# lrNPLi?2~ u^XN/ُ_Px] i?|va߳Ǽھ+w8FsW}o'?^ڌu2Џ;;EC '}-:+{E91yA9%C~-}`+mO,|ף}]U1o;Vue % =i'JII$P fbSp^ 6>aw| [⼨ ]T߳=q|xh&ciks1?F9L' j%/9C&8fvnٙ/mN+f=1U݋j.mx—8Kv-v0|T~hma妒I$I$S/Z_}*RI$IGFo=[~VI$ TZ3?gI(!T}Ov[^mI(8q"={lX49i%BsV^_2wA$I$I$I$I$I$I3/׼$I&Yvך*xs|BnlsGS*I!~wY^I$=Jܓd0$͢I>ⷚI$I$I$I$I$I$UQ|SI$I$I$WWEy$$I$Y&h'I$I :o}[=Eu$I%QYEQSw 0IA7Qo4 |Z@JuNE,#Xc|w۝Eâk~tYK{lˈU~}wzQkX:%Sڋ~{} ݻ?v9-OT}'rk[^^{^[W,g^ƹQWf0cs^۾>+ ew*JixiqӼ7ҮY#=׸ܴܽwҽgV.?Gnghdz|Uv~cwm޻rf3v3]Xvgsv;y}E9oUK%o岷>~z/73 wM{|:-wlv>wӑMAPgVXLt\Fov/9\_߷Y&w!54}5W.klϳuUzKS2+]T-.Q" tY_!c3K_o739U+x>kO]5>ncܿO߆x.s^$-Ji;tOr-uUֽpvs_f( 9pfl+Ūooy$/T Q;~v'qYg|}HXI$I$Ly,Oi3dzk)$I&Q*1EynĒI$*ѕZnJIE)m"iqI(Uͽ8eXx"I✆}}"ekezI$I$I$I$I$I$g^!@,xI$L}4 <:l w Kbw:lfnW^^K]I 1m忥Hf>vߺG쭬dcz&vYjDI$I$I$I$I$I1Uެ'NI$I$I6&-Yw][b>$I$\ۍ~ʵ[RI$I AĵOI$GX3^(Z%Yn+^;$V/ڞ+#kw~cf`?ҶƼH}89v?`>wv:g J|Sqx~{j_qί֣cGٟtQ}1:/##Ncz{Cw6E"u{5u⯼w9-/Ҵgoxu@~Cs/;}ccw׊[ag;2{1zG>*lr_MOv}YQ=ݎ.qEݻTӕʴV;a'{cqGn>ـ|,z+~ɣD]om1f[(ʿ7ۚ|?_J=Cػ^ xu@ ?v>}SO?Z;{n\+б{mϪ c/V=HC̻Zq.=I+O3,A_W'2%#e%7CA!zW x/u]wrd@}~ bd}g]xfa2=:5}5}UӿzjI&NI$Y3&eFYTI$CF'pgtc{kZ$H PjϽq$(UO+RI2ܮ§WRUGTv:ڌ ?[.^_2wA$I$I$I$I$I$I3/׼$I&Xw;ެmme]=ִU~V]56Z)$-9:+i$}q>l2 $1h7zxEI$I$I$I$I$I$K>0ۑW[$I$I$L[e[c,&+iI$I%T9Um a$I$+9vI$ `tJM:J;Tnij!h&{DCO5˺cёOWcܻ[]|_?UnA}g=3=u*jѰ.w LMt X_l{ooxO=/{kV/{-{UͽWOy호g.ܻ}8uzS#\\J=:k hnn--xa^wk\cW8tZ}e{^ 9\_uG_jr{os^{wwalϩ[Lv}gxwn*v74k ?/Ut^ChD57w÷Gc]Z1X慉]S8MQ\W'eXeywsbaxƩ}'Aȯkd2w?hqk!K3O{>/FM02>}#&U}g} E{]-rZиv|MzhJ&fW| {7[$-_P LqSW،߹YsBܽwWcre;~;?aM#@Kc)vH^3azF-W[^MW{<~iq(ͤsxarxa'hG_po7q+IXe>~mXYXWbwݘ?AxqjSJi-*`ʒE1Y]}Oo*i$I*U7=:٤jI$՝i!ȴI$ʽWOJI(K7bv'U'W{}tSUt~ + (V{m0Ε’EyI$I$I$I$I$I$#C+YO+^I$SQUl)$Tp"cSYsAk`Z$PL*cmE#kA$|g &LGxG> 3s޽~3Vm ($I$I$I$I$I$cWEHSNI$I$I!AU<,l-#NI$I&r^csaNI!=aYI$ITxA(N qMYs^AG7٦ݞddO+a~/βS%,/*);zeCxa{o]&=4VrU*sasgǠES+6;o~=}խ:~vg#no6>fn{s %}}xvb}`vl^?tmiVsOaOURdח[Ɂ`ߴ_md5b7 k 8w(+vkl~Y>k(h/weƾ*/h;9Evm>}v?=rQw.Jr(M2Eb>Ʒ3Щuji$I!ϣ:˻4}~+Q$II$J.⌰^O\bJ*ugc6mUjM !% + wڮ1I"ekezI$I$I$I$I$I$g^!@,xI$Lo1u TIWS&Nܿ|}w ?I28A1Ϫ8ևgTtjI#bL|L0Ak5$I$I$I$I$I$Ly*f}KGஅ $I$I$*Wu*~Z)I$I$Pngc'tI$eV}XI$IU~5>=Òԉ).K~oޡWK>\GO;VK뛸99n?ԴB>sm꾁=g}an\<\_}}_Od ׹cvb|w^kfx]̹4}S}sMG]_d}꺮g %?m«v 0gK+>Ɍrr]徿M⳻ucV1 OX}Oڲ۔85!l}??rni|tR6ۻ^ض/ gEafxx./{g%\!:c>N1ue/;?ssgh?>͗qes??p::zwoufV]Wgn8 4W}]Onяn@V{]mvf3ݫ`v:ᮾK?/`=3 c+Ͽir}3<soyزqfAgWhV>m|@W-/'n3}Jt _icaW [t\N'y6qԅU(~J*>ҷ"\ >}_gY*x^/l}-.e^8WG<1doN lϒ8'w^υq]FEr/)W'>ڙW}g=Nj^Kw̛8X %?9}ʪ)o;+c-cl4!s?l>vߴeWw/AޙË{}5/ގ^gў~f*k+}wOb׎tZ=8'TmdR+<$I$ ;=7|gZi$Hr% cVI$*vP)$t9`:gy*yy*Igv)W}moPI$I$I$I$I$I$LK??|2 $IexOhb>Jy5eK2P꩜oE诤jt# 85@HX&܌V7>궙䈝$I$I$I$I$I$;ђeZI$I$I$a/_?#s=<NI$I.aYH'I$AsFUŠO^jI$JgECZl9a*h՝<Ƕ}kOGqg32ip^O{=ʞx__h}~;^s zq5e߿辏ڿئ>N= (wEv'Y`4.~m%8k񷝛jq%zhg6]c}] ??_f?z,:h}_WuOґ5L/3uF=|Vۿ٨+Mn= '={v'xm?e0YY2^߫꼿g\nEYO{ycxM /ﳽ a7:BgsòG۶Uƹhp2 t8kHs<'XjΫW&F5s}\6wؿc-}ld3oo k⯰긼9.v\_-|!^."5I<^H\q{q~fU|CvdaSc-:s(,A^1s5{T}٦}1wd>vX˽pIAy{_ *͙+vWVt o_h:\x.ouXþ .M.>/uzyצcCEP/fakx+Riط2k'Y+v5gcQE=1;^ݻnse2Tt+aVCogJ򬏳n?IWu?`]+^ܰ0k22Yw V~g*q讧d8ŽI$I%] ~AxVI$Bj8ush$J.Q崏[bJ/Y0XOsq+mm|J*VY5 T+_|>W$I$I$I$I$I$I&%>_yZI$ʓpȏyVTLP5?:U0§p(Rv\LWRI ysTfsu^}VIK37Oo6|QRI$I$I$I$I$I$䩶@ҴI$I$I&(n>@/ ?;[NI$I(-ߝAj!:I$HN,j[O$;lq5OUl43W[>/Uo /O]V/mwlalz/?'s>S/ڻ.uw y9/Zşd_3kp+iW{/Lwnp襙+e:>oG~ {f̣X َӕ/`4~=p6Gw`?3;޻k@t+iX+@)$啙{vS/eV+A4/oco龟nOr=֋F/ sgk̾建#j6*{y;مʢrj5cpX*wa}}&<}?{D ~Ӱ7I$@څX񷞪I$K.{-mjg%$\@T{a7l~ky8V:vGGI10Wf4U i/>g[+I$I$I$I$I$I$? g<{I$eEft ښI [[,cNU>;U6W=HC)m!z+ $ eg#_娒K+HYhDI$I$I$I$I$I$<{rOWZ I$I$I!4Uc{ytI$3v!' I$Hꃊ̖OVHYYXz+`C;Yp{|(U?,c.o riWaͥz_qYkf>K,n8ɇi}u۾zv`nIܻ~ 7}ݍv;ZYd~w_{Tvll6RHp( O4|rVa]Jkh<]SduX6gT^ 5llW?ۨomzdɯ8H^{k0us!o{x_oOv{qoq-57~zXQU?_nA<uc%Ӎo.Kw._1g߾̞ygr9Uv]%r{+mN<_cvϲ׏UV%ggi:GQisEߪp^osׂGJV^.8ﵵ773kK""BVV6%F܋El\Oh;.S)Ϊ$鴆r)m?CsmaUwwC*ϴ/2ǵq+C.MEK%Aɺx-`yI}_uS; J\runkyBw9 8y,廲6/}vfu.k?zciܾ}om%zFGtĹe2撦2Sk>)sL, ;9q0/_(+ڸipgQ]Ǐo#"c]ԊﻻwdQ_Oic*}"(i@e=;5[__?fg?Z}pbц*Z9K1߰f-J'|n?kw[3%RI$ =59_}$Qz}S?QZbJ.;p=g5wbUwg'VQp]W[';SH/;^I$I$I$I$I$I$e ?kI$,UͺL`.c­ڱ[y$]!W3yrWI5켻Le$%v-{OmWdGI$I$I$I$I$I$;KQC i$I$I$b.j%Y__}jd$I$Y9xؙ{:ᝫB+Ȕk_(NN%^zV&y(:ګ|Wk-/sJWNs=;7^ŁMi{\ެ=I_ ;c>,{xYm}[w٦_s֗vyc;1+1;[=PY=dTQ:u{'gvFC ú}zo.]3ЬzgoX[kȮޮHFZ+ƥWG!਑eY~ch?7Cpl~b`_ާx88u^۱m5hVUMusH^ }:k ?^k'm> Uo.?w*}_ݾMpYu U٫E-.wW&k]~Ev 'w9?^66-O *_o/mD~wzq|kۻ?>Jk! >v|j_ xjG;hJ}ߑ]_i;s :وi<.輟nb /1%a;_Ͼ&s]eޣl_Pk(Qw Ƃn!yW|Mokriop>~}eMN OUozbWÖv_i[1+.ls1{=VMg2}vżn*MoI4‘I*=ӷb\Gd2k5j{X\a]߾A܃݉N5g~Wv'q3pxn/{xf+ZxwG?W*W Xv\'WO {NkS3wϸagɣ^{_W{)EVg79t*I$,v;9I&rfx5OUyI(W$I$I$I$I$I$I&%>_yZI$X߉_6y߻rʫ?kdx,_f_ 7.7ٌ\^ۜ)G~G n߭z{wڿa[OTnį=Awi.VdL>S(./o)|^ʽ@\*SJOrvWv5yq Z)#ӟߪŗ9!}_]`c1ͦ̓bM-h+ k 7 nw>ۻf>VE|VöO_X<b@0gdSϧwQ}Ϋ'W,e=ͅwR,گf({lwVG}UsZDJD{ay7Z^7{_tyfw5}c|1eCTN;پYjw{XܘK>-y?KUY~X>kٲ~S(SoHYj~߳֜,(CcvM{]eXێ^p\Ըck'}fPhVΒ=߶lݸKi;\VgV;/1-srrF`kg|e{llO"D#}}A?+~h ~YoLWϭҧ;]}xcGomцҤHC#Ѫ9+A:I(Su9|)$y*ybێYVq[[(ck*J%V4ևmVZ^_2wA$I$I$I$I$I$I3/׼$I&k4;?}3۝k {E쏿v>Kl05b>owf U`ᗎ]Vx/-}!c~3 ~HOC5i>eR.7oGc5.MZ=6zYNŌiG4=Β$4f. hvLJGys'n Kc;il=JS=y._+)O W*00E.âr >S!%riƧf;4i\th/dv.9R?v96}X]1k'kUPem G ' $dI:IK?8sf~| =?j}XU`V Z:ni'L Iqf1>-^%g?k'Mj~|j}m Jdr-[)]a=ΰ݄V`XZ)ΥǛ/Cc_UqvU~**hv95nzGϰaߜCg[6nUl9wo__v/ֱcn2ez.xo?=ww( l;{GnKCMWO[NY~%^gud1]Ƅs!Rܚ7<{ؿ'ov./Nf^%^Fii72=4KGuh1rc?{7ÏFp+~P'uI$v{No9j$J8xDbI%nsv>OGZǯk͂g*m̰oUj$ $I$I$I$I$I$IxGWV$I2j`oXjIlSSh%R=ھMWrI$"6߾-w~h۰ ү$y϶PXt<I$I$I$I$I$I$UmNg4I$I$I7E *,MY&7!ഓba M]h{eXr}VK[_<~-+øC@֗Cؿŗ}us{_-oGntdoݚr˭{>k;{ʦwixu}W}5{Łq-;,ed힫U}-{U߳%27/u_fNV2kf*%߉Kj-V]LcY B*C4ֻi-[^1wwݛrMV}f&.C\-of_g5mw }xN?FJٿ_hvM?wz/@5);7oc+v}*q<@Dy4l!phŗm* :0O}L|p⴯\ƑW3avNɊgi^WƧgWݝ*omËe K;({c0+=Ն}Ε߱ӌ8C+g r~g=2Q$I$I$I$H)OœJtН$Tn[i)`sDQpِZ⹊?٬nrٍL_h;mϣOAvw pi~Cxjh;Up?@/f~mNo Wٯ?i1޾Ni\jcD+}[i?mOGGU}76kxx N#2Ɏ٭u[%Vv\8ZW)okk_B'AͰzl<d3&[LXg&4SeͱKoVskuJ+e;j߲gjVaGdS \s}]OuԎK-;"2}i+U{6ۿ7בUYf}~ҽWC*brq+ZNY ;Wn.ȡ֏7c}84ee'"VCVn5m}~hoXI$z*"JrRIET9XgCRLy*OfgXZWZ"ekezI$I$I$I$I$I$g^!@,xI$Lc軏5M$ʵU;v.}V?KZH]P~Vյٿ}?|8>p~I#bv|vQX\KV9:I$I$I$I$I$I&<&}G4a$I$I$I $ۓmq+iPϲ~;m#A:{Vvp/ndy`/a* 5g-cBqƦ3;4.^ ݌cqkg]Q:$'.X_jYm{94 S4{x 5ۻfgt %璟i9׸’]Yf5XK5uϵݲqC[#6Wa;;oYGC5~_@+`vzqQۨ} lW34>6c?n/^Eܾa +GSb1?r)^S>^Wm(":iNG4*sﳬ.6˙p?{(0DZ-1[d 30)䱎.Qʿ?]kW=*:W7?=vq_jr}OW{/A5NįK_bM6F ;)ౣ Z"P^㾿!_I$I$I$I$I$I$L3 _K9+$Ugbcx[^|Ƨe۵O,ޗ}'Qrx9 >`w^uvXlRw~_dp 5>ّeY'j͘kdz[?fN-Ֆ-ԭ myVy]͹:FX8XtuPC~+Xժ,܏?e8m~;xG>*/wWv(mUhw%l,׏O}8]=-#Cc@dOWd_VeQw<܋;fO/ok7 ɇ#90]M]ʧ, _񯇁N+=,^gjUk-6G%[ |וU~ܓӏ a;_}9NnS8-w0O)!t$f3[G)$|v}ίǭVLJj$ $I$I$I$I$I$IxGWV$HYvf3E]͓$!y! '<1ׅYI%~Wtf'I rtW;<W<IK_ FDs[II$I$I$I$I$I1Uf[*SI$I$I$C"Vns㓆ʜ8kSTK/PJws9YLߤ>}Ҿgx,ւu+*3 cUf;_oYԭ}qBwpW|»uߣ~ayfQ޾vͣޜף?j{{3}: 5VD8[v[#K2VE`q8Bo1m_g;4džW~׉M=zc}^CZa~S߻6 5puW}=6k`rG\kYo&<_hq5fWw%U;[dq 7U [-o; Ffgmu9Lȏ Yx5ί +^ͭr4S}OG >@aH}yw2HRvU'߾qÔ;.gﲿñvmyv`ַ"֓pez&p4v%N% ]I$I$I$I$I$I$LV榒I8'W̟hy3}ؔX.Ű092;zVw z"0ݻ/nƶX5khs| V>68/?;gyݘJg3nϵlЎe% <8[C<ϴ_⛳w Is,w@Ggh\ ;.w=1=*Ǻ?g~vkȦ;ݵrXơV%] c69h}1ꭤ9bw[yՇ@vcmsN%ĤUOB$T;>ĭN3=_#&T/˪ʪO>Sz<,_}]Mkws]5T*-'4K?ǟx4p]߸HmqO!}y?ioc8 ^;cq& .o{y8}!+}_id(iB?`\geRZ(g> ׿ŧxsݏ!C߲]LXn/!h@D|ŋо޾}g"f5ݜv?K_2qCEjM0 >E{ؿrgp_ffn^}e乾(~w,r}V0gfsk7Sip}MlO^,š>4w_TbeU`\ӭ-cV(k*o l oGCpTũ:\2gOE^5 .)Z)jq+f_{I$I$I$I$I$I$ά?v{RI$\Az?2َ9k2~PIfQ 4۾ر[ ; ?O,.ڎc}⥝.~vL212F#Uh>vKA]/(pz㹃uX63=^BڎoȶcCkǑU0h˥8Lg@bi43x2/ϟ]>K_v57!<\r;V4ED*V~}̘RIEܖwvϯb\Ѽռ ˀ + (PqU)$W}moPI$I$I$I$I$I$LK?|2)$I,>_fLmbl}*?g=*ZyZ$=#x8A$Y'd}DqK3,#G4QRI$I$I$I$I$I$ǒ2*u[i i$I$I$cRæ{k+}M{0ë/a]LꣲK%'wnGrpuU+sc}86a2/pC{e8/w5* s k̾*s͛> ??l^ޛcw\@K>nCouvidߙn\ohh>Xɗn(Xb?sO'` 703os9^yPO}?f+-w"us&|؞OiŤ:7 ~Ɉadv?_f~bU"T~}))X# gucOW9wm"a]`|/S= #wf3m(1{ݾf=I;2?߿m3Gpc0OGn*\#.?Wa(KvN{ _תo_U#ꕧ#y#:>GֽtAZ&GpbV%e[{ݽ8A[m}, )$*vpcU}[ rٟV x:tB}`IJQt6oks#B6ý}4`e[|B\;';2W@:^'ٛ;q<[g4ʮm|.!Z}˪gzq(NVg|흽?5Uuy8U][xX I8IZEyI$I$I$I$0{cs݃r;S>k~.T?O[ݹ]kX=+}rsUu~d^s1|ek{he~3 ` =ӷe5Z%?>_yZI${ͺt)+xg5_3*2;KA$zNc2}O{5i$ ꃉrz \I#s}?}{t j"I$I$I$I$I$I$ܕaJ;TI$I$I$ǒN^&&3o_gOw{[ɣPǗs+=^܎_|}5>Ysg{)T<>)\۟fY" moĘEQI/} okGvKkj`(Cr{5띏`v<KBՆ~i*FSlg/W=V'w$oKt9L%_T(eOI(95I%hvn5zq<ֻyNE;E9&r&%W}71_I$I$I$I$I$I$L3?3VVšI$I$d%@+ǓHUZ+' WOA1\;ud3,=/oeeUù{ǚ5}LK=+'lŭUSC]B1=й}^kc,e_Ϥ\zAEy> Ow'֞|=3}ʷ^?S1ⷼ~k*rQkPM!ƚ.;v>wdzBWfjbRIAǢhDJ(cI ̻IJB ?a݃e.↞J{'>?yqgacg;Ogw|'kg_@Ig5]H..pwG/ 3{wzQgQ>֮fc}V_qȯ%{_{| pRQ%Iؕ/2ފ|ReM%/>g[+I$I$I$I$:;Ol#㸱ٗ \I0'pq1]HQ;!~(]W{۴adj=KA$ӉVVIOj5D$$I$Nd铤dMw>$I:d$4 5]v{q췂6ھw.Pl\J?#>f+Gi2(G흾ݎ)CB9eGj;۟vE<0z}Gc[^ھ{}^/wNv]wE[c;pa|X>,f\I(JPt_]J4m:I$W}@r"I:eΈ䭎IQ+7v@OoҒJ:U>;|{$ e;zEkE2I'L$I$I$I$LO*܉SI:IN$A/v>Q%%fN]eomYUm-O@K,,)5G"~vO=c4_ooh1G5C؏ݯF&VK/џS}eme8%p{ %UB[i ]ÿ]io_\\Ӽw.ŧ%6d5yց.AgN>|N=O{x Wr>I==w6-a\G > /ǵ7{Z~&Lɭ֚OԼoe}oX/?bvN{_.d{kȍso>z>y]G/~{'_ wu3.a0 x dx,*'j>2Gi=쵸]V[Fq\T} qWK4;}/NK}JcowD[̴XcxS_k_;j*I}moPI$I$I$I$\;OϧYX։~[},;qc~Pۜ7;=?w*(n7;]fp-S<>>+ OsWO&h?vu _==wk֦?gsr;s_[h^!&jQvnEx7:gOi[E?~ڻۻlqͫ'ӎ?JYwH>!"|{s?7ڙ#LHfs!_`meݷ.)sa9h>*E $\oT;/͆W%)`Ae ?f.Gk9^gj?p$x$rp>09e`>ے. p&*d""JbONspSo'"7H%|q6&t-d$6C 5sx!0s%' ySJ|ґ1)`< 7yۯ;]y89\$i|;wuz-gu;03Ywxw-lJ>~95wDܪ:GG]l^hs9z9um8 Is#];ױK$ױc3\rp?)qx~&DȏDΓJBiRc M{$8OP=% YQ(LKG2b3p3npN \s:O uKPH9 K\cTFMKz[p;9A$ O#)LJAG:A4%+ `7z/*]wmhsiv{{ko x=/t⮂c3Zbe:U[?{ 8vN˱}]hZ㧺a~}T;?J3̬[Zk(e7}7'6o)Z?g{kjw f\xwecivخ2nj{}O㨫Uf#݌݇5gqp>H_w'oRc8Z|;ȮOwheڭA2şڼ ]f}2v\[8sZWxZGRcך}<Wc{_xuc!yo|=vOsXwO]͞2^^l7xYwU.}]#8wS:kk~%Gx^g1ϵgV?i$I$I$I$I֗8^!`}ufp<5?v Uʭ{k/}jPΧ^U??'/A_;WOۃU|x޽G[N?ϰewwtu|\NJ??=bt`d{, znV7x?q}8z ZZ>&?fgp30}˶?L_{{mc(|sjUuskIjݚく\Iiu|3;kq^ֶ6<0Mshݎ۱S62YSGhە*6n8q~ yTw$Wfd%GwK\ͲƏF b;V;v˕}8:vz;xZ㥅x̛mo  yGt}׺O{z}1~FpQ˝^ۿGds+6Wmye{]9cr|2rec= UxϹp;=y8GXDaIFǒ.Fr1#Β_*x;MJlgw@[̦=d_?E~k9tRݶYFz"_;-py>8ޕ-39Ǭ,z'Wytp*ݹTF@T;i?3ZL_r8/4hoTN٩yv9Rݔw{cCpFU1E8'18r4w:pqOUp<8v:{w<Ի?i=jhkϰLppۇq{*xu%)cz=UfSΏ\ 3 zVo QgWr]tEPz"?7+7%9"8#=FT1sIz qr.<3`_{,sH=-YvG6AGf9y<N哗8mDn6u!y*qfkELc77q( *9جq:CƪpytS[sdj}w|z*V* z]W1ްܻe}Ɗj}gUE aK'PRɣ*( QXƸ `mbRyݏ}LIUboi2dg-}X]gr7j^,.žpx\\,tFš8#*5bzVL?:]bWUd vhsM<;Ws=G591f5GgG?+1pp4{o.Qϰ+YU|?j-vF%_=gnqwٯϧuk}r-so%g?=+& y'O ye{:홟fXy&lyL>^'mv'sV?tnf3ꍮG;Mvr q}:~vFx~*EѦzB;8knu<-[}`}=.t]6.Wtꬎ)8gPOmƻWys88AҰ{c?}|8DOfxc;j0]DZ;~p^_R1^]ͅ~}%WܲdL1on]ؽc[gf5\S4. ߴb,d{FOg+W۽c*7v;pX#}}?w b?џo w_tV5͟}흏/ewsW.UOu,?f?k{⵿YnI$I$I$I$^m.^5!ߕ@,yQ$S!4u /z+-L[Sp2as6v*6qOYϻ g\'~w~S{}NxT N9=[\o;/!է.}K 'v/`&g@'~OZWsbvWsTs{o5}f\ W] $7Uk?$L8ѭ(5uMKJ@BfH'܂q,H Qp2*gzož=7U3Yr!\#Ii2~Z9S!8A`'d"ptSjEB )Tcs>4&Tϒg:J%.BDi.jNѭgiTSA(O˜}EUf kv@qtV;Ne1bQ)vH ;AMIDIg}+P  t3BbNU,oڭlR/q恑F@ᶶ?Xv~ `i>Y~;\|k 5r치yQiGw`6.]]#|T*܀펊MsQ^ڰ{\7T ?ͳt ȝ_2mұylC\o0߂>̫Z= |!ֹ|UL~Ƀnןj}=;#=ߝK|~ˬH<+{WbtX%}!:I$I$I$I${'V/yssGU|_ Bt$$$'Lt$tI$Щzs\ثV6@D$d&)'I2Wk~6dIbwn1sq-zT$fQl<~3^#w^ۘ{ޘ0K<a!}X!t5ʫk+hc xGWV$I%LR-x+MRI2 9B%U{=g])rI$?l{z ETWuf:}p?ⴒLy,ovno3)[l4$I$I$I$I$"`%+ٙ?c Ǽ̮vO3ho9YXMŭ}ggX~c/>}Ek8JSIM(bt1+'@{=?WؿnN[yz {ڟmoS5{ٚMuf;a~bFbK]94۶Qcc`2g__o"}1oST'cgcYݯ!}uvc8+k:41WI$f9ZI$IQ{> (*OIQr?y?입^N dtWR[1JI$I$I$I$I$I$ΪǠ抒I$I$I$UqOa$I$I1YSOEx)J%8?ݿ_7ysN5S5&v~v7߱bwl .UivC{fpmiһfhAM-J/,E7o]ᅪRQ$EiY$ ╟2{]#- |YIeY9꯴hI$I$I$I$I2,ܱ7nvVCya_^;G4WGM^+>̢\x\3_W@pּwϰj}uL:M?WceQW/axYn0-Y pEٵ EN>.7_}u{[qVp]؏[~^G0?Yw=3;^=Mhi>wܪW㷞0kc~S(-h3bW}[n/4,nU}9ߕK2&m|ܳۏsm}K j<#t;d3֩$I$ ;%޻xL]I$IW, R2BtJkkAu:J%Vǯ h'IFVo ;g/y&(Py*x{ZII$I$I$I$I$I$ʳr8]P9$I$I$I!8fe$I$c0]U;bI$V@GN^{=!t =w`Ϩ2!4mxrh'sݢ ݽvgu_c>\7.+u"p.}zy1m/Z¯/%awګtzG׾g.}.iJ㋜/_ls22xG-AF~[v^HI36߽mM$I$7r(/o +i$I*'sSNUEuv"JI(dwwq8ޖQlwy)$`mR׿9**U'+>p'I$I$I$I$I$I$,]]CvAhuSI$I$I$Qr|UI$I$Vz 42.g뭱⦒I$©G>~4UI.Sg. ;K؜Og%keoUF}NrN~6lNag9jPxySB~U>`j-/%Y U=Q{qX_y̳mY]SlaHRrq1U|~3)d-W/'28^[>2El!Rʪgo:^]1hol^z RI$I$I$I$I$I$#C+YO+^I$ܬgf;?Ú"$U]]66\ x}3Sc~*G`Ef`̭к<M7踾yvy|G{w]N/v5/{Oc.W^ ( mT;_}]Ļp?#A5Fţ ɫS5wyvwwmUœG7 _fOݲo̳x} V%Bv<pO_}+e;ھa _GQ[)1DIE5Y>7Z-䦒I$ɓC3[I$~X:HoU_G׫i:JT;#I$7e'ww^F7x3Y躸5I$I$I$I$I$I$SC1JI$I$I$3Jnj=x+$I$IVnyU<[鶣F| "I&C_+77?ۏf'+G2p?o7S!¼;N=^tNUYER⽋}b\4Q%Nb8({vڲ{[0֒ W>m.! ؟NxsWww*,w1F} Qp}lC?SݻvBagopx*e>տgw >S^+eՕ;w_ji+=g[+I$I$I$I$I$I$? g<{I$K9[jSI$7wUvSq$ο$w*7$=W$zq65l7zB}DI$I$I$I$I$b]]o Hi_3cMokr EA7/Eld̥ Q?{oAM~cax;g˫gs ??c=*Mgǒi0>ǵ*?jI%_byn't ؝;6iǂ_n~ϳe?*_kfw/K}{U^>#-I_5}x^N%pkg5٫#@Iu?x5pU8NI$|;q>\I$IٔiQT,± =^:+㒒J%e|cGq~'ş Pl)$UA[\ W'ޗHWI$I$I$I$I$I$U66 "I$I$I$0ظBI$I$es3ˢ|_V{UiI$De溞tKe7 ;3}{|W;x,rhooyJ>GgܟSq> 7݆fvRW"ce8mĩc*-}?V42}ޫ'.Ɵo۾ٚbW5wӇvhV,hf/cl&if@+ ]G}Sm?Z\׀}!Z{GOe!Nƻ>4ҼekezI$I$I$I$I$I$g^!@,xI$IS Nxg-SI$+leu=Z$}Sw|VI!B *]_I$w*k=߂I#s3s~e?[ldh$I$I$I$I$Kurݛx]2gxϙcnn#;ۙ~/?O]n}n1lX_?a{N"EAp}i WUx~gϴepOf_gMwR>*q} ٻl/}UԷy8?iz6Ccټ?Q@0C|rIG;h zEsww߸j>ݏp@?Wj|XYaیTH:J.Yv{g!¿ZI$H[C*kFe$I%Fgz0$7sUz6R (9gw<_C Mqoi GH鐫Qf¾I$I$I$I$I$I$ί &} G$I$I$IV$I$IWrϣ*Z}U)$I$g.or9`I$JڻvkP{Xm,hbLܷwGO^g}S_}8Ld>s7 q<(8|},[uܢBB_傤+YEbWJU~+_a|Gdeb°w|jyf8CE큍Vwc77[fwJ g^q;xw :. ?/~rO7\],kOZYم%tX6*dz2wE$I$I$I$I$I$I3/׼$I&<{1Ȟ}঒d+8 N[0@>+E$cAWL;XI$';_p9?x4zVp8-Y=22=]UtI$I$I$I2rC]eV 4^m^?t3ܳ1SǞ@sGqe?kgX)|ax&K:|6c8>8 wj[m{A#,ڻÉWhcيʇr%ueQk( `$^,uOħ %\O]cYE{3N͘po#`*=ZO?;Yθg{/hT pG{^i2&?avxNA}ϽwWez/Wӑ],c69so3cw`j/jՐMӸ8XT6YNI1C9zUI$@cw9ꭤI$z\"q%feNSZK M:J%W-^`OUe$n*-9ΰ4 *HONTR2OWtI$I$I$I$I$I2]3=Eo戒I$I$I$FPnU I$I$wEe sl)$I&P<:=ՁZ $H&2 P<}Yֆ>?Fk_I߻'t/Ʊ e,}}j6/g2$V׹O_`:5MC.N}7^[Kl$iڟw뭗U7|VoڬvOƥZ?F:y/niy+3o%ڭixPhc0Yg/~NE}s޾\?KЅ?i}ٵtI$I$I$I$I$LK??|2 $IK;~c;řx&riB"I kܨш jg&t b ֱzP%SVexjIKef2MgVĩ'I$I$I$I$TU8xp96h3l8rť"cU7[3 5W.pe]3+ҳz.Hv+w q$Xy\W>/_nꢷqp/~8bSC+Uz+5\&x[]3h~l|]KMWdWS9[}; xWmd+={ja]xNcO?%ُf[E/[hR^k3?/hĻo6`w}ٹs"] L^ߎ|ju 82[#f^&;̯>,ߵ_jN&%n/k[m{W?WaTÐyo54IEw6QڤI$UczVI$JX88cHh:J%WvD?5Y%,W3D|_%$V%_m=`"Υ]Z3툅}$I$I$I$I$I$I2̋_PI$I$I$-+)$I$I_r3& o%4I$I$d=窲I$V{{}?$MGiwӃ1NU!=]Y{ݎK>zg?ڻ] eihGT?M4h޳wv?^X#?ڱnv3Zw,3=`["Jp~.1#~f֯Oi^_2ŕ]}GΫ>}e{)ͺBzn_B}Ź?Ec;e[Xc]h%sibݺ*e7><l;vC,7'(mmk F>R{{'Up50椒I$I$I$I$I$IxGWV$I2['Wbxa U^os\ 赒I 9MzVIvfae>h|t*IKdF/_I$I$I$I(/Vg!7*$zqg lqz}OVRΟa6_A%c}^|׸zU-\)|<5SbaĀ:I$=~;#՚+RI$I/%i$I%M 8=*TӤjǮsqV$(8T5 8,]%ه\?"L3T\}+E$I$I$I$I$I$I%Bߟe&ѧ+}QI$I$I$܂hm=I$I$?3d[ﭯ "I$Hd_s%VI$B`'Uh a<NlmnQ\hx43컍ӎ L~30F]e{ou͜x--Ykvϳk]oJ?0leH~jd\ۿo+ xoaG|?}뵎ɏ]v^)XW#g:@K3o+re}T$I$I$I$I$I$? g<{I$Kw{1A7+Ui&UO 0\!R?걙Y$@en~H+$:]8Yi$hn|S"tI$I$I$Pz,t/;te{3K\s{/jF'c9q/^_c1vSw~r.Ȱ1OvWwfW{V^g{b=UL*?wU}ojGEo6ۅE{W7ws܄T2>K_nr,<y?Ojcow}8f&Uxc?n/zO d1chYw.ލ،{okucW),;>NCʘO%u>nOecq/E33{'v2f3G-{.EyBon]=o>gZt$݅Ooe]I$I3,c\]-SI$I ܊۲/6TkI$e QN9+t\ W]~*RIE6Ge'aY?9_/o'Yl5t^ܚŕc&WknuWVS\z/mb{[MǭWB1kKtN 3v.×Cn輣>۾LzkYu::^۾v^ז- S?I$I$I$I$I$IxGWV$I7E^M~uSI2 @U;6Uu腤J8*wtfOECIш_47//~e|;]Y,uVWȾk{^z)nN}z/Rco V[xPju6y֏/bܼ ſ+U}d8?spNz0֒p^i3>޳0Ko_T?a],Vڤ0_ȯ~Ot})uytT{wؾ-)t|~>}՜1Ww{# _yZI$ʷ(;TL}*l{cgj-SXlT-!i$s1wr=n'K?IK vl,[ EI$I$I$I%YE\G̎)k\c벪K?ښ{+vGwC0{Q`Ɯ Gߝ/t߮N?m _`nW_^io׾~WH9-ӊ8Oo'㒚H >0uqg0߲a{w٬^}ٴBu\yks^2+v?OEw\'qS}WRֈhEI7E5RX YV?ݿ|lĜ|k)BI$J/jηwi7I$HF:ev}QI$T7 xHJʒt-6qW$(K7!ޗw^ (9enwV+\&pCYyNjI$I$I$I$I$I$K>6g!/wԭ;$I$I$IAUEWI$I$b[r*5Y I$HP'e<Ÿn-c|VI$ Wx#I%ExvfÒ!I$b}ݱNUw߁F3Cl3++wEN;h~}]@1Y^3X0)ͽ#(}McڼkK٭-ϱ^ܬ|>Tkgc}8$I$I$Y_i{lߣxxoI$I$I$LK??|2 $Ikh{uZ i&(!8H])s؃ I!ICc;(eւI g\LG_qkZ$y,}5j"I$I$I$I? QdOk̾wܮI"d Wc wz8=ʞ,0Jq;F;}W `W?>{/97'&ɥ?d}~'x5v:geܕ1]= eM$Qr X`N?{?Ɠ,l5{6]4S]#&酿uk6~MUֳaI$=,m42OeI$J/UGT#M$I$/u4@몼I$ jd:m]o%${t}7pհ9$GIUFS~ihW:$t4cU$I$I$I$I$I$e\cd|Qz$I$I$I!WI$I$,N20q7 9QI$!~kkLl+i$H.^aWI2sUO 9)$;6v^Ǔվ˪ĮcD9*P=>YW=7W۱;kg_d}G_lK, e-0r1Gq}CG/>=WGtq>6W>*MRI$I3\s%rc}A&/Ƹ>:-}d#QeqWl6m_xCL/RI$I$I$? g<{I$eQXvHoOUh)$rݢmo8Ng:/wpes^jJ.Y˨sOƭ2ŁVunK*۵wGceԥo g?s5?ڏ_c?.;w~M?/l?lmAUO.i$>Ng)ؗj9{TՂw_qeY7xh+`~*2MŮ8'aCYO?[={G!$I$I$I3/׼$Iʕu}.@M$e/k {onX.wj$A|C?a$t%Q#z/rI%}L+E7\I$I$I$}W1N{g؏_reKVϷwn:Z\++{vy>,5鹸=g[P5#~0S;+>6v?ۛCleYf~yyiI$I$I1%5>k 4dI$g,`-]i3I$I ⋛>VI$Ulm<^YP7-(8O>V$(e;{;)֫SU18I$I$I$I$I$I$Qs+`h$I$I$H|&oIRI$I$*cƲdž3X i$Ick3{uIx-dI$ e]5u$Qw%I9sLVJlgwׂr=_vbWw gXIE˫K+gbwѫQI$`ignf2$V,9qpu$|,l<Ē<e¿/0c7>4$I$I$iMļb`+Vy^l܍uXt_DozLpZ^tU`lv'I$I$I$<^jp7+$I$J.䪳 oh)$I$ϊV[ I$W_`EpQo<*u{]߻ϊ 'PrFu*HP `b䷸zCҎKA$I$I$I$I$I$I%J<ZI$I$I$qrAmi$I$IEew:U*ہ=VtI$.UeysrI$y*uS;lvբI(U~OSi;$JeŤ,DI1T4+a:[s^+0~l_]X=Oƽo<G۠$I$W-^P}~'J{/ۮgw#ro|k^ګϱdebŚ}-$I$I$I&%>_yZI$ʛ.ys?5Z i&(:=3C?uƢE/%x-tA墫?JI(Upn´kWRHX+/ѡ:}[I$I$I$ܹhoh]bd^&Ȼ }p:kצ rö۝vW5rȮv GhCbc!z IǏ)$I$I$I$ UlLJsoȯ[~y$$I$sr{Q~Z i$I!,k UI$W~3Q J*t*γ8+JY׷`wCC3ⴛI$2V]t!i3k'CTܿIwcI$I$I$I$I$I*?{}>?3Ǫ2I$I$I$8ŠqSYI$I$L{h̢JLֵTI$C坏ݭA#ժI$@ ~Xy+$O MgI2]\q*.x#c:QF*J.UƥֲJT/0;^ I$I$Xk;E֗_岒I$I$I$e ?kI$,u~ZmSI2`>*ªlnkxcj$U6+$Hx= q ]$f!\ çâ֢I$I$I Cx76,z< ǯ}yjc`STD1X4c}ceǎ;=ͱ߾o˸xx/hæ&w%U'R=H'I$I$I$ .=̺c+'I$I%T[^O\/ I$ByU;nKr:?I$Bs1)6(8Q̀Cb;-^%i7aI%mgN[{_۠ZA"OUJ]=>֒I$I$I$I$I$I$d/V?r"I$I$I$m9$I$ƾ܊s $I&C>JC3s8{BI$Cם=ؾZ $A} I%rY:Pyʻꦌ:&VQr0j$ $I*.nvmIkȳ_s9̻m 9|v`;ʾ>Ȱ§2'x mqH*n6z"=Cy.oV>n{XןhB>I$I$I2}g,k26ax˧}2MoP÷^ˢ[M/ q8x^)e2:w6w8(ӰW+2SxI$Xl>Qgdw a?n>um>[[?Ⱦc[45݃b&:l;|)V h+~T{]@r|}xfS|sa}Uufk>ExoWV$I2ϯx PtPmTƕ2sRZ)$e;#{8jI%s#+mH$I&I$^</MPkkrX).:6oG,|>Wa#%nM%-9xEiG[\lzv\Og/#d<2w` `t\t7-Ȃ}D4$Id(*8]͙=# +A$$I&L\>\IӤI!8 ʯV5t'IW}n6 NNϽ9Ng,+'ge:yPUy+A3Ȕ nOtWd&NI$I$I$I$R3,%ZM:I$I&N:d26>N:I&I$a^_l}.y0SI2t(;+vI`sVI:d0 V&0uSjI$Uyi7JI(?mL.n2:\a/3p$J^Et[d^a2wA$I%zgۏs2`'x.;lw?ڢ/ik[nf45ɭn J_ueV3; ՚>LxI$NAUQ[ŗgewcwiۏv]lÞ՞{eqߝ]C_<-i2Y}߇O+\{]=Y.P47_v?8O/U}aĩs/Xݙf^W!ߕ@,yB$2Teܔ|yrnaȃUJq+:uAĢ gw%JT|j!z{Ti*J$sU~ۜZ[黇jQy<:湯e2h3$d 0>/\}_AL*A{aܤ)Jm["T$k, 0;pʳ}mS`+#X۸I$>Q~¾70hg A^E -K0?1 go #us]>zws{s˚C\'QʒϩQH#N!)Ҕ΂S O%3Ymas>(!1 @e4mFTPX2|[WNLJ[RP;*8PTY)R2iUH9>NS$d5 GP ӒTGWX7yF34$n{T\m+ҤCV9q79t 5=vBQ$u5;(2+̿_|>W$I$)W+zZ \OtId}wJZ%xw-tI%Ѯo*:kY+#g@"_.wٿ# tvw3Ew.xS~q`/؞#_w쯞1c5TAG?^S]q~ \Z:R 3<| {30|[K߿ܢ&CؽV?4*d=eU,sZg]d,&R"xʐmݟj9Bw?PVďsPjRl(K)ڷU``{ڳ{_tӌGp<pN_l-?vj{x>y?&ewgy}ev,WSCn,dW>;􁮦l,gn-9OgN[78?sp^i܇lȸ-tx S2UΉYXxU0g[kJ,~wI r>&л]=ն}*^J^NOl㬟#vڻosR¯=q3:YܿWgi]]zfdח+Rp;"= ߑ'V?u}֮f^7}kZN:~Ouus.s;`1>@W6;w7uP̯EmPncp.t߸*5w29+ln[wQ 9/thv[Y'O K5Owe~1ްV53kuOH5"w 3/,wca5z>ΩY5Wos85.K.[C/]_q-ki7q>j_O9~h?|6ner^ڽ\SnUyh~3+:-ԩ˽HWc2dfDY뙓Ccn˸ςj7ߣ =߼}rU}ƿ}~.Wp0槆gaTnO3<3j Le8o"\!gvHmvpƊUfq*Wܿz4ݺFSn_ron-Nw介#{D-Ͼ7mf_:*k2?M܃#!37|4.P˫2Prq1n=9>M]N J;CClz?9{sNKۆ}4O-BBzPfWX5Br>a_fpͼ#?$?WsgsvCJ+_:${Q#;C+N圧;=n jY,ȑM̞ ]ʼ C3U{Wq+ڞj~gƧ_q86댢כzES&Tyf{TwD<62=wKƒ*M߽&Z7O3{7o#mh;' mV<ܶxtSŮ盌ڝXI> }OY8B{[\~}Ae Up+#nm7U]g[^ԒI$7i9zuq8O?RkkK'!֗NCc_QMi)7>"yp$K?h~XMN+=ɝ>&l/##E}dO/wk?}zWw+;}gw!dϿ ƿI_;}cq!C%}*+5=_yZ 'I2pקjI$cx1 lv-OkUĒB|cKo6{ʼH~_k `[U1q*ω_2NVxUIi\iǶvLwp"8UO~Gf=wdq7pىڛ׍w޾9`EamKCXOH]4 =W=g#~wl|]NOb<7ָ8N\řQx}xg-{nM.xk{_ϲbpL,h2O_bފϫ\W/ uy%kw*WCO ohof,}Xxϊ戒tɊ&4M$)$I$IBH&AU(:o<)NdSsrZf’d$Ú?x(VI$W1%xTC1(EqGՆI:++v~^G`ĕߥ:J$U;sjLiU_}1¼ILI$$$I$2I$uA̷99U/r"I$I$I$2Y7ܬ$I$I&{oǺo[?RTI$RW5N$NOq1n*IrI3*VgW^[i-_yZI$ʀw]L{GUui$?oQ|UH~J5ՙw>>e_8?;ں;>OsHm/ks/SiunGwuVh/`xg,?:+{wj]uo|dӣ}okӈiӃL}?h1{en{K]ķ{ ;WO?ďlo漏^Kvy~_n#K/3w|vQpK F?We(m~մv$I$I&&PS׏~H{:+:I$I$ܝܟOZ,䤒I$ _vVI$Um~gQQw5Xͻt+a:J$,jԱ_8O59$T Y|r$sUZ]G A4'JI$I$I$L'I2tLWK_P:Cji'I$I$L 0Vr'~ NI$dw>N~n=u&@o"I$Qq}}l>L$JyMQYI:b!TvCkj5˿Y\bJ. 3X n;-EIܕ7c56/0;^I$I.+ce͕;Go{o ˙+{=ܩw}σ㲺o$x.$I$I$I3/׼$I&+x` 3|qĈnsYϤvo^I$"xy7\I$>{V?kɢo7qKbٮǎZogm/k}d>v-m6|vJF' ܇sCsϣG.k޿ }?x?.rNP~+i".r]Ң9}qcxyotI1TkN2J:I$I$I&(EZ_I'I$I%*譶TI$@s ]9%sxLmhI$icw#&*]{^^Aj%G;$}^/9'Lc;61n+H$P㪧NY=2RI$I$I$I$I$I$ E~59!$I$I$ID_qc}\Koygr-^{Ur~B!M2t'5Wۇ?s+;1cTUY9 \zK\v,fKt>ck]Gp㓿dG$e|~{/ -콿WWգ!) 5>쓋-\7ٿ쓻vM$+bcླྀ'I$LUFT^UNI$I$b < 3}q?r>+I$$I$Pfc 䤒I$BLbӤI*-ӤUԓt' (G}W_5k Pzg=WPkv_a[I$I$I$I$I$I$Oi;[酉_ou`gC=Q/~K$?߭gYDC=Q/~K$?߭gYDC=Q7HgZ' YDB=Q/~Mֳ?,$/߭gYDC=Q/K$?߭g YDC=Q/~K$/߭gą{&b[-*_!k?HgZ%ֳć{_!k?H_gZ(gYBֳć{_!k?HgZ%ֳ#`}k?>x?C=Q/~K$?߭gdEe`*gE~[g%$9QX|4O_TB*J.䨽ٿy` +̅$ $I/-a.}.i>~U k?5WM?ټnkm?iwXSՓ_TUI$I$I$LK??|2 $I*^`)$WlZ$;=~xXpF֢I!h^bHQqyxNJ_?U{:9vSNo 'nee2\ǚͅlzQRI$d́ݱl߲_MW[HRmp$3 `l}NF?hC6.KZ;qek@ |0 {/ݛؔ!hv!hF+s]tI?kS(\Iȳ|Wﳹ1%2>u_71^}ck36k[3}"({^A{ٮ;'e<7Ĉ;lg#[C*tI$ǒbTI$I$I$qhXYwf_\zZ'I$I$9Vwǰ8M$I$7|>ۏV/cI$Wˆ$ QeҮIQr zz@괛$aW 8z Љ*nWq$I$I$I$I$I$LWwzK>RI$I$LKZeC0D2[Oꓢmj}829܀ 8ePۨT2 ?/Ռ̆]kc\`t+swgAp˹~ }p[ÕKCT*I,ϴv:n5/ Au${W+[l[]]P{-ۮmwOAvXYTgbU:nh{ /x/}U_f_ݾ/Q@EvnFf3$FI$I$I$ga`N-;b9+LRIEZsp`Vnl{(&w%JY]GwҮ0BEyI$I$Xپ{heh%ƶzmf~I$I$I$? g<{I$eDa52tm®B)cUsehǏ'K?l{sn^z+ݪӟőKd^5q o?ƫA[\t텙ڲ0?ƍqy.v+ZiaעY } O%)$I$ ޼vQ;{Mflk#ow14u^әNJܪgxVzwmmqN#1h j$'I$;.g-ҚI$I$I$EɱlX> I$I$grToޝij4I$xtPq9h'I$Y;lĢ'I@U{g \lI%݉Kx U}FZs=e_ 8lf_Ǹ䮄$I$I$I$I$I$^g4wJg߂I$I$nuSWg}/hUq~깯a޻Ga뱟{.>~_tVsKruS~՘Wm`'h=۞{uLvXmsb?>}YV_%=Z:vCD?VC2>9[r2R{g[VV/;~}}3^EGA'B߲n6\an]ǭ?*=LJqҾ^G-c~S{M?-?H}JzmFGz /$y5Gt~G+;r=?BH8@I$I$I$L,/iܿ|~hJ.T)ocYĴ_Cmod]V.wEeI/>g[+I$n矉n˰UE-{! Wk9Ã1ոOmh|ٓ^;Me߳{.[ſm7ʽ[}]|?v6ҳ}<V +E7'y+RI$I$I$#C+YO+^I$fz.io~hʚI-զ'jeXrI$=L0gTu?gkaǪߵmose l_ew? Ϳwrr߭âkC;=Rۇ=^>+x9Tx$_wmYyCꪲ毙kwq-%,/+wQwߏK/燹v7Ns..ێB&0Yh?~wUx~0p~d vsoNq;-^"0|'湾w~wn͑nqY4g]vXy՘x`B˨~ݙػZ꪿~x??&ߴٓ]K麩<lDX?b_C{wgoqc$WOckT;~˛E_yxgYao}~Q6?pnw?⟳Asd J~aA[}w$4w 6]43R*]`k mp_|S1FE<8~sWiaُ'קOCs1}1kws2[>!s;[WzeYf[ 'I2wAر].oUv2Kzf}'{rUp݋5Q:I$I$ITIJTI$I$I$ fzyy$$I$ʘHR I$"zO| WBI$J??."'IAʫQKA*䤒?|MO/g-6&BRvithCq3I$I$I$I$I$I$/ol+/+e4s>pYKKY_cݝ՜ ƕ3ݝ9t~]>ae}Pܚ>+ϱh-f[{GpvonJsdc}olG5㻎G'fi>[sVMB8A9֛_rGs9.w|Ͽ~'K|> F"i/Ȼ?\W~}s 8^8ܽ}r[3/Ž\)}fG2fsNtH?"ic;Fvw}֋nqp6b}E_-ӽ}ϊa3to}a#^S;'uEo8 yIJ{`jawm?ω|Fװ$I$I$I&%>_yZI$ʫr9F 榒d Xl5t7ݲqwrU`y VI/jmarYh~}׸Vv\uoْ+]WؿX~߿<^ڱFxmb>*UUWl ~ {N&O~㑉S;{7\jVOtTzjd£+(}N>c)ȩX6`7S}gpKx{=3 [?h{_f>X6O«O@ 6E;Y`jC, }y?foÿ^ s }yW/hk>;6};.j30(I$I$UQ9M$I$I$L;Uqq^ez:x+ɓI$g,G[}/Z2I$C>(t^۾a$I%UDu$($!:I. ίNi߿R@'!UZrN9I$I$I$I$I$I%O;WosWfɾUGo]l6d}=ŵC~?Gp%^"ա'>/{CsrL~GkXݳ6*V1q*ŧҬCVefuf:ꅰE_㋹f?n;y3_ߑz&=x"X4y^mMug׵k/Q>5yW DFxW'r7~Ow2>vGc cIPljw{b8U}"̜kiw摿ҬgW{)د9YfKD-h`]o!sؿ^^q)-h%ew6s+V_C~z+}j>n3-/}hy/ٟ8}q7gw-o{mMXip.S'_؏= 5{\ƐaO烯EN+RI$I$I$L,/m[TQ&W]bJ:ҩܪ Nw*5m*J/UgQF뢰4 $I/=*vʎU?xgl:B(Ƶ:Ye?(`vGw6s-n39ٵsHwtfe ~Qw~=>kC>v;U{e7|'vvϺ >|ںI$I$I3/׼$I&Y=HXHO.9ƕ^~^EO9 pv IO#o#qײ~5,T9^q)p鳻L e_c;'te c֍W7qYt:-=Ope%<-./G3;w+=i~O_k8f;p^g18\0܁emt-`\z{ۻmvn=o31,g^=R/<\o39_ݛW0/pYfP {cbY2wY`ƯZtow}vOz} meQqcYnI$I$I$ܕ };g%tL'I$I$I$Pګ?,׶*AWI$J/Um-BKI$H/1U_ ">^I$I]ׂ#STocg7NUn}^+-$%RmG=Ֆ~WBr~Tr+ƎnZi$I$I$I$I$I$KƟx>LRIEP흿9qwžm?Gݳ ,\J>, Q$L߇ `B<ɍ7f]m^s}wxN{:/x}ow곱ʯ\uW}<beUG۟VS z83ow~߃1h?kn&%tY^ѷ2,wv^?S}N?cşmEw؞ LN ?\En$I$I$IxGWV$I1T^'R"I 69%VqL?谾h)B3nS|}1'oyb{ ~z_sI(^ :2{}UxV}}^S^Bg%We˸~}gnLPr *7&;ŗ:Ɛ2mWwfQDžw%n/1ݾћj(p/ ߏ5o/x^mw}ϸ6Hh#L9Q3ŕ\J񛛃YPl_ph{KXz~-|ٮӕ{7' CRN>[]I$I$I$e ?kI$TLeZjI} N'g|GӍٻ{(g}߉ircIݟXg8 臐RkhEd dWSwMZWn~/f{*3pg?jUe.ϫt#^/MXi/klcy_g;~͐o.Gg$C>ázS6ggo_x``XAuUly{ Wﱟ?ݟ]{{FQexJ[U-`譤I$I$I$ܕ:u.⭂:I$I$I&ý z6ZI:I$I(QkN{I$B(X5ʴI$w$f&*6Uޥ^UJw;h7tcBEpHԒI$I$I$I$I$I%O<g } )$I$I$˒tlX8\KUSr*4 ,kk//}}vWiuγ Y׸v{.MCkw6Xx1,`>kْI$I$I$? g<{I$e_mgy0bZI$.3hm-k7Oy6k¤;w^aU'[,m^7L.#k;.G2ȱv?UfڟZ{WMMOOk/{vG/ ]}ϱ̛m$9wcyawZO Y},v_hgmev{oN{yY_4^{ٓ"ۙ nvi_WWx:}Q\v]=Cc.'e~_dp?=s7l7zTb^>Pl+s_k>554$I$I$I%Mt$I$I$LT8N=.t E$$I$_lyFg%$I$߶Sb[WI*:Pҝ}vj[l4(;ݷ}GZLyy}ކ^oy&S HI$I$I$I$I$I$iǃa^ϡ$I$I$I$I$I$I$I$I$I$I$I$AXX?ӿ ZZ=J}> qʣُOgFxov:<$:TWC]dW}moPI$I%oMۆw,mBڻfgf& rkQǹʘel>Hd}qf\xbGÒڪ<5è*I$I$I$g^!@,xI$)I3o櫍RI2 +=?v=mZ3-vWkPj(=[xasOVdz>lGڟٽ b_kJ7ix~SU\'؎ɑWꚪwUlS3=pX?wt?Lnʗsg> E>?f}Ua;N_j3"'p?>43sWגϬ5\v &mZ>+Mrq}.|?;^%m=GmM$I$I$I$Vxx)I$I$I2c~*-8,̹6.?u:I$I$-{s] j$I$2TLZI$IS}xk}/g#*t qVt\Woyc LV{0~AX1hA*X[Ֆү$I$I$I$I$I$I/3;W3oI$M!7RI$:K7Gb ys, I$I%};r;ksy\Mvx$p~_VI$Xj~fsjsҹ{xf^ sUĒ@3뽎k$#bnݗVK]bڹ9/5u1!`codN>+'S?+ wmI,mmi<ޯ1I%[O7;c][zWCnb>_YtVX^_2wA$IylcHL?L.ߴxnqszUmù3sn&pq;%XشY:oS>sJ? I$I$I$LK??|2 $ImyEc'ߩ$˞_m<Gn0>Y{cohf۾?"w=ak}߬U_n% +|8im` romo_> cYٯ5{k1_e[a7"F)z]Mcy}O.鉕kO؞F@`sFJ*tLVWp{u0r'`oY\G(_ۯƸ@*EGI$I$I$I$%Ej]DI$I$I$*h :tI$I3eX'֚II$A|*I$J’($7Uv"8Q*^3r8' #dd7ޟT~ a"AT&}8Z$I$I$I$I$I$KƟwJg߂I$j1䌒IW:;>Zrכֿ~?lg1~sU4=SHIW}¯?nM~1i }m=⸰5oϴvᝈ),^Í}YFEc|Z_kg+fOnݏ`{uϚ L񫾾 8Z^7#a/U6ߗk_׀*^EaՏ ^CLO F_f7bEM/lX_7~cMTjG]{a;IkGyq~P>{﷝`570c?Gn|OU(ˆ+ܾ]4eտH1?F:^_~wP`Φ8vůͲ;ssǥֶ븚]57_i.h}~ou׷7Va`?iV}SaGf<~S[_5[\_S>D3xEIXx_ӿȔ]hd+ RIAڨwWv]@i8?rdx#HFbEyI%Ձ~w 2)Koo#Us]\̠W#EI1d72CY̯7WOۮ69_z3?X^~:,a]%O__I$I$I$? g<{I$e̫sY:Gm h+揷kIOMwi6.sZxzCpwi}{/U;Afõ1S ڻZ]u nSmŗFZ /?Y6_/>[_ެo0w)0~QEAyS} SgUvɓczݎיIEXJ*tLW?:_$Wuc8yN-qk&a}(^.2]I$I$I$I&w%SҨY>hrRI$I$I$}]'![VtI$IEܕ6:Ͼ8~j$I$ߦ[otºI$qP!ƋS Q*S$mRIEvqq+8y$.Tu=?FV&ffd}JI$I$I$I$I$I$^g4z@t1r2}-WX=t.lNeZ ]ٯ?hqnoաt)4jߴ}p{eY{n̵m?g+?z?m}ȯ"\l4=ѭ״h+Voxdӱ]so8zN?2/}oA v;|[ٕ]@ *H9yXXddiK,}eu+^i.m~e[53K?۾ۻ+;m[+ua{sgh8u߂xٯ/v#bw?5†G>]mg%hv¬p vQs_1Y449B)×%[LFvZIx7w]~oV]~KA%ϋ{_'>1 zʭ;GOWXxٟϹz k dd8c<z2;d~˶ژ5}1ä3~g{ؓ11￟O[~ԟ˨YcEvOtwFT \؜/{Տu}2+dO7zcͧmTU֧ID_X}GGŪjצ7@x#$Bf=.8ZmW^_2wA$I`_zEo 3 dZڅus+-Q1Nܬ9ndY |9߮U[Y[C kysK)}jxI$I$I$e ?kI$ i7 {@T_?UaJ>aqkb}}!rc?"\_=>MXXָ S\..4zwko]m;b4fg*ØC[<׆nnS;u6Ng="De<^a}-~Q{{2f]w6˹f`c>ܛE,Wiܾb k `d}KadIEJd +Egߴ؟fn^ru?jqp0^(鲏̱.Av$I$I$I$TI}N%e"I$I$I$BtNJuYWZl?|$I$K{W}!kWI$I$-(}GI$IV,ƊGM:HN&P,rѥ$;Fk4n j7HolXt<0~[Wt+|&r5[:s &5}:I$I$I$I$I$I$ig ]lV`}ӏp_Cw1`. ^bm_q~zx?x?wp}ӂgt%31ّe7%s'~ϸBJ6wFݰɱX09gk?#`cQN?ꮡ;X۟CU3.s/{yEo{wx̦86<1]uwCr).DUl}2>bᑕ~\'h略>㡉Cv.ﱴ3C?u=f=n u {lu *Ü6G^[`O߁w4s+א,Bˑ}.;~W}翨ʸkٿƆ~ۼ^}./J}ͥV,ӊ_'Eԗ]J?T^[?l+lWmCwedG:Ol[/[^FC*~K:CaIXX?Ӿ mܕGՉahC\JO ff!zo=U:8aOٻ&/neuX7Ŀs;lȽYW>˲81q{=?/;?NM=PʞyJ/__I$I$I$; g<{I$e@ەfwﵿ~ݝG𼎯}xU0a_`$x>۰%4F54QX`CdY׽5UvU6O9\ڃ%|2{{lgϊ/!n5y|7~^ػfWnϯoywMj,:.ZvL,.E(;m9{L)EGC~=vLwE_f,wO&}3[Û۪y-zjgMj*I$I$I$I&+]W +A$I$I3Vd`RI$I'у I$HNcxštV{}hSspPny'Ny?|4GUu3 *(v_ĒI$I$I$I$I$I%O<g k~ #7a7dm@ae2-!~?kckp0P.h}߶dv ^%fu4Z#Uae2G-!mT8Go/;b~,%owJ;o߶VYHޡ}X]VVdƷ"\vUKK[t߱kvU&AFkgS^=Sxk)g;яyG\-giw<|\øe}}?f{{mvc1rٿݏ?2cDzloOm6Y֏M>zr.#W2,d]fvcPsgnV638(0y6}AsqO6"5>qklEEߔYɢW~5_#dY*id{ǯpd:R?7Y/urv>[I}޿٩^̛1-n5O6COc7?6WwN23u28|_/yvV-ËmuC{~? KE-27/?cG h38i;kf6^iϲpG wVAqFUID=˶{5¹)l6 U;OzM$ $Kr-.d`U긹_ov$~sK)}jxI$I$I$e ?kI$r5K7ٳfM65'`H?y??6/e̻Etz7J./ĮB5$;~^cW1⭤ ?=9aw^]9>_ƚ)76CcPR `~=yWc䴸?g~ef}G;_ߜT7>Ͽ;&xgranENII$$I$I$I$b[Yy$I$I$E1 mw O +I$I$Ji(rSI$I0C)S"yII$;h rNW${rvh[8]?TUCHp7a\!SO=hWI$I$I$I$I$I$3a^ߠ|Q%S/ 1 8L\_~X .x;\}֖ծY$MO~fOՕgwŏko;Kp>ԭϵ݆'x\SRȯY.p ǫN|W}g>?oʆOi$Sgݛ Xͷ \/;K'!??\Ճ;6)ǽ?5_w4;Uze0_oݳKGgU{?H:!'a7;&ϼw8?zw3h ,{*=,h/*U}AN{g4½G7n~޿Gr{g,^8b[w|夼#ڢ|,ƭLϲ9dko vu1W = ;qW$I.{a[]_b{{A{wta>ƿ}'*Q;ob~;mnE?uYi%sJ? I$I$I$LK??{ (‹0cv]CE\#/߾]y~ECXPix' Ny*%jr]Y" ĮM_7/;xS=ʏaXX%Z\FHj>~ 3/۟|1;h~Z&V|⳱U>gX;qnrݾjXɮiC#_nex6_oCVy$I$I$I$I$I$I%VSߕi5|4I$I$I1QCc'I$I%{{I$1]U$IU}P?oFDYNKZ)ഇ$(4z`+)P%fcvG;?R /%^\q!^I$I$I$I$I$I$^g4zS~IG'QK?w.ɂ윷ݾtkGRw?w@+|OA`_u<5UQ=:ݮoOVٷvl)s.'r2 xnPRㇷ і/Mf4Y'Y'.a?p*~YovG`.\1ܜG[xI/Ownq~_j;`bV`?~ݣv;j"p8F}Ι{}ylgb<ucO|c;6`4v6UgRQglcM/ ?mww siAlBlL<,;oKj"Q5S`?^;eZ?`N# _N}j~oj[ѐtƜ>ˉngĵ1讧9ka\I$Ism`̾ ={츝W q0W/e=GyΈ򕗑1o0-Gϔ.ôNpY{oie ?kZ ˏEGef2v=:]fK⾈tG燶U Lڿ6bgz_+?cҤj|nX@ofqjoo)}Dv;nm>kw-k]k]۳;[E &T;Jc7og3¸qh?jΪZ⾢ǫj5!e}K3}=2*mU3McoobReF6>0"YP?E\o V{rӝZ8cK Y#[nU96PDv<ķ&m6wP?v[l~^\0ywۓ]u< ׇ fvfñ>\ҤK7v-eAk:Z\ Xx_ӿS[*r$Jsv&1z~jn;[\&<Qw%V@tVjSH/;^I$I$K~P珢|s< >ECd?Vǯn$I*7ߗNZ^N=*;ț?׹Uۯn+?综Y0uqaao emY] ̿F඾L?v:'.1:Go/p7K}8Fܺ. |g}]}:mcpn){ce"dC;+? g;NC#ڎIn[817Թ6cv7? 9oKr dwHw_K~NJn׶8dCo z:K:hsw뮅DI$I$I$I$I$I1Ut(SI$I$I$J*&>u7U䓤I$ANW Q[ I$I!AD+)I$7e? DCzK{k?vߟ}qzoG%$Ɋ)n{ʿ}Bq܏^I$I$I$I$I$I$^g4wJg߂I$I$I$I$I$I$I$I$I$I$I$ͧn*˳WؤUs2/wRcװ1܊"IT8خe~rVT+_|>W$I(mt,xelNs_lYc0γOI$I$Iy|o~~ ΌO?eU cHkG ?Dqn ?0AR쮟L}|~mpzznx׭M6~.~vmx>fa7+[e'g !uc2zg#_~_3pߔ13yA=E<?jf-+;i'Xrri4!\9 <.#GP옹t̟2p#s/?|1CtL#_OqIsZ '6Qw[i{F| }hx2Wٚ&~>jY4^{&/{nWxg2WcvO]ha2K;~U"'L2tL$JR)$$'Qw%Mb2h+_tNӤ$$ўh8e+Ii$NI&<{1ٜMAZ$Ғtҝ ǚfWu~y4$,xK:#%T :J.TWx}7J9'I75^6c{9yWtBp-)$IJt$LII4/4½)K~ I$I$I$n&pϻ'I$I$*;#I$I$H,koe s08 I$I$I&V⭲ERLf;nFyUShg:!W5ji $H9d-𽇨\G?k7l{xpg0=nl_Ŋ^->6cq AűKX׳'ʦ1.X_i,˫bem]I$K?h2ixMz-_g~vZpi8{c2?qnv {'x'f4p|_7S_8/?zo ?.:-}~  ykO7%?a~`eup]y`Zݟq8G y6Y;?w5X_M-yw pDs/u|M@ɵ⮾#3s$m $_c;-N~ =a,i/{wTCj _D3TxXk:S߻; 'iIk_~߃GmcypZ j/i Qq$Bʻ+m歜 d]k]YoRfVMN`螩~m97VDʲk,- <ʞ6C¦x{Hޱ džFPk%,̯GӆD~KOW:it"_g Wpueѿ:o}=$GE<ݏc<,/Ƕ[:=Rebcs oͳ*ks8OT\ dV{c lxi{OU dnoqʼW-mmwpV !=w9֖F˲K8LxU澒Ы̵?;jv~3pk?yr~?xGtOVU1p~wE&C/|?4\ZBL$ Q[\\]+"0Nن!kZ^h(eۏۃ {G5,G Z\T(}UYvA> z9Ʌ ,uQ>=P}-f#.9.g)3lks=.\]Q{~]չ=J6S֖r1t~zZy/F4q]z%eH*v[@U)sL՚㠿Q16SuiOT^8g2qչʳ"X[N6Q9, R[pW?w^}nFܙ鸇~wE +u㶷}]̲8 ke0zufOD8 k.s<2ۋqN!ߒbz-7p Vr8LTo/xz}bxz?WrJN(Z]Tͅ?5_hyEzk~I$I$[̮gdexfIT\'|[wVopAխ`:mp_れ.ߗf%SLGEzu3ݛPo).׆"|?ƅWwa{nwO6q~5!#k*?zwg{G{)>k#`!?{f݉]YwY8O^ޒKG }G6XO֒}K}+ ypgt?졑d?r{{^n{X' /+v[=r83c ܻw_q"u{1{pshw;Z#_zB {JOnuUe߶1=swʾ+6߽=A ?}۝sǫ3 =~ス_f\w ݖEo+lL[-3=%wuIfGn:m8 cƳ>Ìo9/K{Üͧ| U*VP~rn{q fu5ߟI͘Z;G*g 8  Z*wܯ!Y ?O< 1 6[WJk8I> emy5`#0wjp7UC5/Kq ׸;;oՑk~I$7UOW2>2< Jo||o_O[hOot;al$I$7Q01>^pKc@?]8d~7sms~}6wik<8{vtZey'+8~<+w|aZq&yM~G3/˹_<[4MZ\ϰۄG`ݯ=yvO#w}ϻUWlƗU=rwU>]Wr.潿^ˆlVp9+/Vg=A!)IӴ;>8[0t=ګ,[괶^v.#8*}ӷv;v_f2m\zkJ۬C>kxkAsxg;_z}Z;WSwj>|Q$%b>NVeMkgR4$fRI^1"#I@ ]$9&E9Q%.}mB#Dܥ&SuOL}9: 4]Y#'SL$1YKe1ޓl}$U*Xf Җ}!(=oNl4EJ=OɃfq8?iZ{ Bhq W߽zgiq!0u|Ԁ)?1A<[*J;N$ޘJI&)T}yoa^Ϡ|I$$o?_X:?^U4벶58ha=k6>| z}~ ,Økp-cdoxih}vG6Y=^ +}+9 㱀U_?_/ANO1{~;hz^c:D1=߶Q0>gc{}5WN滏_>/ɣ熊qiD/M'x^}U_jF>eKKǖ;gk WgWN[~}3khj5{[H]?㿹^m06VV#?RIq?89ǧvpW$I,ley4O{|y=Ƿh^r uxT{V.Oﲾ췅x {310-9 WwnڳI~ot;al$I$KރkYe*M'K?ry5݇mu ?r^nnmjz5?`{o6ͫ {:r+geݢ1\+?P{ڟ{O2^Em{Z]k({h2z:9!beW9U{n?n³#&9w_ߙǖi#vF׋aw>Gw4NCD0EщZ\O~kU~}jwq ֫ { ⏾1ߑEOVIKeEPtTI$I$I$I$I$I3* fWdjxI$I$cU6_Gy}$I$IE\#I$H.T J]UԒI$MCԔ6$7LVW[gU9'IAgwnp>: 2D7ĉB<)v1I$I$I$I$I$I/3;W3o+^s.c#cż̦~mmcw |c?nϰHN߷_g@Lߚ۫"%a?߽3^h؟l{&eY s+c8*ܭ[?s *Ga}?鿍si-VKmqن7_Wo.'SS/eX",acx8/AiM}jEo5,+'oG~c8ekC2{l~%,>)Qh}֪-h0. ?.wK-c^x#XXxdN=u;Ɓ}ãn5"$+le5>  |_<}G_wyfCˈ>0c 3?_{2*w' .f_Pȿ#ŗxczu`ٜMrⷱ[Gu9}pg?t=eh؟phⴾIo%zh?AzSC8ύ\g.c*ʪӦwZ`5ۗK+2 R{qvlAǴG+yxgvEu?_l TdϏ]/l=WhFm;m껩0Yg%$]dw;Gouxz8ݭ׃S2{ωVQw ;3K_|>W$I/1?w땟ޟX^C?M߻oxU㿏^/>+_orl`u^lpw3lȸw;ɪ>8[/C@1[ $I$g;/Gd^Wp0{vXTT8X+ ?>ޘ0K<a!}X!t5ʫk+hc E|;KU_Dv`xRJ;~+3w5l).Hk89s)ŲƂv}_nr~w h?gv,.j_l>gٕ\E>\ksZh'lo0H}n C'#WP31S1IK=܏طǵI:I$I$I$I$I$I&w%LpM4I$I$I%T{/Ϳ0W_}2tI$Q%YaÏYjI$HNBƧ$I$e始}Q(;jWtJսY:-6ڒJj"\+I BxI$I$I$I$I$I/3;W3o 6b[W^+?vv^YJ/Dzَwi({k/'Lw.8=cW[Qp?|>eOKl=Xh8i}=״FY`- ٱKU2ܻO\-ݓclˣdkQ~S;Xy<4qf_"X}+¹?$c;ۙuc:OS{ }tV꽭?|TnGl*ǭwyW.VY`zIۿ`.Ov;Myod '%M+evO[?둿ܶ mߵ\GNƭnEX$XM,.l=X˓7c`][Y?kpW]МaO_7dwg;wkWCre\;>ёUpWo;r?as<՜,ښw~R_gw+BLu=b.C㉏0egO`d^EݯmMkꥍw k?ۓ>\ݾgks{. \l z. Iv7pnʲ[O`һۻmbS{h`h'0ͧmP}YLpw~h:I%GX߬rWs!%rU歰^_2wA$I%hU;F>7B/dg[7:bӰI$I$I$LK?{$IQkr>.[jIw'+?ύc16ǿ۝σg?iϷvN3\ K 8; ibw~[=kq;|wOY.ng=v~ǥ!!gWuȮW#I%2YnC{\?7_TtI$I$I$I$I$I3Wpܞ i$I$I$grCJ5z~8I$I&ro絢Ji$I!t!xʶI$g>n(t}Ř 'wXN{{^;;֋y$HGCo-$I$I$I$I$I$I%O<g } )$I$Iʥ;'dY9Nl5їܻ_9٧t_ ~.>ω>kE3Gt#N;{hˣm/>ʳbm.t?%>u /1sG`z?[!2u7tW29=ôʦwzy}cջ<;^ qfGv5Q+cU8,p|8k}wnGu3={` ja_wqpZWD~޿GrNVmxEe~alj_ џgj㶜q(k O+m>oYF~fv}߿[_dӿOyGsܯEwm<&m}UqfzKVSgq}9W GOo?z_oůT߃D!w#;W#ꉟm;mUlnOZѫlRIB͵fwOi*ʍݐ27Xُe%rP뒕ji/>g[+I$\g?UUOk>}1W{o_F&7ݜ_Sl_yZI$!{Zd+s<}iͮfy>1m'Vݳ{=w -3;Y؛(>5׿Ҭ0ԯknAVWgv6?+޻&N>gnIswoU;vM9&NAWHX;2?Z2)I$I$I$I$I$I"kuh)$I$I$I(_VZ;$$I$?^-c(Z I$I 4c?xt-I$Wd7 DIEʳY­'ID] 'ˣW'IEU*LJX-9-I$I$I$I$I$I%O<g } )$I$I!mt,pelNsl*ƺOG9' eTf/wm#Cv 񿲯 $~Mf8*u\Zi2:y݉oj#Wf?u7>G}w%kn,?o,3$4/Q^Q/5~<. i_pj;骿w!v_FeoUSym;?'}Dk)h~#^+s\by/ ?1Noi;ټ[ QϮxϱ?f;qۏ>dg[dw_zQ3͗mkr<&OUiI&*p\ceoCH&w%U̩ւOrVZ^_2wA$I%=CpǯƷ2^^~&e/3'+$@"\/uc5#9}f>?p,]I$I$I$e ?kI$*M߿:Vڦe=g׎n=^>z+ I n/R-{^]~XJ(k~ ÿm#+\u#íwd9ķįUb7ݥމ{VRH\߻>}[SI$I$I$I$I$I$/%I$I$I$Ly!I*'oţ6~o׵y$$I$?م$$H NB>QIA;v(93}V I%7|kVD _}ߡJtI$I$I$I$I$Iy½)C~ I$I$K#Z{ݵWk^ 2ӏ ѻ88q=y3+`1ܲ7cWUqx?2VٻWzu䳧ep{s[[cyc\x>+gl oB'=z=s w̻{cy}U7X@ y8f~ o}흏} u7n7-tWwmxǶZ`-/Őߥ຅}g{Q_o?H>)3]a3ۻ-d7':ݲ3chynٟ2 JmyQʬE=7q[w.ޛݻTI.:d]c}:>Efϳ=egyYN򅲒eyľXO3.lkkw?â?+ wV䨜 Y?1I$'>hzc覒*b[iZbEyI$@4$HWёT=7'ÑI$I$IxGWV$I2ɫf-D}Gx}YCq5pi}mlc8@^kk;|:CG5x𾏾UCGG}edbZzٯ}jZ4Hڡٻwo7Ϫ'vIfa2o_btI$I$I$I$I$Ly*UQ.oԭ4 I$I$I$(Z̻'J$$I$ ۛ8@0SI$I SחZ=VI$HO,jrWt\5&LI(K3s|@E4eX~d-4I$I$I$I$I$I%O<g } )$I$I:I$I$I$I$I$I$I$I$I&VΈ:#h䤒wxXF{s*!&*]$ $I$I$I$I$I$IxGWV$I2i[vΕzr5ǻV=߷ֽ'vSǷfDhU֟. x^p??*lDPqTAIJ8/ h}Up5^UŒf>jsSl'Ajiuv[w#i$^ss3~c}ۯvI$I$I$I$I$I&*k.*"I$I$I$%Q>9$I$g*u庎itI$7 bYUm$I%Y=m;ENYحO\ Pz{>yC4c5uWBNCrGįI$I$I$I$I$I%O<g } )$I$I&g'dskEb*I*vedCP{JI$}f«vqVxZ}LFd3"r}eZI$I$I$I$I$I$?+ wV۹*>)$*ŭNhmL$I$I$IU|wsJ 'I$I$f3Sgr~ ѥJI$I!Pu$d$Jm2:+QT'®(O>̦z^}^W,3ŘB ["ga weAjI$I$I$I$I$I$?zS>I$I$^;:}oU=E`^S"?ʿ+Y'wji\;W[^]59Yo~[Ơ]1l~S`iϩq߳Řy్,&4|ofm}Yxf]]T&}; ήk}3-0fWa̽/aU5>X\؏,?nI$I$I$I$I$?+ wVیJ ܓa^bI,⑃[[XG:Ig#*i/>g[+I$I$I$I$I$I$? g<{II%[켿w}?h^ou^!,*Du_As /?4kC;u.qlxcG˶YlcCA ϭ=z+$dJ짻qVIKeWxUTI$I$I$I$I$I3*M9"14TӤI$I$eOӓ~3XyȫI$I$1}xI$H.P0ҮI$Y[D!mTGpW:J.Y}Sڎ?S8G%م$YWWgCԠSN;3$BI$I$I$I$I$I$iǃa^Ϥ|QN$:>ͻ4 jdCh̟hl_#nNx^~/rst^}^+z^'psOgc8 x }>9Gִ}>9Gִ}>9Gֵ~lGPú7OU)$I$I$I$I$I&V@U_[PtU$<:Ya}ҿ~VRLJVC*-3g%qI"ekezI$I$I$I$I$I$g^!@,xIDI.}Xd`/E/_<;fGBǷ}+t!\b|UbwhKpl}ub[ˤ< >N~^65.z{W8y_WWn=e\D9{T<χ{l S!Z $%Sf{K}7ph$Ǔ~fh0 s[NI$I$I$I$I$I3*bn+aI$I$I$L'UwT*ᱟS$I$Qz2ǩ୲:)$I$dB+q 3⭧I$U=qG'(PEG\o%$\V_x4z[:J*uݹe<گAӋKrQd9+$I$I$I$I$I$KƟwGp i?Y y '&_]`?[U^NE̅}v%63ec]?Qv_q>}+Mmy7ي^჉ܰ˨]Eu^Cݿ?vV.M$vܧul:-?o[o}le/ /OهsO5 R\Oo,ϱY?kh5ڱnv!~5w's}>q].q^\0#3/lϰʳ a?%>ඃ9=yqKm_Yz0c'"gWI$I$I$I$I$AXX_ӿ%D_}I$T3Kg"8$Tߑ_ LښEyI$I$I$I$I$I$#Cǿ+YO+^𒋐uuK0m26,j;>6}_/w^h8wg"9%SCwBUes쪻/P.,w H- T~'Uׂᶭ FQykog//e۞!pow+bZz ् ?ƃ}oJʦ<=`RǥZisyՙ5qu8dwOw[_fGgَeg6|GO%GuW/ww/o^Ip`AiҲ{mWٻ+õc]81ZW5~8?,n/w7v([,4g ǧ{osxd)ԒI$I$I$I$I$?+ wV۹*W֏uVPv*u_KU^%P$JM"ekezI$I$I$I$I$I$g^!ߕ@,xBmU4DI2"N݇:^:eӵG>p{K9U}5CKA$mt*vcE}$*=*IK#Z^}Z<8:I$I$I$I$I$I&*4;SI$I$I$HRUlL:;dc^I:I$I(SfyNI!s9wҼ$IV~UMWESN4mrRIE/K}?IC|֣9)$Lc=tUiP3?|$I$I$I$I$I$I$^g4wKg߂tI$I$y~kk7Gfa'};twK`7a䊒䪺zEi^_2wA$I$I$I$I$I$I3/׺_uTTaWdɮ<xyɰ4x"ڞGf4}H^/?ž'`vAPU__4"$#_푅x.!3}v}wC&VI¨prz-Azn2a]I#s݊&f}ؒ\I+u$I$I$I$I$I$ETk[s;I$I$I$B<>|2MǂL$I$_f0w7iZMR I$,$Jt\Oz W?pZ܂JV[]׳kVr9I$I$I$I$I$I%O<g } 'I$I${[G{GHm w {'YOGzm~%uav*0_&<ե iRmKU]v\ݑ^؟=ȯ{ia/9>l?Skw<,O=2EtU@sXowΣ^M?;O~{_|sli>r>=o3Sui_Tӑ/1j[xs^$y[Giop=m^aۻ{7c9w I$I$I$I$I$?+ wm8iUvE#)EmI(MVYcZ|UvRַmLU' u+_|>W$I$I$I$I$I$I&w%how cŊK5kNS~_L}YfOz$s/cύGYwwփ $ o4 b9oمmᰮ)}-5?$ٙNO]$ h:|#DI$I$I$I$I$I3* StI$I$LPyxc'I$I$^ozyRI$I@$yi]I$I tG#6g*D(9g38 !Z9̯o_+YP9s=)Z)$I$I$I$I$I$KƟx>LRI$I$UȢheci{pI*}׵vgד_7n=vpqh Ƥl>]I`}#> _^Gς8 LJ8c꫾kCD.o^^/cȲIi[NI$I$I$I$I$gaN-(p91I%;igwv+5ߜwc<*ømᒬ$m?1I"ekezI$I$I$I$I$I$KՍf^W,uU[oeg_BW}fgSl\FbSB@D%IȬz][jIg~5vu=?א6< \z`4Bt2E]m}۫I5W3l=Gq{+$y.{3;+ѭI$I$I$I$I$I&<6g[+I$I$I$I$I$I$;P;~Ļ~ef7qҿkEV?9)$ۻvwosX=1iiy)$3\hI$ز;BQիe$%_kwd2kA _ei!+?~ku[c=V4QI$I$I$I$I$L,m[U])$K3fр0Y\:sYmu>i欤 8ɮꤑ^_2wA$I$I$I$I$I$I3/׼$I&TØP7Ј+l{f ʷ SӢ֋ctTn(í8\I2~ւt*I zU3{gH\/m!o.EI$I$I$I$I$I$JW+- i$I$I$J 7ܾw.⮧I$I$;^<^ns5YbI$H%hXz&g[I$IgfoLz]J(9U9 8O5mQ+7G/+IPtČw櫉hUB|ԒI$I$I$I$I$I%S<g } 'I$I$@uT3"D ¦߳g v0xXcB?~ec;vjmʚKLvיAd{`Ⲷɾ+cB?~c[45谻mMpqG݊BПgn ,})|k>SYa,fZe߾c}ֺp[$i;lWglf+Zw~޿}(L]LǍ>"I$I$I$I$I$?+ wVۼu2hJI(Sʣ u`V1,mԶ.FIEʡ!mI/>g[+I$I$I$I$I$I$?g<{I$eC}ufz5Cw:;^c5َ_8?M?|3W{k(䗼OEHq;1[w$ !gLٔr>ſZ$p~?I$I$I$I$I$I&w%D]oZ!M$I$I$Ly( Mu!$I$I(f\Ki$I$^>(8Fpq$I$JtBejt\U|)o I'Pg[+I$I$I$I$I$I$; g<{I$ep}.b kÿWڜ3x?X+_fݛd;z?xv覆--BʪWXh}$_T~w#h{'O'3iDI$I$I$I$I$I$;qpI$I$I S _97U$I$6߾ϵ\o%$I$t7'է\I$IW9^O䦝%*m.nƧIA/?O? jeT]sKAEPU~W8\GԴI$I$I$I$I$I$?a^%?o?Es_695,KkX/b__Ŀx?ƿ~ >1vw{(#醙J*Gwf=ppUc9ߪ uk}Vۯ;tǢ덶S ƽBoл#W((W}K{y~&.#\+9'9%zq3so{59frVEƖ_w;;_gm ]q3yr3m?i>ՈGF?[t]ٌÅ]lĿY$I$I$I$I$I3ͧm;િ3A[Ig-o=eZeL`8P Uɒ^_2wA$I$I$I$I"`I\~fUSXf?v2my`~y0|cz57UK-%iBg[S/9_R?52s?v 2om?󚭿 g<{I$eY-vI7%W;cv\e>粶g]u5D!d= v Mh U$ Ʊŗ=VI FU~߈1=_ty$%}4[wc䢤I$I$I$I$I$I%_,4M$I$I$L0aaV~E&Yɾ A:I$I$K2'xZMSI$IJ.'I$U^ax:#)IA~%e'Ҽ?Yjt\j~;xqG+|Vb5^ojGԯ$I$I$I$I$I$I/3½%߂NI$I ׏_װoc#oث 0>ojgגѫ2[V%uy v粼 +݌"zam=o1e2x~lٲ~!wX_e}>T=O_3fe}\/x`?r_g;=7])*f[7+oٮg0]waAlI$I$I$I$I&V⭳*݊t*9)$RxƮ..5~ gB*I޻-護jI/>g[+I$I$I$I$3r{qkwGqԠx؎id0Vq2%oshm5PLսU /zq2B_h?٬trמ3ׇU_yZI$cspOr~8?G5umuTbVTd"v_l3 1'22r+qȧp:JIBmV:HG=r}\Y'VI,VAxi$I$I$I$Jtҝ$I$ǒͧ dqh0IJI$I$aAsA}*ֺ}'[I$I$Qw%P[sMftr$$H/1U_# ^I$IZ1ODh'I@npZCtTU?wԗ{UVݒViGAw-mT`4O)$I$I$SI:I$I?a^ߡ$I$I%]dR^p>Sۻ~۱~|?ŷpVd?%;'_O_Qrb9o?vw]gboOs=øU>~ S}9>̻/`E/(}Q_' >݌|JKy2+ o=,?Jyů/>`t\^>WKViiBǐo/v01[ԭ$I$I$I$I$I$?+ wn;Wߊ3w%߻uϷxW{u?s*J.䫛, o$_|>WI$I$I$I*MBoPl0bѷDk3]w.#EZp}Թ+4z_`_[s/Eۻ5SMj}>{k?{$M.HIrJËh`&l]}9κee0-W8 =f活cAB$5-IG^;hMgվ22%HmP_oy+q)q-ϳ74d}5,Fω+SM2ǔ8/2 4f'"9,\~9>' Udzz$walkJ-L̙uG<9w1)?|>%O?>*]`SRYKVobz*9`Jm#&b hG)o -xTr=?Q3 2'#07/ke赎SɳD{5T?$|U?cKς5dibz>p[ҟ3= Xy?xc !O+,#gc2sQ(cUL~G2ND<6g?;๬jWZA Ĥ] ᬹEPvu94FBj8xB2jc VqpˋUh@rTǽKx~Ue:@fgS3$;1 w_L4z*ѻ)zLù&x&J8O(flQtx(։I^#ojn;!qYO7xU KgP͖?sK 8e]e`} Xx'ſֶGХKpJL=5C!glE4߾k!^ߠ|I$I$I$WVkw6H*mkXֈ ^wmMtI!QeWXoJIf{ioqnKiwE]ácjgEI$I$I$I$I$I$J慾v,yTfEw'+8K&G]%pY`dc㜛kd?/ ^Ml"PxC[ ع_y}D N~b.`ɲkTr1-?G\r\ی}=^$I$I$I$Is_l~]XxlxwP}obm}eru+? {FpR[&3' ng\_ryi{b?۰<|zw }Gܨn# s}l^ -^G묷`,pNq\(<ϥFqjG8|W3w[{y=ϗ;vx-g2Z{}|G!?0p3ԟt'-ll!9`i!v,\+ kVkcfU]`% kQ)-ߚWUu} c0"RkZBag\܌o4OlpZ &HH88Ϫ8_Sѫx})*OSg6qF6fsZa3!P}WZ-% N*gwQS} k5|ljxxcIpH4IƷLHJL8 M]V *lsIWY.kvT@g {5[KrZvRscO!0ʫ815lqxy' ><0kh][@i Mc ̪4LkcKZ5XcxAO]5TcbS*pWۉ>#* g\ FFku'S[ז˛Ȧ}5=ylpH;vZ E7ScX+~!EBOhzaNW|;^(EtW>+EH5`փ0(ڮ09~ՆP7Slx}窇S\ly`rx E))ƹF}l{x\$&g-Jk6[S} &ppG?xxcIDB@k[&mll晕VxDJj骲K[\UMN.c iMUymLa$%;kcI sNy%S9tH1\&?}l+ҙ7ऒI$I$I$I$I$I$I$I$I$I$I$AXk Jߧ]8KT[4kFl%ݳ/6~`Js8%c[$Ɂ*'1dvqT9/8]߳;vu,?"{uu<׌9l~6&kG!xG~WV2bV7.!+;2p?ewa'Yow?pr#y'A6vG5W݅[msJI%Ϛ1`y$t !eQ]?VH\٬ f']~XӤI$I$I$I$I$blgմX$$I$I$B? ^]T/\NI$I&*qnV۰I$%vRHsZNI$?*߽KGvBty!z[(I%C?{c]|Vuij5W7bT,_ $I$I$I$I$I$KƟx>LRI$ҝ4I$۾gϳ}®YE?ړ3&Cc:7J~`0~_=AL|aY\we{/gqu-= t ASWS xcG2oGw:xoyZR۴PnV.$I$I$I$I$I$ 6][D,[Wrn;i;9)${(ǫԵ oTz^kiIJtVX^_2wA$I$I$I$Iag;g޳osدgis+Bwdv,dv㯙[K?>ޘ0K<a!}X!t5ʫk+hc ?g<{e .?H꫺,;-Z~We9^??ml noEr*5eG?=^i2%ZI> `UXܯ-dC?za$?W9q3/I,"={kZ ($I$I$I$I$I$cQexϽ[k$I$I$IBX̮9$$I$sGq}Ț*փSI$A87>⯂ I$e8TrD CqU,f7 Ϲ^jtJV_ǿLW$(cg!3yUR<\5S;?EI$I$I$I$I$I$?zS>LPR 3H$///g/Swcv v0Û`ؽ^ȻnjBnkmd-J 8<_S-d9"8~]3fm5Gꋘa%k[Cڹovc=Lfo!/O cjQwY57\?U_a+3Se? k}?2~nh>Z$I$I$I$I$I&Vt@u7pՆ)$fw0]e\ï=e%r@j54 $I$I$I$I$I$Ix?~WVw>͂^:y]9h~mk`#c"96˒lY͸bZoEH}[!<ϋKA$*ގC[cnu$^.{qwI#a:E:"$I$I$I$I$I$IS A+@4I$I$I2۬}tg'I$I$T~>ii$I!BnA$y$I%]Χv%;]o%$J_wW6-6RLU&]9&rSq~毤I$I$I$I$I$I/3;W1mMEϐVgzݛ#%0 /(imγ5/^;N'<?GgZF;&!xn/s? 3}C膁B~n][ac/m f1RarV3A_˲b>?T\7yh+h(cy-q~>+ϫ.cGw i/a!-ن?w9ffaϲ=|;Z۰C{rO*1?>I$I$I$I$I$AXX?ӿ%S֠E SD)o'V(5XI3;)CiM"ekezI$I$I$I$I$I$gr_5;'tɘy{g']7)8^[veZI*A}"I*Bo.Tk=<k ]_V+$ʶ-γԳ<<=}XYe=c%~I$I$I$I$I$I16ΕDI$I$I$!;Td&׾٩K?U^L$I$^k6f'O+UTI$ATjs]a$I%TՋя50$7\E5iI(=f,|ܯG߅JI-]!1KjfoP.W=z&5I$I$I$I$I$I$ig `ߥx_ohIs{gݺBxGb[?z+&/y2.18qvR=7w|w{/ws_k_'#Yr;WmU9r߻eب#ow./ocmḽ ?]OvdkOᵿnǮiK;oh?ľX05@7˖wm*6w\`;Okav ASO{/H4I$I$I$I$I$ga`n*rf6m@VS62Mlqb0CXḶ$J]ׂȒ^_2wA$I$I$I$I$I$I1_5_Gt6yVlg p'I2`~<48$v[jЯ$vSE~I!,͇1]̟qkZ$;ao2c?ݩ'I$I$I$I$I$I$ lnӤI$I$J%S˲5p$$I$\$zp+MRI$I @8}VI$Au,⍩@4(*O7 NY>GG?FNUzP+a9ºI$I$I$I$I$I$i½!|oKfwɇް_ A%xücfAܣ:b:/R]L6SP-?NSUomKѨSz2f73UÇ>,ޡleQbc{(g}ӇA_˲bOPiq?Oϥ߰v3+F9?rs{r{^.Icv"W}ۖl0A&p|~LW$I$I$I$I$I$AXX?ӿ܃zai$O%q3s0]^v \RƏsJcT7;k=>}UuSH/;^I$I$I$I$I$I$e ?kI$,a3,ӻbI,sCIw!#!8 |U!p{n7A jvKo_GfmYa iOU$dI$I$I$I$I$I1UJȒ|I$I$I" fߏ蹾NWNI$J.Uz6~Ji$I ;)$I*3'iuF(Nk VƓgYZez]MX|4+$I$I$I$I$I$KƟx>LRI$>"I$ߟ/T]h2Cd{}_kNk]gM\\.u}x_fYfwo ?dqrzu9N ?ƃ?YN1ח~ϳf߫w޲SuQNorB^#;W'N΃%zI$I$I$I$I$Im;q;+9s=.\bJ.t7d "hլ./WFђQ*\6g$ $I$I$I$I$I$IxGWV$I2{>x)$مMtxd(cX32I!?wCw迃U$MIּO:-0w$I$I$I$I$I$Ly*qdpNj椝$I$I$]0sj2II$IE=#>kAA$I$71h<'rI$d}/g/(NT2}';WӤP2r)LVe8ݻ:?PZi%VZo߮$I$I$I$I$I$^g4wJg߂I$ùR$m^꧉<([O,[W'=vpCBf;omڻb7">Nw߳;MݿUkkwWoA^1>]c}8u6_]}qD/nގ_k]akמMec}9X~ʿſc 'O;+5M[{Jy{d7ZU{g-yp4o_kdU{̮˘ksRI$I$I$I$I$L,i[T^Aku Q V{m'b>+L)$v6]cj(o05ZrWI$I$I$I$I$I%4 neʧ"M[oxT%@?$gR-T%@?In,[ 3Ė_%@?In,-T%@?Io,[ 3Ė_%@?.[ 3Ė_%@?Io,[ 3Ė_%@?In,[ 3ĖƇ LOTKwfU/ YK$gR-TKwfU/ YK$gR-TKwfU/ YK$gR-TKwfU/ YK$gR-TKwfU/ YLS0?~w7w|eVBC7sqNWI%"hԹ\Kea2ȩMؘe^_2wA$I$I$I$I$I$I3/׼$I&Y-?7RI2s,X}fE6YX^KOVI!a_,WRIFуGZi$0e]#$I$I$I$I$I$I|v]>gI$I$I$$?Wţ"][NI$I& ,e,X #6eWЏ]jEyI$I$I$I$I$I$#C+YO+^I$StUGî4fVšl Wyk!l$#'~VIUOUo_.|IKv:"'I$I$I$I$I$I$_OZ a$I$I$I@*,elt~$I$I&w%OrG9i4)I$p2tI%Rg[+I$I$I$I$I$I$? g<{I$eDccև~yq7slɧ*:pa]I$_a2I -Wv?6q͟jI#cv#(5l䊒I$I$I$I$I$I&w%n%4$I$I$:Uq3[ve$z]U$I$Q}_y5{UrSI$IXWSDuWI$Aq'q'I *ǦgU}Pw5{w޳t$!U>OAxrI 4ZĒI$I$I$I$I$I$amQz$I$I$I!gRz$I$LVWrǡչ:-&DI$L#V"澡\<~t+$H;i&)WI%iV~;}Qwe*/,_t8v=<^mn C _>jIS9@^L[jEyI$I$I$I$I$I$#C+YO+^I$RYYߙ;ߛ^ i&BxўH=klĒC1TveC_rH/ȿpH\am Ϸ\aM$I$I$I$I$I$LJK^ʚI$I$I$E6+ւI$I$*I/䦒I$_Yyt$I*>4(9Vs!Zo%$\r֤꿅9Ӥ S(w|@z$I$I$I$I$I$I&T߾?:x#"$I$I$I!W޸I$I$;qǪ Z}9-V$I$jܣu I$Rۜ3ztWI%OlGRI1Yup9cdO%M   i/>g[+I$I$I$I$I$I$? g<{I$L ;LuBla0*Ӌ1\\ek eCxjI rCl~JW?kT'Iea}d8g_yFI$I$I$I$I$I$JyۑAWzI$I$I`!Ir>1tI$IE1wN|I$BBi+I$I*}Z9puEA:J ,q/Z RI@W+߶|Uē=f3c1U:Zbz©Úr(I$I$I$I$I$I$QԏCsV?$TI$I$I$>JsэxעNI$I&U.8ޣxx7Y i$I(^?kƧۘۜmxZ$HNSn'VI%_ylRIAj}ΞӀrm16v{[U_kֈ^_2wA$I$I$I$I$I$I3/׼$I&Y7hM$V0=o_Wۘ;^y$AO?i$]''j]2BIK?܌A+Tm$I$I$I$I$I$Ly*mw9ZI$I$I$D*c.{%q2tI$Qw%RF^I=:+mp$I`ObzB$IVzvKsBI$I$I$I$I$I$ISf[,}&ZDI$I$I$7B,!WI$I$1.ɡ齧'NI$U*®'t$I RqpקI$_UvC[)zLRI3v5W0tg ~34LUONXwW}moPI$I$I$I$I$I$LK??|2 $I6w_+"e$.=7q[zoh$ To͙fzދI$ c;\* I$y.o0>q{C4I$I$I$I$I$I1BIS i$I$I$b*l69}M'Ai'I$I$\4g}?w⮷I$I$"P'ZI$ISvUx=QݴdQrgq(䤒OxX޵xO59'Npw?7h^ݗΞ+$I$I$I$I$I$I,fR(mdX+mQI$I$I$J} uHI$I$a^ˍܳ-CO5I$@ЩP;8~I$B} I$C 㺳:)$W=3$Z8=1DJfoe牽Ʃ$W}moPI$I$I$I$I$I$LK??|2 $Iuy7THm6p}paQ=otOqgg൒I V55WRIY}qg[+I$I$I$I$I$I$? g<{I$eIc}p)$>@확5g&WI:эc?sI mҨ^o᰿RH\b [tN#'I$I$I$I$I$I$ǒF."$I$I$LYwGw<\c܏I:I$I&r̖}9eI$C~q+I$I*1ړI0%2?ֻWG$(=dw{_u﯎l,jo%$J287* D~] I$I$I$I$I$I$ʯ9tI抒I$I$I$3^v:+$I$Ix|bʮeI!OvG,w]ȬDt_g u+AI/>g[+I$I$I$I$I$I$? g<{I$dtEjI{VJػt01:DC;oi$Qw+>p{GըGinεzǩTI$I$I$I$I$I$R2 O:I$I$I&QUߐCV>q$I$I3s;+݊ݛJ9)I$Tkl#I$?)qoEkU2V=tG[_vKy$%f_?7nN:6c;+´I$I$I$I$I$Iub\*DI$I$I$CyҬ#jI$I$e~pʥ3Z=TI$(K7`,g vI$x8q"$J.0̳,CAI(K7:G}ɼw nl{grUeޫCG; W}moPI$I$I$I$I$Iravܿ{q)p0~*&}U˛څML]V6n5yֶlǰ袿 g<{I$K:JGp~Ow櫠m$- >P{sl8 lUu$<KrۏZI$"V_aYfO~Y(նGWQfNW xNk3$I$I$I$I$I$LJ_-ٔDI$I$I2EWcJq2tI$LUf 4zJ;yiL$I$Mx䆻U$IVZRم0$7*eVgU|rRID1{aן;:)u9-kGԫPrPܮ }I$I$I$I$I$I$JXYNV@I$I$I$xrǷ>+A$I$IGؘTtaU4I$OvQ `WI$Uzknk{$TuEaP{VW~۝_{;!5ǚTW]O䬲T+_|>W$I$I$I$I$I.+l}gffUN?9Y??U,lߚ5?}츿h;.Ooh"O;K_}[˽02+_xOWV$I2goc{̻VTLy 1_Xc4L)$UnU?|X?Ly+$joٳ}$%v,̌Xhcn$I$I$I$I$I$LJ}nSI$I$I$ǒCUƻ&?Lϭ^I:I$I(W8$$HVoJ/݉ʺI*E_x +*a:J%SmW%$\Vou4}?ⴇ$UŞvgT|}N?|rZI$I$I$I$I$I$I,l={J9I$I$I(9Ue`:I$I$e>۱rh=k֓gI$n6B1̗[ԫ)$H Xln{8诤J/YϷ4w&5oԭ)$Y?tUK=Zgm$SvE?xk:LSH/;^I$I$I$I$I$z:Tbϳ'B4 ]%Oi\O}Zuxo_I7aBg<{I$eI#~Zd j+{'DKvޚl/ytI$2M^qhFI$Q˷w?ORL冷##{y{5ɔTI$I$I$I$I$I17+=] tI$I$L Mc֎3 I$IE=;w{3I:I$G ݾ0I$Uj!Ӥ**I(9l[}foB5:J.YT{/ \rLT:,|s1n'I$I$I$I$I$I$TfQst*$I$I$HduT^1dWӤI$IS }K3$I2nVn?j{y{zgZ$I z-m:I(Ru?Cԫ䦒wxx7`_NNWSķ$gฏD~x]\: q7%?X% q3\L`?X% q3\L`?X% q3\L`?X% q3\L`?X% q3\L`|Bb\-!t@'g.&~Kg.&~Kg.&~Kq7targ58G8g.&~Kg.&~K7.S&&otދoO q3\L`?X% q33eeޥ^n3% q3\L`?X% {{C-aK!.&~KK|B{#l9'gA!p36gv_FO)']\ .&~L\,˨} u]|B\M g3\L`x܍}sؿm&~K9͎abfbEޡm7'g0d~moQI$I$I$I$I$^=p]Gڬ|d7az OخPp_4dճW|!ώF8ߤƺ58OYYYڲ?1q/4?dc?_'gjd=O{Sa?VG3% g\KY ڲ?1q'}i WWib[P;<U#hjĿGՑa#Wa??VG3(?k~\~?Ƈ g\KYڲ?1q/3dc??czXųXGՑa#Wa?VG3! dR\byW?OՑa#Wa??VG3%? g\KYڲ?1q/4?dc?_#hjĿGՑa#WaCVG3%?Ƈ g\KYڲ?1q/4?dc?_#hjĿGՑa#WaCVG3%?Ƈ g\KYڲ?1q/4?dc?_#gjĿGՑa#W/̙BRa??VG3% g\KYڲ?1q/4?dc?_#hjĿGՑa#WaCVG3%?Ƈ g\KYڲ?1q/4?dc?4?dc?o4?dc?~=n-se'?3dc?_#gjĿGՑa#WaCVG3%?Ƈ g\KYڲ?1q/3dc?_'gj2}OSqOՑa#WaCVG3%?Ƈ g\KYڲ?1q/4?dc?_#gj}h|2Ra??VG3%?Ƈ g\KYڲ?1q/4?dc?_#hj 3&} WOՑa#Wa??VG3%? g\KYﰿ0yԿGՑa#Wa??VG3%? g\B_|Wxv81/ڲ?1q/4?dc?_#gjĿOՑacPwޫ?GՑa#Wa??VG3(o<^ԿGՑa#W#W#Wa??VG3%?Ƈ g\KYڲ?1q/4?dc?_#hjĿGՑa#WaCVG3%?Ƈ g\KYڲ?1q/4?dc?_#hjĿGՑa#WaCVG3%?Ƈ g\KYڲ?1q/3dc?_'gjek_ g\KYڲ?1q/4?dc?_#hjĿGՑa#WaCVG3%?Ƈ g\KYڲ?1q/4?dc?_#hjĿGՑa#W/^?{ KYڲ?1q/4?dc?_#hjĿGՑa#WaCVG3%?Ƈ g\KYڲ?1q}1n{_f9IvUdѿOՑa#Wa?VG3%? g\KYڲ?1q/4?dc?_'hj6KEUs'ڲ?1q/3dc?_#gjĿGՑa#Wa??VG3(?k~\~ g\KYڲ?1q/3dc?_'gje{~\~ g\KY ڲ?1q/4?dc?`FK8.Ŷx?*?Rg_[YEh]zKYڲ?1q/4?dc?ϡ|{ KYڲ?1q/3dc?>w>pnke w G>N'|$4I$I$I$KeOڎGcQ/=%f gsAcu٢ZvG]Xf{%8zE?^k&O.Y _vcVtNI$'I$$$$$M I$B Q,{(NI$I$I$I$I$:I$I$I$I$I$I&I$$II$I$$hNI$$d铤AMR,*MI$I$I$I$I&NI$I$I$I&I:I$I$I$I$I$I$d$I&$II*i$I$I$I$K+}] r6Q'9ky;!϶?J\$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K }7/m? ߻?rْQͿvI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K?{~@m %I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^[3|%Csx c8sIp1Xw y gܞ'1Ҡ )Y]|/SuF83#G"7N=V'h-qOVf]윋 yϧ\?^1?Ɨ~==G<#ezI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I${hmb]36ma:4UN꽭%?nfvXx w~Hωτ}}ܩ;fk_2'^9y2[<ۛG!W3 ?_ƯNI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$MWke~PCɺl{ou4/~:ϵBܯwwʿmk_n {kPwq]ﻻk䷾ݱM8A50O?wn*9o& {|6 $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Iֶ`D>} ~w1{p?z\WtkĮ+\}GU<2xv_VGg_~%v߶7^bIZ)/~S;,wwzٖ?oo O01m7UUeX]o ]$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%9_=/917~^Q"$ ]ޗ 9$̶? v}c)]~Y5f^Q w兒Sox{_i8}<@]I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K?q{)_H.ud~ZX] aO/.$~TmhvO18lȅaBk?f;w8c F^ΒI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$w} ߰7Pwp+˿9u_yZR,;).3@ROsFMlKOouŨe$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$dR\#2jqcW;~/a^a?cݸu¡ #;O HTc4P=!$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%9_=/^2T/vY-X#{lW*O,)q%W?ėgwo*g?ۦ$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I|G/+㴻XLV> (G}GŇx vWjlm?Zo+=ݗf V7끾_TI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K3w{;sY33eٍ#/ ?g>=v;2=fZޗvnUwl=淁?+`J>}w˾SjՌ]6xk+(zkW[CZI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Kw܎+f=ikx̹xg9׷}߼w=zgvgqqkff6~'G.hzbL>ˉg{ޣN<'>w_iӱ3s:H?zI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I!"l49"I$I$̯{;nmf 6{\~I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$\};^{,`/h%G>#qgOkX_fQc%f|;#ٲigzO¨=?v^Oc}g{UV8c??Fv>[]]U "iu_g󨪷q7ou:kw.VMZﮛ9^I%ϲwel_`c?Vch8nm/)W1k%Vu׸~[;aUhD&$4I02|I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IyږpArN{#V97eF1q Ad~ySu=WK$Krv]}K1>~'mȨ}Mi q>lřlh«(f7/p@$G.r31¾湴|{#Ji>M}U/ﯫ[^&38-2]̕_?Erv=v۾}9~gs˚}C.]O]gw}vKYYl}Te\ |~in?&Bv5h@ *^ 9}U 5uj{~ve~V?'÷ܧ1%v.ٳ{M8(c!~{oa'dz?-,ۻ=?`F&38g A{z}¿}ɮvW+ }n$񳂦[җmpFkYcln˜`wO. Xgw1"L~ך˷}eOlĸdcpHJ?f?W/xr}갷 "@tg}?i,@o|"UO?[!yލۤI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$nV?gv~l3X]fĥT˟[?.{\vGpurխ][g3(Z=i.$qc))|ǥ^cr!+#uGcVF?>bҽy ~w<+q3\1xr*炯ᵿ-c} ^>k`Weu_\i.Lo 6'ِ+ xI+{_vgwf>/12; }޶s5hoQWr;'r>v{G߁kK1cG}VXkܸge7_bKYNKr?6Tr/-AM5#oj%ggm̫d~S' .{I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K/7wod9k۾ǻ$5e/=>Kݳ7cK*72vtTd}_olF S_Įjes~`P~O\g sRݐrpr&KZe;[NWfΣW+-NN:y~]eSm \`\=흌}'w (֗(ּrfw܎DŽ;j s2}I<']?Xsxxxzz[?lZݳ>vwCnˀ,]`3_TAӲ}A:4Jګe52 Z<R_=Ro_ȷ?5T[]Gq~l}Mwt5cGuiff}&h_Jcva:[ǩ_LLvq{xc+I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$nƾn$3f#s/f= w}x۾͵NʏOn;V8XTR,_l;WƊ'':ܱ)ݏ=> d^~mc_|mvߴ=yq.ψ+(W]ގwݣ[ga{C\:I/+ڇAcW[$پw}OqyG//LY#aq&dq x_c>}NUcƳd0]}fvZŢSKIº^%ǯֽqcѡ+_lj%Wa}); 9 8SG8cm}M 1js^~K/ُdoG{8](֬5shuXs\3 !>gw"Yk!ӳn?$C~0Pa;f5Y/nm!mfK}.7>ط_ڱ[ݎ totMYqefK}.7_s5'ڪe}2>3`x( w`8ݏSX\+gE˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LIfK}.7_seg˟.=\ow3%˾?i/]{LH endstream endobj 266 0 obj 275588 endobj 265 0 obj << /Type /XObject /Subtype /Image /Name /Im15 /Width 1844 /Height 1096 /BitsPerComponent 8 /ColorSpace /DeviceCMYK /Decode [ 0 1 0 1 0 1 0 1 ] /Filter /DCTDecode /Length 275588 >> stream JFIFAdobed     "#()%$%%!'+,,-/4443.4444444444 ####44,,444444444444444444444444444444444444444444444    [!1AQa"q2B#R3br$4CS%DT5cs& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjz  S!1AQaq"2BR#3br$CS4csDT%5& E6UF'dteuV7􅕥fv(G)Wg89*wHXhxIYiy:JZjzH4?^I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.[m]XqEC̤K[?OC,|Gߘkm8sǺϵox *_/I$񥇉l\JYEO`eu RI%ʤI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.fw$s,KI\\2I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$)ۇFX82[vmkZ $u$I$_N*S(3HUv+qI%gs·,+uƵ? $I$I$I/e3OG61Ÿd\fG 1I/I$I$I$I$I$I$I$I$I$I$I$I$cGg-0GKS*nqkͼvI.$*rǴI$s{s?5M^艁 $I$I$I$I$I$I$I$I$I$I/edϲ33&o{X·I%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$K'I%/.$ I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I/#C>w֍pI$I$I$oA׼RI%p[Ǝt~I$/xDbܾ|qHoX Ieڌnܫ8n׋*|%i$X_o?a~>F#7^KC 5I{`Gܾ1(h.I$ϽY]Q~'?бWI$u?Q1j,mUqD1\]dI$wk1{/xf6~[m/ƨppZ_ms-]˹maL3Q$ŗػ>wﻹ,qdqѣ̤Kggkevؘݳ6zmn\$]?َ?Ưܻ20oەf@k$Ixۏ} +qkzI($KwoڞGW0ᶧ}6KxfMw?5a$]7w;[v^.>s=8O $b}ZZ8v~6x;k#RI%22{~>Gv+,c83$򼿶+Iݵ6Iv}v>OnAM㷅I$; {5Uez<'$^v^ٱ)[H#d6@قI"Oy>>iYNS)ewV[I%m__FOipiu~}>)$l=Z}oyw.[]4O9I$5owگh0;U2C=:=0޼I$8~`}O1rY6ӱI$~'e;ʵ86`|RI%}֪۱7&#+'0I/hXiie[PVϨ;$K1Eqn~wHc>I?gf֫v{VmNul"Z=$Y_Bcc}S_u~[RI$O!OpCgosGO=%$X_㞪]޺~$.ڳm=[k+cŭ8zI$l~}|ec'kyyK{ٞ1wQGks[m lֺ,G$l_O{jgj֫sI$S.۱p31_mޅC_-$I$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.fw$s,KI\\2I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$oGu;r{] ?$KTI$I}=&}VeӫKև $]9*vEye?$[JهOI$w~ۛ۲]@{|I%;yϳ7?!96}OzI$s ?ؒI/I%齻n^g=Cq9O? $y_b?mv[˽XyJmԒIr˾߶ݷ-n#I%l>N#}߇''$K]œϵ6bBf0:fJI$sjSd,I$0+bgɹw`;wI$>Xvp.gzI$.-/>1Z\dI$$J{vke]t"@I$TIhN;P;9I$Kq?d{d##<$[-ş⿾9#+(ⴒI|I/qyc?I+cOhDs|Xw$Uvo.=-,II$p?ƾwmK=J0]CI$؟j>y}Όžjb&\zIwJ?z ^Ixgo\2)w`J}Xyoʸ7 $?^i$$^G.ُI/;'y$]7?NܒI.6{jI$/Uk"I$i$oNBYI$+,9^Pખ$?w61]?~h=RI%fw:a|I$gэ2nf܌>?[:?3)$~Kg]T9ܒI$_ylN.@p)ߝa^I$!‹OӾ2>`IxW٬ϳ-n9vCGܬՏ=MI$mnshy21çI$,>}_Y_ijox/Ɩ}>RI%wܖbdU_=I%}Ww 'n1Uc|e $i3bOkfgN)$G_h^m4 l^>vG7$K?㻛3r=OI$k}7b3ߗ'x$Kž^;3Nhy$I$}iپ oÔI$s8{[~/g]@SsH%$^}>wl83,zt?$O=I%ϽƧ&Yk΍ٿƒI/I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$3?;NZK_$]I.$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^ؿm+ɾv>8?O?ɹ $gm} FG.r4I,o >CF| I$Llܪ6sq)$7ٌݲD  `w?I$O?bH>ou[ǜyI$w ۝~]FYcBI%]$I$I$I$I$I$I$I$I$I$F=PAI$3;pϏݓ^]RI%U$I$NǺ1ŮBI$]GI HyX{줞~I ĸ2OI$>S<7I!qsRI)ݓ\87 $I$zlI$4I$I//} yn!$Po:I$I$I$b'I${Lڞ[I% deĤH)$^М'$^>S<7)$qdI2I$U9)$&Nf^Tz]GI $I- $H02mha$@I$(k8?`Il/?㴒I?RI% /)$I$SE~YVc $g{ZvI)?#"{)$XJ.88$IO?RI%}yx癝J|,YbI $I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.fw$s,KI\\2I$I$I$I$I$I$I$I$I$I$I$I$I$I$~vwϵ& Izҷ/O~Ć|RI%I$Sc_BI^ rCw>i$uUֶFaRI%N0Yx u)$+{GsL6Coe$]ѽwl}/s~?"I$e$[4}SMwSسƇ1ưȃ $ _XrKRI$ ߳_h~3r>n5 +.{Z2I%I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I"czy~=?yK~?efvjŴ>ǹWG`oG$Kbxݚ~>\$YI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IC$N)$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.fw$s,KI\\2I$I$I$I$I$I$I$I$I$I$I$I$I$I$ilF})k$^'d8?{%=+lI%I$!gmטL^~BI,/*h-g[?m$^!o.(Je6pdTy9$_ES,GYtI$ #7z=;E|"IQNCIEnrއ3AD?mrއϟs!$āCDgEw۬y>(:^*ou??$_ی!"$!CRo>dNed;E&KQA?$:?y]> U6m!ޗϟc .q?!"-I79wϟZN KR*IU"p?%T_!wH#$n t}ȴg"90C[&)jN;> >[e\leKR*$}AN[<[Sw۬wϟs!(MCq?(;0_n,w7E'M& 2^"gĤy!ITS? I|n !"%$ch#NdYvQ!_olQ7A3U'gYETsgd;|P8%$϶,ϟC|DY%ΏgϿG 2^"SAwϟLEorZgϿLG#SkwH"xJEpɿZRl xଟ92>(2^* Ͽ8W@5]w?}MR⩺Y? PwH_#A>)p_#A>)%⤜}#wH1HZuH.+ pU۫giqw =.#?:wϟEo\ wHx(N()e}ǯLQdDgQ^/E>">F$;Wۛd;|S5%*CIgCE):^7roۜ?GI/s!?S|n3?##)̝#cP8A5nC??I7r ~wH#Mr?"jH+?;A#>"-523Wۼ|R)3d~;}d|D̉1>)2^"J#A>)y? x)wHpKI3wHN>wHpKI# ;E!^"I ;EKIKd;E^"J_ێshƇO]93IVeW))!hxr=RSeh?rRRQ#)̖qSdN]?rf}@G_ܤRRR?kjߵhrĔ?o_ܦE$P7\O{P%-rIRy(5pNU\+24o5r'Ґ|hUJo3!"w}Ar$dRQg(!~j>KQIOo)j)!<_rj)"ߴڿM)j)(?_ܧ%>}lRO~ie%cw߻z#K%omxDj*ܬv99?k{l%2ߴڿO@NI%~jR$ߴڿGu$R($o_ܢS,_W)j)#c}OLE$k{N8x/LсfEN7ߵ͑WNrUߴڿH$'$eh?r)kJ_ܧv+>M)j)%?[W)M3)(fX~H"EFC2'>{$W?$S zV3w%[W)E!9$!9$-A$$_ܠJrITuN(9K\po5ek∙U~?r!ߵhG_&AJXk;Xϯ̓ud[ h?$V_[\ w O}&BrUsʐ'j)"c}γtrn$>wc>'~K=GpP|`w2IrSƳ/{SAPڿR&kzx@QS|_=&!H$dQ0x^~wDQkߴڿB( %[#cI읨Ƽ?j>w}/Rd<a-E2o[W)_zZJCw%k)E-E$]ܿD~KQIAk_ܧ2ZHSh)!<_rj)"ÚZHn_r=RSkj6Ij)(w%}ܿJ)j)&g')j))ߴڿMZJKQIg)j)!hxr=RSeh?rRRQڿNd>)KQItvO@B:f%.Y[m:*(j*Pg)%˾i&KQIAk_ܤ__ܤ'-ARCw3)%>}Ij)"?gI-E%bx$u}GH%wL^eތZm㱭0&lEWg'wq6SKexo$Koe_O'.$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^/qw~[0o87`LJ_o;fgv_bq{UeWZz#I/Gaِn`<߯;~TIcۖV`-I$}o$l0I*_f9?h]-ٳ.I$+rٯ&O$KGQ^C˒M3aJujlM "|LKڛEOS$$ $$OdڛII$$lM !$koI& &?`Bm $$ ?$ocjoI& '(LocjgI-!$?KHI/$$Gd($$m $$ ?$z&N(coI-!%JiQcXI ).@'-~c;hcS#{?Vݱ7')!(LG$$ǠboI& $q?؛KHI/BM$%b- $$$Y$v?ؙAI |qʦ`$$ZBI}ޏm %$lvc98(,i}vWse`Ɯ?T? 5D*/cjoAM('P?$),ocjoI '(L^II}ޏM $$$$n&5x$@Iy'ټJ8Ko*kfX}lo^1I9Z`SޏM $$wLRj,"i )}ށ$bc.sF ӂN=wg^loԦG >*DEOjoNV, ?$(LKУ[I0I/Bm $%as࢖kO3%u_agqy#~E7$`zkoI-!%Wbae$$l|lV$Q$Y$ ?$$L^IKjoI&I/$$GdڛIIzkoI&I/$$GdڛIIzkoI&I/BM $%Q$$ ?$$LKУ[I2I}ޏM $%Q$$G`^IKjoI&IBlwVjlGI2KŰp+oۙwSja%z?7$$GdڛIKjoI& %Q$$Gd(L^?EOV?0~d[IY?jcHYI2y$pp2zbki/׾ր;/`j$r^-,KI\!$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$H]s)[k5\~ $g{_djm=?uѱ~]|I/4{7}~uӥzRI%'>WO`7ѹg줒J?ooZ[' m}@ q|I$vƜ3l5<0~I$_>eVz=I$[/LOIz;9_Z$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ip\Oi: G{9?lٜTVJN-1]r $I$I$I$I$I$I$I$I$I$I$I$Iy ۚm]72E>NgʺT)$I$I$I$I$I$I$II$R^K`97R>?<1;'+k5$I$I$I$I$Ib}_R*;rN9?_Lyo}pws?W'+$I$I$I$Iy 2y'N]g/b^K#E+IHI$I$E%e6:ֆGwYIYY$I$J6I"o?Wi?o_^I$I$X?4E<֟9jz>?A$dI$I*ͲjrI_AHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$OS<֗iWAMS%)$I$I$I$I$I$I$I$I$I$I$I$I/&n?ݭ_I_ď޼~U߂Jp)$I$I$I$I$I$I$I$KʿHtVyi}Υi#SRE$I$I$I$I$I%ĔsWe/?㯏IdeI]*II$I$I$I$K~x55SxO^9p,ԒI$I$I%Ce$=ԗ )g&9jX!9ZTI$I$o? 7<\WӾI;hljbt9$Ir?;@VOʩo.$jFElG]*uI$w1Ŋ~)&$|}PςHDII$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$;)$,Yt72+ۓ$I$I$I$I$I$I$I$I$I$I,?j)&$͵NOQ;{;?knHcYƗz:IˆI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$O`Tv߻v!v&=my\q~4Isy/"̋\\)$I$I$g/]fz_lm_x)$pk?p}0Is$Jg\}wr0%_:YII$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$Ƽc2j kcO[?a?㱈S#{?W@ $I$I$I$I$I$I$I$I$I$I$I$Iy 'P['3]72Ids?w~U$AI$I$I$I$I$I$I$HI"_UX洲xxx^,ԒI$I$I$I$I%;IGnI.'QM*dTu{\?[J$a`$I$I$I$I/2?V,To߭jr>c$X,1] JD4I$I$$Iy?ى7Z9,zefI$I($KɾWkO:y*I$I$or5z~}00JHdI$I*fIrI_IHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$_QuZyi8Nqf+ '$I$I$I$I$I$I$I$I$I$I$I$I$Z#Ïެ~U߂JYI$I$I$I$I$I$I$I$?Ҫ->>?ڗbENVcEII$I$I$I$I$6?:*+`61 O^_QN%S/Uw]*II$I$I$I$Kjj,֮'wZ!9Z ):I$I$I$w3g??,^$I$I,ߴoYI6y$G?ϾI(h?ژ%2I$\$[?/k*)L!R?/k'?"S,ԒI%SLx$pg$FI"$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$IIxGrz 㙏e{rbI$I$I$I$I$I$I$I$I$I%;E$5vegZw?ڟ1I//GI9p$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$J_\}wr0%_:YII$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ƿt^?b"U;wtTI$I$I$I$I$I$I$I$I$I$I$I$ 6Jcӂ}Y,l;%* I$I$I$I$I$I$I$GI~&L~ؽi9[Y$I$I$I$I$Kw2ܓaq~TУ[l|^,I$I$I$I%I K*fGu`㱊.G%"I$I$GI}l;U1?(++=$I$IF)$R^M'?7|^ sZyρʽm%af$I$I/7ܰ~i(li:?=vf? |2YM$I$3TxI_EHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$JoL߸G3 jr j:I$I$I$I$I$I$I$I$I$I$I$I$I/&o?֯$K5yͿzI$I$I$I$I$I$I$I$d'54{Opϸi#SRE$I$I$I$I$I%ĔV+ݏ2y*_m;J $I$I$I$Iy/g3SU9Ky3<8ؽhr Y$I$I$K?e$=ԗ )g z3WzJ*ڠI$I$~Ye$>$5?SI% RJ+UjbGj:#6~#.%2I$U;NJII|Dd"HI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$II$`'ˠ9W&++I$I$I$I$I$I$I$I$I$I$Yj㽟RMI/j?_PwoV/݃x/'rt I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$e WџG# UӫU_9I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I.l@. b]yȶ~cW+IHI$I$I$I$I$I$I$I$I$I$I$I$piP[n]/78'UʺD $I$I$I$I$I$I$II$R^K`97R9,?ñzrRI$I$I$I$I$Oe%'{TТ[lio+ԓI$I$I$I$odۚn]_?%Y,[wt )I$I$ zUI$I$on)/&~/MU1Z'nZae$I$I/8~h _惿ڞ?XE>,zI$Jt$(3$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I%< _Ҫ[-.zf?Ȝ%rI$I$I$I$I$I$I$I$I$I$I$I$Kɾ۟k_Uifp?ͿI$I$I$I$I$I$I$I/*NtUk=ڛ8}ʥi#QV#EII$I$I$I$I$6?J*+7aiJ(ג*%"I$I$I$I$owl3TFXs>YuX\ 1:I$I$I$w3g??vQVI$I%k)&$)GXiwc#SY$KREjڌw<_UOSw R?='?"SI%S;|MHhaI"HI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$II",Yt2+ۓUϤI$I$I$I$I$I$I$I$I$I,?j)&$͵NOQ;{+?knHcYƗz:IˆI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$UtnZ+㑅Q*ժHI$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$ 6̌ ´;?l")Ht)'I$I$I$I$I$I$I$I$I$I$I$I/5?Fl#M/㱏NN%6~U$AI$I$I$I$I$I$I$HI"_l9&U#-^I$I$I$I$I$Oe%q.'Q_M[l+io+ԓI$I$I$I$odۚ.n]_?%Y,[wt )I$I$vf/uf4I$T;W$$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$?/ZUK}Lc: 49YK5$I$I$I$I$I$I$I$I$I$I$I$I$}?֯&hNy'^Wmd,$I$I$I$I$I$I$I$IyGF/A,֗jڗbEMS j*HI$I$I$I$I$o'?Aib~ W^1*@^JYWH $I$I$I$Iy?ڿ3PKT&}kG=k WK9:HI$I$w3?u%YjX!ePI$I$YhT$PI$I$I$I$I$I$I$I$I$I$I$I$^k8~4(-o7YG^_期VK7mIHI$I$I$I$I$I$I$E%f6*OwZI[Y$I$I$I$I$Kw2Qےv gWS"[m*io+ԓՕI$I$I$I$o|dۚ>%u`㳊RUĿ{?W@A$I$I#$Kɾ˟l;eV>\OzJI$I$Q7| H^M'?7|^*jg7oZI$I$nT6 Vjz>?ad֚I$I*j$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$^Y3(QȪOF?zf?ȤVaGI9$I$I$I$I$I$I$I$I$I$I$I$I%m +K s?*zso'+!f$I$I$I$I$I$I$I$K?gz1~ N fW>ԽK-?jjdQRE$I$I$I%kɟl?zJI$I$I$I$I$Xm?㹗Tu8(_Lyo}KezzI$I$I$I$?l{s[c8ykrg8)*b+IHI$I$E%e$V#zziQI$I$Q7| I^M'?7|^UXVoʽm5ZY$I$K5y9jz8_a%y,ŦzI$Jsᚧ%WR$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$I$gO +S$[->@zf?՘dNI$I$I$I$I$I$I$I$I$I$I$I$Iy7xf!5VkG zsW~9Y 9I$I$I$I$I$I$I$I$^Q3?ыjpPK5ڿXi#ST%)$I$I*Sﱼҡw)/#?i:^r+jbqA*?u)UPvj(YkˡgRk">3YyTU!GT~)E.J?gwz}d